+/*! jQuery UI - v1.12.1 - 2016-09-14
+* http://jqueryui.com
+* Includes: widget.js, position.js, data.js, disable-selection.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/draggable.js, widgets/droppable.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/resizable.js, widgets/selectable.js, widgets/selectmenu.js, widgets/slider.js, widgets/sortable.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js
+* Copyright jQuery Foundation and other contributors; Licensed MIT */
+
+(function( factory ) {
+ if ( typeof define === "function" && define.amd ) {
+
+ // AMD. Register as an anonymous module.
+ define([ "jquery" ], factory );
+ } else {
+
+ // Browser globals
+ factory( jQuery );
+ }
+}(function( $ ) {
+
+$.ui = $.ui || {};
+
+var version = $.ui.version = "1.12.1";
+
+
/*!
- * jQuery UI 1.8.21
+ * jQuery UI Widget 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI
*/
-(function( $, undefined ) {
-// prevent duplicate loading
-// this is only a problem because we proxy existing functions
-// and we don't want to double proxy them
-$.ui = $.ui || {};
-if ( $.ui.version ) {
- return;
-}
+//>>label: Widget
+//>>group: Core
+//>>description: Provides a factory for creating stateful widgets with a common API.
+//>>docs: http://api.jqueryui.com/jQuery.widget/
+//>>demos: http://jqueryui.com/widget/
-$.extend( $.ui, {
- version: "1.8.21",
-
- keyCode: {
- ALT: 18,
- BACKSPACE: 8,
- CAPS_LOCK: 20,
- COMMA: 188,
- COMMAND: 91,
- COMMAND_LEFT: 91, // COMMAND
- COMMAND_RIGHT: 93,
- CONTROL: 17,
- DELETE: 46,
- DOWN: 40,
- END: 35,
- ENTER: 13,
- ESCAPE: 27,
- HOME: 36,
- INSERT: 45,
- LEFT: 37,
- MENU: 93, // COMMAND_RIGHT
- NUMPAD_ADD: 107,
- NUMPAD_DECIMAL: 110,
- NUMPAD_DIVIDE: 111,
- NUMPAD_ENTER: 108,
- NUMPAD_MULTIPLY: 106,
- NUMPAD_SUBTRACT: 109,
- PAGE_DOWN: 34,
- PAGE_UP: 33,
- PERIOD: 190,
- RIGHT: 39,
- SHIFT: 16,
- SPACE: 32,
- TAB: 9,
- UP: 38,
- WINDOWS: 91 // COMMAND
- }
-});
-
-// plugins
-$.fn.extend({
- propAttr: $.fn.prop || $.fn.attr,
-
- _focus: $.fn.focus,
- focus: function( delay, fn ) {
- return typeof delay === "number" ?
- this.each(function() {
- var elem = this;
- setTimeout(function() {
- $( elem ).focus();
- if ( fn ) {
- fn.call( elem );
- }
- }, delay );
- }) :
- this._focus.apply( this, arguments );
- },
- scrollParent: function() {
- var scrollParent;
- if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
- scrollParent = this.parents().filter(function() {
- return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- } else {
- scrollParent = this.parents().filter(function() {
- return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- }
-
- return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
- },
-
- zIndex: function( zIndex ) {
- if ( zIndex !== undefined ) {
- return this.css( "zIndex", zIndex );
- }
-
- if ( this.length ) {
- var elem = $( this[ 0 ] ), position, value;
- while ( elem.length && elem[ 0 ] !== document ) {
- // Ignore z-index if position is set to a value where z-index is ignored by the browser
- // This makes behavior of this function consistent across browsers
- // WebKit always returns auto if the element is positioned
- position = elem.css( "position" );
- if ( position === "absolute" || position === "relative" || position === "fixed" ) {
- // IE returns 0 when zIndex is not specified
- // other browsers return a string
- // we ignore the case of nested elements with an explicit value of 0
- // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
- value = parseInt( elem.css( "zIndex" ), 10 );
- if ( !isNaN( value ) && value !== 0 ) {
- return value;
- }
+
+var widgetUuid = 0;
+var widgetSlice = Array.prototype.slice;
+
+$.cleanData = ( function( orig ) {
+ return function( elems ) {
+ var events, elem, i;
+ for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) {
+ try {
+
+ // Only trigger remove when necessary to save time
+ events = $._data( elem, "events" );
+ if ( events && events.remove ) {
+ $( elem ).triggerHandler( "remove" );
}
- elem = elem.parent();
- }
+
+ // Http://bugs.jquery.com/ticket/8235
+ } catch ( e ) {}
}
+ orig( elems );
+ };
+} )( $.cleanData );
- return 0;
- },
+$.widget = function( name, base, prototype ) {
+ var existingConstructor, constructor, basePrototype;
- disableSelection: function() {
- return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
- ".ui-disableSelection", function( event ) {
- event.preventDefault();
- });
- },
+ // ProxiedPrototype allows the provided prototype to remain unmodified
+ // so that it can be used as a mixin for multiple widgets (#8876)
+ var proxiedPrototype = {};
- enableSelection: function() {
- return this.unbind( ".ui-disableSelection" );
- }
-});
-
-$.each( [ "Width", "Height" ], function( i, name ) {
- var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
- type = name.toLowerCase(),
- orig = {
- innerWidth: $.fn.innerWidth,
- innerHeight: $.fn.innerHeight,
- outerWidth: $.fn.outerWidth,
- outerHeight: $.fn.outerHeight
- };
+ var namespace = name.split( "." )[ 0 ];
+ name = name.split( "." )[ 1 ];
+ var fullName = namespace + "-" + name;
- function reduce( elem, size, border, margin ) {
- $.each( side, function() {
- size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
- if ( border ) {
- size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
- }
- if ( margin ) {
- size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
- }
- });
- return size;
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
}
- $.fn[ "inner" + name ] = function( size ) {
- if ( size === undefined ) {
- return orig[ "inner" + name ].call( this );
- }
+ if ( $.isArray( prototype ) ) {
+ prototype = $.extend.apply( null, [ {} ].concat( prototype ) );
+ }
- return this.each(function() {
- $( this ).css( type, reduce( this, size ) + "px" );
- });
+ // Create selector for plugin
+ $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+ return !!$.data( elem, fullName );
};
- $.fn[ "outer" + name] = function( size, margin ) {
- if ( typeof size !== "number" ) {
- return orig[ "outer" + name ].call( this, size );
+ $[ namespace ] = $[ namespace ] || {};
+ existingConstructor = $[ namespace ][ name ];
+ constructor = $[ namespace ][ name ] = function( options, element ) {
+
+ // Allow instantiation without "new" keyword
+ if ( !this._createWidget ) {
+ return new constructor( options, element );
}
- return this.each(function() {
- $( this).css( type, reduce( this, size, true, margin ) + "px" );
- });
+ // Allow instantiation without initializing for simple inheritance
+ // must use "new" keyword (the code above always passes args)
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
};
-});
-// selectors
-function focusable( element, isTabIndexNotNaN ) {
- var nodeName = element.nodeName.toLowerCase();
- if ( "area" === nodeName ) {
- var map = element.parentNode,
- mapName = map.name,
- img;
- if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
- return false;
- }
- img = $( "img[usemap=#" + mapName + "]" )[0];
- return !!img && visible( img );
- }
- return ( /input|select|textarea|button|object/.test( nodeName )
- ? !element.disabled
- : "a" == nodeName
- ? element.href || isTabIndexNotNaN
- : isTabIndexNotNaN)
- // the element and all of its ancestors must be visible
- && visible( element );
-}
+ // Extend with the existing constructor to carry over any static properties
+ $.extend( constructor, existingConstructor, {
+ version: prototype.version,
-function visible( element ) {
- return !$( element ).parents().andSelf().filter(function() {
- return $.curCSS( this, "visibility" ) === "hidden" ||
- $.expr.filters.hidden( this );
- }).length;
-}
+ // Copy the object used to create the prototype in case we need to
+ // redefine the widget later
+ _proto: $.extend( {}, prototype ),
-$.extend( $.expr[ ":" ], {
- data: function( elem, i, match ) {
- return !!$.data( elem, match[ 3 ] );
- },
+ // Track widgets that inherit from this widget in case this widget is
+ // redefined after a widget inherits from it
+ _childConstructors: []
+ } );
- focusable: function( element ) {
- return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
- },
+ basePrototype = new base();
- tabbable: function( element ) {
- var tabIndex = $.attr( element, "tabindex" ),
- isTabIndexNaN = isNaN( tabIndex );
- return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
- }
-});
+ // We need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+ basePrototype.options = $.widget.extend( {}, basePrototype.options );
+ $.each( prototype, function( prop, value ) {
+ if ( !$.isFunction( value ) ) {
+ proxiedPrototype[ prop ] = value;
+ return;
+ }
+ proxiedPrototype[ prop ] = ( function() {
+ function _super() {
+ return base.prototype[ prop ].apply( this, arguments );
+ }
+
+ function _superApply( args ) {
+ return base.prototype[ prop ].apply( this, args );
+ }
-// support
-$(function() {
- var body = document.body,
- div = body.appendChild( div = document.createElement( "div" ) );
+ return function() {
+ var __super = this._super;
+ var __superApply = this._superApply;
+ var returnValue;
- // access offsetHeight before setting the style to prevent a layout bug
- // in IE 9 which causes the elemnt to continue to take up space even
- // after it is removed from the DOM (#8026)
- div.offsetHeight;
+ this._super = _super;
+ this._superApply = _superApply;
- $.extend( div.style, {
- minHeight: "100px",
- height: "auto",
- padding: 0,
- borderWidth: 0
- });
+ returnValue = value.apply( this, arguments );
+
+ this._super = __super;
+ this._superApply = __superApply;
+
+ return returnValue;
+ };
+ } )();
+ } );
+ constructor.prototype = $.widget.extend( basePrototype, {
+
+ // TODO: remove support for widgetEventPrefix
+ // always use the name + a colon as the prefix, e.g., draggable:start
+ // don't prefix for widgets that aren't DOM-based
+ widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name
+ }, proxiedPrototype, {
+ constructor: constructor,
+ namespace: namespace,
+ widgetName: name,
+ widgetFullName: fullName
+ } );
+
+ // If this widget is being redefined then we need to find all widgets that
+ // are inheriting from it and redefine all of them so that they inherit from
+ // the new version of this widget. We're essentially trying to replace one
+ // level in the prototype chain.
+ if ( existingConstructor ) {
+ $.each( existingConstructor._childConstructors, function( i, child ) {
+ var childPrototype = child.prototype;
+
+ // Redefine the child widget using the same prototype that was
+ // originally used, but inherit from the new version of the base
+ $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor,
+ child._proto );
+ } );
+
+ // Remove the list of existing child constructors from the old constructor
+ // so the old child constructors can be garbage collected
+ delete existingConstructor._childConstructors;
+ } else {
+ base._childConstructors.push( constructor );
+ }
- $.support.minHeight = div.offsetHeight === 100;
- $.support.selectstart = "onselectstart" in div;
+ $.widget.bridge( name, constructor );
- // set display to none to avoid a layout bug in IE
- // http://dev.jquery.com/ticket/4014
- body.removeChild( div ).style.display = "none";
-});
+ return constructor;
+};
+$.widget.extend = function( target ) {
+ var input = widgetSlice.call( arguments, 1 );
+ var inputIndex = 0;
+ var inputLength = input.length;
+ var key;
+ var value;
+ for ( ; inputIndex < inputLength; inputIndex++ ) {
+ for ( key in input[ inputIndex ] ) {
+ value = input[ inputIndex ][ key ];
+ if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+ // Clone objects
+ if ( $.isPlainObject( value ) ) {
+ target[ key ] = $.isPlainObject( target[ key ] ) ?
+ $.widget.extend( {}, target[ key ], value ) :
+ // Don't extend strings, arrays, etc. with objects
+ $.widget.extend( {}, value );
-// deprecated
-$.extend( $.ui, {
- // $.ui.plugin is deprecated. Use the proxy pattern instead.
- plugin: {
- add: function( module, option, set ) {
- var proto = $.ui[ module ].prototype;
- for ( var i in set ) {
- proto.plugins[ i ] = proto.plugins[ i ] || [];
- proto.plugins[ i ].push( [ option, set[ i ] ] );
- }
- },
- call: function( instance, name, args ) {
- var set = instance.plugins[ name ];
- if ( !set || !instance.element[ 0 ].parentNode ) {
- return;
- }
-
- for ( var i = 0; i < set.length; i++ ) {
- if ( instance.options[ set[ i ][ 0 ] ] ) {
- set[ i ][ 1 ].apply( instance.element, args );
+ // Copy everything else by reference
+ } else {
+ target[ key ] = value;
}
}
}
- },
-
- // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
- contains: function( a, b ) {
- return document.compareDocumentPosition ?
- a.compareDocumentPosition( b ) & 16 :
- a !== b && a.contains( b );
- },
-
- // only used by resizable
- hasScroll: function( el, a ) {
-
- //If overflow is hidden, the element might have extra content, but the user wants to hide it
- if ( $( el ).css( "overflow" ) === "hidden") {
- return false;
- }
-
- var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
- has = false;
-
- if ( el[ scroll ] > 0 ) {
- return true;
- }
-
- // TODO: determine which cases actually cause this to happen
- // if the element doesn't have the scroll set, see if it's possible to
- // set the scroll
- el[ scroll ] = 1;
- has = ( el[ scroll ] > 0 );
- el[ scroll ] = 0;
- return has;
- },
-
- // these are odd functions, fix the API or move into individual plugins
- isOverAxis: function( x, reference, size ) {
- //Determines when x coordinate is over "b" element axis
- return ( x > reference ) && ( x < ( reference + size ) );
- },
- isOver: function( y, x, top, left, height, width ) {
- //Determines when x, y coordinates is over "b" element
- return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
}
-});
-
-})( jQuery );
-/*!
- * jQuery UI Widget 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
-(function( $, undefined ) {
-
-// jQuery 1.4+
-if ( $.cleanData ) {
- var _cleanData = $.cleanData;
- $.cleanData = function( elems ) {
- for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
- try {
- $( elem ).triggerHandler( "remove" );
- // http://bugs.jquery.com/ticket/8235
- } catch( e ) {}
- }
- _cleanData( elems );
- };
-} else {
- var _remove = $.fn.remove;
- $.fn.remove = function( selector, keepData ) {
- return this.each(function() {
- if ( !keepData ) {
- if ( !selector || $.filter( selector, [ this ] ).length ) {
- $( "*", this ).add( [ this ] ).each(function() {
- try {
- $( this ).triggerHandler( "remove" );
- // http://bugs.jquery.com/ticket/8235
- } catch( e ) {}
- });
- }
- }
- return _remove.call( $(this), selector, keepData );
- });
- };
-}
+ return target;
+};
-$.widget = function( name, base, prototype ) {
- var namespace = name.split( "." )[ 0 ],
- fullName;
- name = name.split( "." )[ 1 ];
- fullName = namespace + "-" + name;
+$.widget.bridge = function( name, object ) {
+ var fullName = object.prototype.widgetFullName || name;
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string";
+ var args = widgetSlice.call( arguments, 1 );
+ var returnValue = this;
- if ( !prototype ) {
- prototype = base;
- base = $.Widget;
- }
+ if ( isMethodCall ) {
- // create selector for plugin
- $.expr[ ":" ][ fullName ] = function( elem ) {
- return !!$.data( elem, name );
- };
+ // If this is an empty collection, we need to have the instance method
+ // return undefined instead of the jQuery instance
+ if ( !this.length && options === "instance" ) {
+ returnValue = undefined;
+ } else {
+ this.each( function() {
+ var methodValue;
+ var instance = $.data( this, fullName );
- $[ namespace ] = $[ namespace ] || {};
- $[ namespace ][ name ] = function( options, element ) {
- // allow instantiation without initializing for simple inheritance
- if ( arguments.length ) {
- this._createWidget( options, element );
- }
- };
+ if ( options === "instance" ) {
+ returnValue = instance;
+ return false;
+ }
- var basePrototype = new base();
- // we need to make the options hash a property directly on the new instance
- // otherwise we'll modify the options hash on the prototype that we're
- // inheriting from
-// $.each( basePrototype, function( key, val ) {
-// if ( $.isPlainObject(val) ) {
-// basePrototype[ key ] = $.extend( {}, val );
-// }
-// });
- basePrototype.options = $.extend( true, {}, basePrototype.options );
- $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
- namespace: namespace,
- widgetName: name,
- widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
- widgetBaseClass: fullName
- }, prototype );
+ if ( !instance ) {
+ return $.error( "cannot call methods on " + name +
+ " prior to initialization; " +
+ "attempted to call method '" + options + "'" );
+ }
- $.widget.bridge( name, $[ namespace ][ name ] );
-};
+ if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) {
+ return $.error( "no such method '" + options + "' for " + name +
+ " widget instance" );
+ }
-$.widget.bridge = function( name, object ) {
- $.fn[ name ] = function( options ) {
- var isMethodCall = typeof options === "string",
- args = Array.prototype.slice.call( arguments, 1 ),
- returnValue = this;
+ methodValue = instance[ options ].apply( instance, args );
- // allow multiple hashes to be passed on init
- options = !isMethodCall && args.length ?
- $.extend.apply( null, [ true, options ].concat(args) ) :
- options;
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue && methodValue.jquery ?
+ returnValue.pushStack( methodValue.get() ) :
+ methodValue;
+ return false;
+ }
+ } );
+ }
+ } else {
- // prevent calls to internal methods
- if ( isMethodCall && options.charAt( 0 ) === "_" ) {
- return returnValue;
- }
+ // Allow multiple hashes to be passed on init
+ if ( args.length ) {
+ options = $.widget.extend.apply( null, [ options ].concat( args ) );
+ }
- if ( isMethodCall ) {
- this.each(function() {
- var instance = $.data( this, name ),
- methodValue = instance && $.isFunction( instance[options] ) ?
- instance[ options ].apply( instance, args ) :
- instance;
- // TODO: add this back in 1.9 and use $.error() (see #5972)
-// if ( !instance ) {
-// throw "cannot call methods on " + name + " prior to initialization; " +
-// "attempted to call method '" + options + "'";
-// }
-// if ( !$.isFunction( instance[options] ) ) {
-// throw "no such method '" + options + "' for " + name + " widget instance";
-// }
-// var methodValue = instance[ options ].apply( instance, args );
- if ( methodValue !== instance && methodValue !== undefined ) {
- returnValue = methodValue;
- return false;
- }
- });
- } else {
- this.each(function() {
- var instance = $.data( this, name );
+ this.each( function() {
+ var instance = $.data( this, fullName );
if ( instance ) {
- instance.option( options || {} )._init();
+ instance.option( options || {} );
+ if ( instance._init ) {
+ instance._init();
+ }
} else {
- $.data( this, name, new object( options, this ) );
+ $.data( this, fullName, new object( options, this ) );
}
- });
+ } );
}
return returnValue;
};
};
-$.Widget = function( options, element ) {
- // allow instantiation without initializing for simple inheritance
- if ( arguments.length ) {
- this._createWidget( options, element );
- }
-};
+$.Widget = function( /* options, element */ ) {};
+$.Widget._childConstructors = [];
$.Widget.prototype = {
widgetName: "widget",
widgetEventPrefix: "",
+ defaultElement: "<div>",
+
options: {
- disabled: false
+ classes: {},
+ disabled: false,
+
+ // Callbacks
+ create: null
},
+
_createWidget: function( options, element ) {
- // $.widget.bridge stores the plugin instance, but we do it anyway
- // so that it's stored even before the _create function runs
- $.data( element, this.widgetName, this );
+ element = $( element || this.defaultElement || this )[ 0 ];
this.element = $( element );
- this.options = $.extend( true, {},
+ this.uuid = widgetUuid++;
+ this.eventNamespace = "." + this.widgetName + this.uuid;
+
+ this.bindings = $();
+ this.hoverable = $();
+ this.focusable = $();
+ this.classesElementLookup = {};
+
+ if ( element !== this ) {
+ $.data( element, this.widgetFullName, this );
+ this._on( true, this.element, {
+ remove: function( event ) {
+ if ( event.target === element ) {
+ this.destroy();
+ }
+ }
+ } );
+ this.document = $( element.style ?
+
+ // Element within the document
+ element.ownerDocument :
+
+ // Element is window or document
+ element.document || element );
+ this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow );
+ }
+
+ this.options = $.widget.extend( {},
this.options,
this._getCreateOptions(),
options );
- var self = this;
- this.element.bind( "remove." + this.widgetName, function() {
- self.destroy();
- });
-
this._create();
- this._trigger( "create" );
+
+ if ( this.options.disabled ) {
+ this._setOptionDisabled( this.options.disabled );
+ }
+
+ this._trigger( "create", null, this._getCreateEventData() );
this._init();
},
+
_getCreateOptions: function() {
- return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+ return {};
},
- _create: function() {},
- _init: function() {},
+
+ _getCreateEventData: $.noop,
+
+ _create: $.noop,
+
+ _init: $.noop,
destroy: function() {
+ var that = this;
+
+ this._destroy();
+ $.each( this.classesElementLookup, function( key, value ) {
+ that._removeClass( value, key );
+ } );
+
+ // We can probably remove the unbind calls in 2.0
+ // all event bindings should go through this._on()
this.element
- .unbind( "." + this.widgetName )
- .removeData( this.widgetName );
+ .off( this.eventNamespace )
+ .removeData( this.widgetFullName );
this.widget()
- .unbind( "." + this.widgetName )
- .removeAttr( "aria-disabled" )
- .removeClass(
- this.widgetBaseClass + "-disabled " +
- "ui-state-disabled" );
+ .off( this.eventNamespace )
+ .removeAttr( "aria-disabled" );
+
+ // Clean up events and states
+ this.bindings.off( this.eventNamespace );
},
+ _destroy: $.noop,
+
widget: function() {
return this.element;
},
option: function( key, value ) {
var options = key;
+ var parts;
+ var curOption;
+ var i;
if ( arguments.length === 0 ) {
- // don't return a reference to the internal hash
- return $.extend( {}, this.options );
+
+ // Don't return a reference to the internal hash
+ return $.widget.extend( {}, this.options );
}
- if (typeof key === "string" ) {
- if ( value === undefined ) {
- return this.options[ key ];
- }
+ if ( typeof key === "string" ) {
+
+ // Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
options = {};
- options[ key ] = value;
+ parts = key.split( "." );
+ key = parts.shift();
+ if ( parts.length ) {
+ curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+ for ( i = 0; i < parts.length - 1; i++ ) {
+ curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+ curOption = curOption[ parts[ i ] ];
+ }
+ key = parts.pop();
+ if ( arguments.length === 1 ) {
+ return curOption[ key ] === undefined ? null : curOption[ key ];
+ }
+ curOption[ key ] = value;
+ } else {
+ if ( arguments.length === 1 ) {
+ return this.options[ key ] === undefined ? null : this.options[ key ];
+ }
+ options[ key ] = value;
+ }
}
this._setOptions( options );
return this;
},
+
_setOptions: function( options ) {
- var self = this;
- $.each( options, function( key, value ) {
- self._setOption( key, value );
- });
+ var key;
+
+ for ( key in options ) {
+ this._setOption( key, options[ key ] );
+ }
return this;
},
+
_setOption: function( key, value ) {
+ if ( key === "classes" ) {
+ this._setOptionClasses( value );
+ }
+
this.options[ key ] = value;
if ( key === "disabled" ) {
- this.widget()
- [ value ? "addClass" : "removeClass"](
- this.widgetBaseClass + "-disabled" + " " +
- "ui-state-disabled" )
- .attr( "aria-disabled", value );
+ this._setOptionDisabled( value );
}
return this;
},
+ _setOptionClasses: function( value ) {
+ var classKey, elements, currentElements;
+
+ for ( classKey in value ) {
+ currentElements = this.classesElementLookup[ classKey ];
+ if ( value[ classKey ] === this.options.classes[ classKey ] ||
+ !currentElements ||
+ !currentElements.length ) {
+ continue;
+ }
+
+ // We are doing this to create a new jQuery object because the _removeClass() call
+ // on the next line is going to destroy the reference to the current elements being
+ // tracked. We need to save a copy of this collection so that we can add the new classes
+ // below.
+ elements = $( currentElements.get() );
+ this._removeClass( currentElements, classKey );
+
+ // We don't use _addClass() here, because that uses this.options.classes
+ // for generating the string of classes. We want to use the value passed in from
+ // _setOption(), this is the new value of the classes option which was passed to
+ // _setOption(). We pass this value directly to _classes().
+ elements.addClass( this._classes( {
+ element: elements,
+ keys: classKey,
+ classes: value,
+ add: true
+ } ) );
+ }
+ },
+
+ _setOptionDisabled: function( value ) {
+ this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value );
+
+ // If the widget is becoming disabled, then nothing is interactive
+ if ( value ) {
+ this._removeClass( this.hoverable, null, "ui-state-hover" );
+ this._removeClass( this.focusable, null, "ui-state-focus" );
+ }
+ },
+
enable: function() {
- return this._setOption( "disabled", false );
+ return this._setOptions( { disabled: false } );
},
+
disable: function() {
- return this._setOption( "disabled", true );
+ return this._setOptions( { disabled: true } );
},
- _trigger: function( type, event, data ) {
- var prop, orig,
- callback = this.options[ type ];
-
- data = data || {};
- event = $.Event( event );
- event.type = ( type === this.widgetEventPrefix ?
- type :
- this.widgetEventPrefix + type ).toLowerCase();
- // the original event may come from any element
- // so we need to reset the target on the new event
- event.target = this.element[ 0 ];
+ _classes: function( options ) {
+ var full = [];
+ var that = this;
- // copy original event properties over to the new event
- orig = event.originalEvent;
- if ( orig ) {
- for ( prop in orig ) {
- if ( !( prop in event ) ) {
- event[ prop ] = orig[ prop ];
+ options = $.extend( {
+ element: this.element,
+ classes: this.options.classes || {}
+ }, options );
+
+ function processClassString( classes, checkOption ) {
+ var current, i;
+ for ( i = 0; i < classes.length; i++ ) {
+ current = that.classesElementLookup[ classes[ i ] ] || $();
+ if ( options.add ) {
+ current = $( $.unique( current.get().concat( options.element.get() ) ) );
+ } else {
+ current = $( current.not( options.element ).get() );
+ }
+ that.classesElementLookup[ classes[ i ] ] = current;
+ full.push( classes[ i ] );
+ if ( checkOption && options.classes[ classes[ i ] ] ) {
+ full.push( options.classes[ classes[ i ] ] );
}
}
}
- this.element.trigger( event, data );
-
- return !( $.isFunction(callback) &&
- callback.call( this.element[0], event, data ) === false ||
- event.isDefaultPrevented() );
- }
-};
+ this._on( options.element, {
+ "remove": "_untrackClassesElement"
+ } );
-})( jQuery );
-/*!
- * jQuery UI Mouse 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Mouse
- *
- * Depends:
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
+ if ( options.keys ) {
+ processClassString( options.keys.match( /\S+/g ) || [], true );
+ }
+ if ( options.extra ) {
+ processClassString( options.extra.match( /\S+/g ) || [] );
+ }
-var mouseHandled = false;
-$( document ).mouseup( function( e ) {
- mouseHandled = false;
-});
+ return full.join( " " );
+ },
-$.widget("ui.mouse", {
- options: {
- cancel: ':input,option',
- distance: 1,
- delay: 0
+ _untrackClassesElement: function( event ) {
+ var that = this;
+ $.each( that.classesElementLookup, function( key, value ) {
+ if ( $.inArray( event.target, value ) !== -1 ) {
+ that.classesElementLookup[ key ] = $( value.not( event.target ).get() );
+ }
+ } );
},
- _mouseInit: function() {
- var self = this;
- this.element
- .bind('mousedown.'+this.widgetName, function(event) {
- return self._mouseDown(event);
- })
- .bind('click.'+this.widgetName, function(event) {
- if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
- $.removeData(event.target, self.widgetName + '.preventClickEvent');
- event.stopImmediatePropagation();
- return false;
- }
- });
+ _removeClass: function( element, keys, extra ) {
+ return this._toggleClass( element, keys, extra, false );
+ },
- this.started = false;
+ _addClass: function( element, keys, extra ) {
+ return this._toggleClass( element, keys, extra, true );
},
- // TODO: make sure destroying one instance of mouse doesn't mess with
- // other instances of mouse
- _mouseDestroy: function() {
- this.element.unbind('.'+this.widgetName);
- $(document)
- .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+ _toggleClass: function( element, keys, extra, add ) {
+ add = ( typeof add === "boolean" ) ? add : extra;
+ var shift = ( typeof element === "string" || element === null ),
+ options = {
+ extra: shift ? keys : extra,
+ keys: shift ? element : keys,
+ element: shift ? this.element : element,
+ add: add
+ };
+ options.element.toggleClass( this._classes( options ), add );
+ return this;
},
- _mouseDown: function(event) {
- // don't let more than one widget handle mouseStart
- if( mouseHandled ) { return };
+ _on: function( suppressDisabledCheck, element, handlers ) {
+ var delegateElement;
+ var instance = this;
- // we may have missed mouseup (out of window)
- (this._mouseStarted && this._mouseUp(event));
+ // No suppressDisabledCheck flag, shuffle arguments
+ if ( typeof suppressDisabledCheck !== "boolean" ) {
+ handlers = element;
+ element = suppressDisabledCheck;
+ suppressDisabledCheck = false;
+ }
- this._mouseDownEvent = event;
-
- var self = this,
- btnIsLeft = (event.which == 1),
- // event.target.nodeName works around a bug in IE 8 with
- // disabled inputs (#7620)
- elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
- if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
- return true;
+ // No element argument, shuffle and use this.element
+ if ( !handlers ) {
+ handlers = element;
+ element = this.element;
+ delegateElement = this.widget();
+ } else {
+ element = delegateElement = $( element );
+ this.bindings = this.bindings.add( element );
}
- this.mouseDelayMet = !this.options.delay;
- if (!this.mouseDelayMet) {
- this._mouseDelayTimer = setTimeout(function() {
- self.mouseDelayMet = true;
- }, this.options.delay);
- }
+ $.each( handlers, function( event, handler ) {
+ function handlerProxy() {
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted = (this._mouseStart(event) !== false);
- if (!this._mouseStarted) {
- event.preventDefault();
- return true;
+ // Allow widgets to customize the disabled handling
+ // - disabled as an array instead of boolean
+ // - disabled class as method for disabling individual parts
+ if ( !suppressDisabledCheck &&
+ ( instance.options.disabled === true ||
+ $( this ).hasClass( "ui-state-disabled" ) ) ) {
+ return;
+ }
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
}
- }
- // Click event may never have fired (Gecko & Opera)
- if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
- $.removeData(event.target, this.widgetName + '.preventClickEvent');
- }
+ // Copy the guid so direct unbinding works
+ if ( typeof handler !== "string" ) {
+ handlerProxy.guid = handler.guid =
+ handler.guid || handlerProxy.guid || $.guid++;
+ }
- // these delegates are required to keep context
- this._mouseMoveDelegate = function(event) {
- return self._mouseMove(event);
- };
- this._mouseUpDelegate = function(event) {
- return self._mouseUp(event);
- };
- $(document)
- .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+ var match = event.match( /^([\w:-]*)\s*(.*)$/ );
+ var eventName = match[ 1 ] + instance.eventNamespace;
+ var selector = match[ 2 ];
- event.preventDefault();
-
- mouseHandled = true;
- return true;
+ if ( selector ) {
+ delegateElement.on( eventName, selector, handlerProxy );
+ } else {
+ element.on( eventName, handlerProxy );
+ }
+ } );
},
- _mouseMove: function(event) {
- // IE mouseup check - mouseup happened when mouse was out of window
- if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
- return this._mouseUp(event);
- }
+ _off: function( element, eventName ) {
+ eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) +
+ this.eventNamespace;
+ element.off( eventName ).off( eventName );
- if (this._mouseStarted) {
- this._mouseDrag(event);
- return event.preventDefault();
- }
+ // Clear the stack to avoid memory leaks (#10056)
+ this.bindings = $( this.bindings.not( element ).get() );
+ this.focusable = $( this.focusable.not( element ).get() );
+ this.hoverable = $( this.hoverable.not( element ).get() );
+ },
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted =
- (this._mouseStart(this._mouseDownEvent, event) !== false);
- (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ _delay: function( handler, delay ) {
+ function handlerProxy() {
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
}
+ var instance = this;
+ return setTimeout( handlerProxy, delay || 0 );
+ },
- return !this._mouseStarted;
+ _hoverable: function( element ) {
+ this.hoverable = this.hoverable.add( element );
+ this._on( element, {
+ mouseenter: function( event ) {
+ this._addClass( $( event.currentTarget ), null, "ui-state-hover" );
+ },
+ mouseleave: function( event ) {
+ this._removeClass( $( event.currentTarget ), null, "ui-state-hover" );
+ }
+ } );
+ },
+
+ _focusable: function( element ) {
+ this.focusable = this.focusable.add( element );
+ this._on( element, {
+ focusin: function( event ) {
+ this._addClass( $( event.currentTarget ), null, "ui-state-focus" );
+ },
+ focusout: function( event ) {
+ this._removeClass( $( event.currentTarget ), null, "ui-state-focus" );
+ }
+ } );
},
- _mouseUp: function(event) {
- $(document)
- .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+ _trigger: function( type, event, data ) {
+ var prop, orig;
+ var callback = this.options[ type ];
- if (this._mouseStarted) {
- this._mouseStarted = false;
+ data = data || {};
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+
+ // The original event may come from any element
+ // so we need to reset the target on the new event
+ event.target = this.element[ 0 ];
- if (event.target == this._mouseDownEvent.target) {
- $.data(event.target, this.widgetName + '.preventClickEvent', true);
+ // Copy original event properties over to the new event
+ orig = event.originalEvent;
+ if ( orig ) {
+ for ( prop in orig ) {
+ if ( !( prop in event ) ) {
+ event[ prop ] = orig[ prop ];
+ }
}
+ }
+
+ this.element.trigger( event, data );
+ return !( $.isFunction( callback ) &&
+ callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
- this._mouseStop(event);
+$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+ $.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+ if ( typeof options === "string" ) {
+ options = { effect: options };
}
- return false;
- },
+ var hasOptions;
+ var effectName = !options ?
+ method :
+ options === true || typeof options === "number" ?
+ defaultEffect :
+ options.effect || defaultEffect;
- _mouseDistanceMet: function(event) {
- return (Math.max(
- Math.abs(this._mouseDownEvent.pageX - event.pageX),
- Math.abs(this._mouseDownEvent.pageY - event.pageY)
- ) >= this.options.distance
- );
- },
+ options = options || {};
+ if ( typeof options === "number" ) {
+ options = { duration: options };
+ }
- _mouseDelayMet: function(event) {
- return this.mouseDelayMet;
- },
+ hasOptions = !$.isEmptyObject( options );
+ options.complete = callback;
+
+ if ( options.delay ) {
+ element.delay( options.delay );
+ }
+
+ if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
+ element[ method ]( options );
+ } else if ( effectName !== method && element[ effectName ] ) {
+ element[ effectName ]( options.duration, options.easing, callback );
+ } else {
+ element.queue( function( next ) {
+ $( this )[ method ]();
+ if ( callback ) {
+ callback.call( element[ 0 ] );
+ }
+ next();
+ } );
+ }
+ };
+} );
+
+var widget = $.widget;
- // These are placeholder methods, to be overriden by extending plugin
- _mouseStart: function(event) {},
- _mouseDrag: function(event) {},
- _mouseStop: function(event) {},
- _mouseCapture: function(event) { return true; }
-});
-})(jQuery);
/*!
- * jQuery UI Position 1.8.21
+ * jQuery UI Position 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
*
- * http://docs.jquery.com/UI/Position
+ * http://api.jqueryui.com/position/
*/
-(function( $, undefined ) {
-$.ui = $.ui || {};
+//>>label: Position
+//>>group: Core
+//>>description: Positions elements relative to other elements.
+//>>docs: http://api.jqueryui.com/position/
+//>>demos: http://jqueryui.com/position/
+
+
+( function() {
+var cachedScrollbarWidth,
+ max = Math.max,
+ abs = Math.abs,
+ rhorizontal = /left|center|right/,
+ rvertical = /top|center|bottom/,
+ roffset = /[\+\-]\d+(\.[\d]+)?%?/,
+ rposition = /^\w+/,
+ rpercent = /%$/,
+ _position = $.fn.position;
+
+function getOffsets( offsets, width, height ) {
+ return [
+ parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
+ parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
+ ];
+}
+
+function parseCss( element, property ) {
+ return parseInt( $.css( element, property ), 10 ) || 0;
+}
+
+function getDimensions( elem ) {
+ var raw = elem[ 0 ];
+ if ( raw.nodeType === 9 ) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: { top: 0, left: 0 }
+ };
+ }
+ if ( $.isWindow( raw ) ) {
+ return {
+ width: elem.width(),
+ height: elem.height(),
+ offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
+ };
+ }
+ if ( raw.preventDefault ) {
+ return {
+ width: 0,
+ height: 0,
+ offset: { top: raw.pageY, left: raw.pageX }
+ };
+ }
+ return {
+ width: elem.outerWidth(),
+ height: elem.outerHeight(),
+ offset: elem.offset()
+ };
+}
+
+$.position = {
+ scrollbarWidth: function() {
+ if ( cachedScrollbarWidth !== undefined ) {
+ return cachedScrollbarWidth;
+ }
+ var w1, w2,
+ div = $( "<div " +
+ "style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" +
+ "<div style='height:100px;width:auto;'></div></div>" ),
+ innerDiv = div.children()[ 0 ];
+
+ $( "body" ).append( div );
+ w1 = innerDiv.offsetWidth;
+ div.css( "overflow", "scroll" );
+
+ w2 = innerDiv.offsetWidth;
+
+ if ( w1 === w2 ) {
+ w2 = div[ 0 ].clientWidth;
+ }
+
+ div.remove();
-var horizontalPositions = /left|center|right/,
- verticalPositions = /top|center|bottom/,
- center = "center",
- support = {},
- _position = $.fn.position,
- _offset = $.fn.offset;
+ return ( cachedScrollbarWidth = w1 - w2 );
+ },
+ getScrollInfo: function( within ) {
+ var overflowX = within.isWindow || within.isDocument ? "" :
+ within.element.css( "overflow-x" ),
+ overflowY = within.isWindow || within.isDocument ? "" :
+ within.element.css( "overflow-y" ),
+ hasOverflowX = overflowX === "scroll" ||
+ ( overflowX === "auto" && within.width < within.element[ 0 ].scrollWidth ),
+ hasOverflowY = overflowY === "scroll" ||
+ ( overflowY === "auto" && within.height < within.element[ 0 ].scrollHeight );
+ return {
+ width: hasOverflowY ? $.position.scrollbarWidth() : 0,
+ height: hasOverflowX ? $.position.scrollbarWidth() : 0
+ };
+ },
+ getWithinInfo: function( element ) {
+ var withinElement = $( element || window ),
+ isWindow = $.isWindow( withinElement[ 0 ] ),
+ isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9,
+ hasOffset = !isWindow && !isDocument;
+ return {
+ element: withinElement,
+ isWindow: isWindow,
+ isDocument: isDocument,
+ offset: hasOffset ? $( element ).offset() : { left: 0, top: 0 },
+ scrollLeft: withinElement.scrollLeft(),
+ scrollTop: withinElement.scrollTop(),
+ width: withinElement.outerWidth(),
+ height: withinElement.outerHeight()
+ };
+ }
+};
$.fn.position = function( options ) {
if ( !options || !options.of ) {
return _position.apply( this, arguments );
}
- // make a copy, we don't want to modify arguments
+ // Make a copy, we don't want to modify arguments
options = $.extend( {}, options );
- var target = $( options.of ),
- targetElem = target[0],
+ var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
+ target = $( options.of ),
+ within = $.position.getWithinInfo( options.within ),
+ scrollInfo = $.position.getScrollInfo( within ),
collision = ( options.collision || "flip" ).split( " " ),
- offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
- targetWidth,
- targetHeight,
- basePosition;
-
- if ( targetElem.nodeType === 9 ) {
- targetWidth = target.width();
- targetHeight = target.height();
- basePosition = { top: 0, left: 0 };
- // TODO: use $.isWindow() in 1.9
- } else if ( targetElem.setTimeout ) {
- targetWidth = target.width();
- targetHeight = target.height();
- basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
- } else if ( targetElem.preventDefault ) {
- // force left top to allow flipping
+ offsets = {};
+
+ dimensions = getDimensions( target );
+ if ( target[ 0 ].preventDefault ) {
+
+ // Force left top to allow flipping
options.at = "left top";
- targetWidth = targetHeight = 0;
- basePosition = { top: options.of.pageY, left: options.of.pageX };
- } else {
- targetWidth = target.outerWidth();
- targetHeight = target.outerHeight();
- basePosition = target.offset();
}
+ targetWidth = dimensions.width;
+ targetHeight = dimensions.height;
+ targetOffset = dimensions.offset;
+
+ // Clone to reuse original targetOffset later
+ basePosition = $.extend( {}, targetOffset );
- // force my and at to have valid horizontal and veritcal positions
- // if a value is missing or invalid, it will be converted to center
+ // Force my and at to have valid horizontal and vertical positions
+ // if a value is missing or invalid, it will be converted to center
$.each( [ "my", "at" ], function() {
- var pos = ( options[this] || "" ).split( " " );
- if ( pos.length === 1) {
- pos = horizontalPositions.test( pos[0] ) ?
- pos.concat( [center] ) :
- verticalPositions.test( pos[0] ) ?
- [ center ].concat( pos ) :
- [ center, center ];
- }
- pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
- pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
- options[ this ] = pos;
- });
-
- // normalize collision option
+ var pos = ( options[ this ] || "" ).split( " " ),
+ horizontalOffset,
+ verticalOffset;
+
+ if ( pos.length === 1 ) {
+ pos = rhorizontal.test( pos[ 0 ] ) ?
+ pos.concat( [ "center" ] ) :
+ rvertical.test( pos[ 0 ] ) ?
+ [ "center" ].concat( pos ) :
+ [ "center", "center" ];
+ }
+ pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
+ pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
+
+ // Calculate offsets
+ horizontalOffset = roffset.exec( pos[ 0 ] );
+ verticalOffset = roffset.exec( pos[ 1 ] );
+ offsets[ this ] = [
+ horizontalOffset ? horizontalOffset[ 0 ] : 0,
+ verticalOffset ? verticalOffset[ 0 ] : 0
+ ];
+
+ // Reduce to just the positions without the offsets
+ options[ this ] = [
+ rposition.exec( pos[ 0 ] )[ 0 ],
+ rposition.exec( pos[ 1 ] )[ 0 ]
+ ];
+ } );
+
+ // Normalize collision option
if ( collision.length === 1 ) {
collision[ 1 ] = collision[ 0 ];
}
- // normalize offset option
- offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
- if ( offset.length === 1 ) {
- offset[ 1 ] = offset[ 0 ];
- }
- offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
-
- if ( options.at[0] === "right" ) {
+ if ( options.at[ 0 ] === "right" ) {
basePosition.left += targetWidth;
- } else if ( options.at[0] === center ) {
+ } else if ( options.at[ 0 ] === "center" ) {
basePosition.left += targetWidth / 2;
}
- if ( options.at[1] === "bottom" ) {
+ if ( options.at[ 1 ] === "bottom" ) {
basePosition.top += targetHeight;
- } else if ( options.at[1] === center ) {
+ } else if ( options.at[ 1 ] === "center" ) {
basePosition.top += targetHeight / 2;
}
- basePosition.left += offset[ 0 ];
- basePosition.top += offset[ 1 ];
+ atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
+ basePosition.left += atOffset[ 0 ];
+ basePosition.top += atOffset[ 1 ];
- return this.each(function() {
- var elem = $( this ),
+ return this.each( function() {
+ var collisionPosition, using,
+ elem = $( this ),
elemWidth = elem.outerWidth(),
elemHeight = elem.outerHeight(),
- marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
- marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
- collisionWidth = elemWidth + marginLeft +
- ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
- collisionHeight = elemHeight + marginTop +
- ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+ marginLeft = parseCss( this, "marginLeft" ),
+ marginTop = parseCss( this, "marginTop" ),
+ collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) +
+ scrollInfo.width,
+ collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) +
+ scrollInfo.height,
position = $.extend( {}, basePosition ),
- collisionPosition;
+ myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
- if ( options.my[0] === "right" ) {
+ if ( options.my[ 0 ] === "right" ) {
position.left -= elemWidth;
- } else if ( options.my[0] === center ) {
+ } else if ( options.my[ 0 ] === "center" ) {
position.left -= elemWidth / 2;
}
- if ( options.my[1] === "bottom" ) {
+ if ( options.my[ 1 ] === "bottom" ) {
position.top -= elemHeight;
- } else if ( options.my[1] === center ) {
+ } else if ( options.my[ 1 ] === "center" ) {
position.top -= elemHeight / 2;
}
- // prevent fractions if jQuery version doesn't support them (see #5280)
- if ( !support.fractions ) {
- position.left = Math.round( position.left );
- position.top = Math.round( position.top );
- }
+ position.left += myOffset[ 0 ];
+ position.top += myOffset[ 1 ];
collisionPosition = {
- left: position.left - marginLeft,
- top: position.top - marginTop
+ marginLeft: marginLeft,
+ marginTop: marginTop
};
$.each( [ "left", "top" ], function( i, dir ) {
- if ( $.ui.position[ collision[i] ] ) {
- $.ui.position[ collision[i] ][ dir ]( position, {
+ if ( $.ui.position[ collision[ i ] ] ) {
+ $.ui.position[ collision[ i ] ][ dir ]( position, {
targetWidth: targetWidth,
targetHeight: targetHeight,
elemWidth: elemWidth,
collisionPosition: collisionPosition,
collisionWidth: collisionWidth,
collisionHeight: collisionHeight,
- offset: offset,
+ offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
my: options.my,
- at: options.at
- });
+ at: options.at,
+ within: within,
+ elem: elem
+ } );
}
- });
-
- if ( $.fn.bgiframe ) {
- elem.bgiframe();
+ } );
+
+ if ( options.using ) {
+
+ // Adds feedback as second argument to using callback, if present
+ using = function( props ) {
+ var left = targetOffset.left - position.left,
+ right = left + targetWidth - elemWidth,
+ top = targetOffset.top - position.top,
+ bottom = top + targetHeight - elemHeight,
+ feedback = {
+ target: {
+ element: target,
+ left: targetOffset.left,
+ top: targetOffset.top,
+ width: targetWidth,
+ height: targetHeight
+ },
+ element: {
+ element: elem,
+ left: position.left,
+ top: position.top,
+ width: elemWidth,
+ height: elemHeight
+ },
+ horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+ vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+ };
+ if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
+ feedback.horizontal = "center";
+ }
+ if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
+ feedback.vertical = "middle";
+ }
+ if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
+ feedback.important = "horizontal";
+ } else {
+ feedback.important = "vertical";
+ }
+ options.using.call( this, props, feedback );
+ };
}
- elem.offset( $.extend( position, { using: options.using } ) );
- });
+
+ elem.offset( $.extend( position, { using: using } ) );
+ } );
};
$.ui.position = {
fit: {
left: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
- position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+ outerWidth = within.width,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = withinOffset - collisionPosLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+ newOverRight;
+
+ // Element is wider than within
+ if ( data.collisionWidth > outerWidth ) {
+
+ // Element is initially over the left side of within
+ if ( overLeft > 0 && overRight <= 0 ) {
+ newOverRight = position.left + overLeft + data.collisionWidth - outerWidth -
+ withinOffset;
+ position.left += overLeft - newOverRight;
+
+ // Element is initially over right side of within
+ } else if ( overRight > 0 && overLeft <= 0 ) {
+ position.left = withinOffset;
+
+ // Element is initially over both left and right sides of within
+ } else {
+ if ( overLeft > overRight ) {
+ position.left = withinOffset + outerWidth - data.collisionWidth;
+ } else {
+ position.left = withinOffset;
+ }
+ }
+
+ // Too far left -> align with left edge
+ } else if ( overLeft > 0 ) {
+ position.left += overLeft;
+
+ // Too far right -> align with right edge
+ } else if ( overRight > 0 ) {
+ position.left -= overRight;
+
+ // Adjust based on position and margin
+ } else {
+ position.left = max( position.left - collisionPosLeft, position.left );
+ }
},
top: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
- position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+ outerHeight = data.within.height,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = withinOffset - collisionPosTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+ newOverBottom;
+
+ // Element is taller than within
+ if ( data.collisionHeight > outerHeight ) {
+
+ // Element is initially over the top of within
+ if ( overTop > 0 && overBottom <= 0 ) {
+ newOverBottom = position.top + overTop + data.collisionHeight - outerHeight -
+ withinOffset;
+ position.top += overTop - newOverBottom;
+
+ // Element is initially over bottom of within
+ } else if ( overBottom > 0 && overTop <= 0 ) {
+ position.top = withinOffset;
+
+ // Element is initially over both top and bottom of within
+ } else {
+ if ( overTop > overBottom ) {
+ position.top = withinOffset + outerHeight - data.collisionHeight;
+ } else {
+ position.top = withinOffset;
+ }
+ }
+
+ // Too far up -> align with top
+ } else if ( overTop > 0 ) {
+ position.top += overTop;
+
+ // Too far down -> align with bottom edge
+ } else if ( overBottom > 0 ) {
+ position.top -= overBottom;
+
+ // Adjust based on position and margin
+ } else {
+ position.top = max( position.top - collisionPosTop, position.top );
+ }
}
},
-
flip: {
left: function( position, data ) {
- if ( data.at[0] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+ var within = data.within,
+ withinOffset = within.offset.left + within.scrollLeft,
+ outerWidth = within.width,
+ offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = collisionPosLeft - offsetLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
myOffset = data.my[ 0 ] === "left" ?
-data.elemWidth :
data.my[ 0 ] === "right" ?
0,
atOffset = data.at[ 0 ] === "left" ?
data.targetWidth :
- -data.targetWidth,
- offset = -2 * data.offset[ 0 ];
- position.left += data.collisionPosition.left < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
+ data.at[ 0 ] === "right" ?
+ -data.targetWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ],
+ newOverRight,
+ newOverLeft;
+
+ if ( overLeft < 0 ) {
+ newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth -
+ outerWidth - withinOffset;
+ if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ } else if ( overRight > 0 ) {
+ newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset +
+ atOffset + offset - offsetLeft;
+ if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
},
top: function( position, data ) {
- if ( data.at[1] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
- myOffset = data.my[ 1 ] === "top" ?
+ var within = data.within,
+ withinOffset = within.offset.top + within.scrollTop,
+ outerHeight = within.height,
+ offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = collisionPosTop - offsetTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+ top = data.my[ 1 ] === "top",
+ myOffset = top ?
-data.elemHeight :
data.my[ 1 ] === "bottom" ?
data.elemHeight :
0,
atOffset = data.at[ 1 ] === "top" ?
data.targetHeight :
- -data.targetHeight,
- offset = -2 * data.offset[ 1 ];
- position.top += data.collisionPosition.top < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
- }
- }
-};
-
-// offset setter from jQuery 1.4
-if ( !$.offset.setOffset ) {
- $.offset.setOffset = function( elem, options ) {
- // set position first, in-case top/left are set even on static elem
- if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
- elem.style.position = "relative";
- }
- var curElem = $( elem ),
- curOffset = curElem.offset(),
- curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
- curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
- props = {
- top: (options.top - curOffset.top) + curTop,
- left: (options.left - curOffset.left) + curLeft
- };
-
- if ( 'using' in options ) {
- options.using.call( elem, props );
- } else {
- curElem.css( props );
- }
- };
-
- $.fn.offset = function( options ) {
- var elem = this[ 0 ];
- if ( !elem || !elem.ownerDocument ) { return null; }
- if ( options ) {
- if ( $.isFunction( options ) ) {
- return this.each(function( i ) {
- $( this ).offset( options.call( this, i, $( this ).offset() ) );
- });
+ data.at[ 1 ] === "bottom" ?
+ -data.targetHeight :
+ 0,
+ offset = -2 * data.offset[ 1 ],
+ newOverTop,
+ newOverBottom;
+ if ( overTop < 0 ) {
+ newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight -
+ outerHeight - withinOffset;
+ if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) {
+ position.top += myOffset + atOffset + offset;
+ }
+ } else if ( overBottom > 0 ) {
+ newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset +
+ offset - offsetTop;
+ if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) {
+ position.top += myOffset + atOffset + offset;
+ }
}
- return this.each(function() {
- $.offset.setOffset( this, options );
- });
}
- return _offset.call( this );
- };
-}
-
-// fraction support test (older versions of jQuery don't support fractions)
-(function () {
- var body = document.getElementsByTagName( "body" )[ 0 ],
- div = document.createElement( "div" ),
- testElement, testElementParent, testElementStyle, offset, offsetTotal;
-
- //Create a "fake body" for testing based on method used in jQuery.support
- testElement = document.createElement( body ? "div" : "body" );
- testElementStyle = {
- visibility: "hidden",
- width: 0,
- height: 0,
- border: 0,
- margin: 0,
- background: "none"
- };
- if ( body ) {
- $.extend( testElementStyle, {
- position: "absolute",
- left: "-1000px",
- top: "-1000px"
- });
- }
- for ( var i in testElementStyle ) {
- testElement.style[ i ] = testElementStyle[ i ];
+ },
+ flipfit: {
+ left: function() {
+ $.ui.position.flip.left.apply( this, arguments );
+ $.ui.position.fit.left.apply( this, arguments );
+ },
+ top: function() {
+ $.ui.position.flip.top.apply( this, arguments );
+ $.ui.position.fit.top.apply( this, arguments );
+ }
}
- testElement.appendChild( div );
- testElementParent = body || document.documentElement;
- testElementParent.insertBefore( testElement, testElementParent.firstChild );
-
- div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;";
+};
- offset = $( div ).offset( function( _, offset ) {
- return offset;
- }).offset();
+} )();
- testElement.innerHTML = "";
- testElementParent.removeChild( testElement );
+var position = $.ui.position;
- offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 );
- support.fractions = offsetTotal > 21 && offsetTotal < 22;
-})();
-}( jQuery ));
/*!
- * jQuery UI Draggable 1.8.21
+ * jQuery UI :data 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
*/
-(function( $, undefined ) {
-
-$.widget("ui.draggable", $.ui.mouse, {
- widgetEventPrefix: "drag",
- options: {
- addClasses: true,
- appendTo: "parent",
- axis: false,
- connectToSortable: false,
- containment: false,
- cursor: "auto",
- cursorAt: false,
- grid: false,
- handle: false,
- helper: "original",
- iframeFix: false,
- opacity: false,
- refreshPositions: false,
- revert: false,
- revertDuration: 500,
- scope: "default",
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- snap: false,
- snapMode: "both",
- snapTolerance: 20,
- stack: false,
- zIndex: false
- },
- _create: function() {
- if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
- this.element[0].style.position = 'relative';
+//>>label: :data Selector
+//>>group: Core
+//>>description: Selects elements which have data stored under the specified key.
+//>>docs: http://api.jqueryui.com/data-selector/
- (this.options.addClasses && this.element.addClass("ui-draggable"));
- (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
- this._mouseInit();
-
- },
-
- destroy: function() {
- if(!this.element.data('draggable')) return;
- this.element
- .removeData("draggable")
- .unbind(".draggable")
- .removeClass("ui-draggable"
- + " ui-draggable-dragging"
- + " ui-draggable-disabled");
- this._mouseDestroy();
+var data = $.extend( $.expr[ ":" ], {
+ data: $.expr.createPseudo ?
+ $.expr.createPseudo( function( dataName ) {
+ return function( elem ) {
+ return !!$.data( elem, dataName );
+ };
+ } ) :
- return this;
- },
+ // Support: jQuery <1.8
+ function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ }
+} );
- _mouseCapture: function(event) {
+/*!
+ * jQuery UI Disable Selection 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- var o = this.options;
+//>>label: disableSelection
+//>>group: Core
+//>>description: Disable selection of text content within the set of matched elements.
+//>>docs: http://api.jqueryui.com/disableSelection/
- // among others, prevent a drag on a resizable-handle
- if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
- return false;
+// This file is deprecated
- //Quit if we're not on a valid handle
- this.handle = this._getHandle(event);
- if (!this.handle)
- return false;
-
- if ( o.iframeFix ) {
- $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
- $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
- .css({
- width: this.offsetWidth+"px", height: this.offsetHeight+"px",
- position: "absolute", opacity: "0.001", zIndex: 1000
- })
- .css($(this).offset())
- .appendTo("body");
- });
- }
- return true;
+var disableSelection = $.fn.extend( {
+ disableSelection: ( function() {
+ var eventType = "onselectstart" in document.createElement( "div" ) ?
+ "selectstart" :
+ "mousedown";
- },
+ return function() {
+ return this.on( eventType + ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ } );
+ };
+ } )(),
- _mouseStart: function(event) {
+ enableSelection: function() {
+ return this.off( ".ui-disableSelection" );
+ }
+} );
- var o = this.options;
- //Create and append the visible helper
- this.helper = this._createHelper(event);
+/*!
+ * jQuery UI Effects 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- this.helper.addClass("ui-draggable-dragging");
+//>>label: Effects Core
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/category/effects-core/
+//>>demos: http://jqueryui.com/effect/
- //Cache the helper size
- this._cacheHelperProportions();
- //If ddmanager is used for droppables, set the global draggable
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
+var dataSpace = "ui-effects-",
+ dataSpaceStyle = "ui-effects-style",
+ dataSpaceAnimated = "ui-effects-animated",
- //Cache the margins of the original element
- this._cacheMargins();
+ // Create a local jQuery because jQuery Color relies on it and the
+ // global may not exist with AMD and a custom build (#10199)
+ jQuery = $;
- //Store the helper's css position
- this.cssPosition = this.helper.css("position");
- this.scrollParent = this.helper.scrollParent();
+$.effects = {
+ effect: {}
+};
- //The element's absolute position on the page minus margins
- this.offset = this.positionAbs = this.element.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
-
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
-
- //Generate the original position
- this.originalPosition = this.position = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
-
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
-
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
-
- //Trigger event + callbacks
- if(this._trigger("start", event) === false) {
- this._clear();
- return false;
- }
-
- //Recache the helper size
- this._cacheHelperProportions();
-
- //Prepare the droppable offsets
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
-
-
- this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
-
- //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
- if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
-
- return true;
- },
-
- _mouseDrag: function(event, noPropagation) {
-
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
-
- //Call plugins and callbacks and use the resulting position if something is returned
- if (!noPropagation) {
- var ui = this._uiHash();
- if(this._trigger('drag', event, ui) === false) {
- this._mouseUp({});
- return false;
+/*!
+ * jQuery Color Animations v2.1.2
+ * https://github.com/jquery/jquery-color
+ *
+ * Copyright 2014 jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * Date: Wed Jan 16 08:47:09 2013 -0600
+ */
+( function( jQuery, undefined ) {
+
+ var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " +
+ "borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
+
+ // Plusequals test for += 100 -= 100
+ rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+
+ // A set of RE's that can match strings and generate color tuples.
+ stringParsers = [ {
+ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ],
+ execResult[ 3 ],
+ execResult[ 4 ]
+ ];
}
- this.position = ui.position;
- }
-
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
- return false;
- },
-
- _mouseStop: function(event) {
-
- //If we are using droppables, inform the manager about the drop
- var dropped = false;
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- dropped = $.ui.ddmanager.drop(this, event);
-
- //if a drop comes from outside (a sortable)
- if(this.dropped) {
- dropped = this.dropped;
- this.dropped = false;
- }
-
- //if the original element is no longer in the DOM don't bother to continue (see #8269)
- var element = this.element[0], elementInDom = false;
- while ( element && (element = element.parentNode) ) {
- if (element == document ) {
- elementInDom = true;
+ }, {
+ re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ] * 2.55,
+ execResult[ 2 ] * 2.55,
+ execResult[ 3 ] * 2.55,
+ execResult[ 4 ]
+ ];
}
- }
- if ( !elementInDom && this.options.helper === "original" )
- return false;
-
- if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
- var self = this;
- $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
- if(self._trigger("stop", event) !== false) {
- self._clear();
+ }, {
+
+ // This regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+
+ // This regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+ re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+ space: "hsla",
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ] / 100,
+ execResult[ 3 ] / 100,
+ execResult[ 4 ]
+ ];
+ }
+ } ],
+
+ // JQuery.Color( )
+ color = jQuery.Color = function( color, green, blue, alpha ) {
+ return new jQuery.Color.fn.parse( color, green, blue, alpha );
+ },
+ spaces = {
+ rgba: {
+ props: {
+ red: {
+ idx: 0,
+ type: "byte"
+ },
+ green: {
+ idx: 1,
+ type: "byte"
+ },
+ blue: {
+ idx: 2,
+ type: "byte"
}
- });
- } else {
- if(this._trigger("stop", event) !== false) {
- this._clear();
}
- }
+ },
- return false;
- },
-
- _mouseUp: function(event) {
- if (this.options.iframeFix === true) {
- $("div.ui-draggable-iframeFix").each(function() {
- this.parentNode.removeChild(this);
- }); //Remove frame helpers
+ hsla: {
+ props: {
+ hue: {
+ idx: 0,
+ type: "degrees"
+ },
+ saturation: {
+ idx: 1,
+ type: "percent"
+ },
+ lightness: {
+ idx: 2,
+ type: "percent"
+ }
+ }
}
-
- //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
- if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
-
- return $.ui.mouse.prototype._mouseUp.call(this, event);
},
-
- cancel: function() {
-
- if(this.helper.is(".ui-draggable-dragging")) {
- this._mouseUp({});
- } else {
- this._clear();
+ propTypes = {
+ "byte": {
+ floor: true,
+ max: 255
+ },
+ "percent": {
+ max: 1
+ },
+ "degrees": {
+ mod: 360,
+ floor: true
}
-
- return this;
-
},
+ support = color.support = {},
- _getHandle: function(event) {
-
- var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
- $(this.options.handle, this.element)
- .find("*")
- .andSelf()
- .each(function() {
- if(this == event.target) handle = true;
- });
+ // Element for support tests
+ supportElem = jQuery( "<p>" )[ 0 ],
- return handle;
+ // Colors = jQuery.Color.names
+ colors,
- },
+ // Local aliases of functions called often
+ each = jQuery.each;
- _createHelper: function(event) {
+// Determine rgba support immediately
+supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
+// Define cache name and alpha properties
+// for rgba and hsla spaces
+each( spaces, function( spaceName, space ) {
+ space.cache = "_" + spaceName;
+ space.props.alpha = {
+ idx: 3,
+ type: "percent",
+ def: 1
+ };
+} );
- if(!helper.parents('body').length)
- helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+function clamp( value, prop, allowEmpty ) {
+ var type = propTypes[ prop.type ] || {};
- if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
- helper.css("position", "absolute");
+ if ( value == null ) {
+ return ( allowEmpty || !prop.def ) ? null : prop.def;
+ }
- return helper;
+ // ~~ is an short way of doing floor for positive numbers
+ value = type.floor ? ~~value : parseFloat( value );
- },
+ // IE will pass in empty strings as value for alpha,
+ // which will hit this case
+ if ( isNaN( value ) ) {
+ return prop.def;
+ }
- _adjustOffsetFromHelper: function(obj) {
- if (typeof obj == 'string') {
- obj = obj.split(' ');
- }
- if ($.isArray(obj)) {
- obj = {left: +obj[0], top: +obj[1] || 0};
- }
- if ('left' in obj) {
- this.offset.click.left = obj.left + this.margins.left;
- }
- if ('right' in obj) {
- this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- }
- if ('top' in obj) {
- this.offset.click.top = obj.top + this.margins.top;
- }
- if ('bottom' in obj) {
- this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
- }
- },
+ if ( type.mod ) {
- _getParentOffset: function() {
+ // We add mod before modding to make sure that negatives values
+ // get converted properly: -10 -> 350
+ return ( value + type.mod ) % type.mod;
+ }
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
+ // For now all property types without mod have min and max
+ return 0 > value ? 0 : type.max < value ? type.max : value;
+}
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
+function stringParse( string ) {
+ var inst = color(),
+ rgba = inst._rgba = [];
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
+ string = string.toLowerCase();
- return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
+ each( stringParsers, function( i, parser ) {
+ var parsed,
+ match = parser.re.exec( string ),
+ values = match && parser.parse( match ),
+ spaceName = parser.space || "rgba";
- },
+ if ( values ) {
+ parsed = inst[ spaceName ]( values );
- _getRelativeOffset: function() {
+ // If this was an rgba parse the assignment might happen twice
+ // oh well....
+ inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
+ rgba = inst._rgba = parsed._rgba;
- if(this.cssPosition == "relative") {
- var p = this.element.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
+ // Exit each( stringParsers ) here because we matched
+ return false;
}
+ } );
- },
-
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.element.css("marginLeft"),10) || 0),
- top: (parseInt(this.element.css("marginTop"),10) || 0),
- right: (parseInt(this.element.css("marginRight"),10) || 0),
- bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
- };
- },
-
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
- },
-
- _setContainment: function() {
-
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
- o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
- (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
+ // Found a stringParser that handled it
+ if ( rgba.length ) {
- if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
- var c = $(o.containment);
- var ce = c[0]; if(!ce) return;
- var co = c.offset();
- var over = ($(ce).css("overflow") != 'hidden');
+ // If this came from a parsed string, force "transparent" when alpha is 0
+ // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+ if ( rgba.join() === "0,0,0,0" ) {
+ jQuery.extend( rgba, colors.transparent );
+ }
+ return inst;
+ }
- this.containment = [
- (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
- (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
- (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
- (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom
- ];
- this.relative_container = c;
+ // Named colors
+ return colors[ string ];
+}
- } else if(o.containment.constructor == Array) {
- this.containment = o.containment;
+color.fn = jQuery.extend( color.prototype, {
+ parse: function( red, green, blue, alpha ) {
+ if ( red === undefined ) {
+ this._rgba = [ null, null, null, null ];
+ return this;
+ }
+ if ( red.jquery || red.nodeType ) {
+ red = jQuery( red ).css( green );
+ green = undefined;
}
- },
+ var inst = this,
+ type = jQuery.type( red ),
+ rgba = this._rgba = [];
- _convertPositionTo: function(d, pos) {
+ // More than 1 argument specified - assume ( red, green, blue, alpha )
+ if ( green !== undefined ) {
+ red = [ red, green, blue, alpha ];
+ type = "array";
+ }
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ if ( type === "string" ) {
+ return this.parse( stringParse( red ) || colors._default );
+ }
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
+ if ( type === "array" ) {
+ each( spaces.rgba.props, function( key, prop ) {
+ rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );
+ } );
+ return this;
+ }
- },
+ if ( type === "object" ) {
+ if ( red instanceof color ) {
+ each( spaces, function( spaceName, space ) {
+ if ( red[ space.cache ] ) {
+ inst[ space.cache ] = red[ space.cache ].slice();
+ }
+ } );
+ } else {
+ each( spaces, function( spaceName, space ) {
+ var cache = space.cache;
+ each( space.props, function( key, prop ) {
- _generatePosition: function(event) {
+ // If the cache doesn't exist, and we know how to convert
+ if ( !inst[ cache ] && space.to ) {
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
- var pageX = event.pageX;
- var pageY = event.pageY;
+ // If the value was null, we don't need to copy it
+ // if the key was alpha, we don't need to copy it either
+ if ( key === "alpha" || red[ key ] == null ) {
+ return;
+ }
+ inst[ cache ] = space.to( inst._rgba );
+ }
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
+ // This is the only case where we allow nulls for ALL properties.
+ // call clamp with alwaysAllowEmpty
+ inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
+ } );
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
- var containment;
- if(this.containment) {
- if (this.relative_container){
- var co = this.relative_container.offset();
- containment = [ this.containment[0] + co.left,
- this.containment[1] + co.top,
- this.containment[2] + co.left,
- this.containment[3] + co.top ];
- }
- else {
- containment = this.containment;
- }
+ // Everything defined but alpha?
+ if ( inst[ cache ] &&
+ jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
- if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+ // Use the default of 1
+ inst[ cache ][ 3 ] = 1;
+ if ( space.from ) {
+ inst._rgba = space.from( inst[ cache ] );
+ }
+ }
+ } );
+ }
+ return this;
+ }
+ },
+ is: function( compare ) {
+ var is = color( compare ),
+ same = true,
+ inst = this;
+
+ each( spaces, function( _, space ) {
+ var localCache,
+ isCache = is[ space.cache ];
+ if ( isCache ) {
+ localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || [];
+ each( space.props, function( _, prop ) {
+ if ( isCache[ prop.idx ] != null ) {
+ same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
+ return same;
+ }
+ } );
+ }
+ return same;
+ } );
+ return same;
+ },
+ _space: function() {
+ var used = [],
+ inst = this;
+ each( spaces, function( spaceName, space ) {
+ if ( inst[ space.cache ] ) {
+ used.push( spaceName );
+ }
+ } );
+ return used.pop();
+ },
+ transition: function( other, distance ) {
+ var end = color( other ),
+ spaceName = end._space(),
+ space = spaces[ spaceName ],
+ startColor = this.alpha() === 0 ? color( "transparent" ) : this,
+ start = startColor[ space.cache ] || space.to( startColor._rgba ),
+ result = start.slice();
+
+ end = end[ space.cache ];
+ each( space.props, function( key, prop ) {
+ var index = prop.idx,
+ startValue = start[ index ],
+ endValue = end[ index ],
+ type = propTypes[ prop.type ] || {};
+
+ // If null, don't override start value
+ if ( endValue === null ) {
+ return;
}
- if(o.grid) {
- //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
- var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
- pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
- var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
- pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ // If null - use end
+ if ( startValue === null ) {
+ result[ index ] = endValue;
+ } else {
+ if ( type.mod ) {
+ if ( endValue - startValue > type.mod / 2 ) {
+ startValue += type.mod;
+ } else if ( startValue - endValue > type.mod / 2 ) {
+ startValue -= type.mod;
+ }
+ }
+ result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
}
+ } );
+ return this[ spaceName ]( result );
+ },
+ blend: function( opaque ) {
+ // If we are already opaque - return ourself
+ if ( this._rgba[ 3 ] === 1 ) {
+ return this;
}
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
-
- },
+ var rgb = this._rgba.slice(),
+ a = rgb.pop(),
+ blend = color( opaque )._rgba;
- _clear: function() {
- this.helper.removeClass("ui-draggable-dragging");
- if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
- //if($.ui.ddmanager) $.ui.ddmanager.current = null;
- this.helper = null;
- this.cancelHelperRemoval = false;
+ return color( jQuery.map( rgb, function( v, i ) {
+ return ( 1 - a ) * blend[ i ] + a * v;
+ } ) );
},
+ toRgbaString: function() {
+ var prefix = "rgba(",
+ rgba = jQuery.map( this._rgba, function( v, i ) {
+ return v == null ? ( i > 2 ? 1 : 0 ) : v;
+ } );
- // From now on bulk stuff - mainly helpers
+ if ( rgba[ 3 ] === 1 ) {
+ rgba.pop();
+ prefix = "rgb(";
+ }
- _trigger: function(type, event, ui) {
- ui = ui || this._uiHash();
- $.ui.plugin.call(this, type, [event, ui]);
- if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
- return $.Widget.prototype._trigger.call(this, type, event, ui);
+ return prefix + rgba.join() + ")";
},
+ toHslaString: function() {
+ var prefix = "hsla(",
+ hsla = jQuery.map( this.hsla(), function( v, i ) {
+ if ( v == null ) {
+ v = i > 2 ? 1 : 0;
+ }
- plugins: {},
-
- _uiHash: function(event) {
- return {
- helper: this.helper,
- position: this.position,
- originalPosition: this.originalPosition,
- offset: this.positionAbs
- };
- }
-
-});
+ // Catch 1 and 2
+ if ( i && i < 3 ) {
+ v = Math.round( v * 100 ) + "%";
+ }
+ return v;
+ } );
-$.extend($.ui.draggable, {
- version: "1.8.21"
-});
+ if ( hsla[ 3 ] === 1 ) {
+ hsla.pop();
+ prefix = "hsl(";
+ }
+ return prefix + hsla.join() + ")";
+ },
+ toHexString: function( includeAlpha ) {
+ var rgba = this._rgba.slice(),
+ alpha = rgba.pop();
-$.ui.plugin.add("draggable", "connectToSortable", {
- start: function(event, ui) {
+ if ( includeAlpha ) {
+ rgba.push( ~~( alpha * 255 ) );
+ }
- var inst = $(this).data("draggable"), o = inst.options,
- uiSortable = $.extend({}, ui, { item: inst.element });
- inst.sortables = [];
- $(o.connectToSortable).each(function() {
- var sortable = $.data(this, 'sortable');
- if (sortable && !sortable.options.disabled) {
- inst.sortables.push({
- instance: sortable,
- shouldRevert: sortable.options.revert
- });
- sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
- sortable._trigger("activate", event, uiSortable);
- }
- });
+ return "#" + jQuery.map( rgba, function( v ) {
+ // Default to 0 when nulls exist
+ v = ( v || 0 ).toString( 16 );
+ return v.length === 1 ? "0" + v : v;
+ } ).join( "" );
},
- stop: function(event, ui) {
+ toString: function() {
+ return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
+ }
+} );
+color.fn.parse.prototype = color.fn;
- //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
- var inst = $(this).data("draggable"),
- uiSortable = $.extend({}, ui, { item: inst.element });
+// Hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
- $.each(inst.sortables, function() {
- if(this.instance.isOver) {
+function hue2rgb( p, q, h ) {
+ h = ( h + 1 ) % 1;
+ if ( h * 6 < 1 ) {
+ return p + ( q - p ) * h * 6;
+ }
+ if ( h * 2 < 1 ) {
+ return q;
+ }
+ if ( h * 3 < 2 ) {
+ return p + ( q - p ) * ( ( 2 / 3 ) - h ) * 6;
+ }
+ return p;
+}
- this.instance.isOver = 0;
+spaces.hsla.to = function( rgba ) {
+ if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) {
+ return [ null, null, null, rgba[ 3 ] ];
+ }
+ var r = rgba[ 0 ] / 255,
+ g = rgba[ 1 ] / 255,
+ b = rgba[ 2 ] / 255,
+ a = rgba[ 3 ],
+ max = Math.max( r, g, b ),
+ min = Math.min( r, g, b ),
+ diff = max - min,
+ add = max + min,
+ l = add * 0.5,
+ h, s;
+
+ if ( min === max ) {
+ h = 0;
+ } else if ( r === max ) {
+ h = ( 60 * ( g - b ) / diff ) + 360;
+ } else if ( g === max ) {
+ h = ( 60 * ( b - r ) / diff ) + 120;
+ } else {
+ h = ( 60 * ( r - g ) / diff ) + 240;
+ }
- inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
- this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+ // Chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
+ // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
+ if ( diff === 0 ) {
+ s = 0;
+ } else if ( l <= 0.5 ) {
+ s = diff / add;
+ } else {
+ s = diff / ( 2 - add );
+ }
+ return [ Math.round( h ) % 360, s, l, a == null ? 1 : a ];
+};
- //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
- if(this.shouldRevert) this.instance.options.revert = true;
+spaces.hsla.from = function( hsla ) {
+ if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) {
+ return [ null, null, null, hsla[ 3 ] ];
+ }
+ var h = hsla[ 0 ] / 360,
+ s = hsla[ 1 ],
+ l = hsla[ 2 ],
+ a = hsla[ 3 ],
+ q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+ p = 2 * l - q;
+
+ return [
+ Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
+ Math.round( hue2rgb( p, q, h ) * 255 ),
+ Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
+ a
+ ];
+};
- //Trigger the stop of the sortable
- this.instance._mouseStop(event);
+each( spaces, function( spaceName, space ) {
+ var props = space.props,
+ cache = space.cache,
+ to = space.to,
+ from = space.from;
- this.instance.options.helper = this.instance.options._helper;
+ // Makes rgba() and hsla()
+ color.fn[ spaceName ] = function( value ) {
- //If the helper has been the original item, restore properties in the sortable
- if(inst.options.helper == 'original')
- this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+ // Generate a cache for this space if it doesn't exist
+ if ( to && !this[ cache ] ) {
+ this[ cache ] = to( this._rgba );
+ }
+ if ( value === undefined ) {
+ return this[ cache ].slice();
+ }
- } else {
- this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
- this.instance._trigger("deactivate", event, uiSortable);
+ var ret,
+ type = jQuery.type( value ),
+ arr = ( type === "array" || type === "object" ) ? value : arguments,
+ local = this[ cache ].slice();
+
+ each( props, function( key, prop ) {
+ var val = arr[ type === "object" ? key : prop.idx ];
+ if ( val == null ) {
+ val = local[ prop.idx ];
}
+ local[ prop.idx ] = clamp( val, prop );
+ } );
- });
+ if ( from ) {
+ ret = color( from( local ) );
+ ret[ cache ] = local;
+ return ret;
+ } else {
+ return color( local );
+ }
+ };
- },
- drag: function(event, ui) {
+ // Makes red() green() blue() alpha() hue() saturation() lightness()
+ each( props, function( key, prop ) {
- var inst = $(this).data("draggable"), self = this;
+ // Alpha is included in more than one space
+ if ( color.fn[ key ] ) {
+ return;
+ }
+ color.fn[ key ] = function( value ) {
+ var vtype = jQuery.type( value ),
+ fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+ local = this[ fn ](),
+ cur = local[ prop.idx ],
+ match;
- var checkPos = function(o) {
- var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
- var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
- var itemHeight = o.height, itemWidth = o.width;
- var itemTop = o.top, itemLeft = o.left;
+ if ( vtype === "undefined" ) {
+ return cur;
+ }
- return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ if ( vtype === "function" ) {
+ value = value.call( this, cur );
+ vtype = jQuery.type( value );
+ }
+ if ( value == null && prop.empty ) {
+ return this;
+ }
+ if ( vtype === "string" ) {
+ match = rplusequals.exec( value );
+ if ( match ) {
+ value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
+ }
+ }
+ local[ prop.idx ] = value;
+ return this[ fn ]( local );
};
+ } );
+} );
+
+// Add cssHook and .fx.step function for each named hook.
+// accept a space separated string of properties
+color.hook = function( hook ) {
+ var hooks = hook.split( " " );
+ each( hooks, function( i, hook ) {
+ jQuery.cssHooks[ hook ] = {
+ set: function( elem, value ) {
+ var parsed, curElem,
+ backgroundColor = "";
+
+ if ( value !== "transparent" && ( jQuery.type( value ) !== "string" ||
+ ( parsed = stringParse( value ) ) ) ) {
+ value = color( parsed || value );
+ if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
+ curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+ while (
+ ( backgroundColor === "" || backgroundColor === "transparent" ) &&
+ curElem && curElem.style
+ ) {
+ try {
+ backgroundColor = jQuery.css( curElem, "backgroundColor" );
+ curElem = curElem.parentNode;
+ } catch ( e ) {
+ }
+ }
- $.each(inst.sortables, function(i) {
-
- //Copy over some variables to allow calling the sortable's native _intersectsWith
- this.instance.positionAbs = inst.positionAbs;
- this.instance.helperProportions = inst.helperProportions;
- this.instance.offset.click = inst.offset.click;
-
- if(this.instance._intersectsWith(this.instance.containerCache)) {
-
- //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
- if(!this.instance.isOver) {
-
- this.instance.isOver = 1;
- //Now we fake the start of dragging for the sortable instance,
- //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
- //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
- this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
- this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
- this.instance.options.helper = function() { return ui.helper[0]; };
-
- event.target = this.instance.currentItem[0];
- this.instance._mouseCapture(event, true);
- this.instance._mouseStart(event, true, true);
-
- //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
- this.instance.offset.click.top = inst.offset.click.top;
- this.instance.offset.click.left = inst.offset.click.left;
- this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
- this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+ value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
+ backgroundColor :
+ "_default" );
+ }
- inst._trigger("toSortable", event);
- inst.dropped = this.instance.element; //draggable revert needs that
- //hack so receive/update callbacks work (mostly)
- inst.currentItem = inst.element;
- this.instance.fromOutside = inst;
+ value = value.toRgbaString();
+ }
+ try {
+ elem.style[ hook ] = value;
+ } catch ( e ) {
+ // Wrapped to prevent IE from throwing errors on "invalid" values like
+ // 'auto' or 'inherit'
}
+ }
+ };
+ jQuery.fx.step[ hook ] = function( fx ) {
+ if ( !fx.colorInit ) {
+ fx.start = color( fx.elem, hook );
+ fx.end = color( fx.end );
+ fx.colorInit = true;
+ }
+ jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
+ };
+ } );
- //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
- if(this.instance.currentItem) this.instance._mouseDrag(event);
+};
- } else {
+color.hook( stepHooks );
- //If it doesn't intersect with the sortable, and it intersected before,
- //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
- if(this.instance.isOver) {
+jQuery.cssHooks.borderColor = {
+ expand: function( value ) {
+ var expanded = {};
- this.instance.isOver = 0;
- this.instance.cancelHelperRemoval = true;
-
- //Prevent reverting on this forced stop
- this.instance.options.revert = false;
-
- // The out event needs to be triggered independently
- this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-
- this.instance._mouseStop(event, true);
- this.instance.options.helper = this.instance.options._helper;
+ each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
+ expanded[ "border" + part + "Color" ] = value;
+ } );
+ return expanded;
+ }
+};
- //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
- this.instance.currentItem.remove();
- if(this.instance.placeholder) this.instance.placeholder.remove();
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+colors = jQuery.Color.names = {
+
+ // 4.1. Basic color keywords
+ aqua: "#00ffff",
+ black: "#000000",
+ blue: "#0000ff",
+ fuchsia: "#ff00ff",
+ gray: "#808080",
+ green: "#008000",
+ lime: "#00ff00",
+ maroon: "#800000",
+ navy: "#000080",
+ olive: "#808000",
+ purple: "#800080",
+ red: "#ff0000",
+ silver: "#c0c0c0",
+ teal: "#008080",
+ white: "#ffffff",
+ yellow: "#ffff00",
+
+ // 4.2.3. "transparent" color keyword
+ transparent: [ null, null, null, 0 ],
+
+ _default: "#ffffff"
+};
- inst._trigger("fromSortable", event);
- inst.dropped = false; //draggable revert needs that
- }
+} )( jQuery );
- };
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+( function() {
- });
+var classAnimationActions = [ "add", "remove", "toggle" ],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+$.each(
+ [ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ],
+ function( _, prop ) {
+ $.fx.step[ prop ] = function( fx ) {
+ if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) {
+ jQuery.style( fx.elem, prop, fx.end );
+ fx.setAttr = true;
+ }
+ };
}
-});
+);
+
+function getElementStyles( elem ) {
+ var key, len,
+ style = elem.ownerDocument.defaultView ?
+ elem.ownerDocument.defaultView.getComputedStyle( elem, null ) :
+ elem.currentStyle,
+ styles = {};
+
+ if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
+ len = style.length;
+ while ( len-- ) {
+ key = style[ len ];
+ if ( typeof style[ key ] === "string" ) {
+ styles[ $.camelCase( key ) ] = style[ key ];
+ }
+ }
-$.ui.plugin.add("draggable", "cursor", {
- start: function(event, ui) {
- var t = $('body'), o = $(this).data('draggable').options;
- if (t.css("cursor")) o._cursor = t.css("cursor");
- t.css("cursor", o.cursor);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if (o._cursor) $('body').css("cursor", o._cursor);
+ // Support: Opera, IE <9
+ } else {
+ for ( key in style ) {
+ if ( typeof style[ key ] === "string" ) {
+ styles[ key ] = style[ key ];
+ }
+ }
}
-});
-$.ui.plugin.add("draggable", "opacity", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data('draggable').options;
- if(t.css("opacity")) o._opacity = t.css("opacity");
- t.css('opacity', o.opacity);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ return styles;
+}
+
+function styleDifference( oldStyle, newStyle ) {
+ var diff = {},
+ name, value;
+
+ for ( name in newStyle ) {
+ value = newStyle[ name ];
+ if ( oldStyle[ name ] !== value ) {
+ if ( !shorthandStyles[ name ] ) {
+ if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) {
+ diff[ name ] = value;
+ }
+ }
+ }
}
-});
-$.ui.plugin.add("draggable", "scroll", {
- start: function(event, ui) {
- var i = $(this).data("draggable");
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
- },
- drag: function(event, ui) {
+ return diff;
+}
- var i = $(this).data("draggable"), o = i.options, scrolled = false;
+// Support: jQuery <1.8
+if ( !$.fn.addBack ) {
+ $.fn.addBack = function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ };
+}
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+$.effects.animateClass = function( value, duration, easing, callback ) {
+ var o = $.speed( duration, easing, callback );
- if(!o.axis || o.axis != 'x') {
- if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
- }
+ return this.queue( function() {
+ var animated = $( this ),
+ baseClass = animated.attr( "class" ) || "",
+ applyClassChange,
+ allAnimations = o.children ? animated.find( "*" ).addBack() : animated;
- if(!o.axis || o.axis != 'y') {
- if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
- }
+ // Map the animated objects to store the original styles.
+ allAnimations = allAnimations.map( function() {
+ var el = $( this );
+ return {
+ el: el,
+ start: getElementStyles( this )
+ };
+ } );
- } else {
+ // Apply class change
+ applyClassChange = function() {
+ $.each( classAnimationActions, function( i, action ) {
+ if ( value[ action ] ) {
+ animated[ action + "Class" ]( value[ action ] );
+ }
+ } );
+ };
+ applyClassChange();
+
+ // Map all animated objects again - calculate new styles and diff
+ allAnimations = allAnimations.map( function() {
+ this.end = getElementStyles( this.el[ 0 ] );
+ this.diff = styleDifference( this.start, this.end );
+ return this;
+ } );
+
+ // Apply original class
+ animated.attr( "class", baseClass );
+
+ // Map all animated objects again - this time collecting a promise
+ allAnimations = allAnimations.map( function() {
+ var styleInfo = this,
+ dfd = $.Deferred(),
+ opts = $.extend( {}, o, {
+ queue: false,
+ complete: function() {
+ dfd.resolve( styleInfo );
+ }
+ } );
- if(!o.axis || o.axis != 'x') {
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
- }
+ this.el.animate( this.diff, opts );
+ return dfd.promise();
+ } );
- if(!o.axis || o.axis != 'y') {
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
- }
+ // Once all animations have completed:
+ $.when.apply( $, allAnimations.get() ).done( function() {
- }
+ // Set the final class
+ applyClassChange();
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(i, event);
+ // For each animated element,
+ // clear all css properties that were animated
+ $.each( arguments, function() {
+ var el = this.el;
+ $.each( this.diff, function( key ) {
+ el.css( key, "" );
+ } );
+ } );
- }
-});
+ // This is guarnteed to be there if you use jQuery.speed()
+ // it also handles dequeuing the next anim...
+ o.complete.call( animated[ 0 ] );
+ } );
+ } );
+};
-$.ui.plugin.add("draggable", "snap", {
- start: function(event, ui) {
+$.fn.extend( {
+ addClass: ( function( orig ) {
+ return function( classNames, speed, easing, callback ) {
+ return speed ?
+ $.effects.animateClass.call( this,
+ { add: classNames }, speed, easing, callback ) :
+ orig.apply( this, arguments );
+ };
+ } )( $.fn.addClass ),
+
+ removeClass: ( function( orig ) {
+ return function( classNames, speed, easing, callback ) {
+ return arguments.length > 1 ?
+ $.effects.animateClass.call( this,
+ { remove: classNames }, speed, easing, callback ) :
+ orig.apply( this, arguments );
+ };
+ } )( $.fn.removeClass ),
- var i = $(this).data("draggable"), o = i.options;
- i.snapElements = [];
+ toggleClass: ( function( orig ) {
+ return function( classNames, force, speed, easing, callback ) {
+ if ( typeof force === "boolean" || force === undefined ) {
+ if ( !speed ) {
+
+ // Without speed parameter
+ return orig.apply( this, arguments );
+ } else {
+ return $.effects.animateClass.call( this,
+ ( force ? { add: classNames } : { remove: classNames } ),
+ speed, easing, callback );
+ }
+ } else {
- $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
- var $t = $(this); var $o = $t.offset();
- if(this != i.element[0]) i.snapElements.push({
- item: this,
- width: $t.outerWidth(), height: $t.outerHeight(),
- top: $o.top, left: $o.left
- });
- });
+ // Without force parameter
+ return $.effects.animateClass.call( this,
+ { toggle: classNames }, force, speed, easing );
+ }
+ };
+ } )( $.fn.toggleClass ),
- },
- drag: function(event, ui) {
+ switchClass: function( remove, add, speed, easing, callback ) {
+ return $.effects.animateClass.call( this, {
+ add: add,
+ remove: remove
+ }, speed, easing, callback );
+ }
+} );
- var inst = $(this).data("draggable"), o = inst.options;
- var d = o.snapTolerance;
+} )();
- var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
- y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
- for (var i = inst.snapElements.length - 1; i >= 0; i--){
+( function() {
- var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
- t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+if ( $.expr && $.expr.filters && $.expr.filters.animated ) {
+ $.expr.filters.animated = ( function( orig ) {
+ return function( elem ) {
+ return !!$( elem ).data( dataSpaceAnimated ) || orig( elem );
+ };
+ } )( $.expr.filters.animated );
+}
- //Yes, I know, this is insane ;)
- if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
- if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = false;
- continue;
- }
+if ( $.uiBackCompat !== false ) {
+ $.extend( $.effects, {
- if(o.snapMode != 'inner') {
- var ts = Math.abs(t - y2) <= d;
- var bs = Math.abs(b - y1) <= d;
- var ls = Math.abs(l - x2) <= d;
- var rs = Math.abs(r - x1) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ // Saves a set of properties in a data storage
+ save: function( element, set ) {
+ var i = 0, length = set.length;
+ for ( ; i < length; i++ ) {
+ if ( set[ i ] !== null ) {
+ element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
+ }
}
+ },
- var first = (ts || bs || ls || rs);
+ // Restores a set of previously saved properties from a data storage
+ restore: function( element, set ) {
+ var val, i = 0, length = set.length;
+ for ( ; i < length; i++ ) {
+ if ( set[ i ] !== null ) {
+ val = element.data( dataSpace + set[ i ] );
+ element.css( set[ i ], val );
+ }
+ }
+ },
- if(o.snapMode != 'outer') {
- var ts = Math.abs(t - y1) <= d;
- var bs = Math.abs(b - y2) <= d;
- var ls = Math.abs(l - x1) <= d;
- var rs = Math.abs(r - x2) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ setMode: function( el, mode ) {
+ if ( mode === "toggle" ) {
+ mode = el.is( ":hidden" ) ? "show" : "hide";
}
+ return mode;
+ },
- if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
- (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function( element ) {
- };
+ // If the element is already wrapped, return it
+ if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+ return element.parent();
+ }
- }
-});
+ // Wrap the element
+ var props = {
+ width: element.outerWidth( true ),
+ height: element.outerHeight( true ),
+ "float": element.css( "float" )
+ },
+ wrapper = $( "<div></div>" )
+ .addClass( "ui-effects-wrapper" )
+ .css( {
+ fontSize: "100%",
+ background: "transparent",
+ border: "none",
+ margin: 0,
+ padding: 0
+ } ),
+
+ // Store the size in case width/height are defined in % - Fixes #5245
+ size = {
+ width: element.width(),
+ height: element.height()
+ },
+ active = document.activeElement;
-$.ui.plugin.add("draggable", "stack", {
- start: function(event, ui) {
+ // Support: Firefox
+ // Firefox incorrectly exposes anonymous content
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+ try {
+ active.id;
+ } catch ( e ) {
+ active = document.body;
+ }
- var o = $(this).data("draggable").options;
+ element.wrap( wrapper );
- var group = $.makeArray($(o.stack)).sort(function(a,b) {
- return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
- });
- if (!group.length) { return; }
-
- var min = parseInt(group[0].style.zIndex) || 0;
- $(group).each(function(i) {
- this.style.zIndex = min + i;
- });
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).trigger( "focus" );
+ }
- this[0].style.zIndex = min + group.length;
+ // Hotfix for jQuery 1.4 since some change in wrap() seems to actually
+ // lose the reference to the wrapped element
+ wrapper = element.parent();
- }
-});
+ // Transfer positioning properties to the wrapper
+ if ( element.css( "position" ) === "static" ) {
+ wrapper.css( { position: "relative" } );
+ element.css( { position: "relative" } );
+ } else {
+ $.extend( props, {
+ position: element.css( "position" ),
+ zIndex: element.css( "z-index" )
+ } );
+ $.each( [ "top", "left", "bottom", "right" ], function( i, pos ) {
+ props[ pos ] = element.css( pos );
+ if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
+ props[ pos ] = "auto";
+ }
+ } );
+ element.css( {
+ position: "relative",
+ top: 0,
+ left: 0,
+ right: "auto",
+ bottom: "auto"
+ } );
+ }
+ element.css( size );
-$.ui.plugin.add("draggable", "zIndex", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data("draggable").options;
- if(t.css("zIndex")) o._zIndex = t.css("zIndex");
- t.css('zIndex', o.zIndex);
- },
- stop: function(event, ui) {
- var o = $(this).data("draggable").options;
- if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
- }
-});
+ return wrapper.css( props ).show();
+ },
-})(jQuery);
-/*!
- * jQuery UI Droppable 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.mouse.js
- * jquery.ui.draggable.js
- */
-(function( $, undefined ) {
+ removeWrapper: function( element ) {
+ var active = document.activeElement;
-$.widget("ui.droppable", {
- widgetEventPrefix: "drop",
- options: {
- accept: '*',
- activeClass: false,
- addClasses: true,
- greedy: false,
- hoverClass: false,
- scope: 'default',
- tolerance: 'intersect'
- },
- _create: function() {
+ if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+ element.parent().replaceWith( element );
- var o = this.options, accept = o.accept;
- this.isover = 0; this.isout = 1;
+ // Fixes #7595 - Elements lose focus when wrapped.
+ if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+ $( active ).trigger( "focus" );
+ }
+ }
- this.accept = $.isFunction(accept) ? accept : function(d) {
- return d.is(accept);
- };
+ return element;
+ }
+ } );
+}
- //Store the droppable's proportions
- this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+$.extend( $.effects, {
+ version: "1.12.1",
- // Add the reference and positions to the manager
- $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
- $.ui.ddmanager.droppables[o.scope].push(this);
+ define: function( name, mode, effect ) {
+ if ( !effect ) {
+ effect = mode;
+ mode = "effect";
+ }
- (o.addClasses && this.element.addClass("ui-droppable"));
+ $.effects.effect[ name ] = effect;
+ $.effects.effect[ name ].mode = mode;
+ return effect;
},
- destroy: function() {
- var drop = $.ui.ddmanager.droppables[this.options.scope];
- for ( var i = 0; i < drop.length; i++ )
- if ( drop[i] == this )
- drop.splice(i, 1);
+ scaledDimensions: function( element, percent, direction ) {
+ if ( percent === 0 ) {
+ return {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ };
+ }
- this.element
- .removeClass("ui-droppable ui-droppable-disabled")
- .removeData("droppable")
- .unbind(".droppable");
+ var x = direction !== "horizontal" ? ( ( percent || 100 ) / 100 ) : 1,
+ y = direction !== "vertical" ? ( ( percent || 100 ) / 100 ) : 1;
- return this;
+ return {
+ height: element.height() * y,
+ width: element.width() * x,
+ outerHeight: element.outerHeight() * y,
+ outerWidth: element.outerWidth() * x
+ };
+
+ },
+
+ clipToBox: function( animation ) {
+ return {
+ width: animation.clip.right - animation.clip.left,
+ height: animation.clip.bottom - animation.clip.top,
+ left: animation.clip.left,
+ top: animation.clip.top
+ };
},
- _setOption: function(key, value) {
+ // Injects recently queued functions to be first in line (after "inprogress")
+ unshift: function( element, queueLength, count ) {
+ var queue = element.queue();
- if(key == 'accept') {
- this.accept = $.isFunction(value) ? value : function(d) {
- return d.is(value);
- };
+ if ( queueLength > 1 ) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queueLength, count ) ) );
}
- $.Widget.prototype._setOption.apply(this, arguments);
+ element.dequeue();
},
- _activate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.addClass(this.options.activeClass);
- (draggable && this._trigger('activate', event, this.ui(draggable)));
+ saveStyle: function( element ) {
+ element.data( dataSpaceStyle, element[ 0 ].style.cssText );
},
- _deactivate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ restoreStyle: function( element ) {
+ element[ 0 ].style.cssText = element.data( dataSpaceStyle ) || "";
+ element.removeData( dataSpaceStyle );
},
- _over: function(event) {
+ mode: function( element, mode ) {
+ var hidden = element.is( ":hidden" );
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
- if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
- this._trigger('over', event, this.ui(draggable));
+ if ( mode === "toggle" ) {
+ mode = hidden ? "show" : "hide";
}
-
+ if ( hidden ? mode === "hide" : mode === "show" ) {
+ mode = "none";
+ }
+ return mode;
},
- _out: function(event) {
+ // Translates a [top,left] array into a baseline value
+ getBaseline: function( origin, original ) {
+ var y, x;
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+ switch ( origin[ 0 ] ) {
+ case "top":
+ y = 0;
+ break;
+ case "middle":
+ y = 0.5;
+ break;
+ case "bottom":
+ y = 1;
+ break;
+ default:
+ y = origin[ 0 ] / original.height;
+ }
- if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('out', event, this.ui(draggable));
+ switch ( origin[ 1 ] ) {
+ case "left":
+ x = 0;
+ break;
+ case "center":
+ x = 0.5;
+ break;
+ case "right":
+ x = 1;
+ break;
+ default:
+ x = origin[ 1 ] / original.width;
}
+ return {
+ x: x,
+ y: y
+ };
},
- _drop: function(event,custom) {
+ // Creates a placeholder element so that the original element can be made absolute
+ createPlaceholder: function( element ) {
+ var placeholder,
+ cssPosition = element.css( "position" ),
+ position = element.position();
- var draggable = custom || $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+ // Lock in margins first to account for form elements, which
+ // will change margin if you explicitly set height
+ // see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
+ // Support: Safari
+ element.css( {
+ marginTop: element.css( "marginTop" ),
+ marginBottom: element.css( "marginBottom" ),
+ marginLeft: element.css( "marginLeft" ),
+ marginRight: element.css( "marginRight" )
+ } )
+ .outerWidth( element.outerWidth() )
+ .outerHeight( element.outerHeight() );
- var childrenIntersection = false;
- this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
- var inst = $.data(this, 'droppable');
- if(
- inst.options.greedy
- && !inst.options.disabled
- && inst.options.scope == draggable.options.scope
- && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
- && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
- ) { childrenIntersection = true; return false; }
- });
- if(childrenIntersection) return false;
+ if ( /^(static|relative)/.test( cssPosition ) ) {
+ cssPosition = "absolute";
- if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('drop', event, this.ui(draggable));
- return this.element;
+ placeholder = $( "<" + element[ 0 ].nodeName + ">" ).insertAfter( element ).css( {
+
+ // Convert inline to inline block to account for inline elements
+ // that turn to inline block based on content (like img)
+ display: /^(inline|ruby)/.test( element.css( "display" ) ) ?
+ "inline-block" :
+ "block",
+ visibility: "hidden",
+
+ // Margins need to be set to account for margin collapse
+ marginTop: element.css( "marginTop" ),
+ marginBottom: element.css( "marginBottom" ),
+ marginLeft: element.css( "marginLeft" ),
+ marginRight: element.css( "marginRight" ),
+ "float": element.css( "float" )
+ } )
+ .outerWidth( element.outerWidth() )
+ .outerHeight( element.outerHeight() )
+ .addClass( "ui-effects-placeholder" );
+
+ element.data( dataSpace + "placeholder", placeholder );
}
- return false;
+ element.css( {
+ position: cssPosition,
+ left: position.left,
+ top: position.top
+ } );
+ return placeholder;
},
- ui: function(c) {
- return {
- draggable: (c.currentItem || c.element),
- helper: c.helper,
- position: c.position,
- offset: c.positionAbs
- };
+ removePlaceholder: function( element ) {
+ var dataKey = dataSpace + "placeholder",
+ placeholder = element.data( dataKey );
+
+ if ( placeholder ) {
+ placeholder.remove();
+ element.removeData( dataKey );
+ }
+ },
+
+ // Removes a placeholder if it exists and restores
+ // properties that were modified during placeholder creation
+ cleanUp: function( element ) {
+ $.effects.restoreStyle( element );
+ $.effects.removePlaceholder( element );
+ },
+
+ setTransition: function( element, list, factor, value ) {
+ value = value || {};
+ $.each( list, function( i, x ) {
+ var unit = element.cssUnit( x );
+ if ( unit[ 0 ] > 0 ) {
+ value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
+ }
+ } );
+ return value;
}
+} );
-});
+// Return an effect options object for the given parameters:
+function _normalizeArguments( effect, options, speed, callback ) {
-$.extend($.ui.droppable, {
- version: "1.8.21"
-});
+ // Allow passing all options as the first parameter
+ if ( $.isPlainObject( effect ) ) {
+ options = effect;
+ effect = effect.effect;
+ }
-$.ui.intersect = function(draggable, droppable, toleranceMode) {
+ // Convert to an object
+ effect = { effect: effect };
- if (!droppable.offset) return false;
+ // Catch (effect, null, ...)
+ if ( options == null ) {
+ options = {};
+ }
- var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
- y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
- var l = droppable.offset.left, r = l + droppable.proportions.width,
- t = droppable.offset.top, b = t + droppable.proportions.height;
+ // Catch (effect, callback)
+ if ( $.isFunction( options ) ) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
- switch (toleranceMode) {
- case 'fit':
- return (l <= x1 && x2 <= r
- && t <= y1 && y2 <= b);
- break;
- case 'intersect':
- return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
- && x2 - (draggable.helperProportions.width / 2) < r // Left Half
- && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
- && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
- break;
- case 'pointer':
- var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
- draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
- isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
- return isOver;
- break;
- case 'touch':
- return (
- (y1 >= t && y1 <= b) || // Top edge touching
- (y2 >= t && y2 <= b) || // Bottom edge touching
- (y1 < t && y2 > b) // Surrounded vertically
- ) && (
- (x1 >= l && x1 <= r) || // Left edge touching
- (x2 >= l && x2 <= r) || // Right edge touching
- (x1 < l && x2 > r) // Surrounded horizontally
- );
- break;
- default:
- return false;
- break;
- }
+ // Catch (effect, speed, ?)
+ if ( typeof options === "number" || $.fx.speeds[ options ] ) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
-};
+ // Catch (effect, options, callback)
+ if ( $.isFunction( speed ) ) {
+ callback = speed;
+ speed = null;
+ }
-/*
- This manager tracks offsets of draggables and droppables
-*/
-$.ui.ddmanager = {
- current: null,
- droppables: { 'default': [] },
- prepareOffsets: function(t, event) {
+ // Add options to effect
+ if ( options ) {
+ $.extend( effect, options );
+ }
- var m = $.ui.ddmanager.droppables[t.options.scope] || [];
- var type = event ? event.type : null; // workaround for #2317
- var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+ speed = speed || options.duration;
+ effect.duration = $.fx.off ? 0 :
+ typeof speed === "number" ? speed :
+ speed in $.fx.speeds ? $.fx.speeds[ speed ] :
+ $.fx.speeds._default;
- droppablesLoop: for (var i = 0; i < m.length; i++) {
+ effect.complete = callback || options.complete;
- if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
- for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
- m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+ return effect;
+}
- if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+function standardAnimationOption( option ) {
- m[i].offset = m[i].element.offset();
- m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+ // Valid standard speeds (nothing, number, named speed)
+ if ( !option || typeof option === "number" || $.fx.speeds[ option ] ) {
+ return true;
+ }
- }
+ // Invalid strings - treat as "normal" speed
+ if ( typeof option === "string" && !$.effects.effect[ option ] ) {
+ return true;
+ }
- },
- drop: function(draggable, event) {
+ // Complete callback
+ if ( $.isFunction( option ) ) {
+ return true;
+ }
- var dropped = false;
- $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+ // Options hash (but not naming an effect)
+ if ( typeof option === "object" && !option.effect ) {
+ return true;
+ }
- if(!this.options) return;
- if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
- dropped = this._drop.call(this, event) || dropped;
+ // Didn't match any standard API
+ return false;
+}
- if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- this.isout = 1; this.isover = 0;
- this._deactivate.call(this, event);
- }
+$.fn.extend( {
+ effect: function( /* effect, options, speed, callback */ ) {
+ var args = _normalizeArguments.apply( this, arguments ),
+ effectMethod = $.effects.effect[ args.effect ],
+ defaultMode = effectMethod.mode,
+ queue = args.queue,
+ queueName = queue || "fx",
+ complete = args.complete,
+ mode = args.mode,
+ modes = [],
+ prefilter = function( next ) {
+ var el = $( this ),
+ normalizedMode = $.effects.mode( el, mode ) || defaultMode;
+
+ // Sentinel for duck-punching the :animated psuedo-selector
+ el.data( dataSpaceAnimated, true );
+
+ // Save effect mode for later use,
+ // we can't just call $.effects.mode again later,
+ // as the .show() below destroys the initial state
+ modes.push( normalizedMode );
+
+ // See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
+ if ( defaultMode && ( normalizedMode === "show" ||
+ ( normalizedMode === defaultMode && normalizedMode === "hide" ) ) ) {
+ el.show();
+ }
- });
- return dropped;
+ if ( !defaultMode || normalizedMode !== "none" ) {
+ $.effects.saveStyle( el );
+ }
- },
- dragStart: function( draggable, event ) {
- //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
- draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
- if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
- });
- },
- drag: function(draggable, event) {
+ if ( $.isFunction( next ) ) {
+ next();
+ }
+ };
+
+ if ( $.fx.off || !effectMethod ) {
- //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
- if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+ // Delegate to the original method (e.g., .show()) if possible
+ if ( mode ) {
+ return this[ mode ]( args.duration, complete );
+ } else {
+ return this.each( function() {
+ if ( complete ) {
+ complete.call( this );
+ }
+ } );
+ }
+ }
- //Run through all droppables and check their positions based on specific tolerance options
- $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+ function run( next ) {
+ var elem = $( this );
- if(this.options.disabled || this.greedyChild || !this.visible) return;
- var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+ function cleanup() {
+ elem.removeData( dataSpaceAnimated );
- var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
- if(!c) return;
+ $.effects.cleanUp( elem );
- var parentInstance;
- if (this.options.greedy) {
- var parent = this.element.parents(':data(droppable):eq(0)');
- if (parent.length) {
- parentInstance = $.data(parent[0], 'droppable');
- parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ if ( args.mode === "hide" ) {
+ elem.hide();
}
+
+ done();
}
- // we just moved into a greedy child
- if (parentInstance && c == 'isover') {
- parentInstance['isover'] = 0;
- parentInstance['isout'] = 1;
- parentInstance._out.call(parentInstance, event);
+ function done() {
+ if ( $.isFunction( complete ) ) {
+ complete.call( elem[ 0 ] );
+ }
+
+ if ( $.isFunction( next ) ) {
+ next();
+ }
}
- this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
- this[c == "isover" ? "_over" : "_out"].call(this, event);
+ // Override mode option on a per element basis,
+ // as toggle can be either show or hide depending on element state
+ args.mode = modes.shift();
+
+ if ( $.uiBackCompat !== false && !defaultMode ) {
+ if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
+
+ // Call the core method to track "olddisplay" properly
+ elem[ mode ]();
+ done();
+ } else {
+ effectMethod.call( elem[ 0 ], args, done );
+ }
+ } else {
+ if ( args.mode === "none" ) {
- // we just moved out of a greedy child
- if (parentInstance && c == 'isout') {
- parentInstance['isout'] = 0;
- parentInstance['isover'] = 1;
- parentInstance._over.call(parentInstance, event);
+ // Call the core method to track "olddisplay" properly
+ elem[ mode ]();
+ done();
+ } else {
+ effectMethod.call( elem[ 0 ], args, cleanup );
+ }
}
- });
+ }
+ // Run prefilter on all elements first to ensure that
+ // any showing or hiding happens before placeholder creation,
+ // which ensures that any layout changes are correctly captured.
+ return queue === false ?
+ this.each( prefilter ).each( run ) :
+ this.queue( queueName, prefilter ).queue( queueName, run );
},
- dragStop: function( draggable, event ) {
- draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
- //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
- if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
- }
-};
-})(jQuery);
-/*!
- * jQuery UI Resizable 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
-
-$.widget("ui.resizable", $.ui.mouse, {
- widgetEventPrefix: "resize",
- options: {
- alsoResize: false,
- animate: false,
- animateDuration: "slow",
- animateEasing: "swing",
- aspectRatio: false,
- autoHide: false,
- containment: false,
- ghost: false,
- grid: false,
- handles: "e,s,se",
- helper: false,
- maxHeight: null,
- maxWidth: null,
- minHeight: 10,
- minWidth: 10,
- zIndex: 1000
- },
- _create: function() {
-
- var self = this, o = this.options;
- this.element.addClass("ui-resizable");
-
- $.extend(this, {
- _aspectRatio: !!(o.aspectRatio),
- aspectRatio: o.aspectRatio,
- originalElement: this.element,
- _proportionallyResizeElements: [],
- _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
- });
-
- //Wrap the element if it cannot hold child nodes
- if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+ show: ( function( orig ) {
+ return function( option ) {
+ if ( standardAnimationOption( option ) ) {
+ return orig.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "show";
+ return this.effect.call( this, args );
+ }
+ };
+ } )( $.fn.show ),
- //Create a wrapper element and set the wrapper to the new current internal element
- this.element.wrap(
- $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
- position: this.element.css('position'),
- width: this.element.outerWidth(),
- height: this.element.outerHeight(),
- top: this.element.css('top'),
- left: this.element.css('left')
- })
- );
+ hide: ( function( orig ) {
+ return function( option ) {
+ if ( standardAnimationOption( option ) ) {
+ return orig.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "hide";
+ return this.effect.call( this, args );
+ }
+ };
+ } )( $.fn.hide ),
- //Overwrite the original this.element
- this.element = this.element.parent().data(
- "resizable", this.element.data('resizable')
- );
+ toggle: ( function( orig ) {
+ return function( option ) {
+ if ( standardAnimationOption( option ) || typeof option === "boolean" ) {
+ return orig.apply( this, arguments );
+ } else {
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "toggle";
+ return this.effect.call( this, args );
+ }
+ };
+ } )( $.fn.toggle ),
- this.elementIsWrapper = true;
+ cssUnit: function( key ) {
+ var style = this.css( key ),
+ val = [];
- //Move margins to the wrapper
- this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
- this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+ $.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
+ if ( style.indexOf( unit ) > 0 ) {
+ val = [ parseFloat( style ), unit ];
+ }
+ } );
+ return val;
+ },
- //Prevent Safari textarea resize
- this.originalResizeStyle = this.originalElement.css('resize');
- this.originalElement.css('resize', 'none');
+ cssClip: function( clipObj ) {
+ if ( clipObj ) {
+ return this.css( "clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " +
+ clipObj.bottom + "px " + clipObj.left + "px)" );
+ }
+ return parseClip( this.css( "clip" ), this );
+ },
- //Push the actual element to our proportionallyResize internal array
- this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+ transfer: function( options, done ) {
+ var element = $( this ),
+ target = $( options.to ),
+ targetFixed = target.css( "position" ) === "fixed",
+ body = $( "body" ),
+ fixTop = targetFixed ? body.scrollTop() : 0,
+ fixLeft = targetFixed ? body.scrollLeft() : 0,
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top - fixTop,
+ left: endPosition.left - fixLeft,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = element.offset(),
+ transfer = $( "<div class='ui-effects-transfer'></div>" )
+ .appendTo( "body" )
+ .addClass( options.className )
+ .css( {
+ top: startPosition.top - fixTop,
+ left: startPosition.left - fixLeft,
+ height: element.innerHeight(),
+ width: element.innerWidth(),
+ position: targetFixed ? "fixed" : "absolute"
+ } )
+ .animate( animation, options.duration, options.easing, function() {
+ transfer.remove();
+ if ( $.isFunction( done ) ) {
+ done();
+ }
+ } );
+ }
+} );
- // avoid IE jump (hard set the margin)
- this.originalElement.css({ margin: this.originalElement.css('margin') });
+function parseClip( str, element ) {
+ var outerWidth = element.outerWidth(),
+ outerHeight = element.outerHeight(),
+ clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
+ values = clipRegex.exec( str ) || [ "", 0, outerWidth, outerHeight, 0 ];
- // fix handlers offset
- this._proportionallyResize();
+ return {
+ top: parseFloat( values[ 1 ] ) || 0,
+ right: values[ 2 ] === "auto" ? outerWidth : parseFloat( values[ 2 ] ),
+ bottom: values[ 3 ] === "auto" ? outerHeight : parseFloat( values[ 3 ] ),
+ left: parseFloat( values[ 4 ] ) || 0
+ };
+}
+$.fx.step.clip = function( fx ) {
+ if ( !fx.clipInit ) {
+ fx.start = $( fx.elem ).cssClip();
+ if ( typeof fx.end === "string" ) {
+ fx.end = parseClip( fx.end, fx.elem );
}
+ fx.clipInit = true;
+ }
- this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
- if(this.handles.constructor == String) {
+ $( fx.elem ).cssClip( {
+ top: fx.pos * ( fx.end.top - fx.start.top ) + fx.start.top,
+ right: fx.pos * ( fx.end.right - fx.start.right ) + fx.start.right,
+ bottom: fx.pos * ( fx.end.bottom - fx.start.bottom ) + fx.start.bottom,
+ left: fx.pos * ( fx.end.left - fx.start.left ) + fx.start.left
+ } );
+};
+
+} )();
- if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
- var n = this.handles.split(","); this.handles = {};
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
- for(var i = 0; i < n.length; i++) {
+( function() {
- var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
- var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
- // Apply zIndex to all handles - see #7960
- axis.css({ zIndex: o.zIndex });
+var baseEasings = {};
- //TODO : What's going on here?
- if ('se' == handle) {
- axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
- };
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+ baseEasings[ name ] = function( p ) {
+ return Math.pow( p, i + 2 );
+ };
+} );
- //Insert into internal handles object and append to element
- this.handles[handle] = '.ui-resizable-'+handle;
- this.element.append(axis);
- }
+$.extend( baseEasings, {
+ Sine: function( p ) {
+ return 1 - Math.cos( p * Math.PI / 2 );
+ },
+ Circ: function( p ) {
+ return 1 - Math.sqrt( 1 - p * p );
+ },
+ Elastic: function( p ) {
+ return p === 0 || p === 1 ? p :
+ -Math.pow( 2, 8 * ( p - 1 ) ) * Math.sin( ( ( p - 1 ) * 80 - 7.5 ) * Math.PI / 15 );
+ },
+ Back: function( p ) {
+ return p * p * ( 3 * p - 2 );
+ },
+ Bounce: function( p ) {
+ var pow2,
+ bounce = 4;
- }
+ while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+ return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
+ }
+} );
- this._renderAxis = function(target) {
+$.each( baseEasings, function( name, easeIn ) {
+ $.easing[ "easeIn" + name ] = easeIn;
+ $.easing[ "easeOut" + name ] = function( p ) {
+ return 1 - easeIn( 1 - p );
+ };
+ $.easing[ "easeInOut" + name ] = function( p ) {
+ return p < 0.5 ?
+ easeIn( p * 2 ) / 2 :
+ 1 - easeIn( p * -2 + 2 ) / 2;
+ };
+} );
- target = target || this.element;
+} )();
- for(var i in this.handles) {
+var effect = $.effects;
- if(this.handles[i].constructor == String)
- this.handles[i] = $(this.handles[i], this.element).show();
- //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
- if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+/*!
+ * jQuery UI Effects Blind 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- var axis = $(this.handles[i], this.element), padWrapper = 0;
+//>>label: Blind Effect
+//>>group: Effects
+//>>description: Blinds the element.
+//>>docs: http://api.jqueryui.com/blind-effect/
+//>>demos: http://jqueryui.com/effect/
- //Checking the correct pad and border
- padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
- //The padding type i have to apply...
- var padPos = [ 'padding',
- /ne|nw|n/.test(i) ? 'Top' :
- /se|sw|s/.test(i) ? 'Bottom' :
- /^e$/.test(i) ? 'Right' : 'Left' ].join("");
- target.css(padPos, padWrapper);
+var effectsEffectBlind = $.effects.define( "blind", "hide", function( options, done ) {
+ var map = {
+ up: [ "bottom", "top" ],
+ vertical: [ "bottom", "top" ],
+ down: [ "top", "bottom" ],
+ left: [ "right", "left" ],
+ horizontal: [ "right", "left" ],
+ right: [ "left", "right" ]
+ },
+ element = $( this ),
+ direction = options.direction || "up",
+ start = element.cssClip(),
+ animate = { clip: $.extend( {}, start ) },
+ placeholder = $.effects.createPlaceholder( element );
- this._proportionallyResize();
+ animate.clip[ map[ direction ][ 0 ] ] = animate.clip[ map[ direction ][ 1 ] ];
- }
+ if ( options.mode === "show" ) {
+ element.cssClip( animate.clip );
+ if ( placeholder ) {
+ placeholder.css( $.effects.clipToBox( animate ) );
+ }
- //TODO: What's that good for? There's not anything to be executed left
- if(!$(this.handles[i]).length)
- continue;
+ animate.clip = start;
+ }
- }
- };
+ if ( placeholder ) {
+ placeholder.animate( $.effects.clipToBox( animate ), options.duration, options.easing );
+ }
- //TODO: make renderAxis a prototype function
- this._renderAxis(this.element);
+ element.animate( animate, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
+} );
- this._handles = $('.ui-resizable-handle', this.element)
- .disableSelection();
- //Matching axis name
- this._handles.mouseover(function() {
- if (!self.resizing) {
- if (this.className)
- var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
- //Axis, default = se
- self.axis = axis && axis[1] ? axis[1] : 'se';
- }
- });
+/*!
+ * jQuery UI Effects Bounce 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //If we want to auto hide the elements
- if (o.autoHide) {
- this._handles.hide();
- $(this.element)
- .addClass("ui-resizable-autohide")
- .hover(function() {
- if (o.disabled) return;
- $(this).removeClass("ui-resizable-autohide");
- self._handles.show();
- },
- function(){
- if (o.disabled) return;
- if (!self.resizing) {
- $(this).addClass("ui-resizable-autohide");
- self._handles.hide();
- }
- });
- }
+//>>label: Bounce Effect
+//>>group: Effects
+//>>description: Bounces an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/bounce-effect/
+//>>demos: http://jqueryui.com/effect/
- //Initialize the mouse interaction
- this._mouseInit();
- },
- destroy: function() {
+var effectsEffectBounce = $.effects.define( "bounce", function( options, done ) {
+ var upAnim, downAnim, refValue,
+ element = $( this ),
- this._mouseDestroy();
+ // Defaults:
+ mode = options.mode,
+ hide = mode === "hide",
+ show = mode === "show",
+ direction = options.direction || "up",
+ distance = options.distance,
+ times = options.times || 5,
- var _destroy = function(exp) {
- $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
- .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
- };
+ // Number of internal animations
+ anims = times * 2 + ( show || hide ? 1 : 0 ),
+ speed = options.duration / anims,
+ easing = options.easing,
- //TODO: Unwrap at same DOM position
- if (this.elementIsWrapper) {
- _destroy(this.element);
- var wrapper = this.element;
- wrapper.after(
- this.originalElement.css({
- position: wrapper.css('position'),
- width: wrapper.outerWidth(),
- height: wrapper.outerHeight(),
- top: wrapper.css('top'),
- left: wrapper.css('left')
- })
- ).remove();
- }
+ // Utility:
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ),
+ i = 0,
- this.originalElement.css('resize', this.originalResizeStyle);
- _destroy(this.originalElement);
+ queuelen = element.queue().length;
- return this;
- },
+ $.effects.createPlaceholder( element );
- _mouseCapture: function(event) {
- var handle = false;
- for (var i in this.handles) {
- if ($(this.handles[i])[0] == event.target) {
- handle = true;
- }
- }
+ refValue = element.css( ref );
- return !this.options.disabled && handle;
- },
+ // Default distance for the BIGGEST bounce is the outer Distance / 3
+ if ( !distance ) {
+ distance = element[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3;
+ }
- _mouseStart: function(event) {
+ if ( show ) {
+ downAnim = { opacity: 1 };
+ downAnim[ ref ] = refValue;
- var o = this.options, iniPos = this.element.position(), el = this.element;
+ // If we are showing, force opacity 0 and set the initial position
+ // then do the "first" animation
+ element
+ .css( "opacity", 0 )
+ .css( ref, motion ? -distance * 2 : distance * 2 )
+ .animate( downAnim, speed, easing );
+ }
- this.resizing = true;
- this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+ // Start at the smallest distance if we are hiding
+ if ( hide ) {
+ distance = distance / Math.pow( 2, times - 1 );
+ }
- // bugfix for http://dev.jquery.com/ticket/1749
- if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
- el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
- }
+ downAnim = {};
+ downAnim[ ref ] = refValue;
- this._renderProxy();
+ // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+ for ( ; i < times; i++ ) {
+ upAnim = {};
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
- var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+ element
+ .animate( upAnim, speed, easing )
+ .animate( downAnim, speed, easing );
- if (o.containment) {
- curleft += $(o.containment).scrollLeft() || 0;
- curtop += $(o.containment).scrollTop() || 0;
- }
+ distance = hide ? distance * 2 : distance / 2;
+ }
- //Store needed variables
- this.offset = this.helper.offset();
- this.position = { left: curleft, top: curtop };
- this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalPosition = { left: curleft, top: curtop };
- this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
- this.originalMousePosition = { left: event.pageX, top: event.pageY };
+ // Last Bounce when Hiding
+ if ( hide ) {
+ upAnim = { opacity: 0 };
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
- //Aspect Ratio
- this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+ element.animate( upAnim, speed, easing );
+ }
- var cursor = $('.ui-resizable-' + this.axis).css('cursor');
- $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+ element.queue( done );
- el.addClass("ui-resizable-resizing");
- this._propagate("start", event);
- return true;
- },
+ $.effects.unshift( element, queuelen, anims + 1 );
+} );
- _mouseDrag: function(event) {
- //Increase performance, avoid regex
- var el = this.helper, o = this.options, props = {},
- self = this, smp = this.originalMousePosition, a = this.axis;
+/*!
+ * jQuery UI Effects Clip 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
- var trigger = this._change[a];
- if (!trigger) return false;
+//>>label: Clip Effect
+//>>group: Effects
+//>>description: Clips the element on and off like an old TV.
+//>>docs: http://api.jqueryui.com/clip-effect/
+//>>demos: http://jqueryui.com/effect/
+
+
+
+var effectsEffectClip = $.effects.define( "clip", "hide", function( options, done ) {
+ var start,
+ animate = {},
+ element = $( this ),
+ direction = options.direction || "vertical",
+ both = direction === "both",
+ horizontal = both || direction === "horizontal",
+ vertical = both || direction === "vertical";
+
+ start = element.cssClip();
+ animate.clip = {
+ top: vertical ? ( start.bottom - start.top ) / 2 : start.top,
+ right: horizontal ? ( start.right - start.left ) / 2 : start.right,
+ bottom: vertical ? ( start.bottom - start.top ) / 2 : start.bottom,
+ left: horizontal ? ( start.right - start.left ) / 2 : start.left
+ };
- // Calculate the attrs that will be change
- var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+ $.effects.createPlaceholder( element );
- // Put this in the mouseDrag handler since the user can start pressing shift while resizing
- this._updateVirtualBoundaries(event.shiftKey);
- if (this._aspectRatio || event.shiftKey)
- data = this._updateRatio(data, event);
+ if ( options.mode === "show" ) {
+ element.cssClip( animate.clip );
+ animate.clip = start;
+ }
- data = this._respectSize(data, event);
+ element.animate( animate, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
- // plugins callbacks need to be called first
- this._propagate("resize", event);
+} );
- el.css({
- top: this.position.top + "px", left: this.position.left + "px",
- width: this.size.width + "px", height: this.size.height + "px"
- });
- if (!this._helper && this._proportionallyResizeElements.length)
- this._proportionallyResize();
+/*!
+ * jQuery UI Effects Drop 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- this._updateCache(data);
+//>>label: Drop Effect
+//>>group: Effects
+//>>description: Moves an element in one direction and hides it at the same time.
+//>>docs: http://api.jqueryui.com/drop-effect/
+//>>demos: http://jqueryui.com/effect/
- // calling the user callback at the end
- this._trigger('resize', event, this.ui());
- return false;
- },
- _mouseStop: function(event) {
+var effectsEffectDrop = $.effects.define( "drop", "hide", function( options, done ) {
- this.resizing = false;
- var o = this.options, self = this;
+ var distance,
+ element = $( this ),
+ mode = options.mode,
+ show = mode === "show",
+ direction = options.direction || "left",
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ) ? "-=" : "+=",
+ oppositeMotion = ( motion === "+=" ) ? "-=" : "+=",
+ animation = {
+ opacity: 0
+ };
- if(this._helper) {
- var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
+ $.effects.createPlaceholder( element );
- var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+ distance = options.distance ||
+ element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ) / 2;
- if (!o.animate)
- this.element.css($.extend(s, { top: top, left: left }));
+ animation[ ref ] = motion + distance;
- self.helper.height(self.size.height);
- self.helper.width(self.size.width);
+ if ( show ) {
+ element.css( animation );
- if (this._helper && !o.animate) this._proportionallyResize();
- }
+ animation[ ref ] = oppositeMotion + distance;
+ animation.opacity = 1;
+ }
- $('body').css('cursor', 'auto');
+ // Animate
+ element.animate( animation, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
+} );
- this.element.removeClass("ui-resizable-resizing");
- this._propagate("stop", event);
+/*!
+ * jQuery UI Effects Explode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- if (this._helper) this.helper.remove();
- return false;
+//>>label: Explode Effect
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/explode-effect/
+//>>demos: http://jqueryui.com/effect/
- },
- _updateVirtualBoundaries: function(forceAspectRatio) {
- var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
- b = {
- minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
- maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
- minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
- maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
- };
+var effectsEffectExplode = $.effects.define( "explode", "hide", function( options, done ) {
- if(this._aspectRatio || forceAspectRatio) {
- // We want to create an enclosing box whose aspect ration is the requested one
- // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
- pMinWidth = b.minHeight * this.aspectRatio;
- pMinHeight = b.minWidth / this.aspectRatio;
- pMaxWidth = b.maxHeight * this.aspectRatio;
- pMaxHeight = b.maxWidth / this.aspectRatio;
+ var i, j, left, top, mx, my,
+ rows = options.pieces ? Math.round( Math.sqrt( options.pieces ) ) : 3,
+ cells = rows,
+ element = $( this ),
+ mode = options.mode,
+ show = mode === "show",
- if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
- if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
- if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
- if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
- }
- this._vBoundaries = b;
- },
+ // Show and then visibility:hidden the element before calculating offset
+ offset = element.show().css( "visibility", "hidden" ).offset(),
- _updateCache: function(data) {
- var o = this.options;
- this.offset = this.helper.offset();
- if (isNumber(data.left)) this.position.left = data.left;
- if (isNumber(data.top)) this.position.top = data.top;
- if (isNumber(data.height)) this.size.height = data.height;
- if (isNumber(data.width)) this.size.width = data.width;
- },
+ // Width and height of a piece
+ width = Math.ceil( element.outerWidth() / cells ),
+ height = Math.ceil( element.outerHeight() / rows ),
+ pieces = [];
- _updateRatio: function(data, event) {
+ // Children animate complete:
+ function childComplete() {
+ pieces.push( this );
+ if ( pieces.length === rows * cells ) {
+ animComplete();
+ }
+ }
- var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+ // Clone the element for each row and cell.
+ for ( i = 0; i < rows; i++ ) { // ===>
+ top = offset.top + i * height;
+ my = i - ( rows - 1 ) / 2;
- if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
- else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
+ for ( j = 0; j < cells; j++ ) { // |||
+ left = offset.left + j * width;
+ mx = j - ( cells - 1 ) / 2;
- if (a == 'sw') {
- data.left = cpos.left + (csize.width - data.width);
- data.top = null;
- }
- if (a == 'nw') {
- data.top = cpos.top + (csize.height - data.height);
- data.left = cpos.left + (csize.width - data.width);
+ // Create a clone of the now hidden main element that will be absolute positioned
+ // within a wrapper div off the -left and -top equal to size of our pieces
+ element
+ .clone()
+ .appendTo( "body" )
+ .wrap( "<div></div>" )
+ .css( {
+ position: "absolute",
+ visibility: "visible",
+ left: -j * width,
+ top: -i * height
+ } )
+
+ // Select the wrapper - make it overflow: hidden and absolute positioned based on
+ // where the original was located +left and +top equal to the size of pieces
+ .parent()
+ .addClass( "ui-effects-explode" )
+ .css( {
+ position: "absolute",
+ overflow: "hidden",
+ width: width,
+ height: height,
+ left: left + ( show ? mx * width : 0 ),
+ top: top + ( show ? my * height : 0 ),
+ opacity: show ? 0 : 1
+ } )
+ .animate( {
+ left: left + ( show ? 0 : mx * width ),
+ top: top + ( show ? 0 : my * height ),
+ opacity: show ? 1 : 0
+ }, options.duration || 500, options.easing, childComplete );
}
+ }
- return data;
- },
+ function animComplete() {
+ element.css( {
+ visibility: "visible"
+ } );
+ $( pieces ).remove();
+ done();
+ }
+} );
- _respectSize: function(data, event) {
- var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
- ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
- isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+/*!
+ * jQuery UI Effects Fade 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- if (isminw) data.width = o.minWidth;
- if (isminh) data.height = o.minHeight;
- if (ismaxw) data.width = o.maxWidth;
- if (ismaxh) data.height = o.maxHeight;
+//>>label: Fade Effect
+//>>group: Effects
+//>>description: Fades the element.
+//>>docs: http://api.jqueryui.com/fade-effect/
+//>>demos: http://jqueryui.com/effect/
- var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
- var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
- if (isminw && cw) data.left = dw - o.minWidth;
- if (ismaxw && cw) data.left = dw - o.maxWidth;
- if (isminh && ch) data.top = dh - o.minHeight;
- if (ismaxh && ch) data.top = dh - o.maxHeight;
- // fixing jump error on top/left - bug #2330
- var isNotwh = !data.width && !data.height;
- if (isNotwh && !data.left && data.top) data.top = null;
- else if (isNotwh && !data.top && data.left) data.left = null;
+var effectsEffectFade = $.effects.define( "fade", "toggle", function( options, done ) {
+ var show = options.mode === "show";
- return data;
- },
+ $( this )
+ .css( "opacity", show ? 0 : 1 )
+ .animate( {
+ opacity: show ? 1 : 0
+ }, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
+} );
- _proportionallyResize: function() {
- var o = this.options;
- if (!this._proportionallyResizeElements.length) return;
- var element = this.helper || this.element;
+/*!
+ * jQuery UI Effects Fold 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+//>>label: Fold Effect
+//>>group: Effects
+//>>description: Folds an element first horizontally and then vertically.
+//>>docs: http://api.jqueryui.com/fold-effect/
+//>>demos: http://jqueryui.com/effect/
- var prel = this._proportionallyResizeElements[i];
- if (!this.borderDif) {
- var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
- p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
- this.borderDif = $.map(b, function(v, i) {
- var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
- return border + padding;
- });
- }
+var effectsEffectFold = $.effects.define( "fold", "hide", function( options, done ) {
- if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
- continue;
+ // Create element
+ var element = $( this ),
+ mode = options.mode,
+ show = mode === "show",
+ hide = mode === "hide",
+ size = options.size || 15,
+ percent = /([0-9]+)%/.exec( size ),
+ horizFirst = !!options.horizFirst,
+ ref = horizFirst ? [ "right", "bottom" ] : [ "bottom", "right" ],
+ duration = options.duration / 2,
- prel.css({
- height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
- width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
- });
+ placeholder = $.effects.createPlaceholder( element ),
- };
+ start = element.cssClip(),
+ animation1 = { clip: $.extend( {}, start ) },
+ animation2 = { clip: $.extend( {}, start ) },
- },
+ distance = [ start[ ref[ 0 ] ], start[ ref[ 1 ] ] ],
- _renderProxy: function() {
+ queuelen = element.queue().length;
- var el = this.element, o = this.options;
- this.elementOffset = el.offset();
+ if ( percent ) {
+ size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ];
+ }
+ animation1.clip[ ref[ 0 ] ] = size;
+ animation2.clip[ ref[ 0 ] ] = size;
+ animation2.clip[ ref[ 1 ] ] = 0;
- if(this._helper) {
+ if ( show ) {
+ element.cssClip( animation2.clip );
+ if ( placeholder ) {
+ placeholder.css( $.effects.clipToBox( animation2 ) );
+ }
- this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+ animation2.clip = start;
+ }
- // fix ie6 offset TODO: This seems broken
- var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
- pxyoffset = ( ie6 ? 2 : -1 );
+ // Animate
+ element
+ .queue( function( next ) {
+ if ( placeholder ) {
+ placeholder
+ .animate( $.effects.clipToBox( animation1 ), duration, options.easing )
+ .animate( $.effects.clipToBox( animation2 ), duration, options.easing );
+ }
- this.helper.addClass(this._helper).css({
- width: this.element.outerWidth() + pxyoffset,
- height: this.element.outerHeight() + pxyoffset,
- position: 'absolute',
- left: this.elementOffset.left - ie6offset +'px',
- top: this.elementOffset.top - ie6offset +'px',
- zIndex: ++o.zIndex //TODO: Don't modify option
- });
+ next();
+ } )
+ .animate( animation1, duration, options.easing )
+ .animate( animation2, duration, options.easing )
+ .queue( done );
- this.helper
- .appendTo("body")
- .disableSelection();
+ $.effects.unshift( element, queuelen, 4 );
+} );
- } else {
- this.helper = this.element;
- }
- },
+/*!
+ * jQuery UI Effects Highlight 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- _change: {
- e: function(event, dx, dy) {
- return { width: this.originalSize.width + dx };
- },
- w: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { left: sp.left + dx, width: cs.width - dx };
- },
- n: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { top: sp.top + dy, height: cs.height - dy };
- },
- s: function(event, dx, dy) {
- return { height: this.originalSize.height + dy };
- },
- se: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- sw: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- },
- ne: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- nw: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- }
- },
+//>>label: Highlight Effect
+//>>group: Effects
+//>>description: Highlights the background of an element in a defined color for a custom duration.
+//>>docs: http://api.jqueryui.com/highlight-effect/
+//>>demos: http://jqueryui.com/effect/
- _propagate: function(n, event) {
- $.ui.plugin.call(this, n, [event, this.ui()]);
- (n != "resize" && this._trigger(n, event, this.ui()));
- },
- plugins: {},
- ui: function() {
- return {
- originalElement: this.originalElement,
- element: this.element,
- helper: this.helper,
- position: this.position,
- size: this.size,
- originalSize: this.originalSize,
- originalPosition: this.originalPosition
+var effectsEffectHighlight = $.effects.define( "highlight", "show", function( options, done ) {
+ var element = $( this ),
+ animation = {
+ backgroundColor: element.css( "backgroundColor" )
};
+
+ if ( options.mode === "hide" ) {
+ animation.opacity = 0;
}
-});
+ $.effects.saveStyle( element );
-$.extend($.ui.resizable, {
- version: "1.8.21"
-});
+ element
+ .css( {
+ backgroundImage: "none",
+ backgroundColor: options.color || "#ffff99"
+ } )
+ .animate( animation, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
+} );
-/*
- * Resizable Extensions
+
+/*!
+ * jQuery UI Effects Size 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
*/
-$.ui.plugin.add("resizable", "alsoResize", {
+//>>label: Size Effect
+//>>group: Effects
+//>>description: Resize an element to a specified width and height.
+//>>docs: http://api.jqueryui.com/size-effect/
+//>>demos: http://jqueryui.com/effect/
- start: function (event, ui) {
- var self = $(this).data("resizable"), o = self.options;
- var _store = function (exp) {
- $(exp).each(function() {
- var el = $(this);
- el.data("resizable-alsoresize", {
- width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
- left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10)
- });
- });
- };
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
- if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
- else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
- }else{
- _store(o.alsoResize);
- }
- },
+var effectsEffectSize = $.effects.define( "size", function( options, done ) {
- resize: function (event, ui) {
- var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+ // Create element
+ var baseline, factor, temp,
+ element = $( this ),
- var delta = {
- height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
- top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
- },
+ // Copy for children
+ cProps = [ "fontSize" ],
+ vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ],
+ hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ],
- _alsoResize = function (exp, c) {
- $(exp).each(function() {
- var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
- css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+ // Set options
+ mode = options.mode,
+ restore = mode !== "effect",
+ scale = options.scale || "both",
+ origin = options.origin || [ "middle", "center" ],
+ position = element.css( "position" ),
+ pos = element.position(),
+ original = $.effects.scaledDimensions( element ),
+ from = options.from || original,
+ to = options.to || $.effects.scaledDimensions( element, 0 );
+
+ $.effects.createPlaceholder( element );
+
+ if ( mode === "show" ) {
+ temp = from;
+ from = to;
+ to = temp;
+ }
- $.each(css, function (i, prop) {
- var sum = (start[prop]||0) + (delta[prop]||0);
- if (sum && sum >= 0)
- style[prop] = sum || null;
- });
+ // Set scaling factor
+ factor = {
+ from: {
+ y: from.height / original.height,
+ x: from.width / original.width
+ },
+ to: {
+ y: to.height / original.height,
+ x: to.width / original.width
+ }
+ };
- el.css(style);
- });
- };
+ // Scale the css box
+ if ( scale === "box" || scale === "both" ) {
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
- $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
- }else{
- _alsoResize(o.alsoResize);
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ from = $.effects.setTransition( element, vProps, factor.from.y, from );
+ to = $.effects.setTransition( element, vProps, factor.to.y, to );
}
- },
- stop: function (event, ui) {
- $(this).removeData("resizable-alsoresize");
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ from = $.effects.setTransition( element, hProps, factor.from.x, from );
+ to = $.effects.setTransition( element, hProps, factor.to.x, to );
+ }
}
-});
-
-$.ui.plugin.add("resizable", "animate", {
- stop: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options;
+ // Scale the content
+ if ( scale === "content" || scale === "both" ) {
- var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ from = $.effects.setTransition( element, cProps, factor.from.y, from );
+ to = $.effects.setTransition( element, cProps, factor.to.y, to );
+ }
+ }
- var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+ // Adjust the position properties based on the provided origin points
+ if ( origin ) {
+ baseline = $.effects.getBaseline( origin, original );
+ from.top = ( original.outerHeight - from.outerHeight ) * baseline.y + pos.top;
+ from.left = ( original.outerWidth - from.outerWidth ) * baseline.x + pos.left;
+ to.top = ( original.outerHeight - to.outerHeight ) * baseline.y + pos.top;
+ to.left = ( original.outerWidth - to.outerWidth ) * baseline.x + pos.left;
+ }
+ element.css( from );
+
+ // Animate the children if desired
+ if ( scale === "content" || scale === "both" ) {
+
+ vProps = vProps.concat( [ "marginTop", "marginBottom" ] ).concat( cProps );
+ hProps = hProps.concat( [ "marginLeft", "marginRight" ] );
+
+ // Only animate children with width attributes specified
+ // TODO: is this right? should we include anything with css width specified as well
+ element.find( "*[width]" ).each( function() {
+ var child = $( this ),
+ childOriginal = $.effects.scaledDimensions( child ),
+ childFrom = {
+ height: childOriginal.height * factor.from.y,
+ width: childOriginal.width * factor.from.x,
+ outerHeight: childOriginal.outerHeight * factor.from.y,
+ outerWidth: childOriginal.outerWidth * factor.from.x
+ },
+ childTo = {
+ height: childOriginal.height * factor.to.y,
+ width: childOriginal.width * factor.to.x,
+ outerHeight: childOriginal.height * factor.to.y,
+ outerWidth: childOriginal.width * factor.to.x
+ };
- self.element.animate(
- $.extend(style, top && left ? { top: top, left: left } : {}), {
- duration: o.animateDuration,
- easing: o.animateEasing,
- step: function() {
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ childFrom = $.effects.setTransition( child, vProps, factor.from.y, childFrom );
+ childTo = $.effects.setTransition( child, vProps, factor.to.y, childTo );
+ }
- var data = {
- width: parseInt(self.element.css('width'), 10),
- height: parseInt(self.element.css('height'), 10),
- top: parseInt(self.element.css('top'), 10),
- left: parseInt(self.element.css('left'), 10)
- };
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ childFrom = $.effects.setTransition( child, hProps, factor.from.x, childFrom );
+ childTo = $.effects.setTransition( child, hProps, factor.to.x, childTo );
+ }
- if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+ if ( restore ) {
+ $.effects.saveStyle( child );
+ }
- // propagating resize, and updating values for each animation step
- self._updateCache(data);
- self._propagate("resize", event);
+ // Animate children
+ child.css( childFrom );
+ child.animate( childTo, options.duration, options.easing, function() {
+ // Restore children
+ if ( restore ) {
+ $.effects.restoreStyle( child );
}
- }
- );
+ } );
+ } );
}
-});
+ // Animate
+ element.animate( to, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
-$.ui.plugin.add("resizable", "containment", {
+ var offset = element.offset();
- start: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, el = self.element;
- var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
- if (!ce) return;
+ if ( to.opacity === 0 ) {
+ element.css( "opacity", from.opacity );
+ }
- self.containerElement = $(ce);
+ if ( !restore ) {
+ element
+ .css( "position", position === "static" ? "relative" : position )
+ .offset( offset );
- if (/document/.test(oc) || oc == document) {
- self.containerOffset = { left: 0, top: 0 };
- self.containerPosition = { left: 0, top: 0 };
+ // Need to save style here so that automatic style restoration
+ // doesn't restore to the original styles from before the animation.
+ $.effects.saveStyle( element );
+ }
- self.parentData = {
- element: $(document), left: 0, top: 0,
- width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
- };
+ done();
}
+ } );
- // i'm a node, so compute top, left, right, bottom
- else {
- var element = $(ce), p = [];
- $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+} );
- self.containerOffset = element.offset();
- self.containerPosition = element.position();
- self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
- var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
- width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
-
- self.parentData = {
- element: ce, left: co.left, top: co.top, width: width, height: height
- };
- }
- },
+/*!
+ * jQuery UI Effects Scale 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options,
- ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
- pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+//>>label: Scale Effect
+//>>group: Effects
+//>>description: Grows or shrinks an element and its content.
+//>>docs: http://api.jqueryui.com/scale-effect/
+//>>demos: http://jqueryui.com/effect/
- if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
- if (cp.left < (self._helper ? co.left : 0)) {
- self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
- if (pRatio) self.size.height = self.size.width / self.aspectRatio;
- self.position.left = o.helper ? co.left : 0;
- }
- if (cp.top < (self._helper ? co.top : 0)) {
- self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
- if (pRatio) self.size.width = self.size.height * self.aspectRatio;
- self.position.top = self._helper ? co.top : 0;
- }
+var effectsEffectScale = $.effects.define( "scale", function( options, done ) {
- self.offset.left = self.parentData.left+self.position.left;
- self.offset.top = self.parentData.top+self.position.top;
+ // Create element
+ var el = $( this ),
+ mode = options.mode,
+ percent = parseInt( options.percent, 10 ) ||
+ ( parseInt( options.percent, 10 ) === 0 ? 0 : ( mode !== "effect" ? 0 : 100 ) ),
- var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
- hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+ newOptions = $.extend( true, {
+ from: $.effects.scaledDimensions( el ),
+ to: $.effects.scaledDimensions( el, percent, options.direction || "both" ),
+ origin: options.origin || [ "middle", "center" ]
+ }, options );
- var isParent = self.containerElement.get(0) == self.element.parent().get(0),
- isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+ // Fade option to support puff
+ if ( options.fade ) {
+ newOptions.from.opacity = 1;
+ newOptions.to.opacity = 0;
+ }
- if(isParent && isOffsetRelative) woset -= self.parentData.left;
+ $.effects.effect.size.call( this, newOptions, done );
+} );
- if (woset + self.size.width >= self.parentData.width) {
- self.size.width = self.parentData.width - woset;
- if (pRatio) self.size.height = self.size.width / self.aspectRatio;
- }
- if (hoset + self.size.height >= self.parentData.height) {
- self.size.height = self.parentData.height - hoset;
- if (pRatio) self.size.width = self.size.height * self.aspectRatio;
- }
- },
+/*!
+ * jQuery UI Effects Puff 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, cp = self.position,
- co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+//>>label: Puff Effect
+//>>group: Effects
+//>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
+//>>docs: http://api.jqueryui.com/puff-effect/
+//>>demos: http://jqueryui.com/effect/
- var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
- if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
- if (self._helper && !o.animate && (/static/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+var effectsEffectPuff = $.effects.define( "puff", "hide", function( options, done ) {
+ var newOptions = $.extend( true, {}, options, {
+ fade: true,
+ percent: parseInt( options.percent, 10 ) || 150
+ } );
- }
-});
+ $.effects.effect.scale.call( this, newOptions, done );
+} );
-$.ui.plugin.add("resizable", "ghost", {
- start: function(event, ui) {
+/*!
+ * jQuery UI Effects Pulsate 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- var self = $(this).data("resizable"), o = self.options, cs = self.size;
+//>>label: Pulsate Effect
+//>>group: Effects
+//>>description: Pulsates an element n times by changing the opacity to zero and back.
+//>>docs: http://api.jqueryui.com/pulsate-effect/
+//>>demos: http://jqueryui.com/effect/
- self.ghost = self.originalElement.clone();
- self.ghost
- .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
- .addClass('ui-resizable-ghost')
- .addClass(typeof o.ghost == 'string' ? o.ghost : '');
- self.ghost.appendTo(self.helper);
- },
+var effectsEffectPulsate = $.effects.define( "pulsate", "show", function( options, done ) {
+ var element = $( this ),
+ mode = options.mode,
+ show = mode === "show",
+ hide = mode === "hide",
+ showhide = show || hide,
- resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
- },
+ // Showing or hiding leaves off the "last" animation
+ anims = ( ( options.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+ duration = options.duration / anims,
+ animateTo = 0,
+ i = 1,
+ queuelen = element.queue().length;
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ if ( show || !element.is( ":visible" ) ) {
+ element.css( "opacity", 0 ).show();
+ animateTo = 1;
}
-});
-
-$.ui.plugin.add("resizable", "grid", {
-
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
- o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
- var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
-
- if (/^(se|s|e)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- }
- else if (/^(ne)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- }
- else if (/^(sw)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.left = op.left - ox;
- }
- else {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- self.position.left = op.left - ox;
- }
+ // Anims - 1 opacity "toggles"
+ for ( ; i < anims; i++ ) {
+ element.animate( { opacity: animateTo }, duration, options.easing );
+ animateTo = 1 - animateTo;
}
-});
+ element.animate( { opacity: animateTo }, duration, options.easing );
-var num = function(v) {
- return parseInt(v, 10) || 0;
-};
+ element.queue( done );
+
+ $.effects.unshift( element, queuelen, anims + 1 );
+} );
-var isNumber = function(value) {
- return !isNaN(parseInt(value, 10));
-};
-})(jQuery);
/*!
- * jQuery UI Selectable 1.8.21
+ * jQuery UI Effects Shake 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
*/
-(function( $, undefined ) {
-$.widget("ui.selectable", $.ui.mouse, {
- options: {
- appendTo: 'body',
- autoRefresh: true,
- distance: 0,
- filter: '*',
- tolerance: 'touch'
- },
- _create: function() {
- var self = this;
+//>>label: Shake Effect
+//>>group: Effects
+//>>description: Shakes an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/shake-effect/
+//>>demos: http://jqueryui.com/effect/
- this.element.addClass("ui-selectable");
- this.dragged = false;
- // cache selectee children based on filter
- var selectees;
- this.refresh = function() {
- selectees = $(self.options.filter, self.element[0]);
- selectees.addClass("ui-selectee");
- selectees.each(function() {
- var $this = $(this);
- var pos = $this.offset();
- $.data(this, "selectable-item", {
- element: this,
- $element: $this,
- left: pos.left,
- top: pos.top,
- right: pos.left + $this.outerWidth(),
- bottom: pos.top + $this.outerHeight(),
- startselected: false,
- selected: $this.hasClass('ui-selected'),
- selecting: $this.hasClass('ui-selecting'),
- unselecting: $this.hasClass('ui-unselecting')
- });
- });
- };
- this.refresh();
+var effectsEffectShake = $.effects.define( "shake", function( options, done ) {
- this.selectees = selectees.addClass("ui-selectee");
+ var i = 1,
+ element = $( this ),
+ direction = options.direction || "left",
+ distance = options.distance || 20,
+ times = options.times || 3,
+ anims = times * 2 + 1,
+ speed = Math.round( options.duration / anims ),
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ positiveMotion = ( direction === "up" || direction === "left" ),
+ animation = {},
+ animation1 = {},
+ animation2 = {},
- this._mouseInit();
+ queuelen = element.queue().length;
- this.helper = $("<div class='ui-selectable-helper'></div>");
- },
+ $.effects.createPlaceholder( element );
- destroy: function() {
- this.selectees
- .removeClass("ui-selectee")
- .removeData("selectable-item");
- this.element
- .removeClass("ui-selectable ui-selectable-disabled")
- .removeData("selectable")
- .unbind(".selectable");
- this._mouseDestroy();
+ // Animation
+ animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance;
+ animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+ animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
- return this;
- },
+ // Animate
+ element.animate( animation, speed, options.easing );
- _mouseStart: function(event) {
- var self = this;
+ // Shakes
+ for ( ; i < times; i++ ) {
+ element
+ .animate( animation1, speed, options.easing )
+ .animate( animation2, speed, options.easing );
+ }
- this.opos = [event.pageX, event.pageY];
+ element
+ .animate( animation1, speed, options.easing )
+ .animate( animation, speed / 2, options.easing )
+ .queue( done );
- if (this.options.disabled)
- return;
+ $.effects.unshift( element, queuelen, anims + 1 );
+} );
- var options = this.options;
- this.selectees = $(options.filter, this.element[0]);
+/*!
+ * jQuery UI Effects Slide 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- this._trigger("start", event);
+//>>label: Slide Effect
+//>>group: Effects
+//>>description: Slides an element in and out of the viewport.
+//>>docs: http://api.jqueryui.com/slide-effect/
+//>>demos: http://jqueryui.com/effect/
- $(options.appendTo).append(this.helper);
- // position helper (lasso)
- this.helper.css({
- "left": event.clientX,
- "top": event.clientY,
- "width": 0,
- "height": 0
- });
- if (options.autoRefresh) {
- this.refresh();
- }
- this.selectees.filter('.ui-selected').each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.startselected = true;
- if (!event.metaKey && !event.ctrlKey) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- });
+var effectsEffectSlide = $.effects.define( "slide", "show", function( options, done ) {
+ var startClip, startRef,
+ element = $( this ),
+ map = {
+ up: [ "bottom", "top" ],
+ down: [ "top", "bottom" ],
+ left: [ "right", "left" ],
+ right: [ "left", "right" ]
+ },
+ mode = options.mode,
+ direction = options.direction || "left",
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ positiveMotion = ( direction === "up" || direction === "left" ),
+ distance = options.distance ||
+ element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ),
+ animation = {};
+
+ $.effects.createPlaceholder( element );
+
+ startClip = element.cssClip();
+ startRef = element.position()[ ref ];
+
+ // Define hide animation
+ animation[ ref ] = ( positiveMotion ? -1 : 1 ) * distance + startRef;
+ animation.clip = element.cssClip();
+ animation.clip[ map[ direction ][ 1 ] ] = animation.clip[ map[ direction ][ 0 ] ];
+
+ // Reverse the animation if we're showing
+ if ( mode === "show" ) {
+ element.cssClip( animation.clip );
+ element.css( ref, animation[ ref ] );
+ animation.clip = startClip;
+ animation[ ref ] = startRef;
+ }
- $(event.target).parents().andSelf().each(function() {
- var selectee = $.data(this, "selectable-item");
- if (selectee) {
- var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
- selectee.$element
- .removeClass(doSelect ? "ui-unselecting" : "ui-selected")
- .addClass(doSelect ? "ui-selecting" : "ui-unselecting");
- selectee.unselecting = !doSelect;
- selectee.selecting = doSelect;
- selectee.selected = doSelect;
- // selectable (UN)SELECTING callback
- if (doSelect) {
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- } else {
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- return false;
- }
- });
+ // Actually animate
+ element.animate( animation, {
+ queue: false,
+ duration: options.duration,
+ easing: options.easing,
+ complete: done
+ } );
+} );
- },
- _mouseDrag: function(event) {
- var self = this;
- this.dragged = true;
+/*!
+ * jQuery UI Effects Transfer 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- if (this.options.disabled)
- return;
+//>>label: Transfer Effect
+//>>group: Effects
+//>>description: Displays a transfer effect from one element to another.
+//>>docs: http://api.jqueryui.com/transfer-effect/
+//>>demos: http://jqueryui.com/effect/
- var options = this.options;
- var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
- if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
- if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
- this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
- this.selectees.each(function() {
- var selectee = $.data(this, "selectable-item");
- //prevent helper from being selected if appendTo: selectable
- if (!selectee || selectee.element == self.element[0])
- return;
- var hit = false;
- if (options.tolerance == 'touch') {
- hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
- } else if (options.tolerance == 'fit') {
- hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
- }
+var effect;
+if ( $.uiBackCompat !== false ) {
+ effect = $.effects.define( "transfer", function( options, done ) {
+ $( this ).transfer( options, done );
+ } );
+}
+var effectsEffectTransfer = effect;
- if (hit) {
- // SELECT
- if (selectee.selected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- }
- if (selectee.unselecting) {
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- }
- if (!selectee.selecting) {
- selectee.$element.addClass('ui-selecting');
- selectee.selecting = true;
- // selectable SELECTING callback
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- }
- } else {
- // UNSELECT
- if (selectee.selecting) {
- if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- selectee.$element.addClass('ui-selected');
- selectee.selected = true;
- } else {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- if (selectee.startselected) {
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- }
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- if (selectee.selected) {
- if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- }
- });
+/*!
+ * jQuery UI Focusable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- return false;
- },
+//>>label: :focusable Selector
+//>>group: Core
+//>>description: Selects elements which can be focused.
+//>>docs: http://api.jqueryui.com/focusable-selector/
- _mouseStop: function(event) {
- var self = this;
- this.dragged = false;
- var options = this.options;
+// Selectors
+$.ui.focusable = function( element, hasTabindex ) {
+ var map, mapName, img, focusableIfVisible, fieldset,
+ nodeName = element.nodeName.toLowerCase();
- $('.ui-unselecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- selectee.startselected = false;
- self._trigger("unselected", event, {
- unselected: selectee.element
- });
- });
- $('.ui-selecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
- selectee.selecting = false;
- selectee.selected = true;
- selectee.startselected = true;
- self._trigger("selected", event, {
- selected: selectee.element
- });
- });
- this._trigger("stop", event);
+ if ( "area" === nodeName ) {
+ map = element.parentNode;
+ mapName = map.name;
+ if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+ return false;
+ }
+ img = $( "img[usemap='#" + mapName + "']" );
+ return img.length > 0 && img.is( ":visible" );
+ }
- this.helper.remove();
+ if ( /^(input|select|textarea|button|object)$/.test( nodeName ) ) {
+ focusableIfVisible = !element.disabled;
- return false;
+ if ( focusableIfVisible ) {
+
+ // Form controls within a disabled fieldset are disabled.
+ // However, controls within the fieldset's legend do not get disabled.
+ // Since controls generally aren't placed inside legends, we skip
+ // this portion of the check.
+ fieldset = $( element ).closest( "fieldset" )[ 0 ];
+ if ( fieldset ) {
+ focusableIfVisible = !fieldset.disabled;
+ }
+ }
+ } else if ( "a" === nodeName ) {
+ focusableIfVisible = element.href || hasTabindex;
+ } else {
+ focusableIfVisible = hasTabindex;
}
-});
+ return focusableIfVisible && $( element ).is( ":visible" ) && visible( $( element ) );
+};
+
+// Support: IE 8 only
+// IE 8 doesn't resolve inherit to visible/hidden for computed values
+function visible( element ) {
+ var visibility = element.css( "visibility" );
+ while ( visibility === "inherit" ) {
+ element = element.parent();
+ visibility = element.css( "visibility" );
+ }
+ return visibility !== "hidden";
+}
+
+$.extend( $.expr[ ":" ], {
+ focusable: function( element ) {
+ return $.ui.focusable( element, $.attr( element, "tabindex" ) != null );
+ }
+} );
+
+var focusable = $.ui.focusable;
+
+
+
+
+// Support: IE8 Only
+// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
+// with a string, so we need to find the proper form.
+var form = $.fn.form = function() {
+ return typeof this[ 0 ].form === "string" ? this.closest( "form" ) : $( this[ 0 ].form );
+};
-$.extend($.ui.selectable, {
- version: "1.8.21"
-});
-})(jQuery);
/*!
- * jQuery UI Sortable 1.8.21
+ * jQuery UI Form Reset Mixin 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
*/
-(function( $, undefined ) {
-
-$.widget("ui.sortable", $.ui.mouse, {
- widgetEventPrefix: "sort",
- ready: false,
- options: {
- appendTo: "parent",
- axis: false,
- connectWith: false,
- containment: false,
- cursor: 'auto',
- cursorAt: false,
- dropOnEmpty: true,
- forcePlaceholderSize: false,
- forceHelperSize: false,
- grid: false,
- handle: false,
- helper: "original",
- items: '> *',
- opacity: false,
- placeholder: false,
- revert: false,
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- scope: "default",
- tolerance: "intersect",
- zIndex: 1000
- },
- _create: function() {
-
- var o = this.options;
- this.containerCache = {};
- this.element.addClass("ui-sortable");
- //Get the items
- this.refresh();
+//>>label: Form Reset Mixin
+//>>group: Core
+//>>description: Refresh input widgets when their form is reset
+//>>docs: http://api.jqueryui.com/form-reset-mixin/
- //Let's determine if the items are being displayed horizontally
- this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false;
- //Let's determine the parent's offset
- this.offset = this.element.offset();
- //Initialize mouse events for interaction
- this._mouseInit();
-
- //We're ready to go
- this.ready = true
+var formResetMixin = $.ui.formResetMixin = {
+ _formResetHandler: function() {
+ var form = $( this );
+ // Wait for the form reset to actually happen before refreshing
+ setTimeout( function() {
+ var instances = form.data( "ui-form-reset-instances" );
+ $.each( instances, function() {
+ this.refresh();
+ } );
+ } );
},
- destroy: function() {
- $.Widget.prototype.destroy.call( this );
- this.element
- .removeClass("ui-sortable ui-sortable-disabled");
- this._mouseDestroy();
-
- for ( var i = this.items.length - 1; i >= 0; i-- )
- this.items[i].item.removeData(this.widgetName + "-item");
+ _bindFormResetHandler: function() {
+ this.form = this.element.form();
+ if ( !this.form.length ) {
+ return;
+ }
- return this;
- },
+ var instances = this.form.data( "ui-form-reset-instances" ) || [];
+ if ( !instances.length ) {
- _setOption: function(key, value){
- if ( key === "disabled" ) {
- this.options[ key ] = value;
-
- this.widget()
- [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
- } else {
- // Don't call widget base _setOption for disable as it adds ui-state-disabled class
- $.Widget.prototype._setOption.apply(this, arguments);
+ // We don't use _on() here because we use a single event handler per form
+ this.form.on( "reset.ui-form-reset", this._formResetHandler );
}
+ instances.push( this );
+ this.form.data( "ui-form-reset-instances", instances );
},
- _mouseCapture: function(event, overrideHandle) {
- var that = this;
-
- if (this.reverting) {
- return false;
+ _unbindFormResetHandler: function() {
+ if ( !this.form.length ) {
+ return;
}
- if(this.options.disabled || this.options.type == 'static') return false;
+ var instances = this.form.data( "ui-form-reset-instances" );
+ instances.splice( $.inArray( this, instances ), 1 );
+ if ( instances.length ) {
+ this.form.data( "ui-form-reset-instances", instances );
+ } else {
+ this.form
+ .removeData( "ui-form-reset-instances" )
+ .off( "reset.ui-form-reset" );
+ }
+ }
+};
- //We have to refresh the items data once first
- this._refreshItems(event);
- //Find out if the clicked node (or one of its parents) is a actual item in this.items
- var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
- if($.data(this, that.widgetName + '-item') == self) {
- currentItem = $(this);
- return false;
- }
- });
- if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target);
+/*!
+ * jQuery UI Support for jQuery core 1.7.x 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ */
- if(!currentItem) return false;
- if(this.options.handle && !overrideHandle) {
- var validHandle = false;
+//>>label: jQuery 1.7 Support
+//>>group: Core
+//>>description: Support version 1.7.x of jQuery core
+
+
+
+// Support: jQuery 1.7 only
+// Not a great way to check versions, but since we only support 1.7+ and only
+// need to detect <1.8, this is a simple check that should suffice. Checking
+// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
+// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
+// 1.7 anymore). See #11197 for why we're not using feature detection.
+if ( $.fn.jquery.substring( 0, 3 ) === "1.7" ) {
+
+ // Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
+ // Unlike jQuery Core 1.8+, these only support numeric values to set the
+ // dimensions in pixels
+ $.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
- $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
- if(!validHandle) return false;
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
+ }
+ } );
+ return size;
}
- this.currentItem = currentItem;
- this._removeCurrentsFromItems();
- return true;
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
- },
+ return this.each( function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ } );
+ };
- _mouseStart: function(event, overrideHandle, noActivation) {
+ $.fn[ "outer" + name ] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
- var o = this.options, self = this;
- this.currentContainer = this;
+ return this.each( function() {
+ $( this ).css( type, reduce( this, size, true, margin ) + "px" );
+ } );
+ };
+ } );
- //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
- this.refreshPositions();
+ $.fn.addBack = function( selector ) {
+ return this.add( selector == null ?
+ this.prevObject : this.prevObject.filter( selector )
+ );
+ };
+}
- //Create and append the visible helper
- this.helper = this._createHelper(event);
-
- //Cache the helper size
- this._cacheHelperProportions();
-
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
+;
+/*!
+ * jQuery UI Keycode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //Cache the margins of the original element
- this._cacheMargins();
+//>>label: Keycode
+//>>group: Core
+//>>description: Provide keycodes as keynames
+//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/
+
+
+var keycode = $.ui.keyCode = {
+ BACKSPACE: 8,
+ COMMA: 188,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ LEFT: 37,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+};
- //Get the next scrolling parent
- this.scrollParent = this.helper.scrollParent();
- //The element's absolute position on the page minus margins
- this.offset = this.currentItem.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
- // Only after we got the offset, we can change the helper's position to absolute
- // TODO: Still need to figure out a way to make relative sorting possible
- this.helper.css("position", "absolute");
- this.cssPosition = this.helper.css("position");
-
- //Generate the original position
- this.originalPosition = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
+// Internal use only
+var escapeSelector = $.ui.escapeSelector = ( function() {
+ var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g;
+ return function( selector ) {
+ return selector.replace( selectorEscape, "\\$1" );
+ };
+} )();
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
- //Cache the former DOM position
- this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+/*!
+ * jQuery UI Labels 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
- if(this.helper[0] != this.currentItem[0]) {
- this.currentItem.hide();
- }
+//>>label: labels
+//>>group: Core
+//>>description: Find all the labels associated with a given input
+//>>docs: http://api.jqueryui.com/labels/
- //Create the placeholder
- this._createPlaceholder();
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
- if(o.cursor) { // cursor option
- if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
- $('body').css("cursor", o.cursor);
- }
+var labels = $.fn.labels = function() {
+ var ancestor, selector, id, labels, ancestors;
- if(o.opacity) { // opacity option
- if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
- this.helper.css("opacity", o.opacity);
- }
+ // Check control.labels first
+ if ( this[ 0 ].labels && this[ 0 ].labels.length ) {
+ return this.pushStack( this[ 0 ].labels );
+ }
- if(o.zIndex) { // zIndex option
- if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
- this.helper.css("zIndex", o.zIndex);
- }
+ // Support: IE <= 11, FF <= 37, Android <= 2.3 only
+ // Above browsers do not support control.labels. Everything below is to support them
+ // as well as document fragments. control.labels does not work on document fragments
+ labels = this.eq( 0 ).parents( "label" );
- //Prepare scrolling
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
- this.overflowOffset = this.scrollParent.offset();
+ // Look for the label based on the id
+ id = this.attr( "id" );
+ if ( id ) {
- //Call callbacks
- this._trigger("start", event, this._uiHash());
+ // We don't search against the document in case the element
+ // is disconnected from the DOM
+ ancestor = this.eq( 0 ).parents().last();
- //Recache the helper size
- if(!this._preserveHelperProportions)
- this._cacheHelperProportions();
+ // Get a full set of top level ancestors
+ ancestors = ancestor.add( ancestor.length ? ancestor.siblings() : this.siblings() );
+ // Create a selector for the label based on the id
+ selector = "label[for='" + $.ui.escapeSelector( id ) + "']";
- //Post 'activate' events to possible containers
- if(!noActivation) {
- for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
- }
+ labels = labels.add( ancestors.find( selector ).addBack( selector ) );
- //Prepare possible droppables
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
+ }
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
+ // Return whatever we have found for labels
+ return this.pushStack( labels );
+};
- this.dragging = true;
- this.helper.addClass("ui-sortable-helper");
- this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
- return true;
+/*!
+ * jQuery UI Scroll Parent 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- },
+//>>label: scrollParent
+//>>group: Core
+//>>description: Get the closest ancestor element that is scrollable.
+//>>docs: http://api.jqueryui.com/scrollParent/
- _mouseDrag: function(event) {
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
- if (!this.lastPositionAbs) {
- this.lastPositionAbs = this.positionAbs;
- }
+var scrollParent = $.fn.scrollParent = function( includeHidden ) {
+ var position = this.css( "position" ),
+ excludeStaticParent = position === "absolute",
+ overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
+ scrollParent = this.parents().filter( function() {
+ var parent = $( this );
+ if ( excludeStaticParent && parent.css( "position" ) === "static" ) {
+ return false;
+ }
+ return overflowRegex.test( parent.css( "overflow" ) + parent.css( "overflow-y" ) +
+ parent.css( "overflow-x" ) );
+ } ).eq( 0 );
- //Do scrolling
- if(this.options.scroll) {
- var o = this.options, scrolled = false;
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+ return position === "fixed" || !scrollParent.length ?
+ $( this[ 0 ].ownerDocument || document ) :
+ scrollParent;
+};
- if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
- if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+/*!
+ * jQuery UI Tabbable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- } else {
+//>>label: :tabbable Selector
+//>>group: Core
+//>>description: Selects elements which can be tabbed to.
+//>>docs: http://api.jqueryui.com/tabbable-selector/
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
- }
+var tabbable = $.extend( $.expr[ ":" ], {
+ tabbable: function( element ) {
+ var tabIndex = $.attr( element, "tabindex" ),
+ hasTabindex = tabIndex != null;
+ return ( !hasTabindex || tabIndex >= 0 ) && $.ui.focusable( element, hasTabindex );
+ }
+} );
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
- }
- //Regenerate the absolute position used for position checks
- this.positionAbs = this._convertPositionTo("absolute");
+/*!
+ * jQuery UI Unique ID 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //Set the helper position
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+//>>label: uniqueId
+//>>group: Core
+//>>description: Functions to generate and remove uniqueId's
+//>>docs: http://api.jqueryui.com/uniqueId/
- //Rearrange
- for (var i = this.items.length - 1; i >= 0; i--) {
- //Cache variables and intersection, continue if no intersection
- var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
- if (!intersection) continue;
-
- if(itemElement != this.currentItem[0] //cannot intersect with itself
- && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
- && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
- && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
- //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
- ) {
- this.direction = intersection == 1 ? "down" : "up";
+var uniqueId = $.fn.extend( {
+ uniqueId: ( function() {
+ var uuid = 0;
- if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
- this._rearrange(event, item);
- } else {
- break;
+ return function() {
+ return this.each( function() {
+ if ( !this.id ) {
+ this.id = "ui-id-" + ( ++uuid );
}
+ } );
+ };
+ } )(),
- this._trigger("change", event, this._uiHash());
- break;
+ removeUniqueId: function() {
+ return this.each( function() {
+ if ( /^ui-id-\d+$/.test( this.id ) ) {
+ $( this ).removeAttr( "id" );
}
- }
+ } );
+ }
+} );
- //Post events to containers
- this._contactContainers(event);
- //Interconnect with droppables
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+/*!
+ * jQuery UI Accordion 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //Call callbacks
- this._trigger('sort', event, this._uiHash());
+//>>label: Accordion
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays collapsible content panels for presenting information in a limited amount of space.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/accordion/
+//>>demos: http://jqueryui.com/accordion/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/accordion.css
+//>>css.theme: ../../themes/base/theme.css
- this.lastPositionAbs = this.positionAbs;
- return false;
+
+var widgetsAccordion = $.widget( "ui.accordion", {
+ version: "1.12.1",
+ options: {
+ active: 0,
+ animate: {},
+ classes: {
+ "ui-accordion-header": "ui-corner-top",
+ "ui-accordion-header-collapsed": "ui-corner-all",
+ "ui-accordion-content": "ui-corner-bottom"
+ },
+ collapsible: false,
+ event: "click",
+ header: "> li > :first-child, > :not(li):even",
+ heightStyle: "auto",
+ icons: {
+ activeHeader: "ui-icon-triangle-1-s",
+ header: "ui-icon-triangle-1-e"
+ },
+
+ // Callbacks
+ activate: null,
+ beforeActivate: null
},
- _mouseStop: function(event, noPropagation) {
+ hideProps: {
+ borderTopWidth: "hide",
+ borderBottomWidth: "hide",
+ paddingTop: "hide",
+ paddingBottom: "hide",
+ height: "hide"
+ },
- if(!event) return;
+ showProps: {
+ borderTopWidth: "show",
+ borderBottomWidth: "show",
+ paddingTop: "show",
+ paddingBottom: "show",
+ height: "show"
+ },
- //If we are using droppables, inform the manager about the drop
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- $.ui.ddmanager.drop(this, event);
+ _create: function() {
+ var options = this.options;
- if(this.options.revert) {
- var self = this;
- var cur = self.placeholder.offset();
+ this.prevShow = this.prevHide = $();
+ this._addClass( "ui-accordion", "ui-widget ui-helper-reset" );
+ this.element.attr( "role", "tablist" );
- self.reverting = true;
+ // Don't allow collapsible: false and active: false / null
+ if ( !options.collapsible && ( options.active === false || options.active == null ) ) {
+ options.active = 0;
+ }
- $(this.helper).animate({
- left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
- top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
- }, parseInt(this.options.revert, 10) || 500, function() {
- self._clear(event);
- });
- } else {
- this._clear(event, noPropagation);
+ this._processPanels();
+
+ // handle negative values
+ if ( options.active < 0 ) {
+ options.active += this.headers.length;
}
+ this._refresh();
+ },
- return false;
+ _getCreateEventData: function() {
+ return {
+ header: this.active,
+ panel: !this.active.length ? $() : this.active.next()
+ };
+ },
+
+ _createIcons: function() {
+ var icon, children,
+ icons = this.options.icons;
+ if ( icons ) {
+ icon = $( "<span>" );
+ this._addClass( icon, "ui-accordion-header-icon", "ui-icon " + icons.header );
+ icon.prependTo( this.headers );
+ children = this.active.children( ".ui-accordion-header-icon" );
+ this._removeClass( children, icons.header )
+ ._addClass( children, null, icons.activeHeader )
+ ._addClass( this.headers, "ui-accordion-icons" );
+ }
},
- cancel: function() {
+ _destroyIcons: function() {
+ this._removeClass( this.headers, "ui-accordion-icons" );
+ this.headers.children( ".ui-accordion-header-icon" ).remove();
+ },
- var self = this;
+ _destroy: function() {
+ var contents;
- if(this.dragging) {
+ // Clean up main element
+ this.element.removeAttr( "role" );
- this._mouseUp({ target: null });
+ // Clean up headers
+ this.headers
+ .removeAttr( "role aria-expanded aria-selected aria-controls tabIndex" )
+ .removeUniqueId();
- if(this.options.helper == "original")
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- else
- this.currentItem.show();
+ this._destroyIcons();
- //Post deactivating events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- this.containers[i]._trigger("deactivate", null, self._uiHash(this));
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", null, self._uiHash(this));
- this.containers[i].containerCache.over = 0;
- }
- }
+ // Clean up content panels
+ contents = this.headers.next()
+ .css( "display", "" )
+ .removeAttr( "role aria-hidden aria-labelledby" )
+ .removeUniqueId();
+ if ( this.options.heightStyle !== "content" ) {
+ contents.css( "height", "" );
}
+ },
- if (this.placeholder) {
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
- if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+ _setOption: function( key, value ) {
+ if ( key === "active" ) {
- $.extend(this, {
- helper: null,
- dragging: false,
- reverting: false,
- _noFinalSort: null
- });
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
- if(this.domPosition.prev) {
- $(this.domPosition.prev).after(this.currentItem);
- } else {
- $(this.domPosition.parent).prepend(this.currentItem);
+ if ( key === "event" ) {
+ if ( this.options.event ) {
+ this._off( this.headers, this.options.event );
}
+ this._setupEvents( value );
}
- return this;
+ this._super( key, value );
+
+ // Setting collapsible: false while collapsed; open first panel
+ if ( key === "collapsible" && !value && this.options.active === false ) {
+ this._activate( 0 );
+ }
+ if ( key === "icons" ) {
+ this._destroyIcons();
+ if ( value ) {
+ this._createIcons();
+ }
+ }
},
- serialize: function(o) {
+ _setOptionDisabled: function( value ) {
+ this._super( value );
- var items = this._getItemsAsjQuery(o && o.connected);
- var str = []; o = o || {};
+ this.element.attr( "aria-disabled", value );
- $(items).each(function() {
- var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
- if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
- });
+ // Support: IE8 Only
+ // #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
+ // so we need to add the disabled class to the headers and panels
+ this._toggleClass( null, "ui-state-disabled", !!value );
+ this._toggleClass( this.headers.add( this.headers.next() ), null, "ui-state-disabled",
+ !!value );
+ },
- if(!str.length && o.key) {
- str.push(o.key + '=');
+ _keydown: function( event ) {
+ if ( event.altKey || event.ctrlKey ) {
+ return;
}
- return str.join('&');
-
- },
-
- toArray: function(o) {
+ var keyCode = $.ui.keyCode,
+ length = this.headers.length,
+ currentIndex = this.headers.index( event.target ),
+ toFocus = false;
- var items = this._getItemsAsjQuery(o && o.connected);
- var ret = []; o = o || {};
+ switch ( event.keyCode ) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._eventHandler( event );
+ break;
+ case keyCode.HOME:
+ toFocus = this.headers[ 0 ];
+ break;
+ case keyCode.END:
+ toFocus = this.headers[ length - 1 ];
+ break;
+ }
- items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
- return ret;
+ if ( toFocus ) {
+ $( event.target ).attr( "tabIndex", -1 );
+ $( toFocus ).attr( "tabIndex", 0 );
+ $( toFocus ).trigger( "focus" );
+ event.preventDefault();
+ }
+ },
+ _panelKeyDown: function( event ) {
+ if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
+ $( event.currentTarget ).prev().trigger( "focus" );
+ }
},
- /* Be careful with the following core functions */
- _intersectsWith: function(item) {
+ refresh: function() {
+ var options = this.options;
+ this._processPanels();
- var x1 = this.positionAbs.left,
- x2 = x1 + this.helperProportions.width,
- y1 = this.positionAbs.top,
- y2 = y1 + this.helperProportions.height;
+ // Was collapsed or no panel
+ if ( ( options.active === false && options.collapsible === true ) ||
+ !this.headers.length ) {
+ options.active = false;
+ this.active = $();
- var l = item.left,
- r = l + item.width,
- t = item.top,
- b = t + item.height;
+ // active false only when collapsible is true
+ } else if ( options.active === false ) {
+ this._activate( 0 );
- var dyClick = this.offset.click.top,
- dxClick = this.offset.click.left;
+ // was active, but active panel is gone
+ } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
- var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+ // all remaining panel are disabled
+ if ( this.headers.length === this.headers.find( ".ui-state-disabled" ).length ) {
+ options.active = false;
+ this.active = $();
- if( this.options.tolerance == "pointer"
- || this.options.forcePointerForContainers
- || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
- ) {
- return isOverElement;
- } else {
+ // activate previous panel
+ } else {
+ this._activate( Math.max( 0, options.active - 1 ) );
+ }
- return (l < x1 + (this.helperProportions.width / 2) // Right Half
- && x2 - (this.helperProportions.width / 2) < r // Left Half
- && t < y1 + (this.helperProportions.height / 2) // Bottom Half
- && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+ // was active, active panel still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.headers.index( this.active );
}
- },
- _intersectsWithPointer: function(item) {
+ this._destroyIcons();
- var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
- isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
- isOverElement = isOverElementHeight && isOverElementWidth,
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
+ this._refresh();
+ },
- if (!isOverElement)
- return false;
+ _processPanels: function() {
+ var prevHeaders = this.headers,
+ prevPanels = this.panels;
- return this.floating ?
- ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
- : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+ this.headers = this.element.find( this.options.header );
+ this._addClass( this.headers, "ui-accordion-header ui-accordion-header-collapsed",
+ "ui-state-default" );
+ this.panels = this.headers.next().filter( ":not(.ui-accordion-content-active)" ).hide();
+ this._addClass( this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content" );
+
+ // Avoid memory leaks (#10056)
+ if ( prevPanels ) {
+ this._off( prevHeaders.not( this.headers ) );
+ this._off( prevPanels.not( this.panels ) );
+ }
},
- _intersectsWithSides: function(item) {
+ _refresh: function() {
+ var maxHeight,
+ options = this.options,
+ heightStyle = options.heightStyle,
+ parent = this.element.parent();
- var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
- isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
+ this.active = this._findActive( options.active );
+ this._addClass( this.active, "ui-accordion-header-active", "ui-state-active" )
+ ._removeClass( this.active, "ui-accordion-header-collapsed" );
+ this._addClass( this.active.next(), "ui-accordion-content-active" );
+ this.active.next().show();
+
+ this.headers
+ .attr( "role", "tab" )
+ .each( function() {
+ var header = $( this ),
+ headerId = header.uniqueId().attr( "id" ),
+ panel = header.next(),
+ panelId = panel.uniqueId().attr( "id" );
+ header.attr( "aria-controls", panelId );
+ panel.attr( "aria-labelledby", headerId );
+ } )
+ .next()
+ .attr( "role", "tabpanel" );
- if (this.floating && horizontalDirection) {
- return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ this.headers
+ .not( this.active )
+ .attr( {
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ } )
+ .next()
+ .attr( {
+ "aria-hidden": "true"
+ } )
+ .hide();
+
+ // Make sure at least one header is in the tab order
+ if ( !this.active.length ) {
+ this.headers.eq( 0 ).attr( "tabIndex", 0 );
} else {
- return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ this.active.attr( {
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ } )
+ .next()
+ .attr( {
+ "aria-hidden": "false"
+ } );
}
- },
+ this._createIcons();
- _getDragVerticalDirection: function() {
- var delta = this.positionAbs.top - this.lastPositionAbs.top;
- return delta != 0 && (delta > 0 ? "down" : "up");
- },
+ this._setupEvents( options.event );
- _getDragHorizontalDirection: function() {
- var delta = this.positionAbs.left - this.lastPositionAbs.left;
- return delta != 0 && (delta > 0 ? "right" : "left");
- },
+ if ( heightStyle === "fill" ) {
+ maxHeight = parent.height();
+ this.element.siblings( ":visible" ).each( function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
- refresh: function(event) {
- this._refreshItems(event);
- this.refreshPositions();
- return this;
- },
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
+ } );
- _connectWith: function() {
- var options = this.options;
- return options.connectWith.constructor == String
- ? [options.connectWith]
- : options.connectWith;
- },
-
- _getItemsAsjQuery: function(connected) {
-
- var self = this;
- var items = [];
- var queries = [];
- var connectWith = this._connectWith();
-
- if(connectWith && connected) {
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], this.widgetName);
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ this.headers.each( function() {
+ maxHeight -= $( this ).outerHeight( true );
+ } );
+
+ this.headers.next()
+ .each( function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ } )
+ .css( "overflow", "auto" );
+ } else if ( heightStyle === "auto" ) {
+ maxHeight = 0;
+ this.headers.next()
+ .each( function() {
+ var isVisible = $( this ).is( ":visible" );
+ if ( !isVisible ) {
+ $( this ).show();
}
- };
- };
+ maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
+ if ( !isVisible ) {
+ $( this ).hide();
+ }
+ } )
+ .height( maxHeight );
}
+ },
- queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+ _activate: function( index ) {
+ var active = this._findActive( index )[ 0 ];
- for (var i = queries.length - 1; i >= 0; i--){
- queries[i][0].each(function() {
- items.push(this);
- });
- };
+ // Trying to activate the already active panel
+ if ( active === this.active[ 0 ] ) {
+ return;
+ }
- return $(items);
+ // Trying to collapse, simulate a click on the currently active header
+ active = active || this.active[ 0 ];
+ this._eventHandler( {
+ target: active,
+ currentTarget: active,
+ preventDefault: $.noop
+ } );
},
- _removeCurrentsFromItems: function() {
+ _findActive: function( selector ) {
+ return typeof selector === "number" ? this.headers.eq( selector ) : $();
+ },
- var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
+ _setupEvents: function( event ) {
+ var events = {
+ keydown: "_keydown"
+ };
+ if ( event ) {
+ $.each( event.split( " " ), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ } );
+ }
- for (var i=0; i < this.items.length; i++) {
+ this._off( this.headers.add( this.headers.next() ) );
+ this._on( this.headers, events );
+ this._on( this.headers.next(), { keydown: "_panelKeyDown" } );
+ this._hoverable( this.headers );
+ this._focusable( this.headers );
+ },
- for (var j=0; j < list.length; j++) {
- if(list[j] == this.items[i].item[0])
- this.items.splice(i,1);
+ _eventHandler: function( event ) {
+ var activeChildren, clickedChildren,
+ options = this.options,
+ active = this.active,
+ clicked = $( event.currentTarget ),
+ clickedIsActive = clicked[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : clicked.next(),
+ toHide = active.next(),
+ eventData = {
+ oldHeader: active,
+ oldPanel: toHide,
+ newHeader: collapsing ? $() : clicked,
+ newPanel: toShow
};
- };
+ event.preventDefault();
- },
+ if (
- _refreshItems: function(event) {
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
- this.items = [];
- this.containers = [this];
- var items = this.items;
- var self = this;
- var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
- var connectWith = this._connectWith();
-
- if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], this.widgetName);
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
- this.containers.push(inst);
- }
- };
- };
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+ return;
}
- for (var i = queries.length - 1; i >= 0; i--) {
- var targetData = queries[i][1];
- var _queries = queries[i][0];
+ options.active = collapsing ? false : this.headers.index( clicked );
- for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
- var item = $(_queries[j]);
+ // When the call to ._toggle() comes after the class changes
+ // it causes a very odd bug in IE 8 (see #6720)
+ this.active = clickedIsActive ? $() : clicked;
+ this._toggle( eventData );
- item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager)
+ // Switch classes
+ // corner classes on the previously active header stay after the animation
+ this._removeClass( active, "ui-accordion-header-active", "ui-state-active" );
+ if ( options.icons ) {
+ activeChildren = active.children( ".ui-accordion-header-icon" );
+ this._removeClass( activeChildren, null, options.icons.activeHeader )
+ ._addClass( activeChildren, null, options.icons.header );
+ }
- items.push({
- item: item,
- instance: targetData,
- width: 0, height: 0,
- left: 0, top: 0
- });
- };
- };
+ if ( !clickedIsActive ) {
+ this._removeClass( clicked, "ui-accordion-header-collapsed" )
+ ._addClass( clicked, "ui-accordion-header-active", "ui-state-active" );
+ if ( options.icons ) {
+ clickedChildren = clicked.children( ".ui-accordion-header-icon" );
+ this._removeClass( clickedChildren, null, options.icons.header )
+ ._addClass( clickedChildren, null, options.icons.activeHeader );
+ }
+ this._addClass( clicked.next(), "ui-accordion-content-active" );
+ }
},
- refreshPositions: function(fast) {
+ _toggle: function( data ) {
+ var toShow = data.newPanel,
+ toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
- //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
- if(this.offsetParent && this.helper) {
- this.offset.parent = this._getParentOffset();
- }
+ // Handle activating a panel during the animation for another activation
+ this.prevShow.add( this.prevHide ).stop( true, true );
+ this.prevShow = toShow;
+ this.prevHide = toHide;
+
+ if ( this.options.animate ) {
+ this._animate( toShow, toHide, data );
+ } else {
+ toHide.hide();
+ toShow.show();
+ this._toggleComplete( data );
+ }
+
+ toHide.attr( {
+ "aria-hidden": "true"
+ } );
+ toHide.prev().attr( {
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ } );
+
+ // if we're switching panels, remove the old header from the tab order
+ // if we're opening from collapsed state, remove the previous header from the tab order
+ // if we're collapsing, then keep the collapsing header in the tab order
+ if ( toShow.length && toHide.length ) {
+ toHide.prev().attr( {
+ "tabIndex": -1,
+ "aria-expanded": "false"
+ } );
+ } else if ( toShow.length ) {
+ this.headers.filter( function() {
+ return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0;
+ } )
+ .attr( "tabIndex", -1 );
+ }
+
+ toShow
+ .attr( "aria-hidden", "false" )
+ .prev()
+ .attr( {
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ } );
+ },
- for (var i = this.items.length - 1; i >= 0; i--){
- var item = this.items[i];
+ _animate: function( toShow, toHide, data ) {
+ var total, easing, duration,
+ that = this,
+ adjust = 0,
+ boxSizing = toShow.css( "box-sizing" ),
+ down = toShow.length &&
+ ( !toHide.length || ( toShow.index() < toHide.index() ) ),
+ animate = this.options.animate || {},
+ options = down && animate.down || animate,
+ complete = function() {
+ that._toggleComplete( data );
+ };
- //We ignore calculating positions of all connected containers when we're not over them
- if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
- continue;
+ if ( typeof options === "number" ) {
+ duration = options;
+ }
+ if ( typeof options === "string" ) {
+ easing = options;
+ }
- var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+ // fall back from options to animation in case of partial down settings
+ easing = easing || options.easing || animate.easing;
+ duration = duration || options.duration || animate.duration;
- if (!fast) {
- item.width = t.outerWidth();
- item.height = t.outerHeight();
+ if ( !toHide.length ) {
+ return toShow.animate( this.showProps, duration, easing, complete );
+ }
+ if ( !toShow.length ) {
+ return toHide.animate( this.hideProps, duration, easing, complete );
+ }
+
+ total = toShow.show().outerHeight();
+ toHide.animate( this.hideProps, {
+ duration: duration,
+ easing: easing,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
}
+ } );
+ toShow
+ .hide()
+ .animate( this.showProps, {
+ duration: duration,
+ easing: easing,
+ complete: complete,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
+ if ( fx.prop !== "height" ) {
+ if ( boxSizing === "content-box" ) {
+ adjust += fx.now;
+ }
+ } else if ( that.options.heightStyle !== "content" ) {
+ fx.now = Math.round( total - toHide.outerHeight() - adjust );
+ adjust = 0;
+ }
+ }
+ } );
+ },
- var p = t.offset();
- item.left = p.left;
- item.top = p.top;
- };
+ _toggleComplete: function( data ) {
+ var toHide = data.oldPanel,
+ prev = toHide.prev();
- if(this.options.custom && this.options.custom.refreshContainers) {
- this.options.custom.refreshContainers.call(this);
- } else {
- for (var i = this.containers.length - 1; i >= 0; i--){
- var p = this.containers[i].element.offset();
- this.containers[i].containerCache.left = p.left;
- this.containers[i].containerCache.top = p.top;
- this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
- this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
- };
+ this._removeClass( toHide, "ui-accordion-content-active" );
+ this._removeClass( prev, "ui-accordion-header-active" )
+ ._addClass( prev, "ui-accordion-header-collapsed" );
+
+ // Work around for rendering bug in IE (#5421)
+ if ( toHide.length ) {
+ toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className;
}
+ this._trigger( "activate", null, data );
+ }
+} );
- return this;
- },
- _createPlaceholder: function(that) {
- var self = that || this, o = self.options;
+var safeActiveElement = $.ui.safeActiveElement = function( document ) {
+ var activeElement;
- if(!o.placeholder || o.placeholder.constructor == String) {
- var className = o.placeholder;
- o.placeholder = {
- element: function() {
+ // Support: IE 9 only
+ // IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
+ try {
+ activeElement = document.activeElement;
+ } catch ( error ) {
+ activeElement = document.body;
+ }
- var el = $(document.createElement(self.currentItem[0].nodeName))
- .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
- .removeClass("ui-sortable-helper")[0];
+ // Support: IE 9 - 11 only
+ // IE may return null instead of an element
+ // Interestingly, this only seems to occur when NOT in an iframe
+ if ( !activeElement ) {
+ activeElement = document.body;
+ }
- if(!className)
- el.style.visibility = "hidden";
+ // Support: IE 11 only
+ // IE11 returns a seemingly empty object in some cases when accessing
+ // document.activeElement from an <iframe>
+ if ( !activeElement.nodeName ) {
+ activeElement = document.body;
+ }
- return el;
- },
- update: function(container, p) {
+ return activeElement;
+};
- // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
- // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
- if(className && !o.forcePlaceholderSize) return;
- //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
- if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
- if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
- }
- };
- }
+/*!
+ * jQuery UI Menu 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- //Create the placeholder
- self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+//>>label: Menu
+//>>group: Widgets
+//>>description: Creates nestable menus.
+//>>docs: http://api.jqueryui.com/menu/
+//>>demos: http://jqueryui.com/menu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/menu.css
+//>>css.theme: ../../themes/base/theme.css
- //Append it after the actual current item
- self.currentItem.after(self.placeholder);
- //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
- o.placeholder.update(self, self.placeholder);
+var widgetsMenu = $.widget( "ui.menu", {
+ version: "1.12.1",
+ defaultElement: "<ul>",
+ delay: 300,
+ options: {
+ icons: {
+ submenu: "ui-icon-caret-1-e"
+ },
+ items: "> *",
+ menus: "ul",
+ position: {
+ my: "left top",
+ at: "right top"
+ },
+ role: "menu",
+
+ // Callbacks
+ blur: null,
+ focus: null,
+ select: null
},
- _contactContainers: function(event) {
-
- // get innermost container that intersects with item
- var innermostContainer = null, innermostIndex = null;
-
-
- for (var i = this.containers.length - 1; i >= 0; i--){
+ _create: function() {
+ this.activeMenu = this.element;
- // never consider a container that's located within the item itself
- if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
- continue;
+ // Flag used to prevent firing of the click handler
+ // as the event bubbles up through nested menus
+ this.mouseHandled = false;
+ this.element
+ .uniqueId()
+ .attr( {
+ role: this.options.role,
+ tabIndex: 0
+ } );
- if(this._intersectsWith(this.containers[i].containerCache)) {
+ this._addClass( "ui-menu", "ui-widget ui-widget-content" );
+ this._on( {
- // if we've already found a container and it's more "inner" than this, then continue
- if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
- continue;
+ // Prevent focus from sticking to links inside menu after clicking
+ // them (focus should always stay on UL during navigation).
+ "mousedown .ui-menu-item": function( event ) {
+ event.preventDefault();
+ },
+ "click .ui-menu-item": function( event ) {
+ var target = $( event.target );
+ var active = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+ if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) {
+ this.select( event );
+
+ // Only set the mouseHandled flag if the event will bubble, see #9469.
+ if ( !event.isPropagationStopped() ) {
+ this.mouseHandled = true;
+ }
- innermostContainer = this.containers[i];
- innermostIndex = i;
-
- } else {
- // container doesn't intersect. trigger "out" event if necessary
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", event, this._uiHash(this));
- this.containers[i].containerCache.over = 0;
+ // Open submenu on click
+ if ( target.has( ".ui-menu" ).length ) {
+ this.expand( event );
+ } else if ( !this.element.is( ":focus" ) &&
+ active.closest( ".ui-menu" ).length ) {
+
+ // Redirect focus to the menu
+ this.element.trigger( "focus", [ true ] );
+
+ // If the active item is on the top level, let it stay active.
+ // Otherwise, blur the active item since it is no longer visible.
+ if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) {
+ clearTimeout( this.timer );
+ }
+ }
}
- }
+ },
+ "mouseenter .ui-menu-item": function( event ) {
- }
-
- // if no intersecting containers found, return
- if(!innermostContainer) return;
+ // Ignore mouse events while typeahead is active, see #10458.
+ // Prevents focusing the wrong item when typeahead causes a scroll while the mouse
+ // is over an item in the menu
+ if ( this.previousFilter ) {
+ return;
+ }
- // move the item into the container if it's not there already
- if(this.containers.length === 1) {
- this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
- this.containers[innermostIndex].containerCache.over = 1;
- } else if(this.currentContainer != this.containers[innermostIndex]) {
+ var actualTarget = $( event.target ).closest( ".ui-menu-item" ),
+ target = $( event.currentTarget );
- //When entering a new container, we will find the item with the least distance and append our item near it
- var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
- for (var j = this.items.length - 1; j >= 0; j--) {
- if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
- var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top;
- if(Math.abs(cur - base) < dist) {
- dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
- this.direction = (cur - base > 0) ? 'down' : 'up';
+ // Ignore bubbled events on parent items, see #11641
+ if ( actualTarget[ 0 ] !== target[ 0 ] ) {
+ return;
}
- }
- if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
- return;
+ // Remove ui-state-active class from siblings of the newly focused menu item
+ // to avoid a jump caused by adjacent elements both having a class with a border
+ this._removeClass( target.siblings().children( ".ui-state-active" ),
+ null, "ui-state-active" );
+ this.focus( event, target );
+ },
+ mouseleave: "collapseAll",
+ "mouseleave .ui-menu": "collapseAll",
+ focus: function( event, keepActiveItem ) {
- this.currentContainer = this.containers[innermostIndex];
- itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
- this._trigger("change", event, this._uiHash());
- this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+ // If there's already an active item, keep it active
+ // If not, activate the first item
+ var item = this.active || this.element.find( this.options.items ).eq( 0 );
- //Update the placeholder
- this.options.placeholder.update(this.currentContainer, this.placeholder);
+ if ( !keepActiveItem ) {
+ this.focus( event, item );
+ }
+ },
+ blur: function( event ) {
+ this._delay( function() {
+ var notContained = !$.contains(
+ this.element[ 0 ],
+ $.ui.safeActiveElement( this.document[ 0 ] )
+ );
+ if ( notContained ) {
+ this.collapseAll( event );
+ }
+ } );
+ },
+ keydown: "_keydown"
+ } );
+
+ this.refresh();
+
+ // Clicks outside of a menu collapse any open menus
+ this._on( this.document, {
+ click: function( event ) {
+ if ( this._closeOnDocumentClick( event ) ) {
+ this.collapseAll( event );
+ }
- this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
- this.containers[innermostIndex].containerCache.over = 1;
- }
-
-
+ // Reset the mouseHandled flag
+ this.mouseHandled = false;
+ }
+ } );
},
- _createHelper: function(event) {
+ _destroy: function() {
+ var items = this.element.find( ".ui-menu-item" )
+ .removeAttr( "role aria-disabled" ),
+ submenus = items.children( ".ui-menu-item-wrapper" )
+ .removeUniqueId()
+ .removeAttr( "tabIndex role aria-haspopup" );
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+ // Destroy (sub)menus
+ this.element
+ .removeAttr( "aria-activedescendant" )
+ .find( ".ui-menu" ).addBack()
+ .removeAttr( "role aria-labelledby aria-expanded aria-hidden aria-disabled " +
+ "tabIndex" )
+ .removeUniqueId()
+ .show();
+
+ submenus.children().each( function() {
+ var elem = $( this );
+ if ( elem.data( "ui-menu-submenu-caret" ) ) {
+ elem.remove();
+ }
+ } );
+ },
+
+ _keydown: function( event ) {
+ var match, prev, character, skip,
+ preventDefault = true;
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.PAGE_UP:
+ this.previousPage( event );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ this.nextPage( event );
+ break;
+ case $.ui.keyCode.HOME:
+ this._move( "first", "first", event );
+ break;
+ case $.ui.keyCode.END:
+ this._move( "last", "last", event );
+ break;
+ case $.ui.keyCode.UP:
+ this.previous( event );
+ break;
+ case $.ui.keyCode.DOWN:
+ this.next( event );
+ break;
+ case $.ui.keyCode.LEFT:
+ this.collapse( event );
+ break;
+ case $.ui.keyCode.RIGHT:
+ if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+ this.expand( event );
+ }
+ break;
+ case $.ui.keyCode.ENTER:
+ case $.ui.keyCode.SPACE:
+ this._activate( event );
+ break;
+ case $.ui.keyCode.ESCAPE:
+ this.collapse( event );
+ break;
+ default:
+ preventDefault = false;
+ prev = this.previousFilter || "";
+ skip = false;
- if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
- $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+ // Support number pad values
+ character = event.keyCode >= 96 && event.keyCode <= 105 ?
+ ( event.keyCode - 96 ).toString() : String.fromCharCode( event.keyCode );
- if(helper[0] == this.currentItem[0])
- this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+ clearTimeout( this.filterTimer );
- if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
- if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+ if ( character === prev ) {
+ skip = true;
+ } else {
+ character = prev + character;
+ }
- return helper;
+ match = this._filterMenuItems( character );
+ match = skip && match.index( this.active.next() ) !== -1 ?
+ this.active.nextAll( ".ui-menu-item" ) :
+ match;
- },
+ // If no matches on the current filter, reset to the last character pressed
+ // to move down the menu to the first item that starts with that character
+ if ( !match.length ) {
+ character = String.fromCharCode( event.keyCode );
+ match = this._filterMenuItems( character );
+ }
- _adjustOffsetFromHelper: function(obj) {
- if (typeof obj == 'string') {
- obj = obj.split(' ');
- }
- if ($.isArray(obj)) {
- obj = {left: +obj[0], top: +obj[1] || 0};
- }
- if ('left' in obj) {
- this.offset.click.left = obj.left + this.margins.left;
- }
- if ('right' in obj) {
- this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if ( match.length ) {
+ this.focus( event, match );
+ this.previousFilter = character;
+ this.filterTimer = this._delay( function() {
+ delete this.previousFilter;
+ }, 1000 );
+ } else {
+ delete this.previousFilter;
+ }
}
- if ('top' in obj) {
- this.offset.click.top = obj.top + this.margins.top;
+
+ if ( preventDefault ) {
+ event.preventDefault();
}
- if ('bottom' in obj) {
- this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _activate: function( event ) {
+ if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+ if ( this.active.children( "[aria-haspopup='true']" ).length ) {
+ this.expand( event );
+ } else {
+ this.select( event );
+ }
}
},
- _getParentOffset: function() {
+ refresh: function() {
+ var menus, items, newSubmenus, newItems, newWrappers,
+ that = this,
+ icon = this.options.icons.submenu,
+ submenus = this.element.find( this.options.menus );
+ this._toggleClass( "ui-menu-icons", null, !!this.element.find( ".ui-icon" ).length );
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
+ // Initialize nested menus
+ newSubmenus = submenus.filter( ":not(.ui-menu)" )
+ .hide()
+ .attr( {
+ role: this.options.role,
+ "aria-hidden": "true",
+ "aria-expanded": "false"
+ } )
+ .each( function() {
+ var menu = $( this ),
+ item = menu.prev(),
+ submenuCaret = $( "<span>" ).data( "ui-menu-submenu-caret", true );
+
+ that._addClass( submenuCaret, "ui-menu-icon", "ui-icon " + icon );
+ item
+ .attr( "aria-haspopup", "true" )
+ .prepend( submenuCaret );
+ menu.attr( "aria-labelledby", item.attr( "id" ) );
+ } );
+
+ this._addClass( newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front" );
+
+ menus = submenus.add( this.element );
+ items = menus.find( this.options.items );
+
+ // Initialize menu-items containing spaces and/or dashes only as dividers
+ items.not( ".ui-menu-item" ).each( function() {
+ var item = $( this );
+ if ( that._isDivider( item ) ) {
+ that._addClass( item, "ui-menu-divider", "ui-widget-content" );
+ }
+ } );
+
+ // Don't refresh list items that are already adapted
+ newItems = items.not( ".ui-menu-item, .ui-menu-divider" );
+ newWrappers = newItems.children()
+ .not( ".ui-menu" )
+ .uniqueId()
+ .attr( {
+ tabIndex: -1,
+ role: this._itemRole()
+ } );
+ this._addClass( newItems, "ui-menu-item" )
+ ._addClass( newWrappers, "ui-menu-item-wrapper" );
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
+ // Add aria-disabled attribute to any disabled menu item
+ items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" );
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
+ // If the active item has been removed, blur the menu
+ if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+ this.blur();
+ }
+ },
+ _itemRole: function() {
return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
-
+ menu: "menuitem",
+ listbox: "option"
+ }[ this.options.role ];
},
- _getRelativeOffset: function() {
-
- if(this.cssPosition == "relative") {
- var p = this.currentItem.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
+ _setOption: function( key, value ) {
+ if ( key === "icons" ) {
+ var icons = this.element.find( ".ui-menu-icon" );
+ this._removeClass( icons, null, this.options.icons.submenu )
+ ._addClass( icons, null, value.submenu );
}
-
+ this._super( key, value );
},
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
- top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
- };
- },
+ _setOptionDisabled: function( value ) {
+ this._super( value );
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
+ this.element.attr( "aria-disabled", String( value ) );
+ this._toggleClass( null, "ui-state-disabled", !!value );
},
- _setContainment: function() {
+ focus: function( event, item ) {
+ var nested, focused, activeParent;
+ this.blur( event, event && event.type === "focus" );
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- 0 - this.offset.relative.left - this.offset.parent.left,
- 0 - this.offset.relative.top - this.offset.parent.top,
- $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
+ this._scrollIntoView( item );
- if(!(/^(document|window|parent)$/).test(o.containment)) {
- var ce = $(o.containment)[0];
- var co = $(o.containment).offset();
- var over = ($(ce).css("overflow") != 'hidden');
+ this.active = item.first();
- this.containment = [
- co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
- co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
- co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
- co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
- ];
- }
+ focused = this.active.children( ".ui-menu-item-wrapper" );
+ this._addClass( focused, null, "ui-state-active" );
- },
+ // Only update aria-activedescendant if there's a role
+ // otherwise we assume focus is managed elsewhere
+ if ( this.options.role ) {
+ this.element.attr( "aria-activedescendant", focused.attr( "id" ) );
+ }
- _convertPositionTo: function(d, pos) {
+ // Highlight active parent menu item, if any
+ activeParent = this.active
+ .parent()
+ .closest( ".ui-menu-item" )
+ .children( ".ui-menu-item-wrapper" );
+ this._addClass( activeParent, null, "ui-state-active" );
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ if ( event && event.type === "keydown" ) {
+ this._close();
+ } else {
+ this.timer = this._delay( function() {
+ this._close();
+ }, this.delay );
+ }
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
+ nested = item.children( ".ui-menu" );
+ if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) {
+ this._startOpening( nested );
+ }
+ this.activeMenu = item.parent();
+ this._trigger( "focus", event, { item: item } );
},
- _generatePosition: function(event) {
+ _scrollIntoView: function( item ) {
+ var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+ if ( this._hasScroll() ) {
+ borderTop = parseFloat( $.css( this.activeMenu[ 0 ], "borderTopWidth" ) ) || 0;
+ paddingTop = parseFloat( $.css( this.activeMenu[ 0 ], "paddingTop" ) ) || 0;
+ offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+ scroll = this.activeMenu.scrollTop();
+ elementHeight = this.activeMenu.height();
+ itemHeight = item.outerHeight();
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ if ( offset < 0 ) {
+ this.activeMenu.scrollTop( scroll + offset );
+ } else if ( offset + itemHeight > elementHeight ) {
+ this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight );
+ }
+ }
+ },
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
+ blur: function( event, fromFocus ) {
+ if ( !fromFocus ) {
+ clearTimeout( this.timer );
}
- var pageX = event.pageX;
- var pageY = event.pageY;
+ if ( !this.active ) {
+ return;
+ }
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
+ this._removeClass( this.active.children( ".ui-menu-item-wrapper" ),
+ null, "ui-state-active" );
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+ this._trigger( "blur", event, { item: this.active } );
+ this.active = null;
+ },
- if(this.containment) {
- if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
- }
+ _startOpening: function( submenu ) {
+ clearTimeout( this.timer );
- if(o.grid) {
- var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
- pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+ // Don't open if already open fixes a Firefox bug that caused a .5 pixel
+ // shift in the submenu position when mousing over the caret icon
+ if ( submenu.attr( "aria-hidden" ) !== "true" ) {
+ return;
+ }
- var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
- pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
- }
+ this.timer = this._delay( function() {
+ this._close();
+ this._open( submenu );
+ }, this.delay );
+ },
- }
+ _open: function( submenu ) {
+ var position = $.extend( {
+ of: this.active
+ }, this.options.position );
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
+ clearTimeout( this.timer );
+ this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) )
+ .hide()
+ .attr( "aria-hidden", "true" );
+ submenu
+ .show()
+ .removeAttr( "aria-hidden" )
+ .attr( "aria-expanded", "true" )
+ .position( position );
},
- _rearrange: function(event, i, a, hardRefresh) {
+ collapseAll: function( event, all ) {
+ clearTimeout( this.timer );
+ this.timer = this._delay( function() {
- a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+ // If we were passed an event, look for the submenu that contains the event
+ var currentMenu = all ? this.element :
+ $( event && event.target ).closest( this.element.find( ".ui-menu" ) );
- //Various things done here to improve the performance:
- // 1. we create a setTimeout, that calls refreshPositions
- // 2. on the instance, we have a counter variable, that get's higher after every append
- // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
- // 4. this lets only the last addition to the timeout stack through
- this.counter = this.counter ? ++this.counter : 1;
- var self = this, counter = this.counter;
+ // If we found no valid submenu ancestor, use the main menu to close all
+ // sub menus anyway
+ if ( !currentMenu.length ) {
+ currentMenu = this.element;
+ }
- window.setTimeout(function() {
- if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
- },0);
+ this._close( currentMenu );
- },
+ this.blur( event );
- _clear: function(event, noPropagation) {
+ // Work around active item staying active after menu is blurred
+ this._removeClass( currentMenu.find( ".ui-state-active" ), null, "ui-state-active" );
- this.reverting = false;
- // We delay all events that have to be triggered to after the point where the placeholder has been removed and
- // everything else normalized again
- var delayedTriggers = [], self = this;
+ this.activeMenu = currentMenu;
+ }, this.delay );
+ },
- // We first have to update the dom position of the actual currentItem
- // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
- if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem);
- this._noFinalSort = null;
-
- if(this.helper[0] == this.currentItem[0]) {
- for(var i in this._storedCSS) {
- if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
- }
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- } else {
- this.currentItem.show();
- }
-
- if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
- if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
- if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
- if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
- for (var i = this.containers.length - 1; i >= 0; i--){
- if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- }
- };
- };
-
- //Post events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- if(this.containers[i].containerCache.over) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- //Do what was originally in plugins
- if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
- if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
- if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
-
- this.dragging = false;
- if(this.cancelHelperRemoval) {
- if(!noPropagation) {
- this._trigger("beforeStop", event, this._uiHash());
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
- return false;
- }
-
- if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
-
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-
- if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
-
- if(!noPropagation) {
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
-
- this.fromOutside = false;
- return true;
+ // With no arguments, closes the currently active menu - if nothing is active
+ // it closes all menus. If passed an argument, it will search for menus BELOW
+ _close: function( startMenu ) {
+ if ( !startMenu ) {
+ startMenu = this.active ? this.active.parent() : this.element;
+ }
+ startMenu.find( ".ui-menu" )
+ .hide()
+ .attr( "aria-hidden", "true" )
+ .attr( "aria-expanded", "false" );
},
- _trigger: function() {
- if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
- this.cancel();
- }
+ _closeOnDocumentClick: function( event ) {
+ return !$( event.target ).closest( ".ui-menu" ).length;
},
- _uiHash: function(inst) {
- var self = inst || this;
- return {
- helper: self.helper,
- placeholder: self.placeholder || $([]),
- position: self.position,
- originalPosition: self.originalPosition,
- offset: self.positionAbs,
- item: self.currentItem,
- sender: inst ? inst.element : null
- };
- }
-
-});
-
-$.extend($.ui.sortable, {
- version: "1.8.21"
-});
-
-})(jQuery);
-/*!
- * jQuery UI Accordion 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
+ _isDivider: function( item ) {
-$.widget( "ui.accordion", {
- options: {
- active: 0,
- animated: "slide",
- autoHeight: true,
- clearStyle: false,
- collapsible: false,
- event: "click",
- fillSpace: false,
- header: "> li > :first-child,> :not(li):even",
- icons: {
- header: "ui-icon-triangle-1-e",
- headerSelected: "ui-icon-triangle-1-s"
- },
- navigation: false,
- navigationFilter: function() {
- return this.href.toLowerCase() === location.href.toLowerCase();
- }
+ // Match hyphen, em dash, en dash
+ return !/[^\-\u2014\u2013\s]/.test( item.text() );
},
- _create: function() {
- var self = this,
- options = self.options;
-
- self.running = 0;
-
- self.element
- .addClass( "ui-accordion ui-widget ui-helper-reset" )
- // in lack of child-selectors in CSS
- // we need to mark top-LIs in a UL-accordion for some IE-fix
- .children( "li" )
- .addClass( "ui-accordion-li-fix" );
-
- self.headers = self.element.find( options.header )
- .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
- .bind( "mouseenter.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).addClass( "ui-state-hover" );
- })
- .bind( "mouseleave.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).removeClass( "ui-state-hover" );
- })
- .bind( "focus.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).addClass( "ui-state-focus" );
- })
- .bind( "blur.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).removeClass( "ui-state-focus" );
- });
-
- self.headers.next()
- .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
-
- if ( options.navigation ) {
- var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
- if ( current.length ) {
- var header = current.closest( ".ui-accordion-header" );
- if ( header.length ) {
- // anchor within header
- self.active = header;
- } else {
- // anchor within content
- self.active = current.closest( ".ui-accordion-content" ).prev();
- }
- }
+ collapse: function( event ) {
+ var newItem = this.active &&
+ this.active.parent().closest( ".ui-menu-item", this.element );
+ if ( newItem && newItem.length ) {
+ this._close();
+ this.focus( event, newItem );
}
+ },
- self.active = self._findActive( self.active || options.active )
- .addClass( "ui-state-default ui-state-active" )
- .toggleClass( "ui-corner-all" )
- .toggleClass( "ui-corner-top" );
- self.active.next().addClass( "ui-accordion-content-active" );
-
- self._createIcons();
- self.resize();
-
- // ARIA
- self.element.attr( "role", "tablist" );
-
- self.headers
- .attr( "role", "tab" )
- .bind( "keydown.accordion", function( event ) {
- return self._keydown( event );
- })
- .next()
- .attr( "role", "tabpanel" );
-
- self.headers
- .not( self.active || "" )
- .attr({
- "aria-expanded": "false",
- "aria-selected": "false",
- tabIndex: -1
- })
- .next()
- .hide();
-
- // make sure at least one header is in the tab order
- if ( !self.active.length ) {
- self.headers.eq( 0 ).attr( "tabIndex", 0 );
- } else {
- self.active
- .attr({
- "aria-expanded": "true",
- "aria-selected": "true",
- tabIndex: 0
- });
- }
+ expand: function( event ) {
+ var newItem = this.active &&
+ this.active
+ .children( ".ui-menu " )
+ .find( this.options.items )
+ .first();
- // only need links in tab order for Safari
- if ( !$.browser.safari ) {
- self.headers.find( "a" ).attr( "tabIndex", -1 );
- }
+ if ( newItem && newItem.length ) {
+ this._open( newItem.parent() );
- if ( options.event ) {
- self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
- self._clickHandler.call( self, event, this );
- event.preventDefault();
- });
+ // Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+ this._delay( function() {
+ this.focus( event, newItem );
+ } );
}
},
- _createIcons: function() {
- var options = this.options;
- if ( options.icons ) {
- $( "<span></span>" )
- .addClass( "ui-icon " + options.icons.header )
- .prependTo( this.headers );
- this.active.children( ".ui-icon" )
- .toggleClass(options.icons.header)
- .toggleClass(options.icons.headerSelected);
- this.element.addClass( "ui-accordion-icons" );
- }
+ next: function( event ) {
+ this._move( "next", "first", event );
},
- _destroyIcons: function() {
- this.headers.children( ".ui-icon" ).remove();
- this.element.removeClass( "ui-accordion-icons" );
+ previous: function( event ) {
+ this._move( "prev", "last", event );
},
- destroy: function() {
- var options = this.options;
-
- this.element
- .removeClass( "ui-accordion ui-widget ui-helper-reset" )
- .removeAttr( "role" );
-
- this.headers
- .unbind( ".accordion" )
- .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
- .removeAttr( "role" )
- .removeAttr( "aria-expanded" )
- .removeAttr( "aria-selected" )
- .removeAttr( "tabIndex" );
-
- this.headers.find( "a" ).removeAttr( "tabIndex" );
- this._destroyIcons();
- var contents = this.headers.next()
- .css( "display", "" )
- .removeAttr( "role" )
- .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
- if ( options.autoHeight || options.fillHeight ) {
- contents.css( "height", "" );
- }
+ isFirstItem: function() {
+ return this.active && !this.active.prevAll( ".ui-menu-item" ).length;
+ },
- return $.Widget.prototype.destroy.call( this );
+ isLastItem: function() {
+ return this.active && !this.active.nextAll( ".ui-menu-item" ).length;
},
- _setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
-
- if ( key == "active" ) {
- this.activate( value );
- }
- if ( key == "icons" ) {
- this._destroyIcons();
- if ( value ) {
- this._createIcons();
+ _move: function( direction, filter, event ) {
+ var next;
+ if ( this.active ) {
+ if ( direction === "first" || direction === "last" ) {
+ next = this.active
+ [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" )
+ .eq( -1 );
+ } else {
+ next = this.active
+ [ direction + "All" ]( ".ui-menu-item" )
+ .eq( 0 );
}
}
- // #5332 - opacity doesn't cascade to positioned elements in IE
- // so we need to add the disabled class to the headers and panels
- if ( key == "disabled" ) {
- this.headers.add(this.headers.next())
- [ value ? "addClass" : "removeClass" ](
- "ui-accordion-disabled ui-state-disabled" );
+ if ( !next || !next.length || !this.active ) {
+ next = this.activeMenu.find( this.options.items )[ filter ]();
}
- },
- _keydown: function( event ) {
- if ( this.options.disabled || event.altKey || event.ctrlKey ) {
- return;
- }
+ this.focus( event, next );
+ },
- var keyCode = $.ui.keyCode,
- length = this.headers.length,
- currentIndex = this.headers.index( event.target ),
- toFocus = false;
+ nextPage: function( event ) {
+ var item, base, height;
- switch ( event.keyCode ) {
- case keyCode.RIGHT:
- case keyCode.DOWN:
- toFocus = this.headers[ ( currentIndex + 1 ) % length ];
- break;
- case keyCode.LEFT:
- case keyCode.UP:
- toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
- break;
- case keyCode.SPACE:
- case keyCode.ENTER:
- this._clickHandler( { target: event.target }, event.target );
- event.preventDefault();
+ if ( !this.active ) {
+ this.next( event );
+ return;
}
-
- if ( toFocus ) {
- $( event.target ).attr( "tabIndex", -1 );
- $( toFocus ).attr( "tabIndex", 0 );
- toFocus.focus();
- return false;
+ if ( this.isLastItem() ) {
+ return;
}
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.nextAll( ".ui-menu-item" ).each( function() {
+ item = $( this );
+ return item.offset().top - base - height < 0;
+ } );
- return true;
- },
-
- resize: function() {
- var options = this.options,
- maxHeight;
-
- if ( options.fillSpace ) {
- if ( $.browser.msie ) {
- var defOverflow = this.element.parent().css( "overflow" );
- this.element.parent().css( "overflow", "hidden");
- }
- maxHeight = this.element.parent().height();
- if ($.browser.msie) {
- this.element.parent().css( "overflow", defOverflow );
- }
-
- this.headers.each(function() {
- maxHeight -= $( this ).outerHeight( true );
- });
-
- this.headers.next()
- .each(function() {
- $( this ).height( Math.max( 0, maxHeight -
- $( this ).innerHeight() + $( this ).height() ) );
- })
- .css( "overflow", "auto" );
- } else if ( options.autoHeight ) {
- maxHeight = 0;
- this.headers.next()
- .each(function() {
- maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
- })
- .height( maxHeight );
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.find( this.options.items )
+ [ !this.active ? "first" : "last" ]() );
}
-
- return this;
- },
-
- activate: function( index ) {
- // TODO this gets called on init, changing the option without an explicit call for that
- this.options.active = index;
- // call clickHandler with custom event
- var active = this._findActive( index )[ 0 ];
- this._clickHandler( { target: active }, active );
-
- return this;
- },
-
- _findActive: function( selector ) {
- return selector
- ? typeof selector === "number"
- ? this.headers.filter( ":eq(" + selector + ")" )
- : this.headers.not( this.headers.not( selector ) )
- : selector === false
- ? $( [] )
- : this.headers.filter( ":eq(0)" );
},
- // TODO isn't event.target enough? why the separate target argument?
- _clickHandler: function( event, target ) {
- var options = this.options;
- if ( options.disabled ) {
- return;
- }
-
- // called only when using activate(false) to close all parts programmatically
- if ( !event.target ) {
- if ( !options.collapsible ) {
- return;
- }
- this.active
- .removeClass( "ui-state-active ui-corner-top" )
- .addClass( "ui-state-default ui-corner-all" )
- .children( ".ui-icon" )
- .removeClass( options.icons.headerSelected )
- .addClass( options.icons.header );
- this.active.next().addClass( "ui-accordion-content-active" );
- var toHide = this.active.next(),
- data = {
- options: options,
- newHeader: $( [] ),
- oldHeader: options.active,
- newContent: $( [] ),
- oldContent: toHide
- },
- toShow = ( this.active = $( [] ) );
- this._toggle( toShow, toHide, data );
+ previousPage: function( event ) {
+ var item, base, height;
+ if ( !this.active ) {
+ this.next( event );
return;
}
-
- // get the click target
- var clicked = $( event.currentTarget || target ),
- clickedIsActive = clicked[0] === this.active[0];
-
- // TODO the option is changed, is that correct?
- // TODO if it is correct, shouldn't that happen after determining that the click is valid?
- options.active = options.collapsible && clickedIsActive ?
- false :
- this.headers.index( clicked );
-
- // if animations are still active, or the active header is the target, ignore click
- if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+ if ( this.isFirstItem() ) {
return;
}
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.prevAll( ".ui-menu-item" ).each( function() {
+ item = $( this );
+ return item.offset().top - base + height > 0;
+ } );
- // find elements to show and hide
- var active = this.active,
- toShow = clicked.next(),
- toHide = this.active.next(),
- data = {
- options: options,
- newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
- oldHeader: this.active,
- newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
- oldContent: toHide
- },
- down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
-
- // when the call to ._toggle() comes after the class changes
- // it causes a very odd bug in IE 8 (see #6720)
- this.active = clickedIsActive ? $([]) : clicked;
- this._toggle( toShow, toHide, data, clickedIsActive, down );
-
- // switch classes
- active
- .removeClass( "ui-state-active ui-corner-top" )
- .addClass( "ui-state-default ui-corner-all" )
- .children( ".ui-icon" )
- .removeClass( options.icons.headerSelected )
- .addClass( options.icons.header );
- if ( !clickedIsActive ) {
- clicked
- .removeClass( "ui-state-default ui-corner-all" )
- .addClass( "ui-state-active ui-corner-top" )
- .children( ".ui-icon" )
- .removeClass( options.icons.header )
- .addClass( options.icons.headerSelected );
- clicked
- .next()
- .addClass( "ui-accordion-content-active" );
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.find( this.options.items ).first() );
}
-
- return;
},
- _toggle: function( toShow, toHide, data, clickedIsActive, down ) {
- var self = this,
- options = self.options;
-
- self.toShow = toShow;
- self.toHide = toHide;
- self.data = data;
-
- var complete = function() {
- if ( !self ) {
- return;
- }
- return self._completed.apply( self, arguments );
- };
-
- // trigger changestart event
- self._trigger( "changestart", null, self.data );
-
- // count elements to animate
- self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
-
- if ( options.animated ) {
- var animOptions = {};
-
- if ( options.collapsible && clickedIsActive ) {
- animOptions = {
- toShow: $( [] ),
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: options.autoHeight || options.fillSpace
- };
- } else {
- animOptions = {
- toShow: toShow,
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: options.autoHeight || options.fillSpace
- };
- }
-
- if ( !options.proxied ) {
- options.proxied = options.animated;
- }
-
- if ( !options.proxiedDuration ) {
- options.proxiedDuration = options.duration;
- }
-
- options.animated = $.isFunction( options.proxied ) ?
- options.proxied( animOptions ) :
- options.proxied;
-
- options.duration = $.isFunction( options.proxiedDuration ) ?
- options.proxiedDuration( animOptions ) :
- options.proxiedDuration;
-
- var animations = $.ui.accordion.animations,
- duration = options.duration,
- easing = options.animated;
-
- if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
- easing = "slide";
- }
- if ( !animations[ easing ] ) {
- animations[ easing ] = function( options ) {
- this.slide( options, {
- easing: easing,
- duration: duration || 700
- });
- };
- }
+ _hasScroll: function() {
+ return this.element.outerHeight() < this.element.prop( "scrollHeight" );
+ },
- animations[ easing ]( animOptions );
- } else {
- if ( options.collapsible && clickedIsActive ) {
- toShow.toggle();
- } else {
- toHide.hide();
- toShow.show();
- }
+ select: function( event ) {
- complete( true );
+ // TODO: It should never be possible to not have an active item at this
+ // point, but the tests don't trigger mouseenter before click.
+ this.active = this.active || $( event.target ).closest( ".ui-menu-item" );
+ var ui = { item: this.active };
+ if ( !this.active.has( ".ui-menu" ).length ) {
+ this.collapseAll( event, true );
}
-
- // TODO assert that the blur and focus triggers are really necessary, remove otherwise
- toHide.prev()
- .attr({
- "aria-expanded": "false",
- "aria-selected": "false",
- tabIndex: -1
- })
- .blur();
- toShow.prev()
- .attr({
- "aria-expanded": "true",
- "aria-selected": "true",
- tabIndex: 0
- })
- .focus();
+ this._trigger( "select", event, ui );
},
- _completed: function( cancel ) {
- this.running = cancel ? 0 : --this.running;
- if ( this.running ) {
- return;
- }
-
- if ( this.options.clearStyle ) {
- this.toShow.add( this.toHide ).css({
- height: "",
- overflow: ""
- });
- }
+ _filterMenuItems: function( character ) {
+ var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ),
+ regex = new RegExp( "^" + escapedCharacter, "i" );
- // other classes are removed before the animation; this one needs to stay until completed
- this.toHide.removeClass( "ui-accordion-content-active" );
- // Work around for rendering bug in IE (#5421)
- if ( this.toHide.length ) {
- this.toHide.parent()[0].className = this.toHide.parent()[0].className;
- }
-
- this._trigger( "change", null, this.data );
- }
-});
-
-$.extend( $.ui.accordion, {
- version: "1.8.21",
- animations: {
- slide: function( options, additions ) {
- options = $.extend({
- easing: "swing",
- duration: 300
- }, options, additions );
- if ( !options.toHide.size() ) {
- options.toShow.animate({
- height: "show",
- paddingTop: "show",
- paddingBottom: "show"
- }, options );
- return;
- }
- if ( !options.toShow.size() ) {
- options.toHide.animate({
- height: "hide",
- paddingTop: "hide",
- paddingBottom: "hide"
- }, options );
- return;
- }
- var overflow = options.toShow.css( "overflow" ),
- percentDone = 0,
- showProps = {},
- hideProps = {},
- fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
- originalWidth;
- // fix width before calculating height of hidden element
- var s = options.toShow;
- originalWidth = s[0].style.width;
- s.width( s.parent().width()
- - parseFloat( s.css( "paddingLeft" ) )
- - parseFloat( s.css( "paddingRight" ) )
- - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 )
- - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) );
-
- $.each( fxAttrs, function( i, prop ) {
- hideProps[ prop ] = "hide";
-
- var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
- showProps[ prop ] = {
- value: parts[ 1 ],
- unit: parts[ 2 ] || "px"
- };
- });
- options.toShow.css({ height: 0, overflow: "hidden" }).show();
- options.toHide
- .filter( ":hidden" )
- .each( options.complete )
- .end()
- .filter( ":visible" )
- .animate( hideProps, {
- step: function( now, settings ) {
- // only calculate the percent when animating height
- // IE gets very inconsistent results when animating elements
- // with small values, which is common for padding
- if ( settings.prop == "height" ) {
- percentDone = ( settings.end - settings.start === 0 ) ? 0 :
- ( settings.now - settings.start ) / ( settings.end - settings.start );
- }
+ return this.activeMenu
+ .find( this.options.items )
- options.toShow[ 0 ].style[ settings.prop ] =
- ( percentDone * showProps[ settings.prop ].value )
- + showProps[ settings.prop ].unit;
- },
- duration: options.duration,
- easing: options.easing,
- complete: function() {
- if ( !options.autoHeight ) {
- options.toShow.css( "height", "" );
- }
- options.toShow.css({
- width: originalWidth,
- overflow: overflow
- });
- options.complete();
- }
- });
- },
- bounceslide: function( options ) {
- this.slide( options, {
- easing: options.down ? "easeOutBounce" : "swing",
- duration: options.down ? 1000 : 200
- });
- }
+ // Only match on items, not dividers or other content (#10571)
+ .filter( ".ui-menu-item" )
+ .filter( function() {
+ return regex.test(
+ $.trim( $( this ).children( ".ui-menu-item-wrapper" ).text() ) );
+ } );
}
-});
+} );
+
-})( jQuery );
/*!
- * jQuery UI Autocomplete 1.8.21
+ * jQuery UI Autocomplete 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Autocomplete
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.position.js
*/
-(function( $, undefined ) {
-// used to prevent race conditions with remote data sources
-var requestIndex = 0;
+//>>label: Autocomplete
+//>>group: Widgets
+//>>description: Lists suggested words as the user is typing.
+//>>docs: http://api.jqueryui.com/autocomplete/
+//>>demos: http://jqueryui.com/autocomplete/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/autocomplete.css
+//>>css.theme: ../../themes/base/theme.css
+
+
$.widget( "ui.autocomplete", {
+ version: "1.12.1",
+ defaultElement: "<input>",
options: {
- appendTo: "body",
+ appendTo: null,
autoFocus: false,
delay: 300,
minLength: 1,
at: "left bottom",
collision: "none"
},
- source: null
+ source: null,
+
+ // Callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ response: null,
+ search: null,
+ select: null
},
+ requestIndex: 0,
pending: 0,
_create: function() {
- var self = this,
- doc = this.element[ 0 ].ownerDocument,
- suppressKeyPress;
- this.isMultiLine = this.element.is( "textarea" );
- this.element
- .addClass( "ui-autocomplete-input" )
- .attr( "autocomplete", "off" )
- // TODO verify these actually work as intended
- .attr({
- role: "textbox",
- "aria-autocomplete": "list",
- "aria-haspopup": "true"
- })
- .bind( "keydown.autocomplete", function( event ) {
- if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
+ // Some browsers only repeat keydown events, not keypress events,
+ // so we use the suppressKeyPress flag to determine if we've already
+ // handled the keydown event. #7269
+ // Unfortunately the code for & in keypress is the same as the up arrow,
+ // so we use the suppressKeyPressRepeat flag to avoid handling keypress
+ // events when we know the keydown event was used to modify the
+ // search term. #7799
+ var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
+ nodeName = this.element[ 0 ].nodeName.toLowerCase(),
+ isTextarea = nodeName === "textarea",
+ isInput = nodeName === "input";
+
+ // Textareas are always multi-line
+ // Inputs are always single-line, even if inside a contentEditable element
+ // IE also treats inputs as contentEditable
+ // All other element types are determined by whether or not they're contentEditable
+ this.isMultiLine = isTextarea || !isInput && this._isContentEditable( this.element );
+
+ this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ];
+ this.isNewMenu = true;
+
+ this._addClass( "ui-autocomplete-input" );
+ this.element.attr( "autocomplete", "off" );
+
+ this._on( this.element, {
+ keydown: function( event ) {
+ if ( this.element.prop( "readOnly" ) ) {
+ suppressKeyPress = true;
+ suppressInput = true;
+ suppressKeyPressRepeat = true;
return;
}
suppressKeyPress = false;
+ suppressInput = false;
+ suppressKeyPressRepeat = false;
var keyCode = $.ui.keyCode;
- switch( event.keyCode ) {
+ switch ( event.keyCode ) {
case keyCode.PAGE_UP:
- self._move( "previousPage", event );
+ suppressKeyPress = true;
+ this._move( "previousPage", event );
break;
case keyCode.PAGE_DOWN:
- self._move( "nextPage", event );
+ suppressKeyPress = true;
+ this._move( "nextPage", event );
break;
case keyCode.UP:
- self._keyEvent( "previous", event );
+ suppressKeyPress = true;
+ this._keyEvent( "previous", event );
break;
case keyCode.DOWN:
- self._keyEvent( "next", event );
+ suppressKeyPress = true;
+ this._keyEvent( "next", event );
break;
case keyCode.ENTER:
- case keyCode.NUMPAD_ENTER:
+
// when menu is open and has focus
- if ( self.menu.active ) {
+ if ( this.menu.active ) {
+
// #6055 - Opera still allows the keypress to occur
// which causes forms to submit
suppressKeyPress = true;
event.preventDefault();
+ this.menu.select( event );
}
- //passthrough - ENTER and TAB both select the current element
+ break;
case keyCode.TAB:
- if ( !self.menu.active ) {
- return;
+ if ( this.menu.active ) {
+ this.menu.select( event );
}
- self.menu.select( event );
break;
case keyCode.ESCAPE:
- self.element.val( self.term );
- self.close( event );
+ if ( this.menu.element.is( ":visible" ) ) {
+ if ( !this.isMultiLine ) {
+ this._value( this.term );
+ }
+ this.close( event );
+
+ // Different browsers have different default behavior for escape
+ // Single press can mean undo or clear
+ // Double press in IE means clear the whole form
+ event.preventDefault();
+ }
break;
default:
- // keypress is triggered before the input value is changed
- clearTimeout( self.searching );
- self.searching = setTimeout(function() {
- // only search if the value has changed
- if ( self.term != self.element.val() ) {
- self.selectedItem = null;
- self.search( null, event );
- }
- }, self.options.delay );
+ suppressKeyPressRepeat = true;
+
+ // search timeout should be triggered before the input value is changed
+ this._searchTimeout( event );
break;
}
- })
- .bind( "keypress.autocomplete", function( event ) {
+ },
+ keypress: function( event ) {
if ( suppressKeyPress ) {
suppressKeyPress = false;
- event.preventDefault();
- }
- })
- .bind( "focus.autocomplete", function() {
- if ( self.options.disabled ) {
+ if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+ event.preventDefault();
+ }
return;
}
-
- self.selectedItem = null;
- self.previous = self.element.val();
- })
- .bind( "blur.autocomplete", function( event ) {
- if ( self.options.disabled ) {
+ if ( suppressKeyPressRepeat ) {
return;
}
- clearTimeout( self.searching );
- // clicks on the menu (or a button to trigger a search) will cause a blur event
- self.closing = setTimeout(function() {
- self.close( event );
- self._change( event );
- }, 150 );
- });
- this._initSource();
- this.menu = $( "<ul></ul>" )
- .addClass( "ui-autocomplete" )
- .appendTo( $( this.options.appendTo || "body", doc )[0] )
- // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
- .mousedown(function( event ) {
- // clicking on the scrollbar causes focus to shift to the body
- // but we can't detect a mouseup or a click immediately afterward
- // so we have to track the next mousedown and close the menu if
- // the user clicks somewhere outside of the autocomplete
- var menuElement = self.menu.element[ 0 ];
- if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
- setTimeout(function() {
- $( document ).one( 'mousedown', function( event ) {
- if ( event.target !== self.element[ 0 ] &&
- event.target !== menuElement &&
- !$.ui.contains( menuElement, event.target ) ) {
- self.close();
- }
- });
- }, 1 );
- }
-
- // use another timeout to make sure the blur-event-handler on the input was already triggered
- setTimeout(function() {
- clearTimeout( self.closing );
- }, 13);
- })
- .menu({
- focus: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" );
- if ( false !== self._trigger( "focus", event, { item: item } ) ) {
- // use value to match what will end up in the input, if it was a key event
- if ( /^key/.test(event.originalEvent.type) ) {
- self.element.val( item.value );
- }
- }
- },
- selected: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" ),
- previous = self.previous;
-
- // only trigger when focus was lost (click on menu)
- if ( self.element[0] !== doc.activeElement ) {
- self.element.focus();
- self.previous = previous;
- // #6109 - IE triggers two focus events and the second
- // is asynchronous, so we need to reset the previous
- // term synchronously and asynchronously :-(
- setTimeout(function() {
- self.previous = previous;
- self.selectedItem = item;
- }, 1);
+ // Replicate some key handlers to allow them to repeat in Firefox and Opera
+ var keyCode = $.ui.keyCode;
+ switch ( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ this._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ this._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ this._keyEvent( "previous", event );
+ break;
+ case keyCode.DOWN:
+ this._keyEvent( "next", event );
+ break;
+ }
+ },
+ input: function( event ) {
+ if ( suppressInput ) {
+ suppressInput = false;
+ event.preventDefault();
+ return;
+ }
+ this._searchTimeout( event );
+ },
+ focus: function() {
+ this.selectedItem = null;
+ this.previous = this._value();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ clearTimeout( this.searching );
+ this.close( event );
+ this._change( event );
+ }
+ } );
+
+ this._initSource();
+ this.menu = $( "<ul>" )
+ .appendTo( this._appendTo() )
+ .menu( {
+
+ // disable ARIA support, the live region takes care of that
+ role: null
+ } )
+ .hide()
+ .menu( "instance" );
+
+ this._addClass( this.menu.element, "ui-autocomplete", "ui-front" );
+ this._on( this.menu.element, {
+ mousedown: function( event ) {
+
+ // prevent moving focus out of the text field
+ event.preventDefault();
+
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ this.cancelBlur = true;
+ this._delay( function() {
+ delete this.cancelBlur;
+
+ // Support: IE 8 only
+ // Right clicking a menu item or selecting text from the menu items will
+ // result in focus moving out of the input. However, we've already received
+ // and ignored the blur event because of the cancelBlur flag set above. So
+ // we restore focus to ensure that the menu closes properly based on the user's
+ // next actions.
+ if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+ this.element.trigger( "focus" );
}
+ } );
+ },
+ menufocus: function( event, ui ) {
+ var label, item;
+
+ // support: Firefox
+ // Prevent accidental activation of menu items in Firefox (#7024 #9118)
+ if ( this.isNewMenu ) {
+ this.isNewMenu = false;
+ if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
+ this.menu.blur();
- if ( false !== self._trigger( "select", event, { item: item } ) ) {
- self.element.val( item.value );
+ this.document.one( "mousemove", function() {
+ $( event.target ).trigger( event.originalEvent );
+ } );
+
+ return;
}
- // reset the term after the select event
- // this allows custom select handling to work properly
- self.term = self.element.val();
+ }
- self.close( event );
- self.selectedItem = item;
- },
- blur: function( event, ui ) {
- // don't set the value of the text field if it's already correct
- // this prevents moving the cursor unnecessarily
- if ( self.menu.element.is(":visible") &&
- ( self.element.val() !== self.term ) ) {
- self.element.val( self.term );
+ item = ui.item.data( "ui-autocomplete-item" );
+ if ( false !== this._trigger( "focus", event, { item: item } ) ) {
+
+ // use value to match what will end up in the input, if it was a key event
+ if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
+ this._value( item.value );
}
}
- })
- .zIndex( this.element.zIndex() + 1 )
- // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
- .css({ top: 0, left: 0 })
- .hide()
- .data( "menu" );
- if ( $.fn.bgiframe ) {
- this.menu.element.bgiframe();
- }
- // turning off autocomplete prevents the browser from remembering the
+
+ // Announce the value in the liveRegion
+ label = ui.item.attr( "aria-label" ) || item.value;
+ if ( label && $.trim( label ).length ) {
+ this.liveRegion.children().hide();
+ $( "<div>" ).text( label ).appendTo( this.liveRegion );
+ }
+ },
+ menuselect: function( event, ui ) {
+ var item = ui.item.data( "ui-autocomplete-item" ),
+ previous = this.previous;
+
+ // Only trigger when focus was lost (click on menu)
+ if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+ this.element.trigger( "focus" );
+ this.previous = previous;
+
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ this._delay( function() {
+ this.previous = previous;
+ this.selectedItem = item;
+ } );
+ }
+
+ if ( false !== this._trigger( "select", event, { item: item } ) ) {
+ this._value( item.value );
+ }
+
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ this.term = this._value();
+
+ this.close( event );
+ this.selectedItem = item;
+ }
+ } );
+
+ this.liveRegion = $( "<div>", {
+ role: "status",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ } )
+ .appendTo( this.document[ 0 ].body );
+
+ this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
+
+ // Turning off autocomplete prevents the browser from remembering the
// value when navigating through history, so we re-enable autocomplete
// if the page is unloaded before the widget is destroyed. #7790
- self.beforeunloadHandler = function() {
- self.element.removeAttr( "autocomplete" );
- };
- $( window ).bind( "beforeunload", self.beforeunloadHandler );
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ } );
},
- destroy: function() {
- this.element
- .removeClass( "ui-autocomplete-input" )
- .removeAttr( "autocomplete" )
- .removeAttr( "role" )
- .removeAttr( "aria-autocomplete" )
- .removeAttr( "aria-haspopup" );
+ _destroy: function() {
+ clearTimeout( this.searching );
+ this.element.removeAttr( "autocomplete" );
this.menu.element.remove();
- $( window ).unbind( "beforeunload", this.beforeunloadHandler );
- $.Widget.prototype.destroy.call( this );
+ this.liveRegion.remove();
},
_setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
if ( key === "source" ) {
this._initSource();
}
if ( key === "appendTo" ) {
- this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+ this.menu.element.appendTo( this._appendTo() );
}
if ( key === "disabled" && value && this.xhr ) {
this.xhr.abort();
}
},
+ _isEventTargetInWidget: function( event ) {
+ var menuElement = this.menu.element[ 0 ];
+
+ return event.target === this.element[ 0 ] ||
+ event.target === menuElement ||
+ $.contains( menuElement, event.target );
+ },
+
+ _closeOnClickOutside: function( event ) {
+ if ( !this._isEventTargetInWidget( event ) ) {
+ this.close();
+ }
+ },
+
+ _appendTo: function() {
+ var element = this.options.appendTo;
+
+ if ( element ) {
+ element = element.jquery || element.nodeType ?
+ $( element ) :
+ this.document.find( element ).eq( 0 );
+ }
+
+ if ( !element || !element[ 0 ] ) {
+ element = this.element.closest( ".ui-front, dialog" );
+ }
+
+ if ( !element.length ) {
+ element = this.document[ 0 ].body;
+ }
+
+ return element;
+ },
+
_initSource: function() {
- var self = this,
- array,
- url;
- if ( $.isArray(this.options.source) ) {
+ var array, url,
+ that = this;
+ if ( $.isArray( this.options.source ) ) {
array = this.options.source;
this.source = function( request, response ) {
- response( $.ui.autocomplete.filter(array, request.term) );
+ response( $.ui.autocomplete.filter( array, request.term ) );
};
} else if ( typeof this.options.source === "string" ) {
url = this.options.source;
this.source = function( request, response ) {
- if ( self.xhr ) {
- self.xhr.abort();
+ if ( that.xhr ) {
+ that.xhr.abort();
}
- self.xhr = $.ajax({
+ that.xhr = $.ajax( {
url: url,
data: request,
dataType: "json",
- success: function( data, status ) {
+ success: function( data ) {
response( data );
},
error: function() {
response( [] );
}
- });
+ } );
};
} else {
this.source = this.options.source;
}
},
+ _searchTimeout: function( event ) {
+ clearTimeout( this.searching );
+ this.searching = this._delay( function() {
+
+ // Search if the value has changed, or if the user retypes the same value (see #7434)
+ var equalValues = this.term === this._value(),
+ menuVisible = this.menu.element.is( ":visible" ),
+ modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey;
+
+ if ( !equalValues || ( equalValues && !menuVisible && !modifierKey ) ) {
+ this.selectedItem = null;
+ this.search( null, event );
+ }
+ }, this.options.delay );
+ },
+
search: function( value, event ) {
- value = value != null ? value : this.element.val();
+ value = value != null ? value : this._value();
- // always save the actual value, not the one passed as an argument
- this.term = this.element.val();
+ // Always save the actual value, not the one passed as an argument
+ this.term = this._value();
if ( value.length < this.options.minLength ) {
return this.close( event );
}
- clearTimeout( this.closing );
if ( this._trigger( "search", event ) === false ) {
return;
}
_search: function( value ) {
this.pending++;
- this.element.addClass( "ui-autocomplete-loading" );
+ this._addClass( "ui-autocomplete-loading" );
+ this.cancelSearch = false;
this.source( { term: value }, this._response() );
},
_response: function() {
- var that = this,
- index = ++requestIndex;
+ var index = ++this.requestIndex;
- return function( content ) {
- if ( index === requestIndex ) {
- that.__response( content );
+ return $.proxy( function( content ) {
+ if ( index === this.requestIndex ) {
+ this.__response( content );
}
- that.pending--;
- if ( !that.pending ) {
- that.element.removeClass( "ui-autocomplete-loading" );
+ this.pending--;
+ if ( !this.pending ) {
+ this._removeClass( "ui-autocomplete-loading" );
}
- };
+ }, this );
},
__response: function( content ) {
- if ( !this.options.disabled && content && content.length ) {
+ if ( content ) {
content = this._normalize( content );
+ }
+ this._trigger( "response", null, { content: content } );
+ if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
this._suggest( content );
this._trigger( "open" );
} else {
- this.close();
+
+ // use ._close() instead of .close() so we don't cancel future searches
+ this._close();
}
},
close: function( event ) {
- clearTimeout( this.closing );
- if ( this.menu.element.is(":visible") ) {
+ this.cancelSearch = true;
+ this._close( event );
+ },
+
+ _close: function( event ) {
+
+ // Remove the handler that closes the menu on outside clicks
+ this._off( this.document, "mousedown" );
+
+ if ( this.menu.element.is( ":visible" ) ) {
this.menu.element.hide();
- this.menu.deactivate();
+ this.menu.blur();
+ this.isNewMenu = true;
this._trigger( "close", event );
}
},
-
+
_change: function( event ) {
- if ( this.previous !== this.element.val() ) {
+ if ( this.previous !== this._value() ) {
this._trigger( "change", event, { item: this.selectedItem } );
}
},
_normalize: function( items ) {
+
// assume all items have the right format when the first item is complete
- if ( items.length && items[0].label && items[0].value ) {
+ if ( items.length && items[ 0 ].label && items[ 0 ].value ) {
return items;
}
- return $.map( items, function(item) {
+ return $.map( items, function( item ) {
if ( typeof item === "string" ) {
return {
label: item,
value: item
};
}
- return $.extend({
+ return $.extend( {}, item, {
label: item.label || item.value,
value: item.value || item.label
- }, item );
- });
+ } );
+ } );
},
_suggest: function( items ) {
- var ul = this.menu.element
- .empty()
- .zIndex( this.element.zIndex() + 1 );
+ var ul = this.menu.element.empty();
this._renderMenu( ul, items );
- // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
- this.menu.deactivate();
+ this.isNewMenu = true;
this.menu.refresh();
- // size and position menu
+ // Size and position menu
ul.show();
this._resizeMenu();
- ul.position( $.extend({
+ ul.position( $.extend( {
of: this.element
- }, this.options.position ));
+ }, this.options.position ) );
if ( this.options.autoFocus ) {
- this.menu.next( new $.Event("mouseover") );
+ this.menu.next();
}
+
+ // Listen for interactions outside of the widget (#6642)
+ this._on( this.document, {
+ mousedown: "_closeOnClickOutside"
+ } );
},
_resizeMenu: function() {
var ul = this.menu.element;
ul.outerWidth( Math.max(
+
// Firefox wraps long text (possibly a rounding bug)
// so we add 1px to avoid the wrapping (#7513)
ul.width( "" ).outerWidth() + 1,
},
_renderMenu: function( ul, items ) {
- var self = this;
+ var that = this;
$.each( items, function( index, item ) {
- self._renderItem( ul, item );
- });
+ that._renderItemData( ul, item );
+ } );
+ },
+
+ _renderItemData: function( ul, item ) {
+ return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
},
- _renderItem: function( ul, item) {
- return $( "<li></li>" )
- .data( "item.autocomplete", item )
- .append( $( "<a></a>" ).text( item.label ) )
+ _renderItem: function( ul, item ) {
+ return $( "<li>" )
+ .append( $( "<div>" ).text( item.label ) )
.appendTo( ul );
},
_move: function( direction, event ) {
- if ( !this.menu.element.is(":visible") ) {
+ if ( !this.menu.element.is( ":visible" ) ) {
this.search( null, event );
return;
}
- if ( this.menu.first() && /^previous/.test(direction) ||
- this.menu.last() && /^next/.test(direction) ) {
- this.element.val( this.term );
- this.menu.deactivate();
+ if ( this.menu.isFirstItem() && /^previous/.test( direction ) ||
+ this.menu.isLastItem() && /^next/.test( direction ) ) {
+
+ if ( !this.isMultiLine ) {
+ this._value( this.term );
+ }
+
+ this.menu.blur();
return;
}
this.menu[ direction ]( event );
widget: function() {
return this.menu.element;
},
+
+ _value: function() {
+ return this.valueMethod.apply( this.element, arguments );
+ },
+
_keyEvent: function( keyEvent, event ) {
if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
this._move( keyEvent, event );
- // prevents moving cursor to beginning/end of the text field in some browsers
+ // Prevents moving cursor to beginning/end of the text field in some browsers
event.preventDefault();
}
+ },
+
+ // Support: Chrome <=50
+ // We should be able to just use this.element.prop( "isContentEditable" )
+ // but hidden elements always report false in Chrome.
+ // https://code.google.com/p/chromium/issues/detail?id=313082
+ _isContentEditable: function( element ) {
+ if ( !element.length ) {
+ return false;
+ }
+
+ var editable = element.prop( "contentEditable" );
+
+ if ( editable === "inherit" ) {
+ return this._isContentEditable( element.parent() );
+ }
+
+ return editable === "true";
}
-});
+} );
$.extend( $.ui.autocomplete, {
escapeRegex: function( value ) {
- return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" );
},
- filter: function(array, term) {
- var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
- return $.grep( array, function(value) {
+ filter: function( array, term ) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex( term ), "i" );
+ return $.grep( array, function( value ) {
return matcher.test( value.label || value.value || value );
- });
+ } );
}
-});
+} );
-}( jQuery ));
+// Live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+$.widget( "ui.autocomplete", $.ui.autocomplete, {
+ options: {
+ messages: {
+ noResults: "No search results.",
+ results: function( amount ) {
+ return amount + ( amount > 1 ? " results are" : " result is" ) +
+ " available, use up and down arrow keys to navigate.";
+ }
+ }
+ },
-/*
- * jQuery UI Menu (not officially released)
- *
- * This widget isn't yet finished and the API is subject to change. We plan to finish
- * it for the next release. You're welcome to give it a try anyway and give us feedback,
- * as long as you're okay with migrating your code later on. We can help with that, too.
+ __response: function( content ) {
+ var message;
+ this._superApply( arguments );
+ if ( this.options.disabled || this.cancelSearch ) {
+ return;
+ }
+ if ( content && content.length ) {
+ message = this.options.messages.results( content.length );
+ } else {
+ message = this.options.messages.noResults;
+ }
+ this.liveRegion.children().hide();
+ $( "<div>" ).text( message ).appendTo( this.liveRegion );
+ }
+} );
+
+var widgetsAutocomplete = $.ui.autocomplete;
+
+
+/*!
+ * jQuery UI Controlgroup 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Menu
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
*/
-(function($) {
-$.widget("ui.menu", {
- _create: function() {
- var self = this;
- this.element
- .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
- .attr({
- role: "listbox",
- "aria-activedescendant": "ui-active-menuitem"
- })
- .click(function( event ) {
- if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
- return;
- }
- // temporary
- event.preventDefault();
- self.select( event );
- });
- this.refresh();
- },
-
- refresh: function() {
- var self = this;
-
- // don't refresh list items that are already adapted
- var items = this.element.children("li:not(.ui-menu-item):has(a)")
- .addClass("ui-menu-item")
- .attr("role", "menuitem");
-
- items.children("a")
- .addClass("ui-corner-all")
- .attr("tabindex", -1)
- // mouseenter doesn't work with event delegation
- .mouseenter(function( event ) {
- self.activate( event, $(this).parent() );
- })
- .mouseleave(function() {
- self.deactivate();
- });
- },
-
- activate: function( event, item ) {
- this.deactivate();
- if (this.hasScroll()) {
- var offset = item.offset().top - this.element.offset().top,
- scroll = this.element.scrollTop(),
- elementHeight = this.element.height();
- if (offset < 0) {
- this.element.scrollTop( scroll + offset);
- } else if (offset >= elementHeight) {
- this.element.scrollTop( scroll + offset - elementHeight + item.height());
- }
- }
- this.active = item.eq(0)
- .children("a")
- .addClass("ui-state-hover")
- .attr("id", "ui-active-menuitem")
- .end();
- this._trigger("focus", event, { item: item });
- },
-
- deactivate: function() {
- if (!this.active) { return; }
-
- this.active.children("a")
- .removeClass("ui-state-hover")
- .removeAttr("id");
- this._trigger("blur");
- this.active = null;
- },
+//>>label: Controlgroup
+//>>group: Widgets
+//>>description: Visually groups form control widgets
+//>>docs: http://api.jqueryui.com/controlgroup/
+//>>demos: http://jqueryui.com/controlgroup/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/controlgroup.css
+//>>css.theme: ../../themes/base/theme.css
- next: function(event) {
- this.move("next", ".ui-menu-item:first", event);
- },
- previous: function(event) {
- this.move("prev", ".ui-menu-item:last", event);
+var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g;
+
+var widgetsControlgroup = $.widget( "ui.controlgroup", {
+ version: "1.12.1",
+ defaultElement: "<div>",
+ options: {
+ direction: "horizontal",
+ disabled: null,
+ onlyVisible: true,
+ items: {
+ "button": "input[type=button], input[type=submit], input[type=reset], button, a",
+ "controlgroupLabel": ".ui-controlgroup-label",
+ "checkboxradio": "input[type='checkbox'], input[type='radio']",
+ "selectmenu": "select",
+ "spinner": ".ui-spinner-input"
+ }
},
- first: function() {
- return this.active && !this.active.prevAll(".ui-menu-item").length;
+ _create: function() {
+ this._enhance();
},
- last: function() {
- return this.active && !this.active.nextAll(".ui-menu-item").length;
+ // To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
+ _enhance: function() {
+ this.element.attr( "role", "toolbar" );
+ this.refresh();
},
- move: function(direction, edge, event) {
- if (!this.active) {
- this.activate(event, this.element.children(edge));
- return;
- }
- var next = this.active[direction + "All"](".ui-menu-item").eq(0);
- if (next.length) {
- this.activate(event, next);
- } else {
- this.activate(event, this.element.children(edge));
+ _destroy: function() {
+ this._callChildMethod( "destroy" );
+ this.childWidgets.removeData( "ui-controlgroup-data" );
+ this.element.removeAttr( "role" );
+ if ( this.options.items.controlgroupLabel ) {
+ this.element
+ .find( this.options.items.controlgroupLabel )
+ .find( ".ui-controlgroup-label-contents" )
+ .contents().unwrap();
}
},
- // TODO merge with previousPage
- nextPage: function(event) {
- if (this.hasScroll()) {
- // TODO merge with no-scroll-else
- if (!this.active || this.last()) {
- this.activate(event, this.element.children(".ui-menu-item:first"));
- return;
- }
- var base = this.active.offset().top,
- height = this.element.height(),
- result = this.element.children(".ui-menu-item").filter(function() {
- var close = $(this).offset().top - base - height + $(this).height();
- // TODO improve approximation
- return close < 10 && close > -10;
- });
+ _initWidgets: function() {
+ var that = this,
+ childWidgets = [];
- // TODO try to catch this earlier when scrollTop indicates the last page anyway
- if (!result.length) {
- result = this.element.children(".ui-menu-item:last");
- }
- this.activate(event, result);
- } else {
- this.activate(event, this.element.children(".ui-menu-item")
- .filter(!this.active || this.last() ? ":first" : ":last"));
- }
- },
+ // First we iterate over each of the items options
+ $.each( this.options.items, function( widget, selector ) {
+ var labels;
+ var options = {};
- // TODO merge with nextPage
- previousPage: function(event) {
- if (this.hasScroll()) {
- // TODO merge with no-scroll-else
- if (!this.active || this.first()) {
- this.activate(event, this.element.children(".ui-menu-item:last"));
+ // Make sure the widget has a selector set
+ if ( !selector ) {
return;
}
- var base = this.active.offset().top,
- height = this.element.height(),
- result = this.element.children(".ui-menu-item").filter(function() {
- var close = $(this).offset().top - base + height - $(this).height();
- // TODO improve approximation
- return close < 10 && close > -10;
- });
+ if ( widget === "controlgroupLabel" ) {
+ labels = that.element.find( selector );
+ labels.each( function() {
+ var element = $( this );
- // TODO try to catch this earlier when scrollTop indicates the last page anyway
- if (!result.length) {
- result = this.element.children(".ui-menu-item:first");
+ if ( element.children( ".ui-controlgroup-label-contents" ).length ) {
+ return;
+ }
+ element.contents()
+ .wrapAll( "<span class='ui-controlgroup-label-contents'></span>" );
+ } );
+ that._addClass( labels, null, "ui-widget ui-widget-content ui-state-default" );
+ childWidgets = childWidgets.concat( labels.get() );
+ return;
}
- this.activate(event, result);
- } else {
- this.activate(event, this.element.children(".ui-menu-item")
- .filter(!this.active || this.first() ? ":last" : ":first"));
- }
- },
-
- hasScroll: function() {
- return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
- },
- select: function( event ) {
- this._trigger("selected", event, { item: this.active });
- }
-});
+ // Make sure the widget actually exists
+ if ( !$.fn[ widget ] ) {
+ return;
+ }
-}(jQuery));
-/*!
- * jQuery UI Button 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Button
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
-
-var lastActive, startXPos, startYPos, clickDragged,
- baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
- stateClasses = "ui-state-hover ui-state-active ",
- typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
- formResetHandler = function() {
- var buttons = $( this ).find( ":ui-button" );
- setTimeout(function() {
- buttons.button( "refresh" );
- }, 1 );
- },
- radioGroup = function( radio ) {
- var name = radio.name,
- form = radio.form,
- radios = $( [] );
- if ( name ) {
- if ( form ) {
- radios = $( form ).find( "[name='" + name + "']" );
+ // We assume everything is in the middle to start because we can't determine
+ // first / last elements until all enhancments are done.
+ if ( that[ "_" + widget + "Options" ] ) {
+ options = that[ "_" + widget + "Options" ]( "middle" );
} else {
- radios = $( "[name='" + name + "']", radio.ownerDocument )
- .filter(function() {
- return !this.form;
- });
+ options = { classes: {} };
}
- }
- return radios;
- };
-
-$.widget( "ui.button", {
- options: {
- disabled: null,
- text: true,
- label: null,
- icons: {
- primary: null,
- secondary: null
- }
- },
- _create: function() {
- this.element.closest( "form" )
- .unbind( "reset.button" )
- .bind( "reset.button", formResetHandler );
-
- if ( typeof this.options.disabled !== "boolean" ) {
- this.options.disabled = !!this.element.propAttr( "disabled" );
- } else {
- this.element.propAttr( "disabled", this.options.disabled );
- }
- this._determineButtonType();
- this.hasTitle = !!this.buttonElement.attr( "title" );
+ // Find instances of this widget inside controlgroup and init them
+ that.element
+ .find( selector )
+ .each( function() {
+ var element = $( this );
+ var instance = element[ widget ]( "instance" );
- var self = this,
- options = this.options,
- toggleButton = this.type === "checkbox" || this.type === "radio",
- hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
- focusClass = "ui-state-focus";
-
- if ( options.label === null ) {
- options.label = this.buttonElement.html();
- }
-
- this.buttonElement
- .addClass( baseClasses )
- .attr( "role", "button" )
- .bind( "mouseenter.button", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).addClass( "ui-state-hover" );
- if ( this === lastActive ) {
- $( this ).addClass( "ui-state-active" );
- }
- })
- .bind( "mouseleave.button", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).removeClass( hoverClass );
- })
- .bind( "click.button", function( event ) {
- if ( options.disabled ) {
- event.preventDefault();
- event.stopImmediatePropagation();
- }
- });
+ // We need to clone the default options for this type of widget to avoid
+ // polluting the variable options which has a wider scope than a single widget.
+ var instanceOptions = $.widget.extend( {}, options );
- this.element
- .bind( "focus.button", function() {
- // no need to check disabled, focus won't be triggered anyway
- self.buttonElement.addClass( focusClass );
- })
- .bind( "blur.button", function() {
- self.buttonElement.removeClass( focusClass );
- });
-
- if ( toggleButton ) {
- this.element.bind( "change.button", function() {
- if ( clickDragged ) {
- return;
- }
- self.refresh();
- });
- // if mouse moves between mousedown and mouseup (drag) set clickDragged flag
- // prevents issue where button state changes but checkbox/radio checked state
- // does not in Firefox (see ticket #6970)
- this.buttonElement
- .bind( "mousedown.button", function( event ) {
- if ( options.disabled ) {
- return;
- }
- clickDragged = false;
- startXPos = event.pageX;
- startYPos = event.pageY;
- })
- .bind( "mouseup.button", function( event ) {
- if ( options.disabled ) {
+ // If the button is the child of a spinner ignore it
+ // TODO: Find a more generic solution
+ if ( widget === "button" && element.parent( ".ui-spinner" ).length ) {
return;
}
- if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
- clickDragged = true;
- }
- });
- }
- if ( this.type === "checkbox" ) {
- this.buttonElement.bind( "click.button", function() {
- if ( options.disabled || clickDragged ) {
- return false;
- }
- $( this ).toggleClass( "ui-state-active" );
- self.buttonElement.attr( "aria-pressed", self.element[0].checked );
- });
- } else if ( this.type === "radio" ) {
- this.buttonElement.bind( "click.button", function() {
- if ( options.disabled || clickDragged ) {
- return false;
- }
- $( this ).addClass( "ui-state-active" );
- self.buttonElement.attr( "aria-pressed", "true" );
-
- var radio = self.element[ 0 ];
- radioGroup( radio )
- .not( radio )
- .map(function() {
- return $( this ).button( "widget" )[ 0 ];
- })
- .removeClass( "ui-state-active" )
- .attr( "aria-pressed", "false" );
- });
- } else {
- this.buttonElement
- .bind( "mousedown.button", function() {
- if ( options.disabled ) {
- return false;
- }
- $( this ).addClass( "ui-state-active" );
- lastActive = this;
- $( document ).one( "mouseup", function() {
- lastActive = null;
- });
- })
- .bind( "mouseup.button", function() {
- if ( options.disabled ) {
- return false;
- }
- $( this ).removeClass( "ui-state-active" );
- })
- .bind( "keydown.button", function(event) {
- if ( options.disabled ) {
- return false;
+ // Create the widget if it doesn't exist
+ if ( !instance ) {
+ instance = element[ widget ]()[ widget ]( "instance" );
}
- if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
- $( this ).addClass( "ui-state-active" );
+ if ( instance ) {
+ instanceOptions.classes =
+ that._resolveClassesValues( instanceOptions.classes, instance );
}
- })
- .bind( "keyup.button", function() {
- $( this ).removeClass( "ui-state-active" );
- });
+ element[ widget ]( instanceOptions );
- if ( this.buttonElement.is("a") ) {
- this.buttonElement.keyup(function(event) {
- if ( event.keyCode === $.ui.keyCode.SPACE ) {
- // TODO pass through original event correctly (just as 2nd argument doesn't work)
- $( this ).click();
- }
- });
+ // Store an instance of the controlgroup to be able to reference
+ // from the outermost element for changing options and refresh
+ var widgetElement = element[ widget ]( "widget" );
+ $.data( widgetElement[ 0 ], "ui-controlgroup-data",
+ instance ? instance : element[ widget ]( "instance" ) );
+
+ childWidgets.push( widgetElement[ 0 ] );
+ } );
+ } );
+
+ this.childWidgets = $( $.unique( childWidgets ) );
+ this._addClass( this.childWidgets, "ui-controlgroup-item" );
+ },
+
+ _callChildMethod: function( method ) {
+ this.childWidgets.each( function() {
+ var element = $( this ),
+ data = element.data( "ui-controlgroup-data" );
+ if ( data && data[ method ] ) {
+ data[ method ]();
}
- }
+ } );
+ },
- // TODO: pull out $.Widget's handling for the disabled option into
- // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
- // be overridden by individual plugins
- this._setOption( "disabled", options.disabled );
- this._resetButton();
+ _updateCornerClass: function( element, position ) {
+ var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all";
+ var add = this._buildSimpleOptions( position, "label" ).classes.label;
+
+ this._removeClass( element, null, remove );
+ this._addClass( element, null, add );
},
- _determineButtonType: function() {
+ _buildSimpleOptions: function( position, key ) {
+ var direction = this.options.direction === "vertical";
+ var result = {
+ classes: {}
+ };
+ result.classes[ key ] = {
+ "middle": "",
+ "first": "ui-corner-" + ( direction ? "top" : "left" ),
+ "last": "ui-corner-" + ( direction ? "bottom" : "right" ),
+ "only": "ui-corner-all"
+ }[ position ];
- if ( this.element.is(":checkbox") ) {
- this.type = "checkbox";
- } else if ( this.element.is(":radio") ) {
- this.type = "radio";
- } else if ( this.element.is("input") ) {
- this.type = "input";
- } else {
- this.type = "button";
- }
+ return result;
+ },
- if ( this.type === "checkbox" || this.type === "radio" ) {
- // we don't search against the document in case the element
- // is disconnected from the DOM
- var ancestor = this.element.parents().filter(":last"),
- labelSelector = "label[for='" + this.element.attr("id") + "']";
- this.buttonElement = ancestor.find( labelSelector );
- if ( !this.buttonElement.length ) {
- ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
- this.buttonElement = ancestor.filter( labelSelector );
- if ( !this.buttonElement.length ) {
- this.buttonElement = ancestor.find( labelSelector );
- }
- }
- this.element.addClass( "ui-helper-hidden-accessible" );
+ _spinnerOptions: function( position ) {
+ var options = this._buildSimpleOptions( position, "ui-spinner" );
- var checked = this.element.is( ":checked" );
- if ( checked ) {
- this.buttonElement.addClass( "ui-state-active" );
- }
- this.buttonElement.attr( "aria-pressed", checked );
- } else {
- this.buttonElement = this.element;
- }
+ options.classes[ "ui-spinner-up" ] = "";
+ options.classes[ "ui-spinner-down" ] = "";
+
+ return options;
},
- widget: function() {
- return this.buttonElement;
+ _buttonOptions: function( position ) {
+ return this._buildSimpleOptions( position, "ui-button" );
},
- destroy: function() {
- this.element
- .removeClass( "ui-helper-hidden-accessible" );
- this.buttonElement
- .removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
- .removeAttr( "role" )
- .removeAttr( "aria-pressed" )
- .html( this.buttonElement.find(".ui-button-text").html() );
+ _checkboxradioOptions: function( position ) {
+ return this._buildSimpleOptions( position, "ui-checkboxradio-label" );
+ },
- if ( !this.hasTitle ) {
- this.buttonElement.removeAttr( "title" );
- }
+ _selectmenuOptions: function( position ) {
+ var direction = this.options.direction === "vertical";
+ return {
+ width: direction ? "auto" : false,
+ classes: {
+ middle: {
+ "ui-selectmenu-button-open": "",
+ "ui-selectmenu-button-closed": ""
+ },
+ first: {
+ "ui-selectmenu-button-open": "ui-corner-" + ( direction ? "top" : "tl" ),
+ "ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "top" : "left" )
+ },
+ last: {
+ "ui-selectmenu-button-open": direction ? "" : "ui-corner-tr",
+ "ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "bottom" : "right" )
+ },
+ only: {
+ "ui-selectmenu-button-open": "ui-corner-top",
+ "ui-selectmenu-button-closed": "ui-corner-all"
+ }
+
+ }[ position ]
+ };
+ },
- $.Widget.prototype.destroy.call( this );
+ _resolveClassesValues: function( classes, instance ) {
+ var result = {};
+ $.each( classes, function( key ) {
+ var current = instance.options.classes[ key ] || "";
+ current = $.trim( current.replace( controlgroupCornerRegex, "" ) );
+ result[ key ] = ( current + " " + classes[ key ] ).replace( /\s+/g, " " );
+ } );
+ return result;
},
_setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "direction" ) {
+ this._removeClass( "ui-controlgroup-" + this.options.direction );
+ }
+
+ this._super( key, value );
if ( key === "disabled" ) {
- if ( value ) {
- this.element.propAttr( "disabled", true );
- } else {
- this.element.propAttr( "disabled", false );
- }
+ this._callChildMethod( value ? "disable" : "enable" );
return;
}
- this._resetButton();
+
+ this.refresh();
},
refresh: function() {
- var isDisabled = this.element.is( ":disabled" );
- if ( isDisabled !== this.options.disabled ) {
- this._setOption( "disabled", isDisabled );
- }
- if ( this.type === "radio" ) {
- radioGroup( this.element[0] ).each(function() {
- if ( $( this ).is( ":checked" ) ) {
- $( this ).button( "widget" )
- .addClass( "ui-state-active" )
- .attr( "aria-pressed", "true" );
- } else {
- $( this ).button( "widget" )
- .removeClass( "ui-state-active" )
- .attr( "aria-pressed", "false" );
- }
- });
- } else if ( this.type === "checkbox" ) {
- if ( this.element.is( ":checked" ) ) {
- this.buttonElement
- .addClass( "ui-state-active" )
- .attr( "aria-pressed", "true" );
- } else {
- this.buttonElement
- .removeClass( "ui-state-active" )
- .attr( "aria-pressed", "false" );
- }
- }
- },
+ var children,
+ that = this;
- _resetButton: function() {
- if ( this.type === "input" ) {
- if ( this.options.label ) {
- this.element.val( this.options.label );
- }
- return;
+ this._addClass( "ui-controlgroup ui-controlgroup-" + this.options.direction );
+
+ if ( this.options.direction === "horizontal" ) {
+ this._addClass( null, "ui-helper-clearfix" );
}
- var buttonElement = this.buttonElement.removeClass( typeClasses ),
- buttonText = $( "<span></span>", this.element[0].ownerDocument )
- .addClass( "ui-button-text" )
- .html( this.options.label )
- .appendTo( buttonElement.empty() )
- .text(),
- icons = this.options.icons,
- multipleIcons = icons.primary && icons.secondary,
- buttonClasses = [];
+ this._initWidgets();
- if ( icons.primary || icons.secondary ) {
- if ( this.options.text ) {
- buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
- }
+ children = this.childWidgets;
- if ( icons.primary ) {
- buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
- }
+ // We filter here because we need to track all childWidgets not just the visible ones
+ if ( this.options.onlyVisible ) {
+ children = children.filter( ":visible" );
+ }
- if ( icons.secondary ) {
- buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
- }
+ if ( children.length ) {
- if ( !this.options.text ) {
- buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+ // We do this last because we need to make sure all enhancment is done
+ // before determining first and last
+ $.each( [ "first", "last" ], function( index, value ) {
+ var instance = children[ value ]().data( "ui-controlgroup-data" );
- if ( !this.hasTitle ) {
- buttonElement.attr( "title", buttonText );
+ if ( instance && that[ "_" + instance.widgetName + "Options" ] ) {
+ var options = that[ "_" + instance.widgetName + "Options" ](
+ children.length === 1 ? "only" : value
+ );
+ options.classes = that._resolveClassesValues( options.classes, instance );
+ instance.element[ instance.widgetName ]( options );
+ } else {
+ that._updateCornerClass( children[ value ](), value );
}
- }
- } else {
- buttonClasses.push( "ui-button-text-only" );
- }
- buttonElement.addClass( buttonClasses.join( " " ) );
- }
-});
-
-$.widget( "ui.buttonset", {
- options: {
- items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
- },
-
- _create: function() {
- this.element.addClass( "ui-buttonset" );
- },
-
- _init: function() {
- this.refresh();
- },
+ } );
- _setOption: function( key, value ) {
- if ( key === "disabled" ) {
- this.buttons.button( "option", key, value );
+ // Finally call the refresh method on each of the child widgets.
+ this._callChildMethod( "refresh" );
}
-
- $.Widget.prototype._setOption.apply( this, arguments );
- },
-
- refresh: function() {
- var rtl = this.element.css( "direction" ) === "rtl";
-
- this.buttons = this.element.find( this.options.items )
- .filter( ":ui-button" )
- .button( "refresh" )
- .end()
- .not( ":ui-button" )
- .button()
- .end()
- .map(function() {
- return $( this ).button( "widget" )[ 0 ];
- })
- .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
- .filter( ":first" )
- .addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
- .end()
- .filter( ":last" )
- .addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
- .end()
- .end();
- },
-
- destroy: function() {
- this.element.removeClass( "ui-buttonset" );
- this.buttons
- .map(function() {
- return $( this ).button( "widget" )[ 0 ];
- })
- .removeClass( "ui-corner-left ui-corner-right" )
- .end()
- .button( "destroy" );
-
- $.Widget.prototype.destroy.call( this );
}
-});
+} );
-}( jQuery ) );
/*!
- * jQuery UI Dialog 1.8.21
+ * jQuery UI Checkboxradio 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.button.js
- * jquery.ui.draggable.js
- * jquery.ui.mouse.js
- * jquery.ui.position.js
- * jquery.ui.resizable.js
*/
-(function( $, undefined ) {
-
-var uiDialogClasses =
- 'ui-dialog ' +
- 'ui-widget ' +
- 'ui-widget-content ' +
- 'ui-corner-all ',
- sizeRelatedOptions = {
- buttons: true,
- height: true,
- maxHeight: true,
- maxWidth: true,
- minHeight: true,
- minWidth: true,
- width: true
- },
- resizableRelatedOptions = {
- maxHeight: true,
- maxWidth: true,
- minHeight: true,
- minWidth: true
- },
- // support for jQuery 1.3.2 - handle common attrFn methods for dialog
- attrFn = $.attrFn || {
- val: true,
- css: true,
- html: true,
- text: true,
- data: true,
- width: true,
- height: true,
- offset: true,
- click: true
- };
-$.widget("ui.dialog", {
+//>>label: Checkboxradio
+//>>group: Widgets
+//>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
+//>>docs: http://api.jqueryui.com/checkboxradio/
+//>>demos: http://jqueryui.com/checkboxradio/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.structure: ../../themes/base/checkboxradio.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.checkboxradio", [ $.ui.formResetMixin, {
+ version: "1.12.1",
options: {
- autoOpen: true,
- buttons: {},
- closeOnEscape: true,
- closeText: 'close',
- dialogClass: '',
- draggable: true,
- hide: null,
- height: 'auto',
- maxHeight: false,
- maxWidth: false,
- minHeight: 150,
- minWidth: 150,
- modal: false,
- position: {
- my: 'center',
- at: 'center',
- collision: 'fit',
- // ensure that the titlebar is never outside the document
- using: function(pos) {
- var topOffset = $(this).css(pos).offset().top;
- if (topOffset < 0) {
- $(this).css('top', pos.top - topOffset);
- }
- }
- },
- resizable: true,
- show: null,
- stack: true,
- title: '',
- width: 300,
- zIndex: 1000
+ disabled: null,
+ label: null,
+ icon: true,
+ classes: {
+ "ui-checkboxradio-label": "ui-corner-all",
+ "ui-checkboxradio-icon": "ui-corner-all"
+ }
},
- _create: function() {
- this.originalTitle = this.element.attr('title');
- // #5742 - .attr() might return a DOMElement
- if ( typeof this.originalTitle !== "string" ) {
- this.originalTitle = "";
- }
-
- this.options.title = this.options.title || this.originalTitle;
- var self = this,
- options = self.options,
-
- title = options.title || ' ',
- titleId = $.ui.dialog.getTitleId(self.element),
-
- uiDialog = (self.uiDialog = $('<div></div>'))
- .appendTo(document.body)
- .hide()
- .addClass(uiDialogClasses + options.dialogClass)
- .css({
- zIndex: options.zIndex
- })
- // setting tabIndex makes the div focusable
- // setting outline to 0 prevents a border on focus in Mozilla
- .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
- if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
- event.keyCode === $.ui.keyCode.ESCAPE) {
-
- self.close(event);
- event.preventDefault();
- }
- })
- .attr({
- role: 'dialog',
- 'aria-labelledby': titleId
- })
- .mousedown(function(event) {
- self.moveToTop(false, event);
- }),
-
- uiDialogContent = self.element
- .show()
- .removeAttr('title')
- .addClass(
- 'ui-dialog-content ' +
- 'ui-widget-content')
- .appendTo(uiDialog),
-
- uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
- .addClass(
- 'ui-dialog-titlebar ' +
- 'ui-widget-header ' +
- 'ui-corner-all ' +
- 'ui-helper-clearfix'
- )
- .prependTo(uiDialog),
-
- uiDialogTitlebarClose = $('<a href="#"></a>')
- .addClass(
- 'ui-dialog-titlebar-close ' +
- 'ui-corner-all'
- )
- .attr('role', 'button')
- .hover(
- function() {
- uiDialogTitlebarClose.addClass('ui-state-hover');
- },
- function() {
- uiDialogTitlebarClose.removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- uiDialogTitlebarClose.addClass('ui-state-focus');
- })
- .blur(function() {
- uiDialogTitlebarClose.removeClass('ui-state-focus');
- })
- .click(function(event) {
- self.close(event);
- return false;
- })
- .appendTo(uiDialogTitlebar),
+ _getCreateOptions: function() {
+ var disabled, labels;
+ var that = this;
+ var options = this._super() || {};
- uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
- .addClass(
- 'ui-icon ' +
- 'ui-icon-closethick'
- )
- .text(options.closeText)
- .appendTo(uiDialogTitlebarClose),
+ // We read the type here, because it makes more sense to throw a element type error first,
+ // rather then the error for lack of a label. Often if its the wrong type, it
+ // won't have a label (e.g. calling on a div, btn, etc)
+ this._readType();
- uiDialogTitle = $('<span></span>')
- .addClass('ui-dialog-title')
- .attr('id', titleId)
- .html(title)
- .prependTo(uiDialogTitlebar);
+ labels = this.element.labels();
- //handling of deprecated beforeclose (vs beforeClose) option
- //Ticket #4669 http://dev.jqueryui.com/ticket/4669
- //TODO: remove in 1.9pre
- if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
- options.beforeClose = options.beforeclose;
+ // If there are multiple labels, use the last one
+ this.label = $( labels[ labels.length - 1 ] );
+ if ( !this.label.length ) {
+ $.error( "No label found for checkboxradio widget" );
}
- uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+ this.originalLabel = "";
- if (options.draggable && $.fn.draggable) {
- self._makeDraggable();
- }
- if (options.resizable && $.fn.resizable) {
- self._makeResizable();
- }
+ // We need to get the label text but this may also need to make sure it does not contain the
+ // input itself.
+ this.label.contents().not( this.element[ 0 ] ).each( function() {
- self._createButtons(options.buttons);
- self._isOpen = false;
+ // The label contents could be text, html, or a mix. We concat each element to get a
+ // string representation of the label, without the input as part of it.
+ that.originalLabel += this.nodeType === 3 ? $( this ).text() : this.outerHTML;
+ } );
- if ($.fn.bgiframe) {
- uiDialog.bgiframe();
+ // Set the label option if we found label text
+ if ( this.originalLabel ) {
+ options.label = this.originalLabel;
}
- },
- _init: function() {
- if ( this.options.autoOpen ) {
- this.open();
+ disabled = this.element[ 0 ].disabled;
+ if ( disabled != null ) {
+ options.disabled = disabled;
}
+ return options;
},
- destroy: function() {
- var self = this;
-
- if (self.overlay) {
- self.overlay.destroy();
- }
- self.uiDialog.hide();
- self.element
- .unbind('.dialog')
- .removeData('dialog')
- .removeClass('ui-dialog-content ui-widget-content')
- .hide().appendTo('body');
- self.uiDialog.remove();
+ _create: function() {
+ var checked = this.element[ 0 ].checked;
- if (self.originalTitle) {
- self.element.attr('title', self.originalTitle);
- }
+ this._bindFormResetHandler();
- return self;
- },
+ if ( this.options.disabled == null ) {
+ this.options.disabled = this.element[ 0 ].disabled;
+ }
- widget: function() {
- return this.uiDialog;
- },
+ this._setOption( "disabled", this.options.disabled );
+ this._addClass( "ui-checkboxradio", "ui-helper-hidden-accessible" );
+ this._addClass( this.label, "ui-checkboxradio-label", "ui-button ui-widget" );
- close: function(event) {
- var self = this,
- maxZ, thisZ;
-
- if (false === self._trigger('beforeClose', event)) {
- return;
+ if ( this.type === "radio" ) {
+ this._addClass( this.label, "ui-checkboxradio-radio-label" );
}
- if (self.overlay) {
- self.overlay.destroy();
+ if ( this.options.label && this.options.label !== this.originalLabel ) {
+ this._updateLabel();
+ } else if ( this.originalLabel ) {
+ this.options.label = this.originalLabel;
}
- self.uiDialog.unbind('keypress.ui-dialog');
- self._isOpen = false;
+ this._enhance();
- if (self.options.hide) {
- self.uiDialog.hide(self.options.hide, function() {
- self._trigger('close', event);
- });
- } else {
- self.uiDialog.hide();
- self._trigger('close', event);
+ if ( checked ) {
+ this._addClass( this.label, "ui-checkboxradio-checked", "ui-state-active" );
+ if ( this.icon ) {
+ this._addClass( this.icon, null, "ui-state-hover" );
+ }
}
- $.ui.dialog.overlay.resize();
+ this._on( {
+ change: "_toggleClasses",
+ focus: function() {
+ this._addClass( this.label, null, "ui-state-focus ui-visual-focus" );
+ },
+ blur: function() {
+ this._removeClass( this.label, null, "ui-state-focus ui-visual-focus" );
+ }
+ } );
+ },
- // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- if (self.options.modal) {
- maxZ = 0;
- $('.ui-dialog').each(function() {
- if (this !== self.uiDialog[0]) {
- thisZ = $(this).css('z-index');
- if(!isNaN(thisZ)) {
- maxZ = Math.max(maxZ, thisZ);
- }
- }
- });
- $.ui.dialog.maxZ = maxZ;
+ _readType: function() {
+ var nodeName = this.element[ 0 ].nodeName.toLowerCase();
+ this.type = this.element[ 0 ].type;
+ if ( nodeName !== "input" || !/radio|checkbox/.test( this.type ) ) {
+ $.error( "Can't create checkboxradio on element.nodeName=" + nodeName +
+ " and element.type=" + this.type );
}
+ },
- return self;
+ // Support jQuery Mobile enhanced option
+ _enhance: function() {
+ this._updateIcon( this.element[ 0 ].checked );
},
- isOpen: function() {
- return this._isOpen;
+ widget: function() {
+ return this.label;
},
- // the force parameter allows us to move modal dialogs to their correct
- // position on open
- moveToTop: function(force, event) {
- var self = this,
- options = self.options,
- saveScroll;
+ _getRadioGroup: function() {
+ var group;
+ var name = this.element[ 0 ].name;
+ var nameSelector = "input[name='" + $.ui.escapeSelector( name ) + "']";
- if ((options.modal && !force) ||
- (!options.stack && !options.modal)) {
- return self._trigger('focus', event);
+ if ( !name ) {
+ return $( [] );
}
- if (options.zIndex > $.ui.dialog.maxZ) {
- $.ui.dialog.maxZ = options.zIndex;
- }
- if (self.overlay) {
- $.ui.dialog.maxZ += 1;
- self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
- }
+ if ( this.form.length ) {
+ group = $( this.form[ 0 ].elements ).filter( nameSelector );
+ } else {
- //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
- // http://ui.jquery.com/bugs/ticket/3193
- saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
- $.ui.dialog.maxZ += 1;
- self.uiDialog.css('z-index', $.ui.dialog.maxZ);
- self.element.attr(saveScroll);
- self._trigger('focus', event);
+ // Not inside a form, check all inputs that also are not inside a form
+ group = $( nameSelector ).filter( function() {
+ return $( this ).form().length === 0;
+ } );
+ }
- return self;
+ return group.not( this.element );
},
- open: function() {
- if (this._isOpen) { return; }
-
- var self = this,
- options = self.options,
- uiDialog = self.uiDialog;
-
- self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
- self._size();
- self._position(options.position);
- uiDialog.show(options.show);
- self.moveToTop(true);
-
- // prevent tabbing out of modal dialogs
- if ( options.modal ) {
- uiDialog.bind( "keydown.ui-dialog", function( event ) {
- if ( event.keyCode !== $.ui.keyCode.TAB ) {
- return;
- }
+ _toggleClasses: function() {
+ var checked = this.element[ 0 ].checked;
+ this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
- var tabbables = $(':tabbable', this),
- first = tabbables.filter(':first'),
- last = tabbables.filter(':last');
+ if ( this.options.icon && this.type === "checkbox" ) {
+ this._toggleClass( this.icon, null, "ui-icon-check ui-state-checked", checked )
+ ._toggleClass( this.icon, null, "ui-icon-blank", !checked );
+ }
- if (event.target === last[0] && !event.shiftKey) {
- first.focus(1);
- return false;
- } else if (event.target === first[0] && event.shiftKey) {
- last.focus(1);
- return false;
- }
- });
- }
-
- // set focus to the first tabbable element in the content area or the first button
- // if there are no tabbable elements, set focus on the dialog itself
- $(self.element.find(':tabbable').get().concat(
- uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
- uiDialog.get()))).eq(0).focus();
-
- self._isOpen = true;
- self._trigger('open');
-
- return self;
- },
-
- _createButtons: function(buttons) {
- var self = this,
- hasButtons = false,
- uiDialogButtonPane = $('<div></div>')
- .addClass(
- 'ui-dialog-buttonpane ' +
- 'ui-widget-content ' +
- 'ui-helper-clearfix'
- ),
- uiButtonSet = $( "<div></div>" )
- .addClass( "ui-dialog-buttonset" )
- .appendTo( uiDialogButtonPane );
-
- // if we already have a button pane, remove it
- self.uiDialog.find('.ui-dialog-buttonpane').remove();
-
- if (typeof buttons === 'object' && buttons !== null) {
- $.each(buttons, function() {
- return !(hasButtons = true);
- });
- }
- if (hasButtons) {
- $.each(buttons, function(name, props) {
- props = $.isFunction( props ) ?
- { click: props, text: name } :
- props;
- var button = $('<button type="button"></button>')
- .click(function() {
- props.click.apply(self.element[0], arguments);
- })
- .appendTo(uiButtonSet);
- // can't use .attr( props, true ) with jQuery 1.3.2.
- $.each( props, function( key, value ) {
- if ( key === "click" ) {
- return;
- }
- if ( key in attrFn ) {
- button[ key ]( value );
- } else {
- button.attr( key, value );
+ if ( this.type === "radio" ) {
+ this._getRadioGroup()
+ .each( function() {
+ var instance = $( this ).checkboxradio( "instance" );
+
+ if ( instance ) {
+ instance._removeClass( instance.label,
+ "ui-checkboxradio-checked", "ui-state-active" );
}
- });
- if ($.fn.button) {
- button.button();
- }
- });
- uiDialogButtonPane.appendTo(self.uiDialog);
+ } );
}
},
- _makeDraggable: function() {
- var self = this,
- options = self.options,
- doc = $(document),
- heightBeforeDrag;
+ _destroy: function() {
+ this._unbindFormResetHandler();
- function filteredUi(ui) {
- return {
- position: ui.position,
- offset: ui.offset
- };
+ if ( this.icon ) {
+ this.icon.remove();
+ this.iconSpace.remove();
}
-
- self.uiDialog.draggable({
- cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
- handle: '.ui-dialog-titlebar',
- containment: 'document',
- start: function(event, ui) {
- heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
- $(this).height($(this).height()).addClass("ui-dialog-dragging");
- self._trigger('dragStart', event, filteredUi(ui));
- },
- drag: function(event, ui) {
- self._trigger('drag', event, filteredUi(ui));
- },
- stop: function(event, ui) {
- options.position = [ui.position.left - doc.scrollLeft(),
- ui.position.top - doc.scrollTop()];
- $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
- self._trigger('dragStop', event, filteredUi(ui));
- $.ui.dialog.overlay.resize();
- }
- });
},
- _makeResizable: function(handles) {
- handles = (handles === undefined ? this.options.resizable : handles);
- var self = this,
- options = self.options,
- // .ui-resizable has position: relative defined in the stylesheet
- // but dialogs have to use absolute or fixed positioning
- position = self.uiDialog.css('position'),
- resizeHandles = (typeof handles === 'string' ?
- handles :
- 'n,e,s,w,se,sw,ne,nw'
- );
+ _setOption: function( key, value ) {
- function filteredUi(ui) {
- return {
- originalPosition: ui.originalPosition,
- originalSize: ui.originalSize,
- position: ui.position,
- size: ui.size
- };
+ // We don't allow the value to be set to nothing
+ if ( key === "label" && !value ) {
+ return;
}
- self.uiDialog.resizable({
- cancel: '.ui-dialog-content',
- containment: 'document',
- alsoResize: self.element,
- maxWidth: options.maxWidth,
- maxHeight: options.maxHeight,
- minWidth: options.minWidth,
- minHeight: self._minHeight(),
- handles: resizeHandles,
- start: function(event, ui) {
- $(this).addClass("ui-dialog-resizing");
- self._trigger('resizeStart', event, filteredUi(ui));
- },
- resize: function(event, ui) {
- self._trigger('resize', event, filteredUi(ui));
- },
- stop: function(event, ui) {
- $(this).removeClass("ui-dialog-resizing");
- options.height = $(this).height();
- options.width = $(this).width();
- self._trigger('resizeStop', event, filteredUi(ui));
- $.ui.dialog.overlay.resize();
- }
- })
- .css('position', position)
- .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
- },
+ this._super( key, value );
- _minHeight: function() {
- var options = this.options;
+ if ( key === "disabled" ) {
+ this._toggleClass( this.label, null, "ui-state-disabled", value );
+ this.element[ 0 ].disabled = value;
- if (options.height === 'auto') {
- return options.minHeight;
- } else {
- return Math.min(options.minHeight, options.height);
+ // Don't refresh when setting disabled
+ return;
}
+ this.refresh();
},
- _position: function(position) {
- var myAt = [],
- offset = [0, 0],
- isVisible;
-
- if (position) {
- // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
- // if (typeof position == 'string' || $.isArray(position)) {
- // myAt = $.isArray(position) ? position : position.split(' ');
-
- if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
- myAt = position.split ? position.split(' ') : [position[0], position[1]];
- if (myAt.length === 1) {
- myAt[1] = myAt[0];
- }
-
- $.each(['left', 'top'], function(i, offsetPosition) {
- if (+myAt[i] === myAt[i]) {
- offset[i] = myAt[i];
- myAt[i] = offsetPosition;
- }
- });
+ _updateIcon: function( checked ) {
+ var toAdd = "ui-icon ui-icon-background ";
- position = {
- my: myAt.join(" "),
- at: myAt.join(" "),
- offset: offset.join(" ")
- };
- }
+ if ( this.options.icon ) {
+ if ( !this.icon ) {
+ this.icon = $( "<span>" );
+ this.iconSpace = $( "<span> </span>" );
+ this._addClass( this.iconSpace, "ui-checkboxradio-icon-space" );
+ }
- position = $.extend({}, $.ui.dialog.prototype.options.position, position);
- } else {
- position = $.ui.dialog.prototype.options.position;
+ if ( this.type === "checkbox" ) {
+ toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank";
+ this._removeClass( this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check" );
+ } else {
+ toAdd += "ui-icon-blank";
+ }
+ this._addClass( this.icon, "ui-checkboxradio-icon", toAdd );
+ if ( !checked ) {
+ this._removeClass( this.icon, null, "ui-icon-check ui-state-checked" );
+ }
+ this.icon.prependTo( this.label ).after( this.iconSpace );
+ } else if ( this.icon !== undefined ) {
+ this.icon.remove();
+ this.iconSpace.remove();
+ delete this.icon;
}
+ },
- // need to show the dialog to get the actual offset in the position plugin
- isVisible = this.uiDialog.is(':visible');
- if (!isVisible) {
- this.uiDialog.show();
+ _updateLabel: function() {
+
+ // Remove the contents of the label ( minus the icon, icon space, and input )
+ var contents = this.label.contents().not( this.element[ 0 ] );
+ if ( this.icon ) {
+ contents = contents.not( this.icon[ 0 ] );
}
- this.uiDialog
- // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
- .css({ top: 0, left: 0 })
- .position($.extend({ of: window }, position));
- if (!isVisible) {
- this.uiDialog.hide();
+ if ( this.iconSpace ) {
+ contents = contents.not( this.iconSpace[ 0 ] );
}
- },
+ contents.remove();
- _setOptions: function( options ) {
- var self = this,
- resizableOptions = {},
- resize = false;
+ this.label.append( this.options.label );
+ },
- $.each( options, function( key, value ) {
- self._setOption( key, value );
-
- if ( key in sizeRelatedOptions ) {
- resize = true;
- }
- if ( key in resizableRelatedOptions ) {
- resizableOptions[ key ] = value;
- }
- });
+ refresh: function() {
+ var checked = this.element[ 0 ].checked,
+ isDisabled = this.element[ 0 ].disabled;
- if ( resize ) {
- this._size();
+ this._updateIcon( checked );
+ this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
+ if ( this.options.label !== null ) {
+ this._updateLabel();
}
- if ( this.uiDialog.is( ":data(resizable)" ) ) {
- this.uiDialog.resizable( "option", resizableOptions );
+
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOptions( { "disabled": isDisabled } );
}
- },
+ }
- _setOption: function(key, value){
- var self = this,
- uiDialog = self.uiDialog;
+} ] );
- switch (key) {
- //handling of deprecated beforeclose (vs beforeClose) option
- //Ticket #4669 http://dev.jqueryui.com/ticket/4669
- //TODO: remove in 1.9pre
- case "beforeclose":
- key = "beforeClose";
- break;
- case "buttons":
- self._createButtons(value);
- break;
- case "closeText":
- // ensure that we always pass a string
- self.uiDialogTitlebarCloseText.text("" + value);
- break;
- case "dialogClass":
- uiDialog
- .removeClass(self.options.dialogClass)
- .addClass(uiDialogClasses + value);
- break;
- case "disabled":
- if (value) {
- uiDialog.addClass('ui-dialog-disabled');
- } else {
- uiDialog.removeClass('ui-dialog-disabled');
- }
- break;
- case "draggable":
- var isDraggable = uiDialog.is( ":data(draggable)" );
- if ( isDraggable && !value ) {
- uiDialog.draggable( "destroy" );
- }
-
- if ( !isDraggable && value ) {
- self._makeDraggable();
- }
- break;
- case "position":
- self._position(value);
- break;
- case "resizable":
- // currently resizable, becoming non-resizable
- var isResizable = uiDialog.is( ":data(resizable)" );
- if (isResizable && !value) {
- uiDialog.resizable('destroy');
- }
+var widgetsCheckboxradio = $.ui.checkboxradio;
+
+
+/*!
+ * jQuery UI Button 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Button
+//>>group: Widgets
+//>>description: Enhances a form with themeable buttons.
+//>>docs: http://api.jqueryui.com/button/
+//>>demos: http://jqueryui.com/button/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
- // currently resizable, changing handles
- if (isResizable && typeof value === 'string') {
- uiDialog.resizable('option', 'handles', value);
- }
- // currently non-resizable, becoming resizable
- if (!isResizable && value !== false) {
- self._makeResizable(value);
- }
- break;
- case "title":
- // convert whatever was passed in o a string, for html() to not throw up
- $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
- break;
- }
- $.Widget.prototype._setOption.apply(self, arguments);
+$.widget( "ui.button", {
+ version: "1.12.1",
+ defaultElement: "<button>",
+ options: {
+ classes: {
+ "ui-button": "ui-corner-all"
+ },
+ disabled: null,
+ icon: null,
+ iconPosition: "beginning",
+ label: null,
+ showLabel: true
},
- _size: function() {
- /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
- * divs will both have width and height set, so we need to reset them
- */
- var options = this.options,
- nonContentHeight,
- minContentHeight,
- isVisible = this.uiDialog.is( ":visible" );
+ _getCreateOptions: function() {
+ var disabled,
- // reset content sizing
- this.element.show().css({
- width: 'auto',
- minHeight: 0,
- height: 0
- });
+ // This is to support cases like in jQuery Mobile where the base widget does have
+ // an implementation of _getCreateOptions
+ options = this._super() || {};
- if (options.minWidth > options.width) {
- options.width = options.minWidth;
- }
+ this.isInput = this.element.is( "input" );
- // reset wrapper sizing
- // determine the height of all the non-content elements
- nonContentHeight = this.uiDialog.css({
- height: 'auto',
- width: options.width
- })
- .height();
- minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
-
- if ( options.height === "auto" ) {
- // only needed for IE6 support
- if ( $.support.minHeight ) {
- this.element.css({
- minHeight: minContentHeight,
- height: "auto"
- });
- } else {
- this.uiDialog.show();
- var autoHeight = this.element.css( "height", "auto" ).height();
- if ( !isVisible ) {
- this.uiDialog.hide();
- }
- this.element.height( Math.max( autoHeight, minContentHeight ) );
- }
- } else {
- this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+ disabled = this.element[ 0 ].disabled;
+ if ( disabled != null ) {
+ options.disabled = disabled;
}
- if (this.uiDialog.is(':data(resizable)')) {
- this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ this.originalLabel = this.isInput ? this.element.val() : this.element.html();
+ if ( this.originalLabel ) {
+ options.label = this.originalLabel;
}
- }
-});
-$.extend($.ui.dialog, {
- version: "1.8.21",
+ return options;
+ },
- uuid: 0,
- maxZ: 0,
+ _create: function() {
+ if ( !this.option.showLabel & !this.options.icon ) {
+ this.options.showLabel = true;
+ }
- getTitleId: function($el) {
- var id = $el.attr('id');
- if (!id) {
- this.uuid += 1;
- id = this.uuid;
- }
- return 'ui-dialog-title-' + id;
- },
-
- overlay: function(dialog) {
- this.$el = $.ui.dialog.overlay.create(dialog);
- }
-});
-
-$.extend($.ui.dialog.overlay, {
- instances: [],
- // reuse old instances due to IE memory leak with alpha transparency (see #5185)
- oldInstances: [],
- maxZ: 0,
- events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
- function(event) { return event + '.dialog-overlay'; }).join(' '),
- create: function(dialog) {
- if (this.instances.length === 0) {
- // prevent use of anchors and inputs
- // we use a setTimeout in case the overlay is created from an
- // event that we're going to be cancelling (see #2804)
- setTimeout(function() {
- // handle $(el).dialog().dialog('close') (see #4065)
- if ($.ui.dialog.overlay.instances.length) {
- $(document).bind($.ui.dialog.overlay.events, function(event) {
- // stop events if the z-index of the target is < the z-index of the overlay
- // we cannot return true when we don't want to cancel the event (#3523)
- if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
- return false;
- }
- });
- }
- }, 1);
+ // We have to check the option again here even though we did in _getCreateOptions,
+ // because null may have been passed on init which would override what was set in
+ // _getCreateOptions
+ if ( this.options.disabled == null ) {
+ this.options.disabled = this.element[ 0 ].disabled || false;
+ }
- // allow closing by pressing the escape key
- $(document).bind('keydown.dialog-overlay', function(event) {
- if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
- event.keyCode === $.ui.keyCode.ESCAPE) {
-
- dialog.close(event);
- event.preventDefault();
- }
- });
+ this.hasTitle = !!this.element.attr( "title" );
- // handle window resize
- $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ // Check to see if the label needs to be set or if its already correct
+ if ( this.options.label && this.options.label !== this.originalLabel ) {
+ if ( this.isInput ) {
+ this.element.val( this.options.label );
+ } else {
+ this.element.html( this.options.label );
+ }
}
+ this._addClass( "ui-button", "ui-widget" );
+ this._setOption( "disabled", this.options.disabled );
+ this._enhance();
- var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
- .appendTo(document.body)
- .css({
- width: this.width(),
- height: this.height()
- });
+ if ( this.element.is( "a" ) ) {
+ this._on( {
+ "keyup": function( event ) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ event.preventDefault();
- if ($.fn.bgiframe) {
- $el.bgiframe();
+ // Support: PhantomJS <= 1.9, IE 8 Only
+ // If a native click is available use it so we actually cause navigation
+ // otherwise just trigger a click event
+ if ( this.element[ 0 ].click ) {
+ this.element[ 0 ].click();
+ } else {
+ this.element.trigger( "click" );
+ }
+ }
+ }
+ } );
}
-
- this.instances.push($el);
- return $el;
},
- destroy: function($el) {
- var indexOf = $.inArray($el, this.instances);
- if (indexOf != -1){
- this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+ _enhance: function() {
+ if ( !this.element.is( "button" ) ) {
+ this.element.attr( "role", "button" );
}
- if (this.instances.length === 0) {
- $([document, window]).unbind('.dialog-overlay');
+ if ( this.options.icon ) {
+ this._updateIcon( "icon", this.options.icon );
+ this._updateTooltip();
}
-
- $el.remove();
-
- // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- var maxZ = 0;
- $.each(this.instances, function() {
- maxZ = Math.max(maxZ, this.css('z-index'));
- });
- this.maxZ = maxZ;
},
- height: function() {
- var scrollHeight,
- offsetHeight;
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- scrollHeight = Math.max(
- document.documentElement.scrollHeight,
- document.body.scrollHeight
- );
- offsetHeight = Math.max(
- document.documentElement.offsetHeight,
- document.body.offsetHeight
- );
+ _updateTooltip: function() {
+ this.title = this.element.attr( "title" );
- if (scrollHeight < offsetHeight) {
- return $(window).height() + 'px';
- } else {
- return scrollHeight + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).height() + 'px';
+ if ( !this.options.showLabel && !this.title ) {
+ this.element.attr( "title", this.options.label );
}
},
- width: function() {
- var scrollWidth,
- offsetWidth;
- // handle IE
- if ( $.browser.msie ) {
- scrollWidth = Math.max(
- document.documentElement.scrollWidth,
- document.body.scrollWidth
- );
- offsetWidth = Math.max(
- document.documentElement.offsetWidth,
- document.body.offsetWidth
- );
+ _updateIcon: function( option, value ) {
+ var icon = option !== "iconPosition",
+ position = icon ? this.options.iconPosition : value,
+ displayBlock = position === "top" || position === "bottom";
- if (scrollWidth < offsetWidth) {
- return $(window).width() + 'px';
- } else {
- return scrollWidth + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).width() + 'px';
- }
- },
+ // Create icon
+ if ( !this.icon ) {
+ this.icon = $( "<span>" );
- resize: function() {
- /* If the dialog is draggable and the user drags it past the
- * right edge of the window, the document becomes wider so we
- * need to stretch the overlay. If the user then drags the
- * dialog back to the left, the document will become narrower,
- * so we need to shrink the overlay to the appropriate size.
- * This is handled by shrinking the overlay before setting it
- * to the full document size.
- */
- var $overlays = $([]);
- $.each($.ui.dialog.overlay.instances, function() {
- $overlays = $overlays.add(this);
- });
+ this._addClass( this.icon, "ui-button-icon", "ui-icon" );
- $overlays.css({
- width: 0,
- height: 0
- }).css({
- width: $.ui.dialog.overlay.width(),
- height: $.ui.dialog.overlay.height()
- });
- }
-});
+ if ( !this.options.showLabel ) {
+ this._addClass( "ui-button-icon-only" );
+ }
+ } else if ( icon ) {
-$.extend($.ui.dialog.overlay.prototype, {
- destroy: function() {
- $.ui.dialog.overlay.destroy(this.$el);
- }
-});
+ // If we are updating the icon remove the old icon class
+ this._removeClass( this.icon, null, this.options.icon );
+ }
-}(jQuery));
-/*!
- * jQuery UI Slider 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
+ // If we are updating the icon add the new icon class
+ if ( icon ) {
+ this._addClass( this.icon, null, value );
+ }
-// number of pages in a slider
-// (how many times can you page up/down to go through the whole range)
-var numPages = 5;
+ this._attachIcon( position );
-$.widget( "ui.slider", $.ui.mouse, {
+ // If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
+ // the iconSpace if there is one.
+ if ( displayBlock ) {
+ this._addClass( this.icon, null, "ui-widget-icon-block" );
+ if ( this.iconSpace ) {
+ this.iconSpace.remove();
+ }
+ } else {
- widgetEventPrefix: "slide",
+ // Position is beginning or end so remove the ui-widget-icon-block class and add the
+ // space if it does not exist
+ if ( !this.iconSpace ) {
+ this.iconSpace = $( "<span> </span>" );
+ this._addClass( this.iconSpace, "ui-button-icon-space" );
+ }
+ this._removeClass( this.icon, null, "ui-wiget-icon-block" );
+ this._attachIconSpace( position );
+ }
+ },
- options: {
- animate: false,
- distance: 0,
- max: 100,
- min: 0,
- orientation: "horizontal",
- range: false,
- step: 1,
- value: 0,
- values: null
+ _destroy: function() {
+ this.element.removeAttr( "role" );
+
+ if ( this.icon ) {
+ this.icon.remove();
+ }
+ if ( this.iconSpace ) {
+ this.iconSpace.remove();
+ }
+ if ( !this.hasTitle ) {
+ this.element.removeAttr( "title" );
+ }
},
- _create: function() {
- var self = this,
- o = this.options,
- existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
- handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
- handleCount = ( o.values && o.values.length ) || 1,
- handles = [];
+ _attachIconSpace: function( iconPosition ) {
+ this.icon[ /^(?:end|bottom)/.test( iconPosition ) ? "before" : "after" ]( this.iconSpace );
+ },
- this._keySliding = false;
- this._mouseSliding = false;
- this._animateOff = true;
- this._handleIndex = null;
- this._detectOrientation();
- this._mouseInit();
+ _attachIcon: function( iconPosition ) {
+ this.element[ /^(?:end|bottom)/.test( iconPosition ) ? "append" : "prepend" ]( this.icon );
+ },
- this.element
- .addClass( "ui-slider" +
- " ui-slider-" + this.orientation +
- " ui-widget" +
- " ui-widget-content" +
- " ui-corner-all" +
- ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
+ _setOptions: function( options ) {
+ var newShowLabel = options.showLabel === undefined ?
+ this.options.showLabel :
+ options.showLabel,
+ newIcon = options.icon === undefined ? this.options.icon : options.icon;
- this.range = $([]);
+ if ( !newShowLabel && !newIcon ) {
+ options.showLabel = true;
+ }
+ this._super( options );
+ },
- if ( o.range ) {
- if ( o.range === true ) {
- if ( !o.values ) {
- o.values = [ this._valueMin(), this._valueMin() ];
- }
- if ( o.values.length && o.values.length !== 2 ) {
- o.values = [ o.values[0], o.values[0] ];
+ _setOption: function( key, value ) {
+ if ( key === "icon" ) {
+ if ( value ) {
+ this._updateIcon( key, value );
+ } else if ( this.icon ) {
+ this.icon.remove();
+ if ( this.iconSpace ) {
+ this.iconSpace.remove();
}
}
-
- this.range = $( "<div></div>" )
- .appendTo( this.element )
- .addClass( "ui-slider-range" +
- // note: this isn't the most fittingly semantic framework class for this element,
- // but worked best visually with a variety of themes
- " ui-widget-header" +
- ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
}
- for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
- handles.push( handle );
+ if ( key === "iconPosition" ) {
+ this._updateIcon( key, value );
}
- this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+ // Make sure we can't end up with a button that has neither text nor icon
+ if ( key === "showLabel" ) {
+ this._toggleClass( "ui-button-icon-only", null, !value );
+ this._updateTooltip();
+ }
- this.handle = this.handles.eq( 0 );
+ if ( key === "label" ) {
+ if ( this.isInput ) {
+ this.element.val( value );
+ } else {
- this.handles.add( this.range ).filter( "a" )
- .click(function( event ) {
- event.preventDefault();
- })
- .hover(function() {
- if ( !o.disabled ) {
- $( this ).addClass( "ui-state-hover" );
- }
- }, function() {
- $( this ).removeClass( "ui-state-hover" );
- })
- .focus(function() {
- if ( !o.disabled ) {
- $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
- $( this ).addClass( "ui-state-focus" );
- } else {
- $( this ).blur();
- }
- })
- .blur(function() {
- $( this ).removeClass( "ui-state-focus" );
- });
-
- this.handles.each(function( i ) {
- $( this ).data( "index.ui-slider-handle", i );
- });
-
- this.handles
- .keydown(function( event ) {
- var index = $( this ).data( "index.ui-slider-handle" ),
- allowed,
- curVal,
- newVal,
- step;
-
- if ( self.options.disabled ) {
- return;
- }
-
- switch ( event.keyCode ) {
- case $.ui.keyCode.HOME:
- case $.ui.keyCode.END:
- case $.ui.keyCode.PAGE_UP:
- case $.ui.keyCode.PAGE_DOWN:
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- event.preventDefault();
- if ( !self._keySliding ) {
- self._keySliding = true;
- $( this ).addClass( "ui-state-active" );
- allowed = self._start( event, index );
- if ( allowed === false ) {
- return;
- }
- }
- break;
- }
-
- step = self.options.step;
- if ( self.options.values && self.options.values.length ) {
- curVal = newVal = self.values( index );
- } else {
- curVal = newVal = self.value();
- }
-
- switch ( event.keyCode ) {
- case $.ui.keyCode.HOME:
- newVal = self._valueMin();
- break;
- case $.ui.keyCode.END:
- newVal = self._valueMax();
- break;
- case $.ui.keyCode.PAGE_UP:
- newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
- break;
- case $.ui.keyCode.PAGE_DOWN:
- newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
- break;
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- if ( curVal === self._valueMax() ) {
- return;
- }
- newVal = self._trimAlignValue( curVal + step );
- break;
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- if ( curVal === self._valueMin() ) {
- return;
- }
- newVal = self._trimAlignValue( curVal - step );
- break;
+ // If there is an icon, append it, else nothing then append the value
+ // this avoids removal of the icon when setting label text
+ this.element.html( value );
+ if ( this.icon ) {
+ this._attachIcon( this.options.iconPosition );
+ this._attachIconSpace( this.options.iconPosition );
}
-
- self._slide( event, index, newVal );
- })
- .keyup(function( event ) {
- var index = $( this ).data( "index.ui-slider-handle" );
-
- if ( self._keySliding ) {
- self._keySliding = false;
- self._stop( event, index );
- self._change( event, index );
- $( this ).removeClass( "ui-state-active" );
- }
-
- });
+ }
+ }
- this._refreshValue();
+ this._super( key, value );
- this._animateOff = false;
+ if ( key === "disabled" ) {
+ this._toggleClass( null, "ui-state-disabled", value );
+ this.element[ 0 ].disabled = value;
+ if ( value ) {
+ this.element.blur();
+ }
+ }
},
- destroy: function() {
- this.handles.remove();
- this.range.remove();
-
- this.element
- .removeClass( "ui-slider" +
- " ui-slider-horizontal" +
- " ui-slider-vertical" +
- " ui-slider-disabled" +
- " ui-widget" +
- " ui-widget-content" +
- " ui-corner-all" )
- .removeData( "slider" )
- .unbind( ".slider" );
-
- this._mouseDestroy();
-
- return this;
- },
+ refresh: function() {
- _mouseCapture: function( event ) {
- var o = this.options,
- position,
- normValue,
- distance,
- closestHandle,
- self,
- index,
- allowed,
- offset,
- mouseOverHandle;
+ // Make sure to only check disabled if its an element that supports this otherwise
+ // check for the disabled class to determine state
+ var isDisabled = this.element.is( "input, button" ) ?
+ this.element[ 0 ].disabled : this.element.hasClass( "ui-button-disabled" );
- if ( o.disabled ) {
- return false;
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOptions( { disabled: isDisabled } );
}
- this.elementSize = {
- width: this.element.outerWidth(),
- height: this.element.outerHeight()
- };
- this.elementOffset = this.element.offset();
-
- position = { x: event.pageX, y: event.pageY };
- normValue = this._normValueFromMouse( position );
- distance = this._valueMax() - this._valueMin() + 1;
- self = this;
- this.handles.each(function( i ) {
- var thisDistance = Math.abs( normValue - self.values(i) );
- if ( distance > thisDistance ) {
- distance = thisDistance;
- closestHandle = $( this );
- index = i;
+ this._updateTooltip();
+ }
+} );
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+
+ // Text and Icons options
+ $.widget( "ui.button", $.ui.button, {
+ options: {
+ text: true,
+ icons: {
+ primary: null,
+ secondary: null
}
- });
+ },
- // workaround for bug #3736 (if both handles of a range are at 0,
- // the first is always used as the one with least distance,
- // and moving it is obviously prevented by preventing negative ranges)
- if( o.range === true && this.values(1) === o.min ) {
- index += 1;
- closestHandle = $( this.handles[index] );
- }
+ _create: function() {
+ if ( this.options.showLabel && !this.options.text ) {
+ this.options.showLabel = this.options.text;
+ }
+ if ( !this.options.showLabel && this.options.text ) {
+ this.options.text = this.options.showLabel;
+ }
+ if ( !this.options.icon && ( this.options.icons.primary ||
+ this.options.icons.secondary ) ) {
+ if ( this.options.icons.primary ) {
+ this.options.icon = this.options.icons.primary;
+ } else {
+ this.options.icon = this.options.icons.secondary;
+ this.options.iconPosition = "end";
+ }
+ } else if ( this.options.icon ) {
+ this.options.icons.primary = this.options.icon;
+ }
+ this._super();
+ },
- allowed = this._start( event, index );
- if ( allowed === false ) {
- return false;
+ _setOption: function( key, value ) {
+ if ( key === "text" ) {
+ this._super( "showLabel", value );
+ return;
+ }
+ if ( key === "showLabel" ) {
+ this.options.text = value;
+ }
+ if ( key === "icon" ) {
+ this.options.icons.primary = value;
+ }
+ if ( key === "icons" ) {
+ if ( value.primary ) {
+ this._super( "icon", value.primary );
+ this._super( "iconPosition", "beginning" );
+ } else if ( value.secondary ) {
+ this._super( "icon", value.secondary );
+ this._super( "iconPosition", "end" );
+ }
+ }
+ this._superApply( arguments );
}
- this._mouseSliding = true;
-
- self._handleIndex = index;
+ } );
- closestHandle
- .addClass( "ui-state-active" )
- .focus();
-
- offset = closestHandle.offset();
- mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
- this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
- left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
- top: event.pageY - offset.top -
- ( closestHandle.height() / 2 ) -
- ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
- ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
- ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ $.fn.button = ( function( orig ) {
+ return function() {
+ if ( !this.length || ( this.length && this[ 0 ].tagName !== "INPUT" ) ||
+ ( this.length && this[ 0 ].tagName === "INPUT" && (
+ this.attr( "type" ) !== "checkbox" && this.attr( "type" ) !== "radio"
+ ) ) ) {
+ return orig.apply( this, arguments );
+ }
+ if ( !$.ui.checkboxradio ) {
+ $.error( "Checkboxradio widget missing" );
+ }
+ if ( arguments.length === 0 ) {
+ return this.checkboxradio( {
+ "icon": false
+ } );
+ }
+ return this.checkboxradio.apply( this, arguments );
};
+ } )( $.fn.button );
- if ( !this.handles.hasClass( "ui-state-hover" ) ) {
- this._slide( event, index, normValue );
+ $.fn.buttonset = function() {
+ if ( !$.ui.controlgroup ) {
+ $.error( "Controlgroup widget missing" );
}
- this._animateOff = true;
- return true;
- },
-
- _mouseStart: function( event ) {
- return true;
- },
-
- _mouseDrag: function( event ) {
- var position = { x: event.pageX, y: event.pageY },
- normValue = this._normValueFromMouse( position );
-
- this._slide( event, this._handleIndex, normValue );
+ if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" && arguments[ 2 ] ) {
+ return this.controlgroup.apply( this,
+ [ arguments[ 0 ], "items.button", arguments[ 2 ] ] );
+ }
+ if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" ) {
+ return this.controlgroup.apply( this, [ arguments[ 0 ], "items.button" ] );
+ }
+ if ( typeof arguments[ 0 ] === "object" && arguments[ 0 ].items ) {
+ arguments[ 0 ].items = {
+ button: arguments[ 0 ].items
+ };
+ }
+ return this.controlgroup.apply( this, arguments );
+ };
+}
- return false;
- },
+var widgetsButton = $.ui.button;
- _mouseStop: function( event ) {
- this.handles.removeClass( "ui-state-active" );
- this._mouseSliding = false;
- this._stop( event, this._handleIndex );
- this._change( event, this._handleIndex );
+// jscs:disable maximumLineLength
+/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
+/*!
+ * jQuery UI Datepicker 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- this._handleIndex = null;
- this._clickOffset = null;
- this._animateOff = false;
+//>>label: Datepicker
+//>>group: Widgets
+//>>description: Displays a calendar from an input or inline for selecting dates.
+//>>docs: http://api.jqueryui.com/datepicker/
+//>>demos: http://jqueryui.com/datepicker/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/datepicker.css
+//>>css.theme: ../../themes/base/theme.css
- return false;
- },
-
- _detectOrientation: function() {
- this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
- },
- _normValueFromMouse: function( position ) {
- var pixelTotal,
- pixelMouse,
- percentMouse,
- valueTotal,
- valueMouse;
- if ( this.orientation === "horizontal" ) {
- pixelTotal = this.elementSize.width;
- pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
- } else {
- pixelTotal = this.elementSize.height;
- pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
- }
+$.extend( $.ui, { datepicker: { version: "1.12.1" } } );
- percentMouse = ( pixelMouse / pixelTotal );
- if ( percentMouse > 1 ) {
- percentMouse = 1;
- }
- if ( percentMouse < 0 ) {
- percentMouse = 0;
- }
- if ( this.orientation === "vertical" ) {
- percentMouse = 1 - percentMouse;
- }
+var datepicker_instActive;
- valueTotal = this._valueMax() - this._valueMin();
- valueMouse = this._valueMin() + percentMouse * valueTotal;
+function datepicker_getZindex( elem ) {
+ var position, value;
+ while ( elem.length && elem[ 0 ] !== document ) {
- return this._trimAlignValue( valueMouse );
- },
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css( "position" );
+ if ( position === "absolute" || position === "relative" || position === "fixed" ) {
- _start: function( event, index ) {
- var uiHash = {
- handle: this.handles[ index ],
- value: this.value()
- };
- if ( this.options.values && this.options.values.length ) {
- uiHash.value = this.values( index );
- uiHash.values = this.values();
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt( elem.css( "zIndex" ), 10 );
+ if ( !isNaN( value ) && value !== 0 ) {
+ return value;
+ }
}
- return this._trigger( "start", event, uiHash );
- },
-
- _slide: function( event, index, newVal ) {
- var otherVal,
- newValues,
- allowed;
+ elem = elem.parent();
+ }
- if ( this.options.values && this.options.values.length ) {
- otherVal = this.values( index ? 0 : 1 );
+ return 0;
+}
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
- if ( ( this.options.values.length === 2 && this.options.range === true ) &&
- ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
- ) {
- newVal = otherVal;
- }
+function Datepicker() {
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
+ this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
+ this._appendClass = "ui-datepicker-append"; // The name of the append marker class
+ this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
+ this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
+ this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
+ this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
+ this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
+ this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[ "" ] = { // Default regional settings
+ closeText: "Done", // Display text for close link
+ prevText: "Prev", // Display text for previous month link
+ nextText: "Next", // Display text for next month link
+ currentText: "Today", // Display text for current month link
+ monthNames: [ "January","February","March","April","May","June",
+ "July","August","September","October","November","December" ], // Names of months for drop-down and formatting
+ monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], // For formatting
+ dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], // For formatting
+ dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], // For formatting
+ dayNamesMin: [ "Su","Mo","Tu","We","Th","Fr","Sa" ], // Column headings for days starting at Sunday
+ weekHeader: "Wk", // Column header for week of the year
+ dateFormat: "mm/dd/yy", // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: "" // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: "focus", // "focus" for popup on focus,
+ // "button" for trigger button, or "both" for either
+ showAnim: "fadeIn", // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: "", // Display text following the input box, e.g. showing the format
+ buttonText: "...", // Text for trigger button
+ buttonImage: "", // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: "c-10:c+10", // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: "+10", // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with "+" for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: "fast", // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: "", // Selector for an alternate field to store selected dates into
+ altFormat: "", // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false, // True to size the input for the date format, false to leave as is
+ disabled: false // The initial disabled state
+ };
+ $.extend( this._defaults, this.regional[ "" ] );
+ this.regional.en = $.extend( true, {}, this.regional[ "" ] );
+ this.regional[ "en-US" ] = $.extend( true, {}, this.regional.en );
+ this.dpDiv = datepicker_bindHover( $( "<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) );
+}
+
+$.extend( Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: "hasDatepicker",
+
+ //Keep track of the maximum number of rows displayed (see #7043)
+ maxRows: 4,
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ * @param settings object - the new settings to use as defaults (anonymous object)
+ * @return the manager object
+ */
+ setDefaults: function( settings ) {
+ datepicker_extendRemove( this._defaults, settings || {} );
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param settings object - the new settings to use for this date picker instance (anonymous)
+ */
+ _attachDatepicker: function( target, settings ) {
+ var nodeName, inline, inst;
+ nodeName = target.nodeName.toLowerCase();
+ inline = ( nodeName === "div" || nodeName === "span" );
+ if ( !target.id ) {
+ this.uuid += 1;
+ target.id = "dp" + this.uuid;
+ }
+ inst = this._newInst( $( target ), inline );
+ inst.settings = $.extend( {}, settings || {} );
+ if ( nodeName === "input" ) {
+ this._connectDatepicker( target, inst );
+ } else if ( inline ) {
+ this._inlineDatepicker( target, inst );
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function( target, inline ) {
+ var id = target[ 0 ].id.replace( /([^A-Za-z0-9_\-])/g, "\\\\$1" ); // escape jQuery meta chars
+ return { id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: ( !inline ? this.dpDiv : // presentation div
+ datepicker_bindHover( $( "<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) ) ) };
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function( target, inst ) {
+ var input = $( target );
+ inst.append = $( [] );
+ inst.trigger = $( [] );
+ if ( input.hasClass( this.markerClassName ) ) {
+ return;
+ }
+ this._attachments( input, inst );
+ input.addClass( this.markerClassName ).on( "keydown", this._doKeyDown ).
+ on( "keypress", this._doKeyPress ).on( "keyup", this._doKeyUp );
+ this._autoSize( inst );
+ $.data( target, "datepicker", inst );
+
+ //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+ if ( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function( input, inst ) {
+ var showOn, buttonText, buttonImage,
+ appendText = this._get( inst, "appendText" ),
+ isRTL = this._get( inst, "isRTL" );
+
+ if ( inst.append ) {
+ inst.append.remove();
+ }
+ if ( appendText ) {
+ inst.append = $( "<span class='" + this._appendClass + "'>" + appendText + "</span>" );
+ input[ isRTL ? "before" : "after" ]( inst.append );
+ }
+
+ input.off( "focus", this._showDatepicker );
+
+ if ( inst.trigger ) {
+ inst.trigger.remove();
+ }
+
+ showOn = this._get( inst, "showOn" );
+ if ( showOn === "focus" || showOn === "both" ) { // pop-up date picker when in the marked field
+ input.on( "focus", this._showDatepicker );
+ }
+ if ( showOn === "button" || showOn === "both" ) { // pop-up date picker when button clicked
+ buttonText = this._get( inst, "buttonText" );
+ buttonImage = this._get( inst, "buttonImage" );
+ inst.trigger = $( this._get( inst, "buttonImageOnly" ) ?
+ $( "<img/>" ).addClass( this._triggerClass ).
+ attr( { src: buttonImage, alt: buttonText, title: buttonText } ) :
+ $( "<button type='button'></button>" ).addClass( this._triggerClass ).
+ html( !buttonImage ? buttonText : $( "<img/>" ).attr(
+ { src:buttonImage, alt:buttonText, title:buttonText } ) ) );
+ input[ isRTL ? "before" : "after" ]( inst.trigger );
+ inst.trigger.on( "click", function() {
+ if ( $.datepicker._datepickerShowing && $.datepicker._lastInput === input[ 0 ] ) {
+ $.datepicker._hideDatepicker();
+ } else if ( $.datepicker._datepickerShowing && $.datepicker._lastInput !== input[ 0 ] ) {
+ $.datepicker._hideDatepicker();
+ $.datepicker._showDatepicker( input[ 0 ] );
+ } else {
+ $.datepicker._showDatepicker( input[ 0 ] );
+ }
+ return false;
+ } );
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function( inst ) {
+ if ( this._get( inst, "autoSize" ) && !inst.inline ) {
+ var findMax, max, maxI, i,
+ date = new Date( 2009, 12 - 1, 20 ), // Ensure double digits
+ dateFormat = this._get( inst, "dateFormat" );
+
+ if ( dateFormat.match( /[DM]/ ) ) {
+ findMax = function( names ) {
+ max = 0;
+ maxI = 0;
+ for ( i = 0; i < names.length; i++ ) {
+ if ( names[ i ].length > max ) {
+ max = names[ i ].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth( findMax( this._get( inst, ( dateFormat.match( /MM/ ) ?
+ "monthNames" : "monthNamesShort" ) ) ) );
+ date.setDate( findMax( this._get( inst, ( dateFormat.match( /DD/ ) ?
+ "dayNames" : "dayNamesShort" ) ) ) + 20 - date.getDay() );
+ }
+ inst.input.attr( "size", this._formatDate( inst, date ).length );
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function( target, inst ) {
+ var divSpan = $( target );
+ if ( divSpan.hasClass( this.markerClassName ) ) {
+ return;
+ }
+ divSpan.addClass( this.markerClassName ).append( inst.dpDiv );
+ $.data( target, "datepicker", inst );
+ this._setDate( inst, this._getDefaultDate( inst ), true );
+ this._updateDatepicker( inst );
+ this._updateAlternate( inst );
+
+ //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+ if ( inst.settings.disabled ) {
+ this._disableDatepicker( target );
+ }
+
+ // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+ // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+ inst.dpDiv.css( "display", "block" );
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ * @param input element - ignored
+ * @param date string or Date - the initial date to display
+ * @param onSelect function - the function to call when a date is selected
+ * @param settings object - update the dialog date picker instance's settings (anonymous object)
+ * @param pos int[2] - coordinates for the dialog's position within the screen or
+ * event - with x/y coordinates or
+ * leave empty for default (screen centre)
+ * @return the manager object
+ */
+ _dialogDatepicker: function( input, date, onSelect, settings, pos ) {
+ var id, browserWidth, browserHeight, scrollX, scrollY,
+ inst = this._dialogInst; // internal instance
+
+ if ( !inst ) {
+ this.uuid += 1;
+ id = "dp" + this.uuid;
+ this._dialogInput = $( "<input type='text' id='" + id +
+ "' style='position: absolute; top: -100px; width: 0px;'/>" );
+ this._dialogInput.on( "keydown", this._doKeyDown );
+ $( "body" ).append( this._dialogInput );
+ inst = this._dialogInst = this._newInst( this._dialogInput, false );
+ inst.settings = {};
+ $.data( this._dialogInput[ 0 ], "datepicker", inst );
+ }
+ datepicker_extendRemove( inst.settings, settings || {} );
+ date = ( date && date.constructor === Date ? this._formatDate( inst, date ) : date );
+ this._dialogInput.val( date );
+
+ this._pos = ( pos ? ( pos.length ? pos : [ pos.pageX, pos.pageY ] ) : null );
+ if ( !this._pos ) {
+ browserWidth = document.documentElement.clientWidth;
+ browserHeight = document.documentElement.clientHeight;
+ scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [ ( browserWidth / 2 ) - 100 + scrollX, ( browserHeight / 2 ) - 150 + scrollY ];
+ }
+
+ // Move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css( "left", ( this._pos[ 0 ] + 20 ) + "px" ).css( "top", this._pos[ 1 ] + "px" );
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass( this._dialogClass );
+ this._showDatepicker( this._dialogInput[ 0 ] );
+ if ( $.blockUI ) {
+ $.blockUI( this.dpDiv );
+ }
+ $.data( this._dialogInput[ 0 ], "datepicker", inst );
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ * @param target element - the target input field or division or span
+ */
+ _destroyDatepicker: function( target ) {
+ var nodeName,
+ $target = $( target ),
+ inst = $.data( target, "datepicker" );
+
+ if ( !$target.hasClass( this.markerClassName ) ) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ $.removeData( target, "datepicker" );
+ if ( nodeName === "input" ) {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass( this.markerClassName ).
+ off( "focus", this._showDatepicker ).
+ off( "keydown", this._doKeyDown ).
+ off( "keypress", this._doKeyPress ).
+ off( "keyup", this._doKeyUp );
+ } else if ( nodeName === "div" || nodeName === "span" ) {
+ $target.removeClass( this.markerClassName ).empty();
+ }
+
+ if ( datepicker_instActive === inst ) {
+ datepicker_instActive = null;
+ }
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _enableDatepicker: function( target ) {
+ var nodeName, inline,
+ $target = $( target ),
+ inst = $.data( target, "datepicker" );
+
+ if ( !$target.hasClass( this.markerClassName ) ) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if ( nodeName === "input" ) {
+ target.disabled = false;
+ inst.trigger.filter( "button" ).
+ each( function() { this.disabled = false; } ).end().
+ filter( "img" ).css( { opacity: "1.0", cursor: "" } );
+ } else if ( nodeName === "div" || nodeName === "span" ) {
+ inline = $target.children( "." + this._inlineClass );
+ inline.children().removeClass( "ui-state-disabled" );
+ inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+ prop( "disabled", false );
+ }
+ this._disabledInputs = $.map( this._disabledInputs,
+ function( value ) { return ( value === target ? null : value ); } ); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ * @param target element - the target input field or division or span
+ */
+ _disableDatepicker: function( target ) {
+ var nodeName, inline,
+ $target = $( target ),
+ inst = $.data( target, "datepicker" );
+
+ if ( !$target.hasClass( this.markerClassName ) ) {
+ return;
+ }
+
+ nodeName = target.nodeName.toLowerCase();
+ if ( nodeName === "input" ) {
+ target.disabled = true;
+ inst.trigger.filter( "button" ).
+ each( function() { this.disabled = true; } ).end().
+ filter( "img" ).css( { opacity: "0.5", cursor: "default" } );
+ } else if ( nodeName === "div" || nodeName === "span" ) {
+ inline = $target.children( "." + this._inlineClass );
+ inline.children().addClass( "ui-state-disabled" );
+ inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+ prop( "disabled", true );
+ }
+ this._disabledInputs = $.map( this._disabledInputs,
+ function( value ) { return ( value === target ? null : value ); } ); // delete entry
+ this._disabledInputs[ this._disabledInputs.length ] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ * @param target element - the target input field or division or span
+ * @return boolean - true if disabled, false if enabled
+ */
+ _isDisabledDatepicker: function( target ) {
+ if ( !target ) {
+ return false;
+ }
+ for ( var i = 0; i < this._disabledInputs.length; i++ ) {
+ if ( this._disabledInputs[ i ] === target ) {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ * @param target element - the target input field or division or span
+ * @return object - the associated instance data
+ * @throws error if a jQuery problem getting data
+ */
+ _getInst: function( target ) {
+ try {
+ return $.data( target, "datepicker" );
+ }
+ catch ( err ) {
+ throw "Missing instance data for this datepicker";
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ * @param name object - the new settings to update or
+ * string - the name of the setting to change or retrieve,
+ * when retrieving also "all" for all instance settings or
+ * "defaults" for all global defaults
+ * @param value any - the new value for the setting
+ * (omit if above is an object or to retrieve a value)
+ */
+ _optionDatepicker: function( target, name, value ) {
+ var settings, date, minDate, maxDate,
+ inst = this._getInst( target );
+
+ if ( arguments.length === 2 && typeof name === "string" ) {
+ return ( name === "defaults" ? $.extend( {}, $.datepicker._defaults ) :
+ ( inst ? ( name === "all" ? $.extend( {}, inst.settings ) :
+ this._get( inst, name ) ) : null ) );
+ }
+
+ settings = name || {};
+ if ( typeof name === "string" ) {
+ settings = {};
+ settings[ name ] = value;
+ }
+
+ if ( inst ) {
+ if ( this._curInst === inst ) {
+ this._hideDatepicker();
+ }
+
+ date = this._getDateDatepicker( target, true );
+ minDate = this._getMinMaxDate( inst, "min" );
+ maxDate = this._getMinMaxDate( inst, "max" );
+ datepicker_extendRemove( inst.settings, settings );
+
+ // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+ if ( minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined ) {
+ inst.settings.minDate = this._formatDate( inst, minDate );
+ }
+ if ( maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined ) {
+ inst.settings.maxDate = this._formatDate( inst, maxDate );
+ }
+ if ( "disabled" in settings ) {
+ if ( settings.disabled ) {
+ this._disableDatepicker( target );
+ } else {
+ this._enableDatepicker( target );
+ }
+ }
+ this._attachments( $( target ), inst );
+ this._autoSize( inst );
+ this._setDate( inst, date );
+ this._updateAlternate( inst );
+ this._updateDatepicker( inst );
+ }
+ },
+
+ // Change method deprecated
+ _changeDatepicker: function( target, name, value ) {
+ this._optionDatepicker( target, name, value );
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ * @param target element - the target input field or division or span
+ */
+ _refreshDatepicker: function( target ) {
+ var inst = this._getInst( target );
+ if ( inst ) {
+ this._updateDatepicker( inst );
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param date Date - the new date
+ */
+ _setDateDatepicker: function( target, date ) {
+ var inst = this._getInst( target );
+ if ( inst ) {
+ this._setDate( inst, date );
+ this._updateDatepicker( inst );
+ this._updateAlternate( inst );
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ * @param target element - the target input field or division or span
+ * @param noDefault boolean - true if no default date is to be used
+ * @return Date - the current date
+ */
+ _getDateDatepicker: function( target, noDefault ) {
+ var inst = this._getInst( target );
+ if ( inst && !inst.inline ) {
+ this._setDateFromField( inst, noDefault );
+ }
+ return ( inst ? this._getDate( inst ) : null );
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function( event ) {
+ var onSelect, dateStr, sel,
+ inst = $.datepicker._getInst( event.target ),
+ handled = true,
+ isRTL = inst.dpDiv.is( ".ui-datepicker-rtl" );
+
+ inst._keyEvent = true;
+ if ( $.datepicker._datepickerShowing ) {
+ switch ( event.keyCode ) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: sel = $( "td." + $.datepicker._dayOverClass + ":not(." +
+ $.datepicker._currentClass + ")", inst.dpDiv );
+ if ( sel[ 0 ] ) {
+ $.datepicker._selectDay( event.target, inst.selectedMonth, inst.selectedYear, sel[ 0 ] );
+ }
+
+ onSelect = $.datepicker._get( inst, "onSelect" );
+ if ( onSelect ) {
+ dateStr = $.datepicker._formatDate( inst );
+
+ // Trigger custom callback
+ onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] );
+ } else {
+ $.datepicker._hideDatepicker();
+ }
+
+ return false; // don't submit the form
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+ -$.datepicker._get( inst, "stepBigMonths" ) :
+ -$.datepicker._get( inst, "stepMonths" ) ), "M" );
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+ +$.datepicker._get( inst, "stepBigMonths" ) :
+ +$.datepicker._get( inst, "stepMonths" ) ), "M" );
+ break; // next month/year on page down/+ ctrl
+ case 35: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._clearDate( event.target );
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._gotoToday( event.target );
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._adjustDate( event.target, ( isRTL ? +1 : -1 ), "D" );
+ }
+ handled = event.ctrlKey || event.metaKey;
+
+ // -1 day on ctrl or command +left
+ if ( event.originalEvent.altKey ) {
+ $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+ -$.datepicker._get( inst, "stepBigMonths" ) :
+ -$.datepicker._get( inst, "stepMonths" ) ), "M" );
+ }
+
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._adjustDate( event.target, -7, "D" );
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._adjustDate( event.target, ( isRTL ? -1 : +1 ), "D" );
+ }
+ handled = event.ctrlKey || event.metaKey;
+
+ // +1 day on ctrl or command +right
+ if ( event.originalEvent.altKey ) {
+ $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+ +$.datepicker._get( inst, "stepBigMonths" ) :
+ +$.datepicker._get( inst, "stepMonths" ) ), "M" );
+ }
+
+ // next month/year on alt +right
+ break;
+ case 40: if ( event.ctrlKey || event.metaKey ) {
+ $.datepicker._adjustDate( event.target, +7, "D" );
+ }
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ } else if ( event.keyCode === 36 && event.ctrlKey ) { // display the date picker on ctrl+home
+ $.datepicker._showDatepicker( this );
+ } else {
+ handled = false;
+ }
+
+ if ( handled ) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function( event ) {
+ var chars, chr,
+ inst = $.datepicker._getInst( event.target );
+
+ if ( $.datepicker._get( inst, "constrainInput" ) ) {
+ chars = $.datepicker._possibleChars( $.datepicker._get( inst, "dateFormat" ) );
+ chr = String.fromCharCode( event.charCode == null ? event.keyCode : event.charCode );
+ return event.ctrlKey || event.metaKey || ( chr < " " || !chars || chars.indexOf( chr ) > -1 );
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function( event ) {
+ var date,
+ inst = $.datepicker._getInst( event.target );
+
+ if ( inst.input.val() !== inst.lastVal ) {
+ try {
+ date = $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+ ( inst.input ? inst.input.val() : null ),
+ $.datepicker._getFormatConfig( inst ) );
+
+ if ( date ) { // only if valid
+ $.datepicker._setDateFromField( inst );
+ $.datepicker._updateAlternate( inst );
+ $.datepicker._updateDatepicker( inst );
+ }
+ }
+ catch ( err ) {
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ * If false returned from beforeShow event handler do not show.
+ * @param input element - the input field attached to the date picker or
+ * event - if triggered by focus
+ */
+ _showDatepicker: function( input ) {
+ input = input.target || input;
+ if ( input.nodeName.toLowerCase() !== "input" ) { // find from button/image trigger
+ input = $( "input", input.parentNode )[ 0 ];
+ }
+
+ if ( $.datepicker._isDisabledDatepicker( input ) || $.datepicker._lastInput === input ) { // already here
+ return;
+ }
+
+ var inst, beforeShow, beforeShowSettings, isFixed,
+ offset, showAnim, duration;
+
+ inst = $.datepicker._getInst( input );
+ if ( $.datepicker._curInst && $.datepicker._curInst !== inst ) {
+ $.datepicker._curInst.dpDiv.stop( true, true );
+ if ( inst && $.datepicker._datepickerShowing ) {
+ $.datepicker._hideDatepicker( $.datepicker._curInst.input[ 0 ] );
+ }
+ }
+
+ beforeShow = $.datepicker._get( inst, "beforeShow" );
+ beforeShowSettings = beforeShow ? beforeShow.apply( input, [ input, inst ] ) : {};
+ if ( beforeShowSettings === false ) {
+ return;
+ }
+ datepicker_extendRemove( inst.settings, beforeShowSettings );
+
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField( inst );
+
+ if ( $.datepicker._inDialog ) { // hide cursor
+ input.value = "";
+ }
+ if ( !$.datepicker._pos ) { // position below input
+ $.datepicker._pos = $.datepicker._findPos( input );
+ $.datepicker._pos[ 1 ] += input.offsetHeight; // add the height
+ }
+
+ isFixed = false;
+ $( input ).parents().each( function() {
+ isFixed |= $( this ).css( "position" ) === "fixed";
+ return !isFixed;
+ } );
+
+ offset = { left: $.datepicker._pos[ 0 ], top: $.datepicker._pos[ 1 ] };
+ $.datepicker._pos = null;
+
+ //to avoid flashes on Firefox
+ inst.dpDiv.empty();
+
+ // determine sizing offscreen
+ inst.dpDiv.css( { position: "absolute", display: "block", top: "-1000px" } );
+ $.datepicker._updateDatepicker( inst );
+
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset( inst, offset, isFixed );
+ inst.dpDiv.css( { position: ( $.datepicker._inDialog && $.blockUI ?
+ "static" : ( isFixed ? "fixed" : "absolute" ) ), display: "none",
+ left: offset.left + "px", top: offset.top + "px" } );
+
+ if ( !inst.inline ) {
+ showAnim = $.datepicker._get( inst, "showAnim" );
+ duration = $.datepicker._get( inst, "duration" );
+ inst.dpDiv.css( "z-index", datepicker_getZindex( $( input ) ) + 1 );
+ $.datepicker._datepickerShowing = true;
+
+ if ( $.effects && $.effects.effect[ showAnim ] ) {
+ inst.dpDiv.show( showAnim, $.datepicker._get( inst, "showOptions" ), duration );
+ } else {
+ inst.dpDiv[ showAnim || "show" ]( showAnim ? duration : null );
+ }
+
+ if ( $.datepicker._shouldFocusInput( inst ) ) {
+ inst.input.trigger( "focus" );
+ }
+
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function( inst ) {
+ this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ datepicker_instActive = inst; // for delegate hover events
+ inst.dpDiv.empty().append( this._generateHTML( inst ) );
+ this._attachHandlers( inst );
+
+ var origyearshtml,
+ numMonths = this._getNumberOfMonths( inst ),
+ cols = numMonths[ 1 ],
+ width = 17,
+ activeCell = inst.dpDiv.find( "." + this._dayOverClass + " a" );
+
+ if ( activeCell.length > 0 ) {
+ datepicker_handleMouseover.apply( activeCell.get( 0 ) );
+ }
+
+ inst.dpDiv.removeClass( "ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4" ).width( "" );
+ if ( cols > 1 ) {
+ inst.dpDiv.addClass( "ui-datepicker-multi-" + cols ).css( "width", ( width * cols ) + "em" );
+ }
+ inst.dpDiv[ ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ? "add" : "remove" ) +
+ "Class" ]( "ui-datepicker-multi" );
+ inst.dpDiv[ ( this._get( inst, "isRTL" ) ? "add" : "remove" ) +
+ "Class" ]( "ui-datepicker-rtl" );
+
+ if ( inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput( inst ) ) {
+ inst.input.trigger( "focus" );
+ }
+
+ // Deffered render of the years select (to avoid flashes on Firefox)
+ if ( inst.yearshtml ) {
+ origyearshtml = inst.yearshtml;
+ setTimeout( function() {
+
+ //assure that inst.yearshtml didn't change.
+ if ( origyearshtml === inst.yearshtml && inst.yearshtml ) {
+ inst.dpDiv.find( "select.ui-datepicker-year:first" ).replaceWith( inst.yearshtml );
+ }
+ origyearshtml = inst.yearshtml = null;
+ }, 0 );
+ }
+ },
+
+ // #6694 - don't focus the input if it's already focused
+ // this breaks the change event in IE
+ // Support: IE and jQuery <1.9
+ _shouldFocusInput: function( inst ) {
+ return inst.input && inst.input.is( ":visible" ) && !inst.input.is( ":disabled" ) && !inst.input.is( ":focus" );
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function( inst, offset, isFixed ) {
+ var dpWidth = inst.dpDiv.outerWidth(),
+ dpHeight = inst.dpDiv.outerHeight(),
+ inputWidth = inst.input ? inst.input.outerWidth() : 0,
+ inputHeight = inst.input ? inst.input.outerHeight() : 0,
+ viewWidth = document.documentElement.clientWidth + ( isFixed ? 0 : $( document ).scrollLeft() ),
+ viewHeight = document.documentElement.clientHeight + ( isFixed ? 0 : $( document ).scrollTop() );
+
+ offset.left -= ( this._get( inst, "isRTL" ) ? ( dpWidth - inputWidth ) : 0 );
+ offset.left -= ( isFixed && offset.left === inst.input.offset().left ) ? $( document ).scrollLeft() : 0;
+ offset.top -= ( isFixed && offset.top === ( inst.input.offset().top + inputHeight ) ) ? $( document ).scrollTop() : 0;
+
+ // Now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min( offset.left, ( offset.left + dpWidth > viewWidth && viewWidth > dpWidth ) ?
+ Math.abs( offset.left + dpWidth - viewWidth ) : 0 );
+ offset.top -= Math.min( offset.top, ( offset.top + dpHeight > viewHeight && viewHeight > dpHeight ) ?
+ Math.abs( dpHeight + inputHeight ) : 0 );
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function( obj ) {
+ var position,
+ inst = this._getInst( obj ),
+ isRTL = this._get( inst, "isRTL" );
+
+ while ( obj && ( obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden( obj ) ) ) {
+ obj = obj[ isRTL ? "previousSibling" : "nextSibling" ];
+ }
+
+ position = $( obj ).offset();
+ return [ position.left, position.top ];
+ },
+
+ /* Hide the date picker from view.
+ * @param input element - the input field attached to the date picker
+ */
+ _hideDatepicker: function( input ) {
+ var showAnim, duration, postProcess, onClose,
+ inst = this._curInst;
+
+ if ( !inst || ( input && inst !== $.data( input, "datepicker" ) ) ) {
+ return;
+ }
+
+ if ( this._datepickerShowing ) {
+ showAnim = this._get( inst, "showAnim" );
+ duration = this._get( inst, "duration" );
+ postProcess = function() {
+ $.datepicker._tidyDialog( inst );
+ };
+
+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+ if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) {
+ inst.dpDiv.hide( showAnim, $.datepicker._get( inst, "showOptions" ), duration, postProcess );
+ } else {
+ inst.dpDiv[ ( showAnim === "slideDown" ? "slideUp" :
+ ( showAnim === "fadeIn" ? "fadeOut" : "hide" ) ) ]( ( showAnim ? duration : null ), postProcess );
+ }
+
+ if ( !showAnim ) {
+ postProcess();
+ }
+ this._datepickerShowing = false;
+
+ onClose = this._get( inst, "onClose" );
+ if ( onClose ) {
+ onClose.apply( ( inst.input ? inst.input[ 0 ] : null ), [ ( inst.input ? inst.input.val() : "" ), inst ] );
+ }
+
+ this._lastInput = null;
+ if ( this._inDialog ) {
+ this._dialogInput.css( { position: "absolute", left: "0", top: "-100px" } );
+ if ( $.blockUI ) {
+ $.unblockUI();
+ $( "body" ).append( this.dpDiv );
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function( inst ) {
+ inst.dpDiv.removeClass( this._dialogClass ).off( ".ui-datepicker-calendar" );
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function( event ) {
+ if ( !$.datepicker._curInst ) {
+ return;
+ }
+
+ var $target = $( event.target ),
+ inst = $.datepicker._getInst( $target[ 0 ] );
+
+ if ( ( ( $target[ 0 ].id !== $.datepicker._mainDivId &&
+ $target.parents( "#" + $.datepicker._mainDivId ).length === 0 &&
+ !$target.hasClass( $.datepicker.markerClassName ) &&
+ !$target.closest( "." + $.datepicker._triggerClass ).length &&
+ $.datepicker._datepickerShowing && !( $.datepicker._inDialog && $.blockUI ) ) ) ||
+ ( $target.hasClass( $.datepicker.markerClassName ) && $.datepicker._curInst !== inst ) ) {
+ $.datepicker._hideDatepicker();
+ }
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function( id, offset, period ) {
+ var target = $( id ),
+ inst = this._getInst( target[ 0 ] );
+
+ if ( this._isDisabledDatepicker( target[ 0 ] ) ) {
+ return;
+ }
+ this._adjustInstDate( inst, offset +
+ ( period === "M" ? this._get( inst, "showCurrentAtPos" ) : 0 ), // undo positioning
+ period );
+ this._updateDatepicker( inst );
+ },
+
+ /* Action for current link. */
+ _gotoToday: function( id ) {
+ var date,
+ target = $( id ),
+ inst = this._getInst( target[ 0 ] );
+
+ if ( this._get( inst, "gotoCurrent" ) && inst.currentDay ) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ } else {
+ date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange( inst );
+ this._adjustDate( target );
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function( id, select, period ) {
+ var target = $( id ),
+ inst = this._getInst( target[ 0 ] );
+
+ inst[ "selected" + ( period === "M" ? "Month" : "Year" ) ] =
+ inst[ "draw" + ( period === "M" ? "Month" : "Year" ) ] =
+ parseInt( select.options[ select.selectedIndex ].value, 10 );
+
+ this._notifyChange( inst );
+ this._adjustDate( target );
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function( id, month, year, td ) {
+ var inst,
+ target = $( id );
+
+ if ( $( td ).hasClass( this._unselectableClass ) || this._isDisabledDatepicker( target[ 0 ] ) ) {
+ return;
+ }
+
+ inst = this._getInst( target[ 0 ] );
+ inst.selectedDay = inst.currentDay = $( "a", td ).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate( id, this._formatDate( inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear ) );
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function( id ) {
+ var target = $( id );
+ this._selectDate( target, "" );
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function( id, dateStr ) {
+ var onSelect,
+ target = $( id ),
+ inst = this._getInst( target[ 0 ] );
+
+ dateStr = ( dateStr != null ? dateStr : this._formatDate( inst ) );
+ if ( inst.input ) {
+ inst.input.val( dateStr );
+ }
+ this._updateAlternate( inst );
+
+ onSelect = this._get( inst, "onSelect" );
+ if ( onSelect ) {
+ onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] ); // trigger custom callback
+ } else if ( inst.input ) {
+ inst.input.trigger( "change" ); // fire the change event
+ }
+
+ if ( inst.inline ) {
+ this._updateDatepicker( inst );
+ } else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[ 0 ];
+ if ( typeof( inst.input[ 0 ] ) !== "object" ) {
+ inst.input.trigger( "focus" ); // restore focus
+ }
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function( inst ) {
+ var altFormat, date, dateStr,
+ altField = this._get( inst, "altField" );
+
+ if ( altField ) { // update alternate field too
+ altFormat = this._get( inst, "altFormat" ) || this._get( inst, "dateFormat" );
+ date = this._getDate( inst );
+ dateStr = this.formatDate( altFormat, date, this._getFormatConfig( inst ) );
+ $( altField ).val( dateStr );
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ * @param date Date - the date to customise
+ * @return [boolean, string] - is this date selectable?, what is its CSS class?
+ */
+ noWeekends: function( date ) {
+ var day = date.getDay();
+ return [ ( day > 0 && day < 6 ), "" ];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ * @param date Date - the date to get the week for
+ * @return number - the number of the week within the year that contains this date
+ */
+ iso8601Week: function( date ) {
+ var time,
+ checkDate = new Date( date.getTime() );
+
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate( checkDate.getDate() + 4 - ( checkDate.getDay() || 7 ) );
+
+ time = checkDate.getTime();
+ checkDate.setMonth( 0 ); // Compare with Jan 1
+ checkDate.setDate( 1 );
+ return Math.floor( Math.round( ( time - checkDate ) / 86400000 ) / 7 ) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ * See formatDate below for the possible formats.
+ *
+ * @param format string - the expected format of the date
+ * @param value string - the date in the above format
+ * @param settings Object - attributes include:
+ * shortYearCutoff number - the cutoff year for determining the century (optional)
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return Date - the extracted date value or null if value is blank
+ */
+ parseDate: function( format, value, settings ) {
+ if ( format == null || value == null ) {
+ throw "Invalid arguments";
+ }
+
+ value = ( typeof value === "object" ? value.toString() : value + "" );
+ if ( value === "" ) {
+ return null;
+ }
+
+ var iFormat, dim, extra,
+ iValue = 0,
+ shortYearCutoffTemp = ( settings ? settings.shortYearCutoff : null ) || this._defaults.shortYearCutoff,
+ shortYearCutoff = ( typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
+ new Date().getFullYear() % 100 + parseInt( shortYearCutoffTemp, 10 ) ),
+ dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+ dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+ monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+ monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+ year = -1,
+ month = -1,
+ day = -1,
+ doy = -1,
+ literal = false,
+ date,
+
+ // Check whether a format character is doubled
+ lookAhead = function( match ) {
+ var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+ if ( matches ) {
+ iFormat++;
+ }
+ return matches;
+ },
+
+ // Extract a number from the string value
+ getNumber = function( match ) {
+ var isDoubled = lookAhead( match ),
+ size = ( match === "@" ? 14 : ( match === "!" ? 20 :
+ ( match === "y" && isDoubled ? 4 : ( match === "o" ? 3 : 2 ) ) ) ),
+ minSize = ( match === "y" ? size : 1 ),
+ digits = new RegExp( "^\\d{" + minSize + "," + size + "}" ),
+ num = value.substring( iValue ).match( digits );
+ if ( !num ) {
+ throw "Missing number at position " + iValue;
+ }
+ iValue += num[ 0 ].length;
+ return parseInt( num[ 0 ], 10 );
+ },
+
+ // Extract a name from the string value and convert to an index
+ getName = function( match, shortNames, longNames ) {
+ var index = -1,
+ names = $.map( lookAhead( match ) ? longNames : shortNames, function( v, k ) {
+ return [ [ k, v ] ];
+ } ).sort( function( a, b ) {
+ return -( a[ 1 ].length - b[ 1 ].length );
+ } );
+
+ $.each( names, function( i, pair ) {
+ var name = pair[ 1 ];
+ if ( value.substr( iValue, name.length ).toLowerCase() === name.toLowerCase() ) {
+ index = pair[ 0 ];
+ iValue += name.length;
+ return false;
+ }
+ } );
+ if ( index !== -1 ) {
+ return index + 1;
+ } else {
+ throw "Unknown name at position " + iValue;
+ }
+ },
+
+ // Confirm that a literal character matches the string value
+ checkLiteral = function() {
+ if ( value.charAt( iValue ) !== format.charAt( iFormat ) ) {
+ throw "Unexpected literal at position " + iValue;
+ }
+ iValue++;
+ };
+
+ for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+ if ( literal ) {
+ if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+ literal = false;
+ } else {
+ checkLiteral();
+ }
+ } else {
+ switch ( format.charAt( iFormat ) ) {
+ case "d":
+ day = getNumber( "d" );
+ break;
+ case "D":
+ getName( "D", dayNamesShort, dayNames );
+ break;
+ case "o":
+ doy = getNumber( "o" );
+ break;
+ case "m":
+ month = getNumber( "m" );
+ break;
+ case "M":
+ month = getName( "M", monthNamesShort, monthNames );
+ break;
+ case "y":
+ year = getNumber( "y" );
+ break;
+ case "@":
+ date = new Date( getNumber( "@" ) );
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "!":
+ date = new Date( ( getNumber( "!" ) - this._ticksTo1970 ) / 10000 );
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if ( lookAhead( "'" ) ) {
+ checkLiteral();
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ }
+
+ if ( iValue < value.length ) {
+ extra = value.substr( iValue );
+ if ( !/^\s+/.test( extra ) ) {
+ throw "Extra/unparsed characters found in date: " + extra;
+ }
+ }
+
+ if ( year === -1 ) {
+ year = new Date().getFullYear();
+ } else if ( year < 100 ) {
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ ( year <= shortYearCutoff ? 0 : -100 );
+ }
+
+ if ( doy > -1 ) {
+ month = 1;
+ day = doy;
+ do {
+ dim = this._getDaysInMonth( year, month - 1 );
+ if ( day <= dim ) {
+ break;
+ }
+ month++;
+ day -= dim;
+ } while ( true );
+ }
+
+ date = this._daylightSavingAdjust( new Date( year, month - 1, day ) );
+ if ( date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day ) {
+ throw "Invalid date"; // E.g. 31/02/00
+ }
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
+ COOKIE: "D, dd M yy",
+ ISO_8601: "yy-mm-dd",
+ RFC_822: "D, d M y",
+ RFC_850: "DD, dd-M-y",
+ RFC_1036: "D, d M y",
+ RFC_1123: "D, d M yy",
+ RFC_2822: "D, d M yy",
+ RSS: "D, d M y", // RFC 822
+ TICKS: "!",
+ TIMESTAMP: "@",
+ W3C: "yy-mm-dd", // ISO 8601
+
+ _ticksTo1970: ( ( ( 1970 - 1 ) * 365 + Math.floor( 1970 / 4 ) - Math.floor( 1970 / 100 ) +
+ Math.floor( 1970 / 400 ) ) * 24 * 60 * 60 * 10000000 ),
+
+ /* Format a date object into a string value.
+ * The format can be combinations of the following:
+ * d - day of month (no leading zero)
+ * dd - day of month (two digit)
+ * o - day of year (no leading zeros)
+ * oo - day of year (three digit)
+ * D - day name short
+ * DD - day name long
+ * m - month of year (no leading zero)
+ * mm - month of year (two digit)
+ * M - month name short
+ * MM - month name long
+ * y - year (two digit)
+ * yy - year (four digit)
+ * @ - Unix timestamp (ms since 01/01/1970)
+ * ! - Windows ticks (100ns since 01/01/0001)
+ * "..." - literal text
+ * '' - single quote
+ *
+ * @param format string - the desired format of the date
+ * @param date Date - the date value to format
+ * @param settings Object - attributes include:
+ * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ * dayNames string[7] - names of the days from Sunday (optional)
+ * monthNamesShort string[12] - abbreviated names of the months (optional)
+ * monthNames string[12] - names of the months (optional)
+ * @return string - the date in the above format
+ */
+ formatDate: function( format, date, settings ) {
+ if ( !date ) {
+ return "";
+ }
+
+ var iFormat,
+ dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+ dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+ monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+ monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+
+ // Check whether a format character is doubled
+ lookAhead = function( match ) {
+ var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+ if ( matches ) {
+ iFormat++;
+ }
+ return matches;
+ },
+
+ // Format a number, with leading zero if necessary
+ formatNumber = function( match, value, len ) {
+ var num = "" + value;
+ if ( lookAhead( match ) ) {
+ while ( num.length < len ) {
+ num = "0" + num;
+ }
+ }
+ return num;
+ },
+
+ // Format a name, short or long as requested
+ formatName = function( match, value, shortNames, longNames ) {
+ return ( lookAhead( match ) ? longNames[ value ] : shortNames[ value ] );
+ },
+ output = "",
+ literal = false;
+
+ if ( date ) {
+ for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+ if ( literal ) {
+ if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+ literal = false;
+ } else {
+ output += format.charAt( iFormat );
+ }
+ } else {
+ switch ( format.charAt( iFormat ) ) {
+ case "d":
+ output += formatNumber( "d", date.getDate(), 2 );
+ break;
+ case "D":
+ output += formatName( "D", date.getDay(), dayNamesShort, dayNames );
+ break;
+ case "o":
+ output += formatNumber( "o",
+ Math.round( ( new Date( date.getFullYear(), date.getMonth(), date.getDate() ).getTime() - new Date( date.getFullYear(), 0, 0 ).getTime() ) / 86400000 ), 3 );
+ break;
+ case "m":
+ output += formatNumber( "m", date.getMonth() + 1, 2 );
+ break;
+ case "M":
+ output += formatName( "M", date.getMonth(), monthNamesShort, monthNames );
+ break;
+ case "y":
+ output += ( lookAhead( "y" ) ? date.getFullYear() :
+ ( date.getFullYear() % 100 < 10 ? "0" : "" ) + date.getFullYear() % 100 );
+ break;
+ case "@":
+ output += date.getTime();
+ break;
+ case "!":
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if ( lookAhead( "'" ) ) {
+ output += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ output += format.charAt( iFormat );
+ }
+ }
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function( format ) {
+ var iFormat,
+ chars = "",
+ literal = false,
+
+ // Check whether a format character is doubled
+ lookAhead = function( match ) {
+ var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+ if ( matches ) {
+ iFormat++;
+ }
+ return matches;
+ };
+
+ for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+ if ( literal ) {
+ if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+ literal = false;
+ } else {
+ chars += format.charAt( iFormat );
+ }
+ } else {
+ switch ( format.charAt( iFormat ) ) {
+ case "d": case "m": case "y": case "@":
+ chars += "0123456789";
+ break;
+ case "D": case "M":
+ return null; // Accept anything
+ case "'":
+ if ( lookAhead( "'" ) ) {
+ chars += "'";
+ } else {
+ literal = true;
+ }
+ break;
+ default:
+ chars += format.charAt( iFormat );
+ }
+ }
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function( inst, name ) {
+ return inst.settings[ name ] !== undefined ?
+ inst.settings[ name ] : this._defaults[ name ];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function( inst, noDefault ) {
+ if ( inst.input.val() === inst.lastVal ) {
+ return;
+ }
+
+ var dateFormat = this._get( inst, "dateFormat" ),
+ dates = inst.lastVal = inst.input ? inst.input.val() : null,
+ defaultDate = this._getDefaultDate( inst ),
+ date = defaultDate,
+ settings = this._getFormatConfig( inst );
+
+ try {
+ date = this.parseDate( dateFormat, dates, settings ) || defaultDate;
+ } catch ( event ) {
+ dates = ( noDefault ? "" : dates );
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = ( dates ? date.getDate() : 0 );
+ inst.currentMonth = ( dates ? date.getMonth() : 0 );
+ inst.currentYear = ( dates ? date.getFullYear() : 0 );
+ this._adjustInstDate( inst );
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function( inst ) {
+ return this._restrictMinMax( inst,
+ this._determineDate( inst, this._get( inst, "defaultDate" ), new Date() ) );
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function( inst, date, defaultDate ) {
+ var offsetNumeric = function( offset ) {
+ var date = new Date();
+ date.setDate( date.getDate() + offset );
+ return date;
+ },
+ offsetString = function( offset ) {
+ try {
+ return $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+ offset, $.datepicker._getFormatConfig( inst ) );
+ }
+ catch ( e ) {
+
+ // Ignore
+ }
+
+ var date = ( offset.toLowerCase().match( /^c/ ) ?
+ $.datepicker._getDate( inst ) : null ) || new Date(),
+ year = date.getFullYear(),
+ month = date.getMonth(),
+ day = date.getDate(),
+ pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
+ matches = pattern.exec( offset );
+
+ while ( matches ) {
+ switch ( matches[ 2 ] || "d" ) {
+ case "d" : case "D" :
+ day += parseInt( matches[ 1 ], 10 ); break;
+ case "w" : case "W" :
+ day += parseInt( matches[ 1 ], 10 ) * 7; break;
+ case "m" : case "M" :
+ month += parseInt( matches[ 1 ], 10 );
+ day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+ break;
+ case "y": case "Y" :
+ year += parseInt( matches[ 1 ], 10 );
+ day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+ break;
+ }
+ matches = pattern.exec( offset );
+ }
+ return new Date( year, month, day );
+ },
+ newDate = ( date == null || date === "" ? defaultDate : ( typeof date === "string" ? offsetString( date ) :
+ ( typeof date === "number" ? ( isNaN( date ) ? defaultDate : offsetNumeric( date ) ) : new Date( date.getTime() ) ) ) );
+
+ newDate = ( newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate );
+ if ( newDate ) {
+ newDate.setHours( 0 );
+ newDate.setMinutes( 0 );
+ newDate.setSeconds( 0 );
+ newDate.setMilliseconds( 0 );
+ }
+ return this._daylightSavingAdjust( newDate );
+ },
+
+ /* Handle switch to/from daylight saving.
+ * Hours may be non-zero on daylight saving cut-over:
+ * > 12 when midnight changeover, but then cannot generate
+ * midnight datetime, so jump to 1AM, otherwise reset.
+ * @param date (Date) the date to check
+ * @return (Date) the corrected date
+ */
+ _daylightSavingAdjust: function( date ) {
+ if ( !date ) {
+ return null;
+ }
+ date.setHours( date.getHours() > 12 ? date.getHours() + 2 : 0 );
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function( inst, date, noChange ) {
+ var clear = !date,
+ origMonth = inst.selectedMonth,
+ origYear = inst.selectedYear,
+ newDate = this._restrictMinMax( inst, this._determineDate( inst, date, new Date() ) );
+
+ inst.selectedDay = inst.currentDay = newDate.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+ if ( ( origMonth !== inst.selectedMonth || origYear !== inst.selectedYear ) && !noChange ) {
+ this._notifyChange( inst );
+ }
+ this._adjustInstDate( inst );
+ if ( inst.input ) {
+ inst.input.val( clear ? "" : this._formatDate( inst ) );
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function( inst ) {
+ var startDate = ( !inst.currentYear || ( inst.input && inst.input.val() === "" ) ? null :
+ this._daylightSavingAdjust( new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+ return startDate;
+ },
+
+ /* Attach the onxxx handlers. These are declared statically so
+ * they work with static code transformers like Caja.
+ */
+ _attachHandlers: function( inst ) {
+ var stepMonths = this._get( inst, "stepMonths" ),
+ id = "#" + inst.id.replace( /\\\\/g, "\\" );
+ inst.dpDiv.find( "[data-handler]" ).map( function() {
+ var handler = {
+ prev: function() {
+ $.datepicker._adjustDate( id, -stepMonths, "M" );
+ },
+ next: function() {
+ $.datepicker._adjustDate( id, +stepMonths, "M" );
+ },
+ hide: function() {
+ $.datepicker._hideDatepicker();
+ },
+ today: function() {
+ $.datepicker._gotoToday( id );
+ },
+ selectDay: function() {
+ $.datepicker._selectDay( id, +this.getAttribute( "data-month" ), +this.getAttribute( "data-year" ), this );
+ return false;
+ },
+ selectMonth: function() {
+ $.datepicker._selectMonthYear( id, this, "M" );
+ return false;
+ },
+ selectYear: function() {
+ $.datepicker._selectMonthYear( id, this, "Y" );
+ return false;
+ }
+ };
+ $( this ).on( this.getAttribute( "data-event" ), handler[ this.getAttribute( "data-handler" ) ] );
+ } );
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function( inst ) {
+ var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
+ controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
+ monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
+ selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
+ cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
+ printDate, dRow, tbody, daySettings, otherMonth, unselectable,
+ tempDate = new Date(),
+ today = this._daylightSavingAdjust(
+ new Date( tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate() ) ), // clear time
+ isRTL = this._get( inst, "isRTL" ),
+ showButtonPanel = this._get( inst, "showButtonPanel" ),
+ hideIfNoPrevNext = this._get( inst, "hideIfNoPrevNext" ),
+ navigationAsDateFormat = this._get( inst, "navigationAsDateFormat" ),
+ numMonths = this._getNumberOfMonths( inst ),
+ showCurrentAtPos = this._get( inst, "showCurrentAtPos" ),
+ stepMonths = this._get( inst, "stepMonths" ),
+ isMultiMonth = ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ),
+ currentDate = this._daylightSavingAdjust( ( !inst.currentDay ? new Date( 9999, 9, 9 ) :
+ new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) ),
+ minDate = this._getMinMaxDate( inst, "min" ),
+ maxDate = this._getMinMaxDate( inst, "max" ),
+ drawMonth = inst.drawMonth - showCurrentAtPos,
+ drawYear = inst.drawYear;
+
+ if ( drawMonth < 0 ) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if ( maxDate ) {
+ maxDraw = this._daylightSavingAdjust( new Date( maxDate.getFullYear(),
+ maxDate.getMonth() - ( numMonths[ 0 ] * numMonths[ 1 ] ) + 1, maxDate.getDate() ) );
+ maxDraw = ( minDate && maxDraw < minDate ? minDate : maxDraw );
+ while ( this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 ) ) > maxDraw ) {
+ drawMonth--;
+ if ( drawMonth < 0 ) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+
+ prevText = this._get( inst, "prevText" );
+ prevText = ( !navigationAsDateFormat ? prevText : this.formatDate( prevText,
+ this._daylightSavingAdjust( new Date( drawYear, drawMonth - stepMonths, 1 ) ),
+ this._getFormatConfig( inst ) ) );
+
+ prev = ( this._canAdjustMonth( inst, -1, drawYear, drawMonth ) ?
+ "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
+ " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" :
+ ( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" ) );
+
+ nextText = this._get( inst, "nextText" );
+ nextText = ( !navigationAsDateFormat ? nextText : this.formatDate( nextText,
+ this._daylightSavingAdjust( new Date( drawYear, drawMonth + stepMonths, 1 ) ),
+ this._getFormatConfig( inst ) ) );
+
+ next = ( this._canAdjustMonth( inst, +1, drawYear, drawMonth ) ?
+ "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
+ " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" :
+ ( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" ) );
+
+ currentText = this._get( inst, "currentText" );
+ gotoDate = ( this._get( inst, "gotoCurrent" ) && inst.currentDay ? currentDate : today );
+ currentText = ( !navigationAsDateFormat ? currentText :
+ this.formatDate( currentText, gotoDate, this._getFormatConfig( inst ) ) );
+
+ controls = ( !inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
+ this._get( inst, "closeText" ) + "</button>" : "" );
+
+ buttonPanel = ( showButtonPanel ) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + ( isRTL ? controls : "" ) +
+ ( this._isInRange( inst, gotoDate ) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
+ ">" + currentText + "</button>" : "" ) + ( isRTL ? "" : controls ) + "</div>" : "";
+
+ firstDay = parseInt( this._get( inst, "firstDay" ), 10 );
+ firstDay = ( isNaN( firstDay ) ? 0 : firstDay );
+
+ showWeek = this._get( inst, "showWeek" );
+ dayNames = this._get( inst, "dayNames" );
+ dayNamesMin = this._get( inst, "dayNamesMin" );
+ monthNames = this._get( inst, "monthNames" );
+ monthNamesShort = this._get( inst, "monthNamesShort" );
+ beforeShowDay = this._get( inst, "beforeShowDay" );
+ showOtherMonths = this._get( inst, "showOtherMonths" );
+ selectOtherMonths = this._get( inst, "selectOtherMonths" );
+ defaultDate = this._getDefaultDate( inst );
+ html = "";
+
+ for ( row = 0; row < numMonths[ 0 ]; row++ ) {
+ group = "";
+ this.maxRows = 4;
+ for ( col = 0; col < numMonths[ 1 ]; col++ ) {
+ selectedDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, inst.selectedDay ) );
+ cornerClass = " ui-corner-all";
+ calender = "";
+ if ( isMultiMonth ) {
+ calender += "<div class='ui-datepicker-group";
+ if ( numMonths[ 1 ] > 1 ) {
+ switch ( col ) {
+ case 0: calender += " ui-datepicker-group-first";
+ cornerClass = " ui-corner-" + ( isRTL ? "right" : "left" ); break;
+ case numMonths[ 1 ] - 1: calender += " ui-datepicker-group-last";
+ cornerClass = " ui-corner-" + ( isRTL ? "left" : "right" ); break;
+ default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break;
+ }
+ }
+ calender += "'>";
+ }
+ calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
+ ( /all|left/.test( cornerClass ) && row === 0 ? ( isRTL ? next : prev ) : "" ) +
+ ( /all|right/.test( cornerClass ) && row === 0 ? ( isRTL ? prev : next ) : "" ) +
+ this._generateMonthYearHeader( inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort ) + // draw month headers
+ "</div><table class='ui-datepicker-calendar'><thead>" +
+ "<tr>";
+ thead = ( showWeek ? "<th class='ui-datepicker-week-col'>" + this._get( inst, "weekHeader" ) + "</th>" : "" );
+ for ( dow = 0; dow < 7; dow++ ) { // days of the week
+ day = ( dow + firstDay ) % 7;
+ thead += "<th scope='col'" + ( ( dow + firstDay + 6 ) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "" ) + ">" +
+ "<span title='" + dayNames[ day ] + "'>" + dayNamesMin[ day ] + "</span></th>";
+ }
+ calender += thead + "</tr></thead><tbody>";
+ daysInMonth = this._getDaysInMonth( drawYear, drawMonth );
+ if ( drawYear === inst.selectedYear && drawMonth === inst.selectedMonth ) {
+ inst.selectedDay = Math.min( inst.selectedDay, daysInMonth );
+ }
+ leadDays = ( this._getFirstDayOfMonth( drawYear, drawMonth ) - firstDay + 7 ) % 7;
+ curRows = Math.ceil( ( leadDays + daysInMonth ) / 7 ); // calculate the number of rows to generate
+ numRows = ( isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows ); //If multiple months, use the higher number of rows (see #7043)
+ this.maxRows = numRows;
+ printDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 - leadDays ) );
+ for ( dRow = 0; dRow < numRows; dRow++ ) { // create date picker rows
+ calender += "<tr>";
+ tbody = ( !showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
+ this._get( inst, "calculateWeek" )( printDate ) + "</td>" );
+ for ( dow = 0; dow < 7; dow++ ) { // create date picker days
+ daySettings = ( beforeShowDay ?
+ beforeShowDay.apply( ( inst.input ? inst.input[ 0 ] : null ), [ printDate ] ) : [ true, "" ] );
+ otherMonth = ( printDate.getMonth() !== drawMonth );
+ unselectable = ( otherMonth && !selectOtherMonths ) || !daySettings[ 0 ] ||
+ ( minDate && printDate < minDate ) || ( maxDate && printDate > maxDate );
+ tbody += "<td class='" +
+ ( ( dow + firstDay + 6 ) % 7 >= 5 ? " ui-datepicker-week-end" : "" ) + // highlight weekends
+ ( otherMonth ? " ui-datepicker-other-month" : "" ) + // highlight days from other months
+ ( ( printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent ) || // user pressed key
+ ( defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime() ) ?
+
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ " " + this._dayOverClass : "" ) + // highlight selected day
+ ( unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "" ) + // highlight unselectable days
+ ( otherMonth && !showOtherMonths ? "" : " " + daySettings[ 1 ] + // highlight custom dates
+ ( printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "" ) + // highlight selected day
+ ( printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "" ) ) + "'" + // highlight today (if different)
+ ( ( !otherMonth || showOtherMonths ) && daySettings[ 2 ] ? " title='" + daySettings[ 2 ].replace( /'/g, "'" ) + "'" : "" ) + // cell title
+ ( unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'" ) + ">" + // actions
+ ( otherMonth && !showOtherMonths ? " " : // display for other months
+ ( unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
+ ( printDate.getTime() === today.getTime() ? " ui-state-highlight" : "" ) +
+ ( printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "" ) + // highlight selected day
+ ( otherMonth ? " ui-priority-secondary" : "" ) + // distinguish dates from other months
+ "' href='#'>" + printDate.getDate() + "</a>" ) ) + "</td>"; // display selectable date
+ printDate.setDate( printDate.getDate() + 1 );
+ printDate = this._daylightSavingAdjust( printDate );
+ }
+ calender += tbody + "</tr>";
+ }
+ drawMonth++;
+ if ( drawMonth > 11 ) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += "</tbody></table>" + ( isMultiMonth ? "</div>" +
+ ( ( numMonths[ 0 ] > 0 && col === numMonths[ 1 ] - 1 ) ? "<div class='ui-datepicker-row-break'></div>" : "" ) : "" );
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel;
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function( inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort ) {
+
+ var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
+ changeMonth = this._get( inst, "changeMonth" ),
+ changeYear = this._get( inst, "changeYear" ),
+ showMonthAfterYear = this._get( inst, "showMonthAfterYear" ),
+ html = "<div class='ui-datepicker-title'>",
+ monthHtml = "";
+
+ // Month selection
+ if ( secondary || !changeMonth ) {
+ monthHtml += "<span class='ui-datepicker-month'>" + monthNames[ drawMonth ] + "</span>";
+ } else {
+ inMinYear = ( minDate && minDate.getFullYear() === drawYear );
+ inMaxYear = ( maxDate && maxDate.getFullYear() === drawYear );
+ monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
+ for ( month = 0; month < 12; month++ ) {
+ if ( ( !inMinYear || month >= minDate.getMonth() ) && ( !inMaxYear || month <= maxDate.getMonth() ) ) {
+ monthHtml += "<option value='" + month + "'" +
+ ( month === drawMonth ? " selected='selected'" : "" ) +
+ ">" + monthNamesShort[ month ] + "</option>";
+ }
+ }
+ monthHtml += "</select>";
+ }
+
+ if ( !showMonthAfterYear ) {
+ html += monthHtml + ( secondary || !( changeMonth && changeYear ) ? " " : "" );
+ }
+
+ // Year selection
+ if ( !inst.yearshtml ) {
+ inst.yearshtml = "";
+ if ( secondary || !changeYear ) {
+ html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
+ } else {
+
+ // determine range of years to display
+ years = this._get( inst, "yearRange" ).split( ":" );
+ thisYear = new Date().getFullYear();
+ determineYear = function( value ) {
+ var year = ( value.match( /c[+\-].*/ ) ? drawYear + parseInt( value.substring( 1 ), 10 ) :
+ ( value.match( /[+\-].*/ ) ? thisYear + parseInt( value, 10 ) :
+ parseInt( value, 10 ) ) );
+ return ( isNaN( year ) ? thisYear : year );
+ };
+ year = determineYear( years[ 0 ] );
+ endYear = Math.max( year, determineYear( years[ 1 ] || "" ) );
+ year = ( minDate ? Math.max( year, minDate.getFullYear() ) : year );
+ endYear = ( maxDate ? Math.min( endYear, maxDate.getFullYear() ) : endYear );
+ inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
+ for ( ; year <= endYear; year++ ) {
+ inst.yearshtml += "<option value='" + year + "'" +
+ ( year === drawYear ? " selected='selected'" : "" ) +
+ ">" + year + "</option>";
+ }
+ inst.yearshtml += "</select>";
+
+ html += inst.yearshtml;
+ inst.yearshtml = null;
+ }
+ }
+
+ html += this._get( inst, "yearSuffix" );
+ if ( showMonthAfterYear ) {
+ html += ( secondary || !( changeMonth && changeYear ) ? " " : "" ) + monthHtml;
+ }
+ html += "</div>"; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function( inst, offset, period ) {
+ var year = inst.selectedYear + ( period === "Y" ? offset : 0 ),
+ month = inst.selectedMonth + ( period === "M" ? offset : 0 ),
+ day = Math.min( inst.selectedDay, this._getDaysInMonth( year, month ) ) + ( period === "D" ? offset : 0 ),
+ date = this._restrictMinMax( inst, this._daylightSavingAdjust( new Date( year, month, day ) ) );
+
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if ( period === "M" || period === "Y" ) {
+ this._notifyChange( inst );
+ }
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function( inst, date ) {
+ var minDate = this._getMinMaxDate( inst, "min" ),
+ maxDate = this._getMinMaxDate( inst, "max" ),
+ newDate = ( minDate && date < minDate ? minDate : date );
+ return ( maxDate && newDate > maxDate ? maxDate : newDate );
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function( inst ) {
+ var onChange = this._get( inst, "onChangeMonthYear" );
+ if ( onChange ) {
+ onChange.apply( ( inst.input ? inst.input[ 0 ] : null ),
+ [ inst.selectedYear, inst.selectedMonth + 1, inst ] );
+ }
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function( inst ) {
+ var numMonths = this._get( inst, "numberOfMonths" );
+ return ( numMonths == null ? [ 1, 1 ] : ( typeof numMonths === "number" ? [ 1, numMonths ] : numMonths ) );
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function( inst, minMax ) {
+ return this._determineDate( inst, this._get( inst, minMax + "Date" ), null );
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function( year, month ) {
+ return 32 - this._daylightSavingAdjust( new Date( year, month, 32 ) ).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function( year, month ) {
+ return new Date( year, month, 1 ).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function( inst, offset, curYear, curMonth ) {
+ var numMonths = this._getNumberOfMonths( inst ),
+ date = this._daylightSavingAdjust( new Date( curYear,
+ curMonth + ( offset < 0 ? offset : numMonths[ 0 ] * numMonths[ 1 ] ), 1 ) );
+
+ if ( offset < 0 ) {
+ date.setDate( this._getDaysInMonth( date.getFullYear(), date.getMonth() ) );
+ }
+ return this._isInRange( inst, date );
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function( inst, date ) {
+ var yearSplit, currentYear,
+ minDate = this._getMinMaxDate( inst, "min" ),
+ maxDate = this._getMinMaxDate( inst, "max" ),
+ minYear = null,
+ maxYear = null,
+ years = this._get( inst, "yearRange" );
+ if ( years ) {
+ yearSplit = years.split( ":" );
+ currentYear = new Date().getFullYear();
+ minYear = parseInt( yearSplit[ 0 ], 10 );
+ maxYear = parseInt( yearSplit[ 1 ], 10 );
+ if ( yearSplit[ 0 ].match( /[+\-].*/ ) ) {
+ minYear += currentYear;
+ }
+ if ( yearSplit[ 1 ].match( /[+\-].*/ ) ) {
+ maxYear += currentYear;
+ }
+ }
+
+ return ( ( !minDate || date.getTime() >= minDate.getTime() ) &&
+ ( !maxDate || date.getTime() <= maxDate.getTime() ) &&
+ ( !minYear || date.getFullYear() >= minYear ) &&
+ ( !maxYear || date.getFullYear() <= maxYear ) );
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function( inst ) {
+ var shortYearCutoff = this._get( inst, "shortYearCutoff" );
+ shortYearCutoff = ( typeof shortYearCutoff !== "string" ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt( shortYearCutoff, 10 ) );
+ return { shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get( inst, "dayNamesShort" ), dayNames: this._get( inst, "dayNames" ),
+ monthNamesShort: this._get( inst, "monthNamesShort" ), monthNames: this._get( inst, "monthNames" ) };
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function( inst, day, month, year ) {
+ if ( !day ) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = ( day ? ( typeof day === "object" ? day :
+ this._daylightSavingAdjust( new Date( year, month, day ) ) ) :
+ this._daylightSavingAdjust( new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+ return this.formatDate( this._get( inst, "dateFormat" ), date, this._getFormatConfig( inst ) );
+ }
+} );
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function datepicker_bindHover( dpDiv ) {
+ var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+ return dpDiv.on( "mouseout", selector, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+ $( this ).removeClass( "ui-datepicker-prev-hover" );
+ }
+ if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+ $( this ).removeClass( "ui-datepicker-next-hover" );
+ }
+ } )
+ .on( "mouseover", selector, datepicker_handleMouseover );
+}
+
+function datepicker_handleMouseover() {
+ if ( !$.datepicker._isDisabledDatepicker( datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[ 0 ] : datepicker_instActive.input[ 0 ] ) ) {
+ $( this ).parents( ".ui-datepicker-calendar" ).find( "a" ).removeClass( "ui-state-hover" );
+ $( this ).addClass( "ui-state-hover" );
+ if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+ $( this ).addClass( "ui-datepicker-prev-hover" );
+ }
+ if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+ $( this ).addClass( "ui-datepicker-next-hover" );
+ }
+ }
+}
+
+/* jQuery extend now ignores nulls! */
+function datepicker_extendRemove( target, props ) {
+ $.extend( target, props );
+ for ( var name in props ) {
+ if ( props[ name ] == null ) {
+ target[ name ] = props[ name ];
+ }
+ }
+ return target;
+}
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function( options ) {
+
+ /* Verify an empty collection wasn't passed - Fixes #6976 */
+ if ( !this.length ) {
+ return this;
+ }
+
+ /* Initialise the date picker. */
+ if ( !$.datepicker.initialized ) {
+ $( document ).on( "mousedown", $.datepicker._checkExternalClick );
+ $.datepicker.initialized = true;
+ }
+
+ /* Append datepicker main container to body if not exist. */
+ if ( $( "#" + $.datepicker._mainDivId ).length === 0 ) {
+ $( "body" ).append( $.datepicker.dpDiv );
+ }
+
+ var otherArgs = Array.prototype.slice.call( arguments, 1 );
+ if ( typeof options === "string" && ( options === "isDisabled" || options === "getDate" || options === "widget" ) ) {
+ return $.datepicker[ "_" + options + "Datepicker" ].
+ apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+ }
+ if ( options === "option" && arguments.length === 2 && typeof arguments[ 1 ] === "string" ) {
+ return $.datepicker[ "_" + options + "Datepicker" ].
+ apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+ }
+ return this.each( function() {
+ typeof options === "string" ?
+ $.datepicker[ "_" + options + "Datepicker" ].
+ apply( $.datepicker, [ this ].concat( otherArgs ) ) :
+ $.datepicker._attachDatepicker( this, options );
+ } );
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.12.1";
+
+var widgetsDatepicker = $.datepicker;
+
+
+
+
+// This file is deprecated
+var ie = $.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() );
+
+/*!
+ * jQuery UI Mouse 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Mouse
+//>>group: Widgets
+//>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
+//>>docs: http://api.jqueryui.com/mouse/
+
+
+
+var mouseHandled = false;
+$( document ).on( "mouseup", function() {
+ mouseHandled = false;
+} );
+
+var widgetsMouse = $.widget( "ui.mouse", {
+ version: "1.12.1",
+ options: {
+ cancel: "input, textarea, button, select, option",
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var that = this;
+
+ this.element
+ .on( "mousedown." + this.widgetName, function( event ) {
+ return that._mouseDown( event );
+ } )
+ .on( "click." + this.widgetName, function( event ) {
+ if ( true === $.data( event.target, that.widgetName + ".preventClickEvent" ) ) {
+ $.removeData( event.target, that.widgetName + ".preventClickEvent" );
+ event.stopImmediatePropagation();
+ return false;
+ }
+ } );
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.off( "." + this.widgetName );
+ if ( this._mouseMoveDelegate ) {
+ this.document
+ .off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+ .off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+ }
+ },
+
+ _mouseDown: function( event ) {
+
+ // don't let more than one widget handle mouseStart
+ if ( mouseHandled ) {
+ return;
+ }
+
+ this._mouseMoved = false;
+
+ // We may have missed mouseup (out of window)
+ ( this._mouseStarted && this._mouseUp( event ) );
+
+ this._mouseDownEvent = event;
+
+ var that = this,
+ btnIsLeft = ( event.which === 1 ),
+
+ // event.target.nodeName works around a bug in IE 8 with
+ // disabled inputs (#7620)
+ elIsCancel = ( typeof this.options.cancel === "string" && event.target.nodeName ?
+ $( event.target ).closest( this.options.cancel ).length : false );
+ if ( !btnIsLeft || elIsCancel || !this._mouseCapture( event ) ) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if ( !this.mouseDelayMet ) {
+ this._mouseDelayTimer = setTimeout( function() {
+ that.mouseDelayMet = true;
+ }, this.options.delay );
+ }
+
+ if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+ this._mouseStarted = ( this._mouseStart( event ) !== false );
+ if ( !this._mouseStarted ) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // Click event may never have fired (Gecko & Opera)
+ if ( true === $.data( event.target, this.widgetName + ".preventClickEvent" ) ) {
+ $.removeData( event.target, this.widgetName + ".preventClickEvent" );
+ }
+
+ // These delegates are required to keep context
+ this._mouseMoveDelegate = function( event ) {
+ return that._mouseMove( event );
+ };
+ this._mouseUpDelegate = function( event ) {
+ return that._mouseUp( event );
+ };
+
+ this.document
+ .on( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+ .on( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+ event.preventDefault();
+
+ mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function( event ) {
+
+ // Only check for mouseups outside the document if you've moved inside the document
+ // at least once. This prevents the firing of mouseup in the case of IE<9, which will
+ // fire a mousemove event if content is placed under the cursor. See #7778
+ // Support: IE <9
+ if ( this._mouseMoved ) {
+
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ( $.ui.ie && ( !document.documentMode || document.documentMode < 9 ) &&
+ !event.button ) {
+ return this._mouseUp( event );
+
+ // Iframe mouseup check - mouseup occurred in another document
+ } else if ( !event.which ) {
+
+ // Support: Safari <=8 - 9
+ // Safari sets which to 0 if you press any of the following keys
+ // during a drag (#14461)
+ if ( event.originalEvent.altKey || event.originalEvent.ctrlKey ||
+ event.originalEvent.metaKey || event.originalEvent.shiftKey ) {
+ this.ignoreMissingWhich = true;
+ } else if ( !this.ignoreMissingWhich ) {
+ return this._mouseUp( event );
+ }
+ }
+ }
+
+ if ( event.which || event.button ) {
+ this._mouseMoved = true;
+ }
+
+ if ( this._mouseStarted ) {
+ this._mouseDrag( event );
+ return event.preventDefault();
+ }
+
+ if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+ this._mouseStarted =
+ ( this._mouseStart( this._mouseDownEvent, event ) !== false );
+ ( this._mouseStarted ? this._mouseDrag( event ) : this._mouseUp( event ) );
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function( event ) {
+ this.document
+ .off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+ .off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+ if ( this._mouseStarted ) {
+ this._mouseStarted = false;
+
+ if ( event.target === this._mouseDownEvent.target ) {
+ $.data( event.target, this.widgetName + ".preventClickEvent", true );
+ }
+
+ this._mouseStop( event );
+ }
+
+ if ( this._mouseDelayTimer ) {
+ clearTimeout( this._mouseDelayTimer );
+ delete this._mouseDelayTimer;
+ }
+
+ this.ignoreMissingWhich = false;
+ mouseHandled = false;
+ event.preventDefault();
+ },
+
+ _mouseDistanceMet: function( event ) {
+ return ( Math.max(
+ Math.abs( this._mouseDownEvent.pageX - event.pageX ),
+ Math.abs( this._mouseDownEvent.pageY - event.pageY )
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function( /* event */ ) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function( /* event */ ) {},
+ _mouseDrag: function( /* event */ ) {},
+ _mouseStop: function( /* event */ ) {},
+ _mouseCapture: function( /* event */ ) { return true; }
+} );
+
+
+
+
+// $.ui.plugin is deprecated. Use $.widget() extensions instead.
+var plugin = $.ui.plugin = {
+ add: function( module, option, set ) {
+ var i,
+ proto = $.ui[ module ].prototype;
+ for ( i in set ) {
+ proto.plugins[ i ] = proto.plugins[ i ] || [];
+ proto.plugins[ i ].push( [ option, set[ i ] ] );
+ }
+ },
+ call: function( instance, name, args, allowDisconnected ) {
+ var i,
+ set = instance.plugins[ name ];
+
+ if ( !set ) {
+ return;
+ }
+
+ if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode ||
+ instance.element[ 0 ].parentNode.nodeType === 11 ) ) {
+ return;
+ }
+
+ for ( i = 0; i < set.length; i++ ) {
+ if ( instance.options[ set[ i ][ 0 ] ] ) {
+ set[ i ][ 1 ].apply( instance.element, args );
+ }
+ }
+ }
+};
+
+
+
+var safeBlur = $.ui.safeBlur = function( element ) {
+
+ // Support: IE9 - 10 only
+ // If the <body> is blurred, IE will switch windows, see #9420
+ if ( element && element.nodeName.toLowerCase() !== "body" ) {
+ $( element ).trigger( "blur" );
+ }
+};
+
+
+/*!
+ * jQuery UI Draggable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Draggable
+//>>group: Interactions
+//>>description: Enables dragging functionality for any element.
+//>>docs: http://api.jqueryui.com/draggable/
+//>>demos: http://jqueryui.com/draggable/
+//>>css.structure: ../../themes/base/draggable.css
+
+
+
+$.widget( "ui.draggable", $.ui.mouse, {
+ version: "1.12.1",
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false,
+
+ // Callbacks
+ drag: null,
+ start: null,
+ stop: null
+ },
+ _create: function() {
+
+ if ( this.options.helper === "original" ) {
+ this._setPositionRelative();
+ }
+ if ( this.options.addClasses ) {
+ this._addClass( "ui-draggable" );
+ }
+ this._setHandleClassName();
+
+ this._mouseInit();
+ },
+
+ _setOption: function( key, value ) {
+ this._super( key, value );
+ if ( key === "handle" ) {
+ this._removeHandleClassName();
+ this._setHandleClassName();
+ }
+ },
+
+ _destroy: function() {
+ if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) {
+ this.destroyOnClear = true;
+ return;
+ }
+ this._removeHandleClassName();
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options;
+
+ // Among others, prevent a drag on a resizable-handle
+ if ( this.helper || o.disabled ||
+ $( event.target ).closest( ".ui-resizable-handle" ).length > 0 ) {
+ return false;
+ }
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle( event );
+ if ( !this.handle ) {
+ return false;
+ }
+
+ this._blurActiveElement( event );
+
+ this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix );
+
+ return true;
+
+ },
+
+ _blockFrames: function( selector ) {
+ this.iframeBlocks = this.document.find( selector ).map( function() {
+ var iframe = $( this );
+
+ return $( "<div>" )
+ .css( "position", "absolute" )
+ .appendTo( iframe.parent() )
+ .outerWidth( iframe.outerWidth() )
+ .outerHeight( iframe.outerHeight() )
+ .offset( iframe.offset() )[ 0 ];
+ } );
+ },
+
+ _unblockFrames: function() {
+ if ( this.iframeBlocks ) {
+ this.iframeBlocks.remove();
+ delete this.iframeBlocks;
+ }
+ },
+
+ _blurActiveElement: function( event ) {
+ var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+ target = $( event.target );
+
+ // Don't blur if the event occurred on an element that is within
+ // the currently focused element
+ // See #10527, #12472
+ if ( target.closest( activeElement ).length ) {
+ return;
+ }
+
+ // Blur any element that currently has focus, see #4261
+ $.ui.safeBlur( activeElement );
+ },
+
+ _mouseStart: function( event ) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper( event );
+
+ this._addClass( this.helper, "ui-draggable-dragging" );
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.current = this;
+ }
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css( "position" );
+ this.scrollParent = this.helper.scrollParent( true );
+ this.offsetParent = this.helper.offsetParent();
+ this.hasFixedAncestor = this.helper.parents().filter( function() {
+ return $( this ).css( "position" ) === "fixed";
+ } ).length > 0;
+
+ //The element's absolute position on the page minus margins
+ this.positionAbs = this.element.offset();
+ this._refreshOffsets( event );
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition( event, false );
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ ( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
+
+ //Set a containment if given in the options
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if ( this._trigger( "start", event ) === false ) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ( $.ui.ddmanager && !o.dropBehaviour ) {
+ $.ui.ddmanager.prepareOffsets( this, event );
+ }
+
+ // Execute the drag once - this causes the helper not to be visible before getting its
+ // correct position
+ this._mouseDrag( event, true );
+
+ // If the ddmanager is used for droppables, inform the manager that dragging has started
+ // (see #5003)
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.dragStart( this, event );
+ }
+
+ return true;
+ },
+
+ _refreshOffsets: function( event ) {
+ this.offset = {
+ top: this.positionAbs.top - this.margins.top,
+ left: this.positionAbs.left - this.margins.left,
+ scroll: false,
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset()
+ };
+
+ this.offset.click = {
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ };
+ },
+
+ _mouseDrag: function( event, noPropagation ) {
+
+ // reset any necessary cached properties (see #5009)
+ if ( this.hasFixedAncestor ) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ //Compute the helpers position
+ this.position = this._generatePosition( event, true );
+ this.positionAbs = this._convertPositionTo( "absolute" );
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if ( !noPropagation ) {
+ var ui = this._uiHash();
+ if ( this._trigger( "drag", event, ui ) === false ) {
+ this._mouseUp( new $.Event( "mouseup", event ) );
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ this.helper[ 0 ].style.left = this.position.left + "px";
+ this.helper[ 0 ].style.top = this.position.top + "px";
+
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.drag( this, event );
+ }
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+
+ //If we are using droppables, inform the manager about the drop
+ var that = this,
+ dropped = false;
+ if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+ dropped = $.ui.ddmanager.drop( this, event );
+ }
+
+ //if a drop comes from outside (a sortable)
+ if ( this.dropped ) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if ( ( this.options.revert === "invalid" && !dropped ) ||
+ ( this.options.revert === "valid" && dropped ) ||
+ this.options.revert === true || ( $.isFunction( this.options.revert ) &&
+ this.options.revert.call( this.element, dropped ) )
+ ) {
+ $( this.helper ).animate(
+ this.originalPosition,
+ parseInt( this.options.revertDuration, 10 ),
+ function() {
+ if ( that._trigger( "stop", event ) !== false ) {
+ that._clear();
+ }
+ }
+ );
+ } else {
+ if ( this._trigger( "stop", event ) !== false ) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ _mouseUp: function( event ) {
+ this._unblockFrames();
+
+ // If the ddmanager is used for droppables, inform the manager that dragging has stopped
+ // (see #5003)
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.dragStop( this, event );
+ }
+
+ // Only need to focus if the event occurred on the draggable itself, see #10527
+ if ( this.handleElement.is( event.target ) ) {
+
+ // The interaction is over; whether or not the click resulted in a drag,
+ // focus the element
+ this.element.trigger( "focus" );
+ }
+
+ return $.ui.mouse.prototype._mouseUp.call( this, event );
+ },
+
+ cancel: function() {
+
+ if ( this.helper.is( ".ui-draggable-dragging" ) ) {
+ this._mouseUp( new $.Event( "mouseup", { target: this.element[ 0 ] } ) );
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function( event ) {
+ return this.options.handle ?
+ !!$( event.target ).closest( this.element.find( this.options.handle ) ).length :
+ true;
+ },
+
+ _setHandleClassName: function() {
+ this.handleElement = this.options.handle ?
+ this.element.find( this.options.handle ) : this.element;
+ this._addClass( this.handleElement, "ui-draggable-handle" );
+ },
+
+ _removeHandleClassName: function() {
+ this._removeClass( this.handleElement, "ui-draggable-handle" );
+ },
+
+ _createHelper: function( event ) {
+
+ var o = this.options,
+ helperIsFunction = $.isFunction( o.helper ),
+ helper = helperIsFunction ?
+ $( o.helper.apply( this.element[ 0 ], [ event ] ) ) :
+ ( o.helper === "clone" ?
+ this.element.clone().removeAttr( "id" ) :
+ this.element );
+
+ if ( !helper.parents( "body" ).length ) {
+ helper.appendTo( ( o.appendTo === "parent" ?
+ this.element[ 0 ].parentNode :
+ o.appendTo ) );
+ }
+
+ // Http://bugs.jqueryui.com/ticket/9446
+ // a helper function can return the original element
+ // which wouldn't have been set to relative in _create
+ if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) {
+ this._setPositionRelative();
+ }
+
+ if ( helper[ 0 ] !== this.element[ 0 ] &&
+ !( /(fixed|absolute)/ ).test( helper.css( "position" ) ) ) {
+ helper.css( "position", "absolute" );
+ }
+
+ return helper;
+
+ },
+
+ _setPositionRelative: function() {
+ if ( !( /^(?:r|a|f)/ ).test( this.element.css( "position" ) ) ) {
+ this.element[ 0 ].style.position = "relative";
+ }
+ },
+
+ _adjustOffsetFromHelper: function( obj ) {
+ if ( typeof obj === "string" ) {
+ obj = obj.split( " " );
+ }
+ if ( $.isArray( obj ) ) {
+ obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+ }
+ if ( "left" in obj ) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ( "right" in obj ) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ( "top" in obj ) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ( "bottom" in obj ) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _isRootNode: function( element ) {
+ return ( /(html|body)/i ).test( element.tagName ) || element === this.document[ 0 ];
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ var po = this.offsetParent.offset(),
+ document = this.document[ 0 ];
+
+ // This is a special case where we need to modify a offset calculated on start, since the
+ // following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the
+ // next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+ // the document, which means that the scroll is included in the initial calculation of the
+ // offset of the parent, and never recalculated upon drag
+ if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== document &&
+ $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if ( this._isRootNode( this.offsetParent[ 0 ] ) ) {
+ po = { top: 0, left: 0 };
+ }
+
+ return {
+ top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+ left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+ if ( this.cssPosition !== "relative" ) {
+ return { top: 0, left: 0 };
+ }
+
+ var p = this.element.position(),
+ scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+ return {
+ top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+ ( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ),
+ left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+ ( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 )
+ };
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: ( parseInt( this.element.css( "marginLeft" ), 10 ) || 0 ),
+ top: ( parseInt( this.element.css( "marginTop" ), 10 ) || 0 ),
+ right: ( parseInt( this.element.css( "marginRight" ), 10 ) || 0 ),
+ bottom: ( parseInt( this.element.css( "marginBottom" ), 10 ) || 0 )
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var isUserScrollable, c, ce,
+ o = this.options,
+ document = this.document[ 0 ];
+
+ this.relativeContainer = null;
+
+ if ( !o.containment ) {
+ this.containment = null;
+ return;
+ }
+
+ if ( o.containment === "window" ) {
+ this.containment = [
+ $( window ).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+ $( window ).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+ $( window ).scrollLeft() + $( window ).width() -
+ this.helperProportions.width - this.margins.left,
+ $( window ).scrollTop() +
+ ( $( window ).height() || document.body.parentNode.scrollHeight ) -
+ this.helperProportions.height - this.margins.top
+ ];
+ return;
+ }
+
+ if ( o.containment === "document" ) {
+ this.containment = [
+ 0,
+ 0,
+ $( document ).width() - this.helperProportions.width - this.margins.left,
+ ( $( document ).height() || document.body.parentNode.scrollHeight ) -
+ this.helperProportions.height - this.margins.top
+ ];
+ return;
+ }
+
+ if ( o.containment.constructor === Array ) {
+ this.containment = o.containment;
+ return;
+ }
+
+ if ( o.containment === "parent" ) {
+ o.containment = this.helper[ 0 ].parentNode;
+ }
+
+ c = $( o.containment );
+ ce = c[ 0 ];
+
+ if ( !ce ) {
+ return;
+ }
+
+ isUserScrollable = /(scroll|auto)/.test( c.css( "overflow" ) );
+
+ this.containment = [
+ ( parseInt( c.css( "borderLeftWidth" ), 10 ) || 0 ) +
+ ( parseInt( c.css( "paddingLeft" ), 10 ) || 0 ),
+ ( parseInt( c.css( "borderTopWidth" ), 10 ) || 0 ) +
+ ( parseInt( c.css( "paddingTop" ), 10 ) || 0 ),
+ ( isUserScrollable ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+ ( parseInt( c.css( "borderRightWidth" ), 10 ) || 0 ) -
+ ( parseInt( c.css( "paddingRight" ), 10 ) || 0 ) -
+ this.helperProportions.width -
+ this.margins.left -
+ this.margins.right,
+ ( isUserScrollable ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+ ( parseInt( c.css( "borderBottomWidth" ), 10 ) || 0 ) -
+ ( parseInt( c.css( "paddingBottom" ), 10 ) || 0 ) -
+ this.helperProportions.height -
+ this.margins.top -
+ this.margins.bottom
+ ];
+ this.relativeContainer = c;
+ },
+
+ _convertPositionTo: function( d, pos ) {
+
+ if ( !pos ) {
+ pos = this.position;
+ }
+
+ var mod = d === "absolute" ? 1 : -1,
+ scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+ return {
+ top: (
+
+ // The absolute mouse position
+ pos.top +
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.top * mod +
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.top * mod -
+ ( ( this.cssPosition === "fixed" ?
+ -this.offset.scroll.top :
+ ( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod )
+ ),
+ left: (
+
+ // The absolute mouse position
+ pos.left +
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.left * mod +
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.left * mod -
+ ( ( this.cssPosition === "fixed" ?
+ -this.offset.scroll.left :
+ ( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod )
+ )
+ };
+
+ },
+
+ _generatePosition: function( event, constrainPosition ) {
+
+ var containment, co, top, left,
+ o = this.options,
+ scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ),
+ pageX = event.pageX,
+ pageY = event.pageY;
+
+ // Cache the scroll
+ if ( !scrollIsRootNode || !this.offset.scroll ) {
+ this.offset.scroll = {
+ top: this.scrollParent.scrollTop(),
+ left: this.scrollParent.scrollLeft()
+ };
+ }
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ // If we are not dragging yet, we won't check for options
+ if ( constrainPosition ) {
+ if ( this.containment ) {
+ if ( this.relativeContainer ) {
+ co = this.relativeContainer.offset();
+ containment = [
+ this.containment[ 0 ] + co.left,
+ this.containment[ 1 ] + co.top,
+ this.containment[ 2 ] + co.left,
+ this.containment[ 3 ] + co.top
+ ];
+ } else {
+ containment = this.containment;
+ }
+
+ if ( event.pageX - this.offset.click.left < containment[ 0 ] ) {
+ pageX = containment[ 0 ] + this.offset.click.left;
+ }
+ if ( event.pageY - this.offset.click.top < containment[ 1 ] ) {
+ pageY = containment[ 1 ] + this.offset.click.top;
+ }
+ if ( event.pageX - this.offset.click.left > containment[ 2 ] ) {
+ pageX = containment[ 2 ] + this.offset.click.left;
+ }
+ if ( event.pageY - this.offset.click.top > containment[ 3 ] ) {
+ pageY = containment[ 3 ] + this.offset.click.top;
+ }
+ }
+
+ if ( o.grid ) {
+
+ //Check for grid elements set to 0 to prevent divide by 0 error causing invalid
+ // argument errors in IE (see ticket #6950)
+ top = o.grid[ 1 ] ? this.originalPageY + Math.round( ( pageY -
+ this.originalPageY ) / o.grid[ 1 ] ) * o.grid[ 1 ] : this.originalPageY;
+ pageY = containment ? ( ( top - this.offset.click.top >= containment[ 1 ] ||
+ top - this.offset.click.top > containment[ 3 ] ) ?
+ top :
+ ( ( top - this.offset.click.top >= containment[ 1 ] ) ?
+ top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : top;
+
+ left = o.grid[ 0 ] ? this.originalPageX +
+ Math.round( ( pageX - this.originalPageX ) / o.grid[ 0 ] ) * o.grid[ 0 ] :
+ this.originalPageX;
+ pageX = containment ? ( ( left - this.offset.click.left >= containment[ 0 ] ||
+ left - this.offset.click.left > containment[ 2 ] ) ?
+ left :
+ ( ( left - this.offset.click.left >= containment[ 0 ] ) ?
+ left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : left;
+ }
+
+ if ( o.axis === "y" ) {
+ pageX = this.originalPageX;
+ }
+
+ if ( o.axis === "x" ) {
+ pageY = this.originalPageY;
+ }
+ }
+
+ return {
+ top: (
+
+ // The absolute mouse position
+ pageY -
+
+ // Click offset (relative to the element)
+ this.offset.click.top -
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.top -
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.top +
+ ( this.cssPosition === "fixed" ?
+ -this.offset.scroll.top :
+ ( scrollIsRootNode ? 0 : this.offset.scroll.top ) )
+ ),
+ left: (
+
+ // The absolute mouse position
+ pageX -
+
+ // Click offset (relative to the element)
+ this.offset.click.left -
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.left -
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.left +
+ ( this.cssPosition === "fixed" ?
+ -this.offset.scroll.left :
+ ( scrollIsRootNode ? 0 : this.offset.scroll.left ) )
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this._removeClass( this.helper, "ui-draggable-dragging" );
+ if ( this.helper[ 0 ] !== this.element[ 0 ] && !this.cancelHelperRemoval ) {
+ this.helper.remove();
+ }
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ if ( this.destroyOnClear ) {
+ this.destroy();
+ }
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function( type, event, ui ) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call( this, type, [ event, ui, this ], true );
+
+ // Absolute position and offset (see #6884 ) have to be recalculated after plugins
+ if ( /^(drag|start|stop)/.test( type ) ) {
+ this.positionAbs = this._convertPositionTo( "absolute" );
+ ui.offset = this.positionAbs;
+ }
+ return $.Widget.prototype._trigger.call( this, type, event, ui );
+ },
+
+ plugins: {},
+
+ _uiHash: function() {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+} );
+
+$.ui.plugin.add( "draggable", "connectToSortable", {
+ start: function( event, ui, draggable ) {
+ var uiSortable = $.extend( {}, ui, {
+ item: draggable.element
+ } );
+
+ draggable.sortables = [];
+ $( draggable.options.connectToSortable ).each( function() {
+ var sortable = $( this ).sortable( "instance" );
+
+ if ( sortable && !sortable.options.disabled ) {
+ draggable.sortables.push( sortable );
+
+ // RefreshPositions is called at drag start to refresh the containerCache
+ // which is used in drag. This ensures it's initialized and synchronized
+ // with any changes that might have happened on the page since initialization.
+ sortable.refreshPositions();
+ sortable._trigger( "activate", event, uiSortable );
+ }
+ } );
+ },
+ stop: function( event, ui, draggable ) {
+ var uiSortable = $.extend( {}, ui, {
+ item: draggable.element
+ } );
+
+ draggable.cancelHelperRemoval = false;
+
+ $.each( draggable.sortables, function() {
+ var sortable = this;
+
+ if ( sortable.isOver ) {
+ sortable.isOver = 0;
+
+ // Allow this sortable to handle removing the helper
+ draggable.cancelHelperRemoval = true;
+ sortable.cancelHelperRemoval = false;
+
+ // Use _storedCSS To restore properties in the sortable,
+ // as this also handles revert (#9675) since the draggable
+ // may have modified them in unexpected ways (#8809)
+ sortable._storedCSS = {
+ position: sortable.placeholder.css( "position" ),
+ top: sortable.placeholder.css( "top" ),
+ left: sortable.placeholder.css( "left" )
+ };
+
+ sortable._mouseStop( event );
+
+ // Once drag has ended, the sortable should return to using
+ // its original helper, not the shared helper from draggable
+ sortable.options.helper = sortable.options._helper;
+ } else {
+
+ // Prevent this Sortable from removing the helper.
+ // However, don't set the draggable to remove the helper
+ // either as another connected Sortable may yet handle the removal.
+ sortable.cancelHelperRemoval = true;
+
+ sortable._trigger( "deactivate", event, uiSortable );
+ }
+ } );
+ },
+ drag: function( event, ui, draggable ) {
+ $.each( draggable.sortables, function() {
+ var innermostIntersecting = false,
+ sortable = this;
+
+ // Copy over variables that sortable's _intersectsWith uses
+ sortable.positionAbs = draggable.positionAbs;
+ sortable.helperProportions = draggable.helperProportions;
+ sortable.offset.click = draggable.offset.click;
+
+ if ( sortable._intersectsWith( sortable.containerCache ) ) {
+ innermostIntersecting = true;
+
+ $.each( draggable.sortables, function() {
+
+ // Copy over variables that sortable's _intersectsWith uses
+ this.positionAbs = draggable.positionAbs;
+ this.helperProportions = draggable.helperProportions;
+ this.offset.click = draggable.offset.click;
+
+ if ( this !== sortable &&
+ this._intersectsWith( this.containerCache ) &&
+ $.contains( sortable.element[ 0 ], this.element[ 0 ] ) ) {
+ innermostIntersecting = false;
+ }
+
+ return innermostIntersecting;
+ } );
+ }
+
+ if ( innermostIntersecting ) {
+
+ // If it intersects, we use a little isOver variable and set it once,
+ // so that the move-in stuff gets fired only once.
+ if ( !sortable.isOver ) {
+ sortable.isOver = 1;
+
+ // Store draggable's parent in case we need to reappend to it later.
+ draggable._parent = ui.helper.parent();
+
+ sortable.currentItem = ui.helper
+ .appendTo( sortable.element )
+ .data( "ui-sortable-item", true );
+
+ // Store helper option to later restore it
+ sortable.options._helper = sortable.options.helper;
+
+ sortable.options.helper = function() {
+ return ui.helper[ 0 ];
+ };
+
+ // Fire the start events of the sortable with our passed browser event,
+ // and our own helper (so it doesn't create a new one)
+ event.target = sortable.currentItem[ 0 ];
+ sortable._mouseCapture( event, true );
+ sortable._mouseStart( event, true, true );
+
+ // Because the browser event is way off the new appended portlet,
+ // modify necessary variables to reflect the changes
+ sortable.offset.click.top = draggable.offset.click.top;
+ sortable.offset.click.left = draggable.offset.click.left;
+ sortable.offset.parent.left -= draggable.offset.parent.left -
+ sortable.offset.parent.left;
+ sortable.offset.parent.top -= draggable.offset.parent.top -
+ sortable.offset.parent.top;
+
+ draggable._trigger( "toSortable", event );
+
+ // Inform draggable that the helper is in a valid drop zone,
+ // used solely in the revert option to handle "valid/invalid".
+ draggable.dropped = sortable.element;
+
+ // Need to refreshPositions of all sortables in the case that
+ // adding to one sortable changes the location of the other sortables (#9675)
+ $.each( draggable.sortables, function() {
+ this.refreshPositions();
+ } );
+
+ // Hack so receive/update callbacks work (mostly)
+ draggable.currentItem = draggable.element;
+ sortable.fromOutside = draggable;
+ }
+
+ if ( sortable.currentItem ) {
+ sortable._mouseDrag( event );
+
+ // Copy the sortable's position because the draggable's can potentially reflect
+ // a relative position, while sortable is always absolute, which the dragged
+ // element has now become. (#8809)
+ ui.position = sortable.position;
+ }
+ } else {
+
+ // If it doesn't intersect with the sortable, and it intersected before,
+ // we fake the drag stop of the sortable, but make sure it doesn't remove
+ // the helper by using cancelHelperRemoval.
+ if ( sortable.isOver ) {
+
+ sortable.isOver = 0;
+ sortable.cancelHelperRemoval = true;
+
+ // Calling sortable's mouseStop would trigger a revert,
+ // so revert must be temporarily false until after mouseStop is called.
+ sortable.options._revert = sortable.options.revert;
+ sortable.options.revert = false;
+
+ sortable._trigger( "out", event, sortable._uiHash( sortable ) );
+ sortable._mouseStop( event, true );
+
+ // Restore sortable behaviors that were modfied
+ // when the draggable entered the sortable area (#9481)
+ sortable.options.revert = sortable.options._revert;
+ sortable.options.helper = sortable.options._helper;
+
+ if ( sortable.placeholder ) {
+ sortable.placeholder.remove();
+ }
+
+ // Restore and recalculate the draggable's offset considering the sortable
+ // may have modified them in unexpected ways. (#8809, #10669)
+ ui.helper.appendTo( draggable._parent );
+ draggable._refreshOffsets( event );
+ ui.position = draggable._generatePosition( event, true );
+
+ draggable._trigger( "fromSortable", event );
+
+ // Inform draggable that the helper is no longer in a valid drop zone
+ draggable.dropped = false;
+
+ // Need to refreshPositions of all sortables just in case removing
+ // from one sortable changes the location of other sortables (#9675)
+ $.each( draggable.sortables, function() {
+ this.refreshPositions();
+ } );
+ }
+ }
+ } );
+ }
+} );
+
+$.ui.plugin.add( "draggable", "cursor", {
+ start: function( event, ui, instance ) {
+ var t = $( "body" ),
+ o = instance.options;
+
+ if ( t.css( "cursor" ) ) {
+ o._cursor = t.css( "cursor" );
+ }
+ t.css( "cursor", o.cursor );
+ },
+ stop: function( event, ui, instance ) {
+ var o = instance.options;
+ if ( o._cursor ) {
+ $( "body" ).css( "cursor", o._cursor );
+ }
+ }
+} );
+
+$.ui.plugin.add( "draggable", "opacity", {
+ start: function( event, ui, instance ) {
+ var t = $( ui.helper ),
+ o = instance.options;
+ if ( t.css( "opacity" ) ) {
+ o._opacity = t.css( "opacity" );
+ }
+ t.css( "opacity", o.opacity );
+ },
+ stop: function( event, ui, instance ) {
+ var o = instance.options;
+ if ( o._opacity ) {
+ $( ui.helper ).css( "opacity", o._opacity );
+ }
+ }
+} );
+
+$.ui.plugin.add( "draggable", "scroll", {
+ start: function( event, ui, i ) {
+ if ( !i.scrollParentNotHidden ) {
+ i.scrollParentNotHidden = i.helper.scrollParent( false );
+ }
+
+ if ( i.scrollParentNotHidden[ 0 ] !== i.document[ 0 ] &&
+ i.scrollParentNotHidden[ 0 ].tagName !== "HTML" ) {
+ i.overflowOffset = i.scrollParentNotHidden.offset();
+ }
+ },
+ drag: function( event, ui, i ) {
+
+ var o = i.options,
+ scrolled = false,
+ scrollParent = i.scrollParentNotHidden[ 0 ],
+ document = i.document[ 0 ];
+
+ if ( scrollParent !== document && scrollParent.tagName !== "HTML" ) {
+ if ( !o.axis || o.axis !== "x" ) {
+ if ( ( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY <
+ o.scrollSensitivity ) {
+ scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed;
+ } else if ( event.pageY - i.overflowOffset.top < o.scrollSensitivity ) {
+ scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed;
+ }
+ }
+
+ if ( !o.axis || o.axis !== "y" ) {
+ if ( ( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX <
+ o.scrollSensitivity ) {
+ scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed;
+ } else if ( event.pageX - i.overflowOffset.left < o.scrollSensitivity ) {
+ scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed;
+ }
+ }
+
+ } else {
+
+ if ( !o.axis || o.axis !== "x" ) {
+ if ( event.pageY - $( document ).scrollTop() < o.scrollSensitivity ) {
+ scrolled = $( document ).scrollTop( $( document ).scrollTop() - o.scrollSpeed );
+ } else if ( $( window ).height() - ( event.pageY - $( document ).scrollTop() ) <
+ o.scrollSensitivity ) {
+ scrolled = $( document ).scrollTop( $( document ).scrollTop() + o.scrollSpeed );
+ }
+ }
+
+ if ( !o.axis || o.axis !== "y" ) {
+ if ( event.pageX - $( document ).scrollLeft() < o.scrollSensitivity ) {
+ scrolled = $( document ).scrollLeft(
+ $( document ).scrollLeft() - o.scrollSpeed
+ );
+ } else if ( $( window ).width() - ( event.pageX - $( document ).scrollLeft() ) <
+ o.scrollSensitivity ) {
+ scrolled = $( document ).scrollLeft(
+ $( document ).scrollLeft() + o.scrollSpeed
+ );
+ }
+ }
+
+ }
+
+ if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+ $.ui.ddmanager.prepareOffsets( i, event );
+ }
+
+ }
+} );
+
+$.ui.plugin.add( "draggable", "snap", {
+ start: function( event, ui, i ) {
+
+ var o = i.options;
+
+ i.snapElements = [];
+
+ $( o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap )
+ .each( function() {
+ var $t = $( this ),
+ $o = $t.offset();
+ if ( this !== i.element[ 0 ] ) {
+ i.snapElements.push( {
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ } );
+ }
+ } );
+
+ },
+ drag: function( event, ui, inst ) {
+
+ var ts, bs, ls, rs, l, r, t, b, i, first,
+ o = inst.options,
+ d = o.snapTolerance,
+ x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for ( i = inst.snapElements.length - 1; i >= 0; i-- ) {
+
+ l = inst.snapElements[ i ].left - inst.margins.left;
+ r = l + inst.snapElements[ i ].width;
+ t = inst.snapElements[ i ].top - inst.margins.top;
+ b = t + inst.snapElements[ i ].height;
+
+ if ( x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d ||
+ !$.contains( inst.snapElements[ i ].item.ownerDocument,
+ inst.snapElements[ i ].item ) ) {
+ if ( inst.snapElements[ i ].snapping ) {
+ ( inst.options.snap.release &&
+ inst.options.snap.release.call(
+ inst.element,
+ event,
+ $.extend( inst._uiHash(), { snapItem: inst.snapElements[ i ].item } )
+ ) );
+ }
+ inst.snapElements[ i ].snapping = false;
+ continue;
+ }
+
+ if ( o.snapMode !== "inner" ) {
+ ts = Math.abs( t - y2 ) <= d;
+ bs = Math.abs( b - y1 ) <= d;
+ ls = Math.abs( l - x2 ) <= d;
+ rs = Math.abs( r - x1 ) <= d;
+ if ( ts ) {
+ ui.position.top = inst._convertPositionTo( "relative", {
+ top: t - inst.helperProportions.height,
+ left: 0
+ } ).top;
+ }
+ if ( bs ) {
+ ui.position.top = inst._convertPositionTo( "relative", {
+ top: b,
+ left: 0
+ } ).top;
+ }
+ if ( ls ) {
+ ui.position.left = inst._convertPositionTo( "relative", {
+ top: 0,
+ left: l - inst.helperProportions.width
+ } ).left;
+ }
+ if ( rs ) {
+ ui.position.left = inst._convertPositionTo( "relative", {
+ top: 0,
+ left: r
+ } ).left;
+ }
+ }
+
+ first = ( ts || bs || ls || rs );
+
+ if ( o.snapMode !== "outer" ) {
+ ts = Math.abs( t - y1 ) <= d;
+ bs = Math.abs( b - y2 ) <= d;
+ ls = Math.abs( l - x1 ) <= d;
+ rs = Math.abs( r - x2 ) <= d;
+ if ( ts ) {
+ ui.position.top = inst._convertPositionTo( "relative", {
+ top: t,
+ left: 0
+ } ).top;
+ }
+ if ( bs ) {
+ ui.position.top = inst._convertPositionTo( "relative", {
+ top: b - inst.helperProportions.height,
+ left: 0
+ } ).top;
+ }
+ if ( ls ) {
+ ui.position.left = inst._convertPositionTo( "relative", {
+ top: 0,
+ left: l
+ } ).left;
+ }
+ if ( rs ) {
+ ui.position.left = inst._convertPositionTo( "relative", {
+ top: 0,
+ left: r - inst.helperProportions.width
+ } ).left;
+ }
+ }
+
+ if ( !inst.snapElements[ i ].snapping && ( ts || bs || ls || rs || first ) ) {
+ ( inst.options.snap.snap &&
+ inst.options.snap.snap.call(
+ inst.element,
+ event,
+ $.extend( inst._uiHash(), {
+ snapItem: inst.snapElements[ i ].item
+ } ) ) );
+ }
+ inst.snapElements[ i ].snapping = ( ts || bs || ls || rs || first );
+
+ }
+
+ }
+} );
+
+$.ui.plugin.add( "draggable", "stack", {
+ start: function( event, ui, instance ) {
+ var min,
+ o = instance.options,
+ group = $.makeArray( $( o.stack ) ).sort( function( a, b ) {
+ return ( parseInt( $( a ).css( "zIndex" ), 10 ) || 0 ) -
+ ( parseInt( $( b ).css( "zIndex" ), 10 ) || 0 );
+ } );
+
+ if ( !group.length ) { return; }
+
+ min = parseInt( $( group[ 0 ] ).css( "zIndex" ), 10 ) || 0;
+ $( group ).each( function( i ) {
+ $( this ).css( "zIndex", min + i );
+ } );
+ this.css( "zIndex", ( min + group.length ) );
+ }
+} );
+
+$.ui.plugin.add( "draggable", "zIndex", {
+ start: function( event, ui, instance ) {
+ var t = $( ui.helper ),
+ o = instance.options;
+
+ if ( t.css( "zIndex" ) ) {
+ o._zIndex = t.css( "zIndex" );
+ }
+ t.css( "zIndex", o.zIndex );
+ },
+ stop: function( event, ui, instance ) {
+ var o = instance.options;
+
+ if ( o._zIndex ) {
+ $( ui.helper ).css( "zIndex", o._zIndex );
+ }
+ }
+} );
+
+var widgetsDraggable = $.ui.draggable;
+
+
+/*!
+ * jQuery UI Resizable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Resizable
+//>>group: Interactions
+//>>description: Enables resize functionality for any element.
+//>>docs: http://api.jqueryui.com/resizable/
+//>>demos: http://jqueryui.com/resizable/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/resizable.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.resizable", $.ui.mouse, {
+ version: "1.12.1",
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ classes: {
+ "ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se"
+ },
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+
+ // See #7960
+ zIndex: 90,
+
+ // Callbacks
+ resize: null,
+ start: null,
+ stop: null
+ },
+
+ _num: function( value ) {
+ return parseFloat( value ) || 0;
+ },
+
+ _isNumber: function( value ) {
+ return !isNaN( parseFloat( value ) );
+ },
+
+ _hasScroll: function( el, a ) {
+
+ if ( $( el ).css( "overflow" ) === "hidden" ) {
+ return false;
+ }
+
+ var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+ has = false;
+
+ if ( el[ scroll ] > 0 ) {
+ return true;
+ }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[ scroll ] = 1;
+ has = ( el[ scroll ] > 0 );
+ el[ scroll ] = 0;
+ return has;
+ },
+
+ _create: function() {
+
+ var margins,
+ o = this.options,
+ that = this;
+ this._addClass( "ui-resizable" );
+
+ $.extend( this, {
+ _aspectRatio: !!( o.aspectRatio ),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
+ } );
+
+ // Wrap the element if it cannot hold child nodes
+ if ( this.element[ 0 ].nodeName.match( /^(canvas|textarea|input|select|button|img)$/i ) ) {
+
+ this.element.wrap(
+ $( "<div class='ui-wrapper' style='overflow: hidden;'></div>" ).css( {
+ position: this.element.css( "position" ),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css( "top" ),
+ left: this.element.css( "left" )
+ } )
+ );
+
+ this.element = this.element.parent().data(
+ "ui-resizable", this.element.resizable( "instance" )
+ );
+
+ this.elementIsWrapper = true;
+
+ margins = {
+ marginTop: this.originalElement.css( "marginTop" ),
+ marginRight: this.originalElement.css( "marginRight" ),
+ marginBottom: this.originalElement.css( "marginBottom" ),
+ marginLeft: this.originalElement.css( "marginLeft" )
+ };
+
+ this.element.css( margins );
+ this.originalElement.css( "margin", 0 );
+
+ // support: Safari
+ // Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css( "resize" );
+ this.originalElement.css( "resize", "none" );
+
+ this._proportionallyResizeElements.push( this.originalElement.css( {
+ position: "static",
+ zoom: 1,
+ display: "block"
+ } ) );
+
+ // Support: IE9
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css( margins );
+
+ this._proportionallyResize();
+ }
+
+ this._setupHandles();
+
+ if ( o.autoHide ) {
+ $( this.element )
+ .on( "mouseenter", function() {
+ if ( o.disabled ) {
+ return;
+ }
+ that._removeClass( "ui-resizable-autohide" );
+ that._handles.show();
+ } )
+ .on( "mouseleave", function() {
+ if ( o.disabled ) {
+ return;
+ }
+ if ( !that.resizing ) {
+ that._addClass( "ui-resizable-autohide" );
+ that._handles.hide();
+ }
+ } );
+ }
+
+ this._mouseInit();
+ },
+
+ _destroy: function() {
+
+ this._mouseDestroy();
+
+ var wrapper,
+ _destroy = function( exp ) {
+ $( exp )
+ .removeData( "resizable" )
+ .removeData( "ui-resizable" )
+ .off( ".resizable" )
+ .find( ".ui-resizable-handle" )
+ .remove();
+ };
+
+ // TODO: Unwrap at same DOM position
+ if ( this.elementIsWrapper ) {
+ _destroy( this.element );
+ wrapper = this.element;
+ this.originalElement.css( {
+ position: wrapper.css( "position" ),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css( "top" ),
+ left: wrapper.css( "left" )
+ } ).insertAfter( wrapper );
+ wrapper.remove();
+ }
+
+ this.originalElement.css( "resize", this.originalResizeStyle );
+ _destroy( this.originalElement );
+
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ this._super( key, value );
+
+ switch ( key ) {
+ case "handles":
+ this._removeHandles();
+ this._setupHandles();
+ break;
+ default:
+ break;
+ }
+ },
+
+ _setupHandles: function() {
+ var o = this.options, handle, i, n, hname, axis, that = this;
+ this.handles = o.handles ||
+ ( !$( ".ui-resizable-handle", this.element ).length ?
+ "e,s,se" : {
+ n: ".ui-resizable-n",
+ e: ".ui-resizable-e",
+ s: ".ui-resizable-s",
+ w: ".ui-resizable-w",
+ se: ".ui-resizable-se",
+ sw: ".ui-resizable-sw",
+ ne: ".ui-resizable-ne",
+ nw: ".ui-resizable-nw"
+ } );
+
+ this._handles = $();
+ if ( this.handles.constructor === String ) {
+
+ if ( this.handles === "all" ) {
+ this.handles = "n,e,s,w,se,sw,ne,nw";
+ }
+
+ n = this.handles.split( "," );
+ this.handles = {};
+
+ for ( i = 0; i < n.length; i++ ) {
+
+ handle = $.trim( n[ i ] );
+ hname = "ui-resizable-" + handle;
+ axis = $( "<div>" );
+ this._addClass( axis, "ui-resizable-handle " + hname );
+
+ axis.css( { zIndex: o.zIndex } );
+
+ this.handles[ handle ] = ".ui-resizable-" + handle;
+ this.element.append( axis );
+ }
+
+ }
+
+ this._renderAxis = function( target ) {
+
+ var i, axis, padPos, padWrapper;
+
+ target = target || this.element;
+
+ for ( i in this.handles ) {
+
+ if ( this.handles[ i ].constructor === String ) {
+ this.handles[ i ] = this.element.children( this.handles[ i ] ).first().show();
+ } else if ( this.handles[ i ].jquery || this.handles[ i ].nodeType ) {
+ this.handles[ i ] = $( this.handles[ i ] );
+ this._on( this.handles[ i ], { "mousedown": that._mouseDown } );
+ }
+
+ if ( this.elementIsWrapper &&
+ this.originalElement[ 0 ]
+ .nodeName
+ .match( /^(textarea|input|select|button)$/i ) ) {
+ axis = $( this.handles[ i ], this.element );
+
+ padWrapper = /sw|ne|nw|se|n|s/.test( i ) ?
+ axis.outerHeight() :
+ axis.outerWidth();
+
+ padPos = [ "padding",
+ /ne|nw|n/.test( i ) ? "Top" :
+ /se|sw|s/.test( i ) ? "Bottom" :
+ /^e$/.test( i ) ? "Right" : "Left" ].join( "" );
+
+ target.css( padPos, padWrapper );
+
+ this._proportionallyResize();
+ }
+
+ this._handles = this._handles.add( this.handles[ i ] );
+ }
+ };
+
+ // TODO: make renderAxis a prototype function
+ this._renderAxis( this.element );
+
+ this._handles = this._handles.add( this.element.find( ".ui-resizable-handle" ) );
+ this._handles.disableSelection();
+
+ this._handles.on( "mouseover", function() {
+ if ( !that.resizing ) {
+ if ( this.className ) {
+ axis = this.className.match( /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i );
+ }
+ that.axis = axis && axis[ 1 ] ? axis[ 1 ] : "se";
+ }
+ } );
+
+ if ( o.autoHide ) {
+ this._handles.hide();
+ this._addClass( "ui-resizable-autohide" );
+ }
+ },
+
+ _removeHandles: function() {
+ this._handles.remove();
+ },
+
+ _mouseCapture: function( event ) {
+ var i, handle,
+ capture = false;
+
+ for ( i in this.handles ) {
+ handle = $( this.handles[ i ] )[ 0 ];
+ if ( handle === event.target || $.contains( handle, event.target ) ) {
+ capture = true;
+ }
+ }
+
+ return !this.options.disabled && capture;
+ },
+
+ _mouseStart: function( event ) {
+
+ var curleft, curtop, cursor,
+ o = this.options,
+ el = this.element;
+
+ this.resizing = true;
+
+ this._renderProxy();
+
+ curleft = this._num( this.helper.css( "left" ) );
+ curtop = this._num( this.helper.css( "top" ) );
+
+ if ( o.containment ) {
+ curleft += $( o.containment ).scrollLeft() || 0;
+ curtop += $( o.containment ).scrollTop() || 0;
+ }
+
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+
+ this.size = this._helper ? {
+ width: this.helper.width(),
+ height: this.helper.height()
+ } : {
+ width: el.width(),
+ height: el.height()
+ };
+
+ this.originalSize = this._helper ? {
+ width: el.outerWidth(),
+ height: el.outerHeight()
+ } : {
+ width: el.width(),
+ height: el.height()
+ };
+
+ this.sizeDiff = {
+ width: el.outerWidth() - el.width(),
+ height: el.outerHeight() - el.height()
+ };
+
+ this.originalPosition = { left: curleft, top: curtop };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ this.aspectRatio = ( typeof o.aspectRatio === "number" ) ?
+ o.aspectRatio :
+ ( ( this.originalSize.width / this.originalSize.height ) || 1 );
+
+ cursor = $( ".ui-resizable-" + this.axis ).css( "cursor" );
+ $( "body" ).css( "cursor", cursor === "auto" ? this.axis + "-resize" : cursor );
+
+ this._addClass( "ui-resizable-resizing" );
+ this._propagate( "start", event );
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+
+ var data, props,
+ smp = this.originalMousePosition,
+ a = this.axis,
+ dx = ( event.pageX - smp.left ) || 0,
+ dy = ( event.pageY - smp.top ) || 0,
+ trigger = this._change[ a ];
+
+ this._updatePrevProperties();
+
+ if ( !trigger ) {
+ return false;
+ }
+
+ data = trigger.apply( this, [ event, dx, dy ] );
+
+ this._updateVirtualBoundaries( event.shiftKey );
+ if ( this._aspectRatio || event.shiftKey ) {
+ data = this._updateRatio( data, event );
+ }
+
+ data = this._respectSize( data, event );
+
+ this._updateCache( data );
+
+ this._propagate( "resize", event );
+
+ props = this._applyChanges();
+
+ if ( !this._helper && this._proportionallyResizeElements.length ) {
+ this._proportionallyResize();
+ }
+
+ if ( !$.isEmptyObject( props ) ) {
+ this._updatePrevProperties();
+ this._trigger( "resize", event, this.ui() );
+ this._applyChanges();
+ }
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+
+ this.resizing = false;
+ var pr, ista, soffseth, soffsetw, s, left, top,
+ o = this.options, that = this;
+
+ if ( this._helper ) {
+
+ pr = this._proportionallyResizeElements;
+ ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName );
+ soffseth = ista && this._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height;
+ soffsetw = ista ? 0 : that.sizeDiff.width;
+
+ s = {
+ width: ( that.helper.width() - soffsetw ),
+ height: ( that.helper.height() - soffseth )
+ };
+ left = ( parseFloat( that.element.css( "left" ) ) +
+ ( that.position.left - that.originalPosition.left ) ) || null;
+ top = ( parseFloat( that.element.css( "top" ) ) +
+ ( that.position.top - that.originalPosition.top ) ) || null;
+
+ if ( !o.animate ) {
+ this.element.css( $.extend( s, { top: top, left: left } ) );
+ }
+
+ that.helper.height( that.size.height );
+ that.helper.width( that.size.width );
+
+ if ( this._helper && !o.animate ) {
+ this._proportionallyResize();
+ }
+ }
+
+ $( "body" ).css( "cursor", "auto" );
+
+ this._removeClass( "ui-resizable-resizing" );
+
+ this._propagate( "stop", event );
+
+ if ( this._helper ) {
+ this.helper.remove();
+ }
+
+ return false;
+
+ },
+
+ _updatePrevProperties: function() {
+ this.prevPosition = {
+ top: this.position.top,
+ left: this.position.left
+ };
+ this.prevSize = {
+ width: this.size.width,
+ height: this.size.height
+ };
+ },
+
+ _applyChanges: function() {
+ var props = {};
+
+ if ( this.position.top !== this.prevPosition.top ) {
+ props.top = this.position.top + "px";
+ }
+ if ( this.position.left !== this.prevPosition.left ) {
+ props.left = this.position.left + "px";
+ }
+ if ( this.size.width !== this.prevSize.width ) {
+ props.width = this.size.width + "px";
+ }
+ if ( this.size.height !== this.prevSize.height ) {
+ props.height = this.size.height + "px";
+ }
+
+ this.helper.css( props );
+
+ return props;
+ },
+
+ _updateVirtualBoundaries: function( forceAspectRatio ) {
+ var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
+ o = this.options;
+
+ b = {
+ minWidth: this._isNumber( o.minWidth ) ? o.minWidth : 0,
+ maxWidth: this._isNumber( o.maxWidth ) ? o.maxWidth : Infinity,
+ minHeight: this._isNumber( o.minHeight ) ? o.minHeight : 0,
+ maxHeight: this._isNumber( o.maxHeight ) ? o.maxHeight : Infinity
+ };
+
+ if ( this._aspectRatio || forceAspectRatio ) {
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
+
+ if ( pMinWidth > b.minWidth ) {
+ b.minWidth = pMinWidth;
+ }
+ if ( pMinHeight > b.minHeight ) {
+ b.minHeight = pMinHeight;
+ }
+ if ( pMaxWidth < b.maxWidth ) {
+ b.maxWidth = pMaxWidth;
+ }
+ if ( pMaxHeight < b.maxHeight ) {
+ b.maxHeight = pMaxHeight;
+ }
+ }
+ this._vBoundaries = b;
+ },
+
+ _updateCache: function( data ) {
+ this.offset = this.helper.offset();
+ if ( this._isNumber( data.left ) ) {
+ this.position.left = data.left;
+ }
+ if ( this._isNumber( data.top ) ) {
+ this.position.top = data.top;
+ }
+ if ( this._isNumber( data.height ) ) {
+ this.size.height = data.height;
+ }
+ if ( this._isNumber( data.width ) ) {
+ this.size.width = data.width;
+ }
+ },
+
+ _updateRatio: function( data ) {
+
+ var cpos = this.position,
+ csize = this.size,
+ a = this.axis;
+
+ if ( this._isNumber( data.height ) ) {
+ data.width = ( data.height * this.aspectRatio );
+ } else if ( this._isNumber( data.width ) ) {
+ data.height = ( data.width / this.aspectRatio );
+ }
+
+ if ( a === "sw" ) {
+ data.left = cpos.left + ( csize.width - data.width );
+ data.top = null;
+ }
+ if ( a === "nw" ) {
+ data.top = cpos.top + ( csize.height - data.height );
+ data.left = cpos.left + ( csize.width - data.width );
+ }
+
+ return data;
+ },
+
+ _respectSize: function( data ) {
+
+ var o = this._vBoundaries,
+ a = this.axis,
+ ismaxw = this._isNumber( data.width ) && o.maxWidth && ( o.maxWidth < data.width ),
+ ismaxh = this._isNumber( data.height ) && o.maxHeight && ( o.maxHeight < data.height ),
+ isminw = this._isNumber( data.width ) && o.minWidth && ( o.minWidth > data.width ),
+ isminh = this._isNumber( data.height ) && o.minHeight && ( o.minHeight > data.height ),
+ dw = this.originalPosition.left + this.originalSize.width,
+ dh = this.originalPosition.top + this.originalSize.height,
+ cw = /sw|nw|w/.test( a ), ch = /nw|ne|n/.test( a );
+ if ( isminw ) {
+ data.width = o.minWidth;
+ }
+ if ( isminh ) {
+ data.height = o.minHeight;
+ }
+ if ( ismaxw ) {
+ data.width = o.maxWidth;
+ }
+ if ( ismaxh ) {
+ data.height = o.maxHeight;
+ }
+
+ if ( isminw && cw ) {
+ data.left = dw - o.minWidth;
+ }
+ if ( ismaxw && cw ) {
+ data.left = dw - o.maxWidth;
+ }
+ if ( isminh && ch ) {
+ data.top = dh - o.minHeight;
+ }
+ if ( ismaxh && ch ) {
+ data.top = dh - o.maxHeight;
+ }
+
+ // Fixing jump error on top/left - bug #2330
+ if ( !data.width && !data.height && !data.left && data.top ) {
+ data.top = null;
+ } else if ( !data.width && !data.height && !data.top && data.left ) {
+ data.left = null;
+ }
+
+ return data;
+ },
+
+ _getPaddingPlusBorderDimensions: function( element ) {
+ var i = 0,
+ widths = [],
+ borders = [
+ element.css( "borderTopWidth" ),
+ element.css( "borderRightWidth" ),
+ element.css( "borderBottomWidth" ),
+ element.css( "borderLeftWidth" )
+ ],
+ paddings = [
+ element.css( "paddingTop" ),
+ element.css( "paddingRight" ),
+ element.css( "paddingBottom" ),
+ element.css( "paddingLeft" )
+ ];
+
+ for ( ; i < 4; i++ ) {
+ widths[ i ] = ( parseFloat( borders[ i ] ) || 0 );
+ widths[ i ] += ( parseFloat( paddings[ i ] ) || 0 );
+ }
+
+ return {
+ height: widths[ 0 ] + widths[ 2 ],
+ width: widths[ 1 ] + widths[ 3 ]
+ };
+ },
+
+ _proportionallyResize: function() {
+
+ if ( !this._proportionallyResizeElements.length ) {
+ return;
+ }
+
+ var prel,
+ i = 0,
+ element = this.helper || this.element;
+
+ for ( ; i < this._proportionallyResizeElements.length; i++ ) {
+
+ prel = this._proportionallyResizeElements[ i ];
+
+ // TODO: Seems like a bug to cache this.outerDimensions
+ // considering that we are in a loop.
+ if ( !this.outerDimensions ) {
+ this.outerDimensions = this._getPaddingPlusBorderDimensions( prel );
+ }
+
+ prel.css( {
+ height: ( element.height() - this.outerDimensions.height ) || 0,
+ width: ( element.width() - this.outerDimensions.width ) || 0
+ } );
+
+ }
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if ( this._helper ) {
+
+ this.helper = this.helper || $( "<div style='overflow:hidden;'></div>" );
+
+ this._addClass( this.helper, this._helper );
+ this.helper.css( {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ position: "absolute",
+ left: this.elementOffset.left + "px",
+ top: this.elementOffset.top + "px",
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ } );
+
+ this.helper
+ .appendTo( "body" )
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function( event, dx ) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function( event, dx ) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function( event, dx, dy ) {
+ var cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function( event, dx, dy ) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function( event, dx, dy ) {
+ return $.extend( this._change.s.apply( this, arguments ),
+ this._change.e.apply( this, [ event, dx, dy ] ) );
+ },
+ sw: function( event, dx, dy ) {
+ return $.extend( this._change.s.apply( this, arguments ),
+ this._change.w.apply( this, [ event, dx, dy ] ) );
+ },
+ ne: function( event, dx, dy ) {
+ return $.extend( this._change.n.apply( this, arguments ),
+ this._change.e.apply( this, [ event, dx, dy ] ) );
+ },
+ nw: function( event, dx, dy ) {
+ return $.extend( this._change.n.apply( this, arguments ),
+ this._change.w.apply( this, [ event, dx, dy ] ) );
+ }
+ },
+
+ _propagate: function( n, event ) {
+ $.ui.plugin.call( this, n, [ event, this.ui() ] );
+ ( n !== "resize" && this._trigger( n, event, this.ui() ) );
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+} );
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add( "resizable", "animate", {
+
+ stop: function( event ) {
+ var that = $( this ).resizable( "instance" ),
+ o = that.options,
+ pr = that._proportionallyResizeElements,
+ ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ),
+ soffseth = ista && that._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height,
+ soffsetw = ista ? 0 : that.sizeDiff.width,
+ style = {
+ width: ( that.size.width - soffsetw ),
+ height: ( that.size.height - soffseth )
+ },
+ left = ( parseFloat( that.element.css( "left" ) ) +
+ ( that.position.left - that.originalPosition.left ) ) || null,
+ top = ( parseFloat( that.element.css( "top" ) ) +
+ ( that.position.top - that.originalPosition.top ) ) || null;
+
+ that.element.animate(
+ $.extend( style, top && left ? { top: top, left: left } : {} ), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseFloat( that.element.css( "width" ) ),
+ height: parseFloat( that.element.css( "height" ) ),
+ top: parseFloat( that.element.css( "top" ) ),
+ left: parseFloat( that.element.css( "left" ) )
+ };
+
+ if ( pr && pr.length ) {
+ $( pr[ 0 ] ).css( { width: data.width, height: data.height } );
+ }
+
+ // Propagating resize, and updating values for each animation step
+ that._updateCache( data );
+ that._propagate( "resize", event );
+
+ }
+ }
+ );
+ }
+
+} );
+
+$.ui.plugin.add( "resizable", "containment", {
+
+ start: function() {
+ var element, p, co, ch, cw, width, height,
+ that = $( this ).resizable( "instance" ),
+ o = that.options,
+ el = that.element,
+ oc = o.containment,
+ ce = ( oc instanceof $ ) ?
+ oc.get( 0 ) :
+ ( /parent/.test( oc ) ) ? el.parent().get( 0 ) : oc;
+
+ if ( !ce ) {
+ return;
+ }
+
+ that.containerElement = $( ce );
+
+ if ( /document/.test( oc ) || oc === document ) {
+ that.containerOffset = {
+ left: 0,
+ top: 0
+ };
+ that.containerPosition = {
+ left: 0,
+ top: 0
+ };
+
+ that.parentData = {
+ element: $( document ),
+ left: 0,
+ top: 0,
+ width: $( document ).width(),
+ height: $( document ).height() || document.body.parentNode.scrollHeight
+ };
+ } else {
+ element = $( ce );
+ p = [];
+ $( [ "Top", "Right", "Left", "Bottom" ] ).each( function( i, name ) {
+ p[ i ] = that._num( element.css( "padding" + name ) );
+ } );
+
+ that.containerOffset = element.offset();
+ that.containerPosition = element.position();
+ that.containerSize = {
+ height: ( element.innerHeight() - p[ 3 ] ),
+ width: ( element.innerWidth() - p[ 1 ] )
+ };
+
+ co = that.containerOffset;
+ ch = that.containerSize.height;
+ cw = that.containerSize.width;
+ width = ( that._hasScroll ( ce, "left" ) ? ce.scrollWidth : cw );
+ height = ( that._hasScroll ( ce ) ? ce.scrollHeight : ch ) ;
+
+ that.parentData = {
+ element: ce,
+ left: co.left,
+ top: co.top,
+ width: width,
+ height: height
+ };
+ }
+ },
+
+ resize: function( event ) {
+ var woset, hoset, isParent, isOffsetRelative,
+ that = $( this ).resizable( "instance" ),
+ o = that.options,
+ co = that.containerOffset,
+ cp = that.position,
+ pRatio = that._aspectRatio || event.shiftKey,
+ cop = {
+ top: 0,
+ left: 0
+ },
+ ce = that.containerElement,
+ continueResize = true;
+
+ if ( ce[ 0 ] !== document && ( /static/ ).test( ce.css( "position" ) ) ) {
+ cop = co;
+ }
+
+ if ( cp.left < ( that._helper ? co.left : 0 ) ) {
+ that.size.width = that.size.width +
+ ( that._helper ?
+ ( that.position.left - co.left ) :
+ ( that.position.left - cop.left ) );
+
+ if ( pRatio ) {
+ that.size.height = that.size.width / that.aspectRatio;
+ continueResize = false;
+ }
+ that.position.left = o.helper ? co.left : 0;
+ }
+
+ if ( cp.top < ( that._helper ? co.top : 0 ) ) {
+ that.size.height = that.size.height +
+ ( that._helper ?
+ ( that.position.top - co.top ) :
+ that.position.top );
+
+ if ( pRatio ) {
+ that.size.width = that.size.height * that.aspectRatio;
+ continueResize = false;
+ }
+ that.position.top = that._helper ? co.top : 0;
+ }
+
+ isParent = that.containerElement.get( 0 ) === that.element.parent().get( 0 );
+ isOffsetRelative = /relative|absolute/.test( that.containerElement.css( "position" ) );
+
+ if ( isParent && isOffsetRelative ) {
+ that.offset.left = that.parentData.left + that.position.left;
+ that.offset.top = that.parentData.top + that.position.top;
+ } else {
+ that.offset.left = that.element.offset().left;
+ that.offset.top = that.element.offset().top;
+ }
+
+ woset = Math.abs( that.sizeDiff.width +
+ ( that._helper ?
+ that.offset.left - cop.left :
+ ( that.offset.left - co.left ) ) );
+
+ hoset = Math.abs( that.sizeDiff.height +
+ ( that._helper ?
+ that.offset.top - cop.top :
+ ( that.offset.top - co.top ) ) );
+
+ if ( woset + that.size.width >= that.parentData.width ) {
+ that.size.width = that.parentData.width - woset;
+ if ( pRatio ) {
+ that.size.height = that.size.width / that.aspectRatio;
+ continueResize = false;
+ }
+ }
+
+ if ( hoset + that.size.height >= that.parentData.height ) {
+ that.size.height = that.parentData.height - hoset;
+ if ( pRatio ) {
+ that.size.width = that.size.height * that.aspectRatio;
+ continueResize = false;
+ }
+ }
+
+ if ( !continueResize ) {
+ that.position.left = that.prevPosition.left;
+ that.position.top = that.prevPosition.top;
+ that.size.width = that.prevSize.width;
+ that.size.height = that.prevSize.height;
+ }
+ },
+
+ stop: function() {
+ var that = $( this ).resizable( "instance" ),
+ o = that.options,
+ co = that.containerOffset,
+ cop = that.containerPosition,
+ ce = that.containerElement,
+ helper = $( that.helper ),
+ ho = helper.offset(),
+ w = helper.outerWidth() - that.sizeDiff.width,
+ h = helper.outerHeight() - that.sizeDiff.height;
+
+ if ( that._helper && !o.animate && ( /relative/ ).test( ce.css( "position" ) ) ) {
+ $( this ).css( {
+ left: ho.left - cop.left - co.left,
+ width: w,
+ height: h
+ } );
+ }
+
+ if ( that._helper && !o.animate && ( /static/ ).test( ce.css( "position" ) ) ) {
+ $( this ).css( {
+ left: ho.left - cop.left - co.left,
+ width: w,
+ height: h
+ } );
+ }
+ }
+} );
+
+$.ui.plugin.add( "resizable", "alsoResize", {
+
+ start: function() {
+ var that = $( this ).resizable( "instance" ),
+ o = that.options;
+
+ $( o.alsoResize ).each( function() {
+ var el = $( this );
+ el.data( "ui-resizable-alsoresize", {
+ width: parseFloat( el.width() ), height: parseFloat( el.height() ),
+ left: parseFloat( el.css( "left" ) ), top: parseFloat( el.css( "top" ) )
+ } );
+ } );
+ },
+
+ resize: function( event, ui ) {
+ var that = $( this ).resizable( "instance" ),
+ o = that.options,
+ os = that.originalSize,
+ op = that.originalPosition,
+ delta = {
+ height: ( that.size.height - os.height ) || 0,
+ width: ( that.size.width - os.width ) || 0,
+ top: ( that.position.top - op.top ) || 0,
+ left: ( that.position.left - op.left ) || 0
+ };
+
+ $( o.alsoResize ).each( function() {
+ var el = $( this ), start = $( this ).data( "ui-resizable-alsoresize" ), style = {},
+ css = el.parents( ui.originalElement[ 0 ] ).length ?
+ [ "width", "height" ] :
+ [ "width", "height", "top", "left" ];
+
+ $.each( css, function( i, prop ) {
+ var sum = ( start[ prop ] || 0 ) + ( delta[ prop ] || 0 );
+ if ( sum && sum >= 0 ) {
+ style[ prop ] = sum || null;
+ }
+ } );
+
+ el.css( style );
+ } );
+ },
+
+ stop: function() {
+ $( this ).removeData( "ui-resizable-alsoresize" );
+ }
+} );
+
+$.ui.plugin.add( "resizable", "ghost", {
+
+ start: function() {
+
+ var that = $( this ).resizable( "instance" ), cs = that.size;
+
+ that.ghost = that.originalElement.clone();
+ that.ghost.css( {
+ opacity: 0.25,
+ display: "block",
+ position: "relative",
+ height: cs.height,
+ width: cs.width,
+ margin: 0,
+ left: 0,
+ top: 0
+ } );
+
+ that._addClass( that.ghost, "ui-resizable-ghost" );
+
+ // DEPRECATED
+ // TODO: remove after 1.12
+ if ( $.uiBackCompat !== false && typeof that.options.ghost === "string" ) {
+
+ // Ghost option
+ that.ghost.addClass( this.options.ghost );
+ }
+
+ that.ghost.appendTo( that.helper );
+
+ },
+
+ resize: function() {
+ var that = $( this ).resizable( "instance" );
+ if ( that.ghost ) {
+ that.ghost.css( {
+ position: "relative",
+ height: that.size.height,
+ width: that.size.width
+ } );
+ }
+ },
+
+ stop: function() {
+ var that = $( this ).resizable( "instance" );
+ if ( that.ghost && that.helper ) {
+ that.helper.get( 0 ).removeChild( that.ghost.get( 0 ) );
+ }
+ }
+
+} );
+
+$.ui.plugin.add( "resizable", "grid", {
+
+ resize: function() {
+ var outerDimensions,
+ that = $( this ).resizable( "instance" ),
+ o = that.options,
+ cs = that.size,
+ os = that.originalSize,
+ op = that.originalPosition,
+ a = that.axis,
+ grid = typeof o.grid === "number" ? [ o.grid, o.grid ] : o.grid,
+ gridX = ( grid[ 0 ] || 1 ),
+ gridY = ( grid[ 1 ] || 1 ),
+ ox = Math.round( ( cs.width - os.width ) / gridX ) * gridX,
+ oy = Math.round( ( cs.height - os.height ) / gridY ) * gridY,
+ newWidth = os.width + ox,
+ newHeight = os.height + oy,
+ isMaxWidth = o.maxWidth && ( o.maxWidth < newWidth ),
+ isMaxHeight = o.maxHeight && ( o.maxHeight < newHeight ),
+ isMinWidth = o.minWidth && ( o.minWidth > newWidth ),
+ isMinHeight = o.minHeight && ( o.minHeight > newHeight );
+
+ o.grid = grid;
+
+ if ( isMinWidth ) {
+ newWidth += gridX;
+ }
+ if ( isMinHeight ) {
+ newHeight += gridY;
+ }
+ if ( isMaxWidth ) {
+ newWidth -= gridX;
+ }
+ if ( isMaxHeight ) {
+ newHeight -= gridY;
+ }
+
+ if ( /^(se|s|e)$/.test( a ) ) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ } else if ( /^(ne)$/.test( a ) ) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ } else if ( /^(sw)$/.test( a ) ) {
+ that.size.width = newWidth;
+ that.size.height = newHeight;
+ that.position.left = op.left - ox;
+ } else {
+ if ( newHeight - gridY <= 0 || newWidth - gridX <= 0 ) {
+ outerDimensions = that._getPaddingPlusBorderDimensions( this );
+ }
+
+ if ( newHeight - gridY > 0 ) {
+ that.size.height = newHeight;
+ that.position.top = op.top - oy;
+ } else {
+ newHeight = gridY - outerDimensions.height;
+ that.size.height = newHeight;
+ that.position.top = op.top + os.height - newHeight;
+ }
+ if ( newWidth - gridX > 0 ) {
+ that.size.width = newWidth;
+ that.position.left = op.left - ox;
+ } else {
+ newWidth = gridX - outerDimensions.width;
+ that.size.width = newWidth;
+ that.position.left = op.left + os.width - newWidth;
+ }
+ }
+ }
+
+} );
+
+var widgetsResizable = $.ui.resizable;
+
+
+/*!
+ * jQuery UI Dialog 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Dialog
+//>>group: Widgets
+//>>description: Displays customizable dialog windows.
+//>>docs: http://api.jqueryui.com/dialog/
+//>>demos: http://jqueryui.com/dialog/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/dialog.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.dialog", {
+ version: "1.12.1",
+ options: {
+ appendTo: "body",
+ autoOpen: true,
+ buttons: [],
+ classes: {
+ "ui-dialog": "ui-corner-all",
+ "ui-dialog-titlebar": "ui-corner-all"
+ },
+ closeOnEscape: true,
+ closeText: "Close",
+ draggable: true,
+ hide: null,
+ height: "auto",
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: {
+ my: "center",
+ at: "center",
+ of: window,
+ collision: "fit",
+
+ // Ensure the titlebar is always visible
+ using: function( pos ) {
+ var topOffset = $( this ).css( pos ).offset().top;
+ if ( topOffset < 0 ) {
+ $( this ).css( "top", pos.top - topOffset );
+ }
+ }
+ },
+ resizable: true,
+ show: null,
+ title: null,
+ width: 300,
+
+ // Callbacks
+ beforeClose: null,
+ close: null,
+ drag: null,
+ dragStart: null,
+ dragStop: null,
+ focus: null,
+ open: null,
+ resize: null,
+ resizeStart: null,
+ resizeStop: null
+ },
+
+ sizeRelatedOptions: {
+ buttons: true,
+ height: true,
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true,
+ width: true
+ },
+
+ resizableRelatedOptions: {
+ maxHeight: true,
+ maxWidth: true,
+ minHeight: true,
+ minWidth: true
+ },
+
+ _create: function() {
+ this.originalCss = {
+ display: this.element[ 0 ].style.display,
+ width: this.element[ 0 ].style.width,
+ minHeight: this.element[ 0 ].style.minHeight,
+ maxHeight: this.element[ 0 ].style.maxHeight,
+ height: this.element[ 0 ].style.height
+ };
+ this.originalPosition = {
+ parent: this.element.parent(),
+ index: this.element.parent().children().index( this.element )
+ };
+ this.originalTitle = this.element.attr( "title" );
+ if ( this.options.title == null && this.originalTitle != null ) {
+ this.options.title = this.originalTitle;
+ }
+
+ // Dialogs can't be disabled
+ if ( this.options.disabled ) {
+ this.options.disabled = false;
+ }
+
+ this._createWrapper();
+
+ this.element
+ .show()
+ .removeAttr( "title" )
+ .appendTo( this.uiDialog );
+
+ this._addClass( "ui-dialog-content", "ui-widget-content" );
+
+ this._createTitlebar();
+ this._createButtonPane();
+
+ if ( this.options.draggable && $.fn.draggable ) {
+ this._makeDraggable();
+ }
+ if ( this.options.resizable && $.fn.resizable ) {
+ this._makeResizable();
+ }
+
+ this._isOpen = false;
+
+ this._trackFocus();
+ },
+
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ _appendTo: function() {
+ var element = this.options.appendTo;
+ if ( element && ( element.jquery || element.nodeType ) ) {
+ return $( element );
+ }
+ return this.document.find( element || "body" ).eq( 0 );
+ },
+
+ _destroy: function() {
+ var next,
+ originalPosition = this.originalPosition;
+
+ this._untrackInstance();
+ this._destroyOverlay();
+
+ this.element
+ .removeUniqueId()
+ .css( this.originalCss )
+
+ // Without detaching first, the following becomes really slow
+ .detach();
+
+ this.uiDialog.remove();
+
+ if ( this.originalTitle ) {
+ this.element.attr( "title", this.originalTitle );
+ }
+
+ next = originalPosition.parent.children().eq( originalPosition.index );
+
+ // Don't try to place the dialog next to itself (#8613)
+ if ( next.length && next[ 0 ] !== this.element[ 0 ] ) {
+ next.before( this.element );
+ } else {
+ originalPosition.parent.append( this.element );
+ }
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ disable: $.noop,
+ enable: $.noop,
+
+ close: function( event ) {
+ var that = this;
+
+ if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) {
+ return;
+ }
+
+ this._isOpen = false;
+ this._focusedElement = null;
+ this._destroyOverlay();
+ this._untrackInstance();
+
+ if ( !this.opener.filter( ":focusable" ).trigger( "focus" ).length ) {
+
+ // Hiding a focused element doesn't trigger blur in WebKit
+ // so in case we have nothing to focus on, explicitly blur the active element
+ // https://bugs.webkit.org/show_bug.cgi?id=47182
+ $.ui.safeBlur( $.ui.safeActiveElement( this.document[ 0 ] ) );
+ }
+
+ this._hide( this.uiDialog, this.options.hide, function() {
+ that._trigger( "close", event );
+ } );
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ moveToTop: function() {
+ this._moveToTop();
+ },
+
+ _moveToTop: function( event, silent ) {
+ var moved = false,
+ zIndices = this.uiDialog.siblings( ".ui-front:visible" ).map( function() {
+ return +$( this ).css( "z-index" );
+ } ).get(),
+ zIndexMax = Math.max.apply( null, zIndices );
+
+ if ( zIndexMax >= +this.uiDialog.css( "z-index" ) ) {
+ this.uiDialog.css( "z-index", zIndexMax + 1 );
+ moved = true;
+ }
+
+ if ( moved && !silent ) {
+ this._trigger( "focus", event );
+ }
+ return moved;
+ },
+
+ open: function() {
+ var that = this;
+ if ( this._isOpen ) {
+ if ( this._moveToTop() ) {
+ this._focusTabbable();
+ }
+ return;
+ }
+
+ this._isOpen = true;
+ this.opener = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+
+ this._size();
+ this._position();
+ this._createOverlay();
+ this._moveToTop( null, true );
+
+ // Ensure the overlay is moved to the top with the dialog, but only when
+ // opening. The overlay shouldn't move after the dialog is open so that
+ // modeless dialogs opened after the modal dialog stack properly.
+ if ( this.overlay ) {
+ this.overlay.css( "z-index", this.uiDialog.css( "z-index" ) - 1 );
+ }
+
+ this._show( this.uiDialog, this.options.show, function() {
+ that._focusTabbable();
+ that._trigger( "focus" );
+ } );
+
+ // Track the dialog immediately upon openening in case a focus event
+ // somehow occurs outside of the dialog before an element inside the
+ // dialog is focused (#10152)
+ this._makeFocusTarget();
+
+ this._trigger( "open" );
+ },
+
+ _focusTabbable: function() {
+
+ // Set focus to the first match:
+ // 1. An element that was focused previously
+ // 2. First element inside the dialog matching [autofocus]
+ // 3. Tabbable element inside the content element
+ // 4. Tabbable element inside the buttonpane
+ // 5. The close button
+ // 6. The dialog itself
+ var hasFocus = this._focusedElement;
+ if ( !hasFocus ) {
+ hasFocus = this.element.find( "[autofocus]" );
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.element.find( ":tabbable" );
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialogButtonPane.find( ":tabbable" );
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialogTitlebarClose.filter( ":tabbable" );
+ }
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialog;
+ }
+ hasFocus.eq( 0 ).trigger( "focus" );
+ },
+
+ _keepFocus: function( event ) {
+ function checkFocus() {
+ var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+ isActive = this.uiDialog[ 0 ] === activeElement ||
+ $.contains( this.uiDialog[ 0 ], activeElement );
+ if ( !isActive ) {
+ this._focusTabbable();
+ }
+ }
+ event.preventDefault();
+ checkFocus.call( this );
+
+ // support: IE
+ // IE <= 8 doesn't prevent moving focus even with event.preventDefault()
+ // so we check again later
+ this._delay( checkFocus );
+ },
+
+ _createWrapper: function() {
+ this.uiDialog = $( "<div>" )
+ .hide()
+ .attr( {
+
+ // Setting tabIndex makes the div focusable
+ tabIndex: -1,
+ role: "dialog"
+ } )
+ .appendTo( this._appendTo() );
+
+ this._addClass( this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front" );
+ this._on( this.uiDialog, {
+ keydown: function( event ) {
+ if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE ) {
+ event.preventDefault();
+ this.close( event );
+ return;
+ }
+
+ // Prevent tabbing out of dialogs
+ if ( event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented() ) {
+ return;
+ }
+ var tabbables = this.uiDialog.find( ":tabbable" ),
+ first = tabbables.filter( ":first" ),
+ last = tabbables.filter( ":last" );
+
+ if ( ( event.target === last[ 0 ] || event.target === this.uiDialog[ 0 ] ) &&
+ !event.shiftKey ) {
+ this._delay( function() {
+ first.trigger( "focus" );
+ } );
+ event.preventDefault();
+ } else if ( ( event.target === first[ 0 ] ||
+ event.target === this.uiDialog[ 0 ] ) && event.shiftKey ) {
+ this._delay( function() {
+ last.trigger( "focus" );
+ } );
+ event.preventDefault();
+ }
+ },
+ mousedown: function( event ) {
+ if ( this._moveToTop( event ) ) {
+ this._focusTabbable();
+ }
+ }
+ } );
+
+ // We assume that any existing aria-describedby attribute means
+ // that the dialog content is marked up properly
+ // otherwise we brute force the content as the description
+ if ( !this.element.find( "[aria-describedby]" ).length ) {
+ this.uiDialog.attr( {
+ "aria-describedby": this.element.uniqueId().attr( "id" )
+ } );
+ }
+ },
+
+ _createTitlebar: function() {
+ var uiDialogTitle;
+
+ this.uiDialogTitlebar = $( "<div>" );
+ this._addClass( this.uiDialogTitlebar,
+ "ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix" );
+ this._on( this.uiDialogTitlebar, {
+ mousedown: function( event ) {
+
+ // Don't prevent click on close button (#8838)
+ // Focusing a dialog that is partially scrolled out of view
+ // causes the browser to scroll it into view, preventing the click event
+ if ( !$( event.target ).closest( ".ui-dialog-titlebar-close" ) ) {
+
+ // Dialog isn't getting focus when dragging (#8063)
+ this.uiDialog.trigger( "focus" );
+ }
+ }
+ } );
+
+ // Support: IE
+ // Use type="button" to prevent enter keypresses in textboxes from closing the
+ // dialog in IE (#9312)
+ this.uiDialogTitlebarClose = $( "<button type='button'></button>" )
+ .button( {
+ label: $( "<a>" ).text( this.options.closeText ).html(),
+ icon: "ui-icon-closethick",
+ showLabel: false
+ } )
+ .appendTo( this.uiDialogTitlebar );
+
+ this._addClass( this.uiDialogTitlebarClose, "ui-dialog-titlebar-close" );
+ this._on( this.uiDialogTitlebarClose, {
+ click: function( event ) {
+ event.preventDefault();
+ this.close( event );
+ }
+ } );
+
+ uiDialogTitle = $( "<span>" ).uniqueId().prependTo( this.uiDialogTitlebar );
+ this._addClass( uiDialogTitle, "ui-dialog-title" );
+ this._title( uiDialogTitle );
+
+ this.uiDialogTitlebar.prependTo( this.uiDialog );
+
+ this.uiDialog.attr( {
+ "aria-labelledby": uiDialogTitle.attr( "id" )
+ } );
+ },
+
+ _title: function( title ) {
+ if ( this.options.title ) {
+ title.text( this.options.title );
+ } else {
+ title.html( " " );
+ }
+ },
+
+ _createButtonPane: function() {
+ this.uiDialogButtonPane = $( "<div>" );
+ this._addClass( this.uiDialogButtonPane, "ui-dialog-buttonpane",
+ "ui-widget-content ui-helper-clearfix" );
+
+ this.uiButtonSet = $( "<div>" )
+ .appendTo( this.uiDialogButtonPane );
+ this._addClass( this.uiButtonSet, "ui-dialog-buttonset" );
+
+ this._createButtons();
+ },
+
+ _createButtons: function() {
+ var that = this,
+ buttons = this.options.buttons;
+
+ // If we already have a button pane, remove it
+ this.uiDialogButtonPane.remove();
+ this.uiButtonSet.empty();
+
+ if ( $.isEmptyObject( buttons ) || ( $.isArray( buttons ) && !buttons.length ) ) {
+ this._removeClass( this.uiDialog, "ui-dialog-buttons" );
+ return;
+ }
+
+ $.each( buttons, function( name, props ) {
+ var click, buttonOptions;
+ props = $.isFunction( props ) ?
+ { click: props, text: name } :
+ props;
+
+ // Default to a non-submitting button
+ props = $.extend( { type: "button" }, props );
+
+ // Change the context for the click callback to be the main element
+ click = props.click;
+ buttonOptions = {
+ icon: props.icon,
+ iconPosition: props.iconPosition,
+ showLabel: props.showLabel,
+
+ // Deprecated options
+ icons: props.icons,
+ text: props.text
+ };
+
+ delete props.click;
+ delete props.icon;
+ delete props.iconPosition;
+ delete props.showLabel;
+
+ // Deprecated options
+ delete props.icons;
+ if ( typeof props.text === "boolean" ) {
+ delete props.text;
+ }
+
+ $( "<button></button>", props )
+ .button( buttonOptions )
+ .appendTo( that.uiButtonSet )
+ .on( "click", function() {
+ click.apply( that.element[ 0 ], arguments );
+ } );
+ } );
+ this._addClass( this.uiDialog, "ui-dialog-buttons" );
+ this.uiDialogButtonPane.appendTo( this.uiDialog );
+ },
+
+ _makeDraggable: function() {
+ var that = this,
+ options = this.options;
+
+ function filteredUi( ui ) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ this.uiDialog.draggable( {
+ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+ handle: ".ui-dialog-titlebar",
+ containment: "document",
+ start: function( event, ui ) {
+ that._addClass( $( this ), "ui-dialog-dragging" );
+ that._blockFrames();
+ that._trigger( "dragStart", event, filteredUi( ui ) );
+ },
+ drag: function( event, ui ) {
+ that._trigger( "drag", event, filteredUi( ui ) );
+ },
+ stop: function( event, ui ) {
+ var left = ui.offset.left - that.document.scrollLeft(),
+ top = ui.offset.top - that.document.scrollTop();
+
+ options.position = {
+ my: "left top",
+ at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+ "top" + ( top >= 0 ? "+" : "" ) + top,
+ of: that.window
+ };
+ that._removeClass( $( this ), "ui-dialog-dragging" );
+ that._unblockFrames();
+ that._trigger( "dragStop", event, filteredUi( ui ) );
+ }
+ } );
+ },
+
+ _makeResizable: function() {
+ var that = this,
+ options = this.options,
+ handles = options.resizable,
+
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = this.uiDialog.css( "position" ),
+ resizeHandles = typeof handles === "string" ?
+ handles :
+ "n,e,s,w,se,sw,ne,nw";
+
+ function filteredUi( ui ) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ this.uiDialog.resizable( {
+ cancel: ".ui-dialog-content",
+ containment: "document",
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: this._minHeight(),
+ handles: resizeHandles,
+ start: function( event, ui ) {
+ that._addClass( $( this ), "ui-dialog-resizing" );
+ that._blockFrames();
+ that._trigger( "resizeStart", event, filteredUi( ui ) );
+ },
+ resize: function( event, ui ) {
+ that._trigger( "resize", event, filteredUi( ui ) );
+ },
+ stop: function( event, ui ) {
+ var offset = that.uiDialog.offset(),
+ left = offset.left - that.document.scrollLeft(),
+ top = offset.top - that.document.scrollTop();
+
+ options.height = that.uiDialog.height();
+ options.width = that.uiDialog.width();
+ options.position = {
+ my: "left top",
+ at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+ "top" + ( top >= 0 ? "+" : "" ) + top,
+ of: that.window
+ };
+ that._removeClass( $( this ), "ui-dialog-resizing" );
+ that._unblockFrames();
+ that._trigger( "resizeStop", event, filteredUi( ui ) );
+ }
+ } )
+ .css( "position", position );
+ },
+
+ _trackFocus: function() {
+ this._on( this.widget(), {
+ focusin: function( event ) {
+ this._makeFocusTarget();
+ this._focusedElement = $( event.target );
+ }
+ } );
+ },
+
+ _makeFocusTarget: function() {
+ this._untrackInstance();
+ this._trackingInstances().unshift( this );
+ },
+
+ _untrackInstance: function() {
+ var instances = this._trackingInstances(),
+ exists = $.inArray( this, instances );
+ if ( exists !== -1 ) {
+ instances.splice( exists, 1 );
+ }
+ },
+
+ _trackingInstances: function() {
+ var instances = this.document.data( "ui-dialog-instances" );
+ if ( !instances ) {
+ instances = [];
+ this.document.data( "ui-dialog-instances", instances );
+ }
+ return instances;
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ return options.height === "auto" ?
+ options.minHeight :
+ Math.min( options.minHeight, options.height );
+ },
+
+ _position: function() {
+
+ // Need to show the dialog to get the actual offset in the position plugin
+ var isVisible = this.uiDialog.is( ":visible" );
+ if ( !isVisible ) {
+ this.uiDialog.show();
+ }
+ this.uiDialog.position( this.options.position );
+ if ( !isVisible ) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOptions: function( options ) {
+ var that = this,
+ resize = false,
+ resizableOptions = {};
+
+ $.each( options, function( key, value ) {
+ that._setOption( key, value );
+
+ if ( key in that.sizeRelatedOptions ) {
+ resize = true;
+ }
+ if ( key in that.resizableRelatedOptions ) {
+ resizableOptions[ key ] = value;
+ }
+ } );
+
+ if ( resize ) {
+ this._size();
+ this._position();
+ }
+ if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+ this.uiDialog.resizable( "option", resizableOptions );
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var isDraggable, isResizable,
+ uiDialog = this.uiDialog;
+
+ if ( key === "disabled" ) {
+ return;
+ }
+
+ this._super( key, value );
+
+ if ( key === "appendTo" ) {
+ this.uiDialog.appendTo( this._appendTo() );
+ }
+
+ if ( key === "buttons" ) {
+ this._createButtons();
+ }
+
+ if ( key === "closeText" ) {
+ this.uiDialogTitlebarClose.button( {
+
+ // Ensure that we always pass a string
+ label: $( "<a>" ).text( "" + this.options.closeText ).html()
+ } );
+ }
+
+ if ( key === "draggable" ) {
+ isDraggable = uiDialog.is( ":data(ui-draggable)" );
+ if ( isDraggable && !value ) {
+ uiDialog.draggable( "destroy" );
+ }
+
+ if ( !isDraggable && value ) {
+ this._makeDraggable();
+ }
+ }
+
+ if ( key === "position" ) {
+ this._position();
+ }
+
+ if ( key === "resizable" ) {
+
+ // currently resizable, becoming non-resizable
+ isResizable = uiDialog.is( ":data(ui-resizable)" );
+ if ( isResizable && !value ) {
+ uiDialog.resizable( "destroy" );
+ }
+
+ // Currently resizable, changing handles
+ if ( isResizable && typeof value === "string" ) {
+ uiDialog.resizable( "option", "handles", value );
+ }
+
+ // Currently non-resizable, becoming resizable
+ if ( !isResizable && value !== false ) {
+ this._makeResizable();
+ }
+ }
+
+ if ( key === "title" ) {
+ this._title( this.uiDialogTitlebar.find( ".ui-dialog-title" ) );
+ }
+ },
+
+ _size: function() {
+
+ // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ // divs will both have width and height set, so we need to reset them
+ var nonContentHeight, minContentHeight, maxContentHeight,
+ options = this.options;
+
+ // Reset content sizing
+ this.element.show().css( {
+ width: "auto",
+ minHeight: 0,
+ maxHeight: "none",
+ height: 0
+ } );
+
+ if ( options.minWidth > options.width ) {
+ options.width = options.minWidth;
+ }
+
+ // Reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css( {
+ height: "auto",
+ width: options.width
+ } )
+ .outerHeight();
+ minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+ maxContentHeight = typeof options.maxHeight === "number" ?
+ Math.max( 0, options.maxHeight - nonContentHeight ) :
+ "none";
+
+ if ( options.height === "auto" ) {
+ this.element.css( {
+ minHeight: minContentHeight,
+ maxHeight: maxContentHeight,
+ height: "auto"
+ } );
+ } else {
+ this.element.height( Math.max( 0, options.height - nonContentHeight ) );
+ }
+
+ if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+ this.uiDialog.resizable( "option", "minHeight", this._minHeight() );
+ }
+ },
+
+ _blockFrames: function() {
+ this.iframeBlocks = this.document.find( "iframe" ).map( function() {
+ var iframe = $( this );
+
+ return $( "<div>" )
+ .css( {
+ position: "absolute",
+ width: iframe.outerWidth(),
+ height: iframe.outerHeight()
+ } )
+ .appendTo( iframe.parent() )
+ .offset( iframe.offset() )[ 0 ];
+ } );
+ },
+
+ _unblockFrames: function() {
+ if ( this.iframeBlocks ) {
+ this.iframeBlocks.remove();
+ delete this.iframeBlocks;
+ }
+ },
+
+ _allowInteraction: function( event ) {
+ if ( $( event.target ).closest( ".ui-dialog" ).length ) {
+ return true;
+ }
+
+ // TODO: Remove hack when datepicker implements
+ // the .ui-front logic (#8989)
+ return !!$( event.target ).closest( ".ui-datepicker" ).length;
+ },
+
+ _createOverlay: function() {
+ if ( !this.options.modal ) {
+ return;
+ }
+
+ // We use a delay in case the overlay is created from an
+ // event that we're going to be cancelling (#2804)
+ var isOpening = true;
+ this._delay( function() {
+ isOpening = false;
+ } );
+
+ if ( !this.document.data( "ui-dialog-overlays" ) ) {
+
+ // Prevent use of anchors and inputs
+ // Using _on() for an event handler shared across many instances is
+ // safe because the dialogs stack and must be closed in reverse order
+ this._on( this.document, {
+ focusin: function( event ) {
+ if ( isOpening ) {
+ return;
+ }
+
+ if ( !this._allowInteraction( event ) ) {
+ event.preventDefault();
+ this._trackingInstances()[ 0 ]._focusTabbable();
+ }
+ }
+ } );
+ }
+
+ this.overlay = $( "<div>" )
+ .appendTo( this._appendTo() );
+
+ this._addClass( this.overlay, null, "ui-widget-overlay ui-front" );
+ this._on( this.overlay, {
+ mousedown: "_keepFocus"
+ } );
+ this.document.data( "ui-dialog-overlays",
+ ( this.document.data( "ui-dialog-overlays" ) || 0 ) + 1 );
+ },
+
+ _destroyOverlay: function() {
+ if ( !this.options.modal ) {
+ return;
+ }
+
+ if ( this.overlay ) {
+ var overlays = this.document.data( "ui-dialog-overlays" ) - 1;
+
+ if ( !overlays ) {
+ this._off( this.document, "focusin" );
+ this.document.removeData( "ui-dialog-overlays" );
+ } else {
+ this.document.data( "ui-dialog-overlays", overlays );
+ }
+
+ this.overlay.remove();
+ this.overlay = null;
+ }
+ }
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+ // Backcompat for dialogClass option
+ $.widget( "ui.dialog", $.ui.dialog, {
+ options: {
+ dialogClass: ""
+ },
+ _createWrapper: function() {
+ this._super();
+ this.uiDialog.addClass( this.options.dialogClass );
+ },
+ _setOption: function( key, value ) {
+ if ( key === "dialogClass" ) {
+ this.uiDialog
+ .removeClass( this.options.dialogClass )
+ .addClass( value );
+ }
+ this._superApply( arguments );
+ }
+ } );
+}
+
+var widgetsDialog = $.ui.dialog;
+
+
+/*!
+ * jQuery UI Droppable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Droppable
+//>>group: Interactions
+//>>description: Enables drop targets for draggable elements.
+//>>docs: http://api.jqueryui.com/droppable/
+//>>demos: http://jqueryui.com/droppable/
+
+
+
+$.widget( "ui.droppable", {
+ version: "1.12.1",
+ widgetEventPrefix: "drop",
+ options: {
+ accept: "*",
+ addClasses: true,
+ greedy: false,
+ scope: "default",
+ tolerance: "intersect",
+
+ // Callbacks
+ activate: null,
+ deactivate: null,
+ drop: null,
+ out: null,
+ over: null
+ },
+ _create: function() {
+
+ var proportions,
+ o = this.options,
+ accept = o.accept;
+
+ this.isover = false;
+ this.isout = true;
+
+ this.accept = $.isFunction( accept ) ? accept : function( d ) {
+ return d.is( accept );
+ };
+
+ this.proportions = function( /* valueToWrite */ ) {
+ if ( arguments.length ) {
+
+ // Store the droppable's proportions
+ proportions = arguments[ 0 ];
+ } else {
+
+ // Retrieve or derive the droppable's proportions
+ return proportions ?
+ proportions :
+ proportions = {
+ width: this.element[ 0 ].offsetWidth,
+ height: this.element[ 0 ].offsetHeight
+ };
+ }
+ };
+
+ this._addToManager( o.scope );
+
+ o.addClasses && this._addClass( "ui-droppable" );
+
+ },
+
+ _addToManager: function( scope ) {
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[ scope ] = $.ui.ddmanager.droppables[ scope ] || [];
+ $.ui.ddmanager.droppables[ scope ].push( this );
+ },
+
+ _splice: function( drop ) {
+ var i = 0;
+ for ( ; i < drop.length; i++ ) {
+ if ( drop[ i ] === this ) {
+ drop.splice( i, 1 );
+ }
+ }
+ },
+
+ _destroy: function() {
+ var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+ this._splice( drop );
+ },
+
+ _setOption: function( key, value ) {
+
+ if ( key === "accept" ) {
+ this.accept = $.isFunction( value ) ? value : function( d ) {
+ return d.is( value );
+ };
+ } else if ( key === "scope" ) {
+ var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+ this._splice( drop );
+ this._addToManager( value );
+ }
+
+ this._super( key, value );
+ },
+
+ _activate: function( event ) {
+ var draggable = $.ui.ddmanager.current;
+
+ this._addActiveClass();
+ if ( draggable ) {
+ this._trigger( "activate", event, this.ui( draggable ) );
+ }
+ },
+
+ _deactivate: function( event ) {
+ var draggable = $.ui.ddmanager.current;
+
+ this._removeActiveClass();
+ if ( draggable ) {
+ this._trigger( "deactivate", event, this.ui( draggable ) );
+ }
+ },
+
+ _over: function( event ) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if ( !draggable || ( draggable.currentItem ||
+ draggable.element )[ 0 ] === this.element[ 0 ] ) {
+ return;
+ }
+
+ if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+ draggable.element ) ) ) {
+ this._addHoverClass();
+ this._trigger( "over", event, this.ui( draggable ) );
+ }
+
+ },
+
+ _out: function( event ) {
+
+ var draggable = $.ui.ddmanager.current;
+
+ // Bail if draggable and droppable are same element
+ if ( !draggable || ( draggable.currentItem ||
+ draggable.element )[ 0 ] === this.element[ 0 ] ) {
+ return;
+ }
+
+ if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+ draggable.element ) ) ) {
+ this._removeHoverClass();
+ this._trigger( "out", event, this.ui( draggable ) );
+ }
+
+ },
+
+ _drop: function( event, custom ) {
+
+ var draggable = custom || $.ui.ddmanager.current,
+ childrenIntersection = false;
+
+ // Bail if draggable and droppable are same element
+ if ( !draggable || ( draggable.currentItem ||
+ draggable.element )[ 0 ] === this.element[ 0 ] ) {
+ return false;
+ }
+
+ this.element
+ .find( ":data(ui-droppable)" )
+ .not( ".ui-draggable-dragging" )
+ .each( function() {
+ var inst = $( this ).droppable( "instance" );
+ if (
+ inst.options.greedy &&
+ !inst.options.disabled &&
+ inst.options.scope === draggable.options.scope &&
+ inst.accept.call(
+ inst.element[ 0 ], ( draggable.currentItem || draggable.element )
+ ) &&
+ intersect(
+ draggable,
+ $.extend( inst, { offset: inst.element.offset() } ),
+ inst.options.tolerance, event
+ )
+ ) {
+ childrenIntersection = true;
+ return false; }
+ } );
+ if ( childrenIntersection ) {
+ return false;
+ }
+
+ if ( this.accept.call( this.element[ 0 ],
+ ( draggable.currentItem || draggable.element ) ) ) {
+ this._removeActiveClass();
+ this._removeHoverClass();
+
+ this._trigger( "drop", event, this.ui( draggable ) );
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function( c ) {
+ return {
+ draggable: ( c.currentItem || c.element ),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ },
+
+ // Extension points just to make backcompat sane and avoid duplicating logic
+ // TODO: Remove in 1.13 along with call to it below
+ _addHoverClass: function() {
+ this._addClass( "ui-droppable-hover" );
+ },
+
+ _removeHoverClass: function() {
+ this._removeClass( "ui-droppable-hover" );
+ },
+
+ _addActiveClass: function() {
+ this._addClass( "ui-droppable-active" );
+ },
+
+ _removeActiveClass: function() {
+ this._removeClass( "ui-droppable-active" );
+ }
+} );
+
+var intersect = $.ui.intersect = ( function() {
+ function isOverAxis( x, reference, size ) {
+ return ( x >= reference ) && ( x < ( reference + size ) );
+ }
+
+ return function( draggable, droppable, toleranceMode, event ) {
+
+ if ( !droppable.offset ) {
+ return false;
+ }
+
+ var x1 = ( draggable.positionAbs ||
+ draggable.position.absolute ).left + draggable.margins.left,
+ y1 = ( draggable.positionAbs ||
+ draggable.position.absolute ).top + draggable.margins.top,
+ x2 = x1 + draggable.helperProportions.width,
+ y2 = y1 + draggable.helperProportions.height,
+ l = droppable.offset.left,
+ t = droppable.offset.top,
+ r = l + droppable.proportions().width,
+ b = t + droppable.proportions().height;
+
+ switch ( toleranceMode ) {
+ case "fit":
+ return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b );
+ case "intersect":
+ return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half
+ x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half
+ t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half
+ y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half
+ case "pointer":
+ return isOverAxis( event.pageY, t, droppable.proportions().height ) &&
+ isOverAxis( event.pageX, l, droppable.proportions().width );
+ case "touch":
+ return (
+ ( y1 >= t && y1 <= b ) || // Top edge touching
+ ( y2 >= t && y2 <= b ) || // Bottom edge touching
+ ( y1 < t && y2 > b ) // Surrounded vertically
+ ) && (
+ ( x1 >= l && x1 <= r ) || // Left edge touching
+ ( x2 >= l && x2 <= r ) || // Right edge touching
+ ( x1 < l && x2 > r ) // Surrounded horizontally
+ );
+ default:
+ return false;
+ }
+ };
+} )();
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { "default": [] },
+ prepareOffsets: function( t, event ) {
+
+ var i, j,
+ m = $.ui.ddmanager.droppables[ t.options.scope ] || [],
+ type = event ? event.type : null, // workaround for #2317
+ list = ( t.currentItem || t.element ).find( ":data(ui-droppable)" ).addBack();
+
+ droppablesLoop: for ( i = 0; i < m.length; i++ ) {
+
+ // No disabled and non-accepted
+ if ( m[ i ].options.disabled || ( t && !m[ i ].accept.call( m[ i ].element[ 0 ],
+ ( t.currentItem || t.element ) ) ) ) {
+ continue;
+ }
+
+ // Filter out elements in the current dragged item
+ for ( j = 0; j < list.length; j++ ) {
+ if ( list[ j ] === m[ i ].element[ 0 ] ) {
+ m[ i ].proportions().height = 0;
+ continue droppablesLoop;
+ }
+ }
+
+ m[ i ].visible = m[ i ].element.css( "display" ) !== "none";
+ if ( !m[ i ].visible ) {
+ continue;
+ }
+
+ // Activate the droppable if used directly from draggables
+ if ( type === "mousedown" ) {
+ m[ i ]._activate.call( m[ i ], event );
+ }
+
+ m[ i ].offset = m[ i ].element.offset();
+ m[ i ].proportions( {
+ width: m[ i ].element[ 0 ].offsetWidth,
+ height: m[ i ].element[ 0 ].offsetHeight
+ } );
+
+ }
+
+ },
+ drop: function( draggable, event ) {
+
+ var dropped = false;
+
+ // Create a copy of the droppables in case the list changes during the drop (#9116)
+ $.each( ( $.ui.ddmanager.droppables[ draggable.options.scope ] || [] ).slice(), function() {
+
+ if ( !this.options ) {
+ return;
+ }
+ if ( !this.options.disabled && this.visible &&
+ intersect( draggable, this, this.options.tolerance, event ) ) {
+ dropped = this._drop.call( this, event ) || dropped;
+ }
+
+ if ( !this.options.disabled && this.visible && this.accept.call( this.element[ 0 ],
+ ( draggable.currentItem || draggable.element ) ) ) {
+ this.isout = true;
+ this.isover = false;
+ this._deactivate.call( this, event );
+ }
+
+ } );
+ return dropped;
+
+ },
+ dragStart: function( draggable, event ) {
+
+ // Listen for scrolling so that if the dragging causes scrolling the position of the
+ // droppables can be recalculated (see #5003)
+ draggable.element.parentsUntil( "body" ).on( "scroll.droppable", function() {
+ if ( !draggable.options.refreshPositions ) {
+ $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+ } );
+ },
+ drag: function( draggable, event ) {
+
+ // If you have a highly dynamic page, you might try this option. It renders positions
+ // every time you move the mouse.
+ if ( draggable.options.refreshPositions ) {
+ $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+
+ // Run through all droppables and check their positions based on specific tolerance options
+ $.each( $.ui.ddmanager.droppables[ draggable.options.scope ] || [], function() {
+
+ if ( this.options.disabled || this.greedyChild || !this.visible ) {
+ return;
+ }
+
+ var parentInstance, scope, parent,
+ intersects = intersect( draggable, this, this.options.tolerance, event ),
+ c = !intersects && this.isover ?
+ "isout" :
+ ( intersects && !this.isover ? "isover" : null );
+ if ( !c ) {
+ return;
+ }
+
+ if ( this.options.greedy ) {
+
+ // find droppable parents with same scope
+ scope = this.options.scope;
+ parent = this.element.parents( ":data(ui-droppable)" ).filter( function() {
+ return $( this ).droppable( "instance" ).options.scope === scope;
+ } );
+
+ if ( parent.length ) {
+ parentInstance = $( parent[ 0 ] ).droppable( "instance" );
+ parentInstance.greedyChild = ( c === "isover" );
+ }
+ }
+
+ // We just moved into a greedy child
+ if ( parentInstance && c === "isover" ) {
+ parentInstance.isover = false;
+ parentInstance.isout = true;
+ parentInstance._out.call( parentInstance, event );
+ }
+
+ this[ c ] = true;
+ this[ c === "isout" ? "isover" : "isout" ] = false;
+ this[ c === "isover" ? "_over" : "_out" ].call( this, event );
+
+ // We just moved out of a greedy child
+ if ( parentInstance && c === "isout" ) {
+ parentInstance.isout = false;
+ parentInstance.isover = true;
+ parentInstance._over.call( parentInstance, event );
+ }
+ } );
+
+ },
+ dragStop: function( draggable, event ) {
+ draggable.element.parentsUntil( "body" ).off( "scroll.droppable" );
+
+ // Call prepareOffsets one final time since IE does not fire return scroll events when
+ // overflow was caused by drag (see #5003)
+ if ( !draggable.options.refreshPositions ) {
+ $.ui.ddmanager.prepareOffsets( draggable, event );
+ }
+ }
+};
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+ // Backcompat for activeClass and hoverClass options
+ $.widget( "ui.droppable", $.ui.droppable, {
+ options: {
+ hoverClass: false,
+ activeClass: false
+ },
+ _addActiveClass: function() {
+ this._super();
+ if ( this.options.activeClass ) {
+ this.element.addClass( this.options.activeClass );
+ }
+ },
+ _removeActiveClass: function() {
+ this._super();
+ if ( this.options.activeClass ) {
+ this.element.removeClass( this.options.activeClass );
+ }
+ },
+ _addHoverClass: function() {
+ this._super();
+ if ( this.options.hoverClass ) {
+ this.element.addClass( this.options.hoverClass );
+ }
+ },
+ _removeHoverClass: function() {
+ this._super();
+ if ( this.options.hoverClass ) {
+ this.element.removeClass( this.options.hoverClass );
+ }
+ }
+ } );
+}
+
+var widgetsDroppable = $.ui.droppable;
+
+
+/*!
+ * jQuery UI Progressbar 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Progressbar
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/progressbar/
+//>>demos: http://jqueryui.com/progressbar/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/progressbar.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsProgressbar = $.widget( "ui.progressbar", {
+ version: "1.12.1",
+ options: {
+ classes: {
+ "ui-progressbar": "ui-corner-all",
+ "ui-progressbar-value": "ui-corner-left",
+ "ui-progressbar-complete": "ui-corner-right"
+ },
+ max: 100,
+ value: 0,
+
+ change: null,
+ complete: null
+ },
+
+ min: 0,
+
+ _create: function() {
+
+ // Constrain initial value
+ this.oldValue = this.options.value = this._constrainedValue();
+
+ this.element.attr( {
+
+ // Only set static values; aria-valuenow and aria-valuemax are
+ // set inside _refreshValue()
+ role: "progressbar",
+ "aria-valuemin": this.min
+ } );
+ this._addClass( "ui-progressbar", "ui-widget ui-widget-content" );
+
+ this.valueDiv = $( "<div>" ).appendTo( this.element );
+ this._addClass( this.valueDiv, "ui-progressbar-value", "ui-widget-header" );
+ this._refreshValue();
+ },
+
+ _destroy: function() {
+ this.element.removeAttr( "role aria-valuemin aria-valuemax aria-valuenow" );
+
+ this.valueDiv.remove();
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this.options.value;
+ }
+
+ this.options.value = this._constrainedValue( newValue );
+ this._refreshValue();
+ },
+
+ _constrainedValue: function( newValue ) {
+ if ( newValue === undefined ) {
+ newValue = this.options.value;
+ }
+
+ this.indeterminate = newValue === false;
+
+ // Sanitize value
+ if ( typeof newValue !== "number" ) {
+ newValue = 0;
+ }
+
+ return this.indeterminate ? false :
+ Math.min( this.options.max, Math.max( this.min, newValue ) );
+ },
+
+ _setOptions: function( options ) {
+
+ // Ensure "value" option is set after other values (like max)
+ var value = options.value;
+ delete options.value;
+
+ this._super( options );
+
+ this.options.value = this._constrainedValue( value );
+ this._refreshValue();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "max" ) {
+
+ // Don't allow a max less than min
+ value = Math.max( this.min, value );
+ }
+ this._super( key, value );
+ },
+
+ _setOptionDisabled: function( value ) {
+ this._super( value );
+
+ this.element.attr( "aria-disabled", value );
+ this._toggleClass( null, "ui-state-disabled", !!value );
+ },
+
+ _percentage: function() {
+ return this.indeterminate ?
+ 100 :
+ 100 * ( this.options.value - this.min ) / ( this.options.max - this.min );
+ },
+
+ _refreshValue: function() {
+ var value = this.options.value,
+ percentage = this._percentage();
+
+ this.valueDiv
+ .toggle( this.indeterminate || value > this.min )
+ .width( percentage.toFixed( 0 ) + "%" );
+
+ this
+ ._toggleClass( this.valueDiv, "ui-progressbar-complete", null,
+ value === this.options.max )
+ ._toggleClass( "ui-progressbar-indeterminate", null, this.indeterminate );
+
+ if ( this.indeterminate ) {
+ this.element.removeAttr( "aria-valuenow" );
+ if ( !this.overlayDiv ) {
+ this.overlayDiv = $( "<div>" ).appendTo( this.valueDiv );
+ this._addClass( this.overlayDiv, "ui-progressbar-overlay" );
+ }
+ } else {
+ this.element.attr( {
+ "aria-valuemax": this.options.max,
+ "aria-valuenow": value
+ } );
+ if ( this.overlayDiv ) {
+ this.overlayDiv.remove();
+ this.overlayDiv = null;
+ }
+ }
+
+ if ( this.oldValue !== value ) {
+ this.oldValue = value;
+ this._trigger( "change" );
+ }
+ if ( value === this.options.max ) {
+ this._trigger( "complete" );
+ }
+ }
+} );
+
+
+/*!
+ * jQuery UI Selectable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectable
+//>>group: Interactions
+//>>description: Allows groups of elements to be selected with the mouse.
+//>>docs: http://api.jqueryui.com/selectable/
+//>>demos: http://jqueryui.com/selectable/
+//>>css.structure: ../../themes/base/selectable.css
+
+
+
+var widgetsSelectable = $.widget( "ui.selectable", $.ui.mouse, {
+ version: "1.12.1",
+ options: {
+ appendTo: "body",
+ autoRefresh: true,
+ distance: 0,
+ filter: "*",
+ tolerance: "touch",
+
+ // Callbacks
+ selected: null,
+ selecting: null,
+ start: null,
+ stop: null,
+ unselected: null,
+ unselecting: null
+ },
+ _create: function() {
+ var that = this;
+
+ this._addClass( "ui-selectable" );
+
+ this.dragged = false;
+
+ // Cache selectee children based on filter
+ this.refresh = function() {
+ that.elementPos = $( that.element[ 0 ] ).offset();
+ that.selectees = $( that.options.filter, that.element[ 0 ] );
+ that._addClass( that.selectees, "ui-selectee" );
+ that.selectees.each( function() {
+ var $this = $( this ),
+ selecteeOffset = $this.offset(),
+ pos = {
+ left: selecteeOffset.left - that.elementPos.left,
+ top: selecteeOffset.top - that.elementPos.top
+ };
+ $.data( this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass( "ui-selected" ),
+ selecting: $this.hasClass( "ui-selecting" ),
+ unselecting: $this.hasClass( "ui-unselecting" )
+ } );
+ } );
+ };
+ this.refresh();
+
+ this._mouseInit();
+
+ this.helper = $( "<div>" );
+ this._addClass( this.helper, "ui-selectable-helper" );
+ },
+
+ _destroy: function() {
+ this.selectees.removeData( "selectable-item" );
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function( event ) {
+ var that = this,
+ options = this.options;
+
+ this.opos = [ event.pageX, event.pageY ];
+ this.elementPos = $( this.element[ 0 ] ).offset();
+
+ if ( this.options.disabled ) {
+ return;
+ }
+
+ this.selectees = $( options.filter, this.element[ 0 ] );
+
+ this._trigger( "start", event );
+
+ $( options.appendTo ).append( this.helper );
+
+ // position helper (lasso)
+ this.helper.css( {
+ "left": event.pageX,
+ "top": event.pageY,
+ "width": 0,
+ "height": 0
+ } );
+
+ if ( options.autoRefresh ) {
+ this.refresh();
+ }
+
+ this.selectees.filter( ".ui-selected" ).each( function() {
+ var selectee = $.data( this, "selectable-item" );
+ selectee.startselected = true;
+ if ( !event.metaKey && !event.ctrlKey ) {
+ that._removeClass( selectee.$element, "ui-selected" );
+ selectee.selected = false;
+ that._addClass( selectee.$element, "ui-unselecting" );
+ selectee.unselecting = true;
+
+ // selectable UNSELECTING callback
+ that._trigger( "unselecting", event, {
+ unselecting: selectee.element
+ } );
+ }
+ } );
+
+ $( event.target ).parents().addBack().each( function() {
+ var doSelect,
+ selectee = $.data( this, "selectable-item" );
+ if ( selectee ) {
+ doSelect = ( !event.metaKey && !event.ctrlKey ) ||
+ !selectee.$element.hasClass( "ui-selected" );
+ that._removeClass( selectee.$element, doSelect ? "ui-unselecting" : "ui-selected" )
+ ._addClass( selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting" );
+ selectee.unselecting = !doSelect;
+ selectee.selecting = doSelect;
+ selectee.selected = doSelect;
+
+ // selectable (UN)SELECTING callback
+ if ( doSelect ) {
+ that._trigger( "selecting", event, {
+ selecting: selectee.element
+ } );
+ } else {
+ that._trigger( "unselecting", event, {
+ unselecting: selectee.element
+ } );
+ }
+ return false;
+ }
+ } );
+
+ },
+
+ _mouseDrag: function( event ) {
+
+ this.dragged = true;
+
+ if ( this.options.disabled ) {
+ return;
+ }
+
+ var tmp,
+ that = this,
+ options = this.options,
+ x1 = this.opos[ 0 ],
+ y1 = this.opos[ 1 ],
+ x2 = event.pageX,
+ y2 = event.pageY;
+
+ if ( x1 > x2 ) { tmp = x2; x2 = x1; x1 = tmp; }
+ if ( y1 > y2 ) { tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css( { left: x1, top: y1, width: x2 - x1, height: y2 - y1 } );
+
+ this.selectees.each( function() {
+ var selectee = $.data( this, "selectable-item" ),
+ hit = false,
+ offset = {};
+
+ //prevent helper from being selected if appendTo: selectable
+ if ( !selectee || selectee.element === that.element[ 0 ] ) {
+ return;
+ }
+
+ offset.left = selectee.left + that.elementPos.left;
+ offset.right = selectee.right + that.elementPos.left;
+ offset.top = selectee.top + that.elementPos.top;
+ offset.bottom = selectee.bottom + that.elementPos.top;
+
+ if ( options.tolerance === "touch" ) {
+ hit = ( !( offset.left > x2 || offset.right < x1 || offset.top > y2 ||
+ offset.bottom < y1 ) );
+ } else if ( options.tolerance === "fit" ) {
+ hit = ( offset.left > x1 && offset.right < x2 && offset.top > y1 &&
+ offset.bottom < y2 );
+ }
+
+ if ( hit ) {
+
+ // SELECT
+ if ( selectee.selected ) {
+ that._removeClass( selectee.$element, "ui-selected" );
+ selectee.selected = false;
+ }
+ if ( selectee.unselecting ) {
+ that._removeClass( selectee.$element, "ui-unselecting" );
+ selectee.unselecting = false;
+ }
+ if ( !selectee.selecting ) {
+ that._addClass( selectee.$element, "ui-selecting" );
+ selectee.selecting = true;
+
+ // selectable SELECTING callback
+ that._trigger( "selecting", event, {
+ selecting: selectee.element
+ } );
+ }
+ } else {
+
+ // UNSELECT
+ if ( selectee.selecting ) {
+ if ( ( event.metaKey || event.ctrlKey ) && selectee.startselected ) {
+ that._removeClass( selectee.$element, "ui-selecting" );
+ selectee.selecting = false;
+ that._addClass( selectee.$element, "ui-selected" );
+ selectee.selected = true;
+ } else {
+ that._removeClass( selectee.$element, "ui-selecting" );
+ selectee.selecting = false;
+ if ( selectee.startselected ) {
+ that._addClass( selectee.$element, "ui-unselecting" );
+ selectee.unselecting = true;
+ }
+
+ // selectable UNSELECTING callback
+ that._trigger( "unselecting", event, {
+ unselecting: selectee.element
+ } );
+ }
+ }
+ if ( selectee.selected ) {
+ if ( !event.metaKey && !event.ctrlKey && !selectee.startselected ) {
+ that._removeClass( selectee.$element, "ui-selected" );
+ selectee.selected = false;
+
+ that._addClass( selectee.$element, "ui-unselecting" );
+ selectee.unselecting = true;
+
+ // selectable UNSELECTING callback
+ that._trigger( "unselecting", event, {
+ unselecting: selectee.element
+ } );
+ }
+ }
+ }
+ } );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ var that = this;
+
+ this.dragged = false;
+
+ $( ".ui-unselecting", this.element[ 0 ] ).each( function() {
+ var selectee = $.data( this, "selectable-item" );
+ that._removeClass( selectee.$element, "ui-unselecting" );
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ that._trigger( "unselected", event, {
+ unselected: selectee.element
+ } );
+ } );
+ $( ".ui-selecting", this.element[ 0 ] ).each( function() {
+ var selectee = $.data( this, "selectable-item" );
+ that._removeClass( selectee.$element, "ui-selecting" )
+ ._addClass( selectee.$element, "ui-selected" );
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ that._trigger( "selected", event, {
+ selected: selectee.element
+ } );
+ } );
+ this._trigger( "stop", event );
+
+ this.helper.remove();
+
+ return false;
+ }
+
+} );
+
+
+/*!
+ * jQuery UI Selectmenu 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectmenu
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/selectmenu/
+//>>demos: http://jqueryui.com/selectmenu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsSelectmenu = $.widget( "ui.selectmenu", [ $.ui.formResetMixin, {
+ version: "1.12.1",
+ defaultElement: "<select>",
+ options: {
+ appendTo: null,
+ classes: {
+ "ui-selectmenu-button-open": "ui-corner-top",
+ "ui-selectmenu-button-closed": "ui-corner-all"
+ },
+ disabled: null,
+ icons: {
+ button: "ui-icon-triangle-1-s"
+ },
+ position: {
+ my: "left top",
+ at: "left bottom",
+ collision: "none"
+ },
+ width: false,
+
+ // Callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ select: null
+ },
+
+ _create: function() {
+ var selectmenuId = this.element.uniqueId().attr( "id" );
+ this.ids = {
+ element: selectmenuId,
+ button: selectmenuId + "-button",
+ menu: selectmenuId + "-menu"
+ };
+
+ this._drawButton();
+ this._drawMenu();
+ this._bindFormResetHandler();
+
+ this._rendered = false;
+ this.menuItems = $();
+ },
+
+ _drawButton: function() {
+ var icon,
+ that = this,
+ item = this._parseOption(
+ this.element.find( "option:selected" ),
+ this.element[ 0 ].selectedIndex
+ );
+
+ // Associate existing label with the new button
+ this.labels = this.element.labels().attr( "for", this.ids.button );
+ this._on( this.labels, {
+ click: function( event ) {
+ this.button.focus();
+ event.preventDefault();
+ }
+ } );
+
+ // Hide original select element
+ this.element.hide();
+
+ // Create button
+ this.button = $( "<span>", {
+ tabindex: this.options.disabled ? -1 : 0,
+ id: this.ids.button,
+ role: "combobox",
+ "aria-expanded": "false",
+ "aria-autocomplete": "list",
+ "aria-owns": this.ids.menu,
+ "aria-haspopup": "true",
+ title: this.element.attr( "title" )
+ } )
+ .insertAfter( this.element );
+
+ this._addClass( this.button, "ui-selectmenu-button ui-selectmenu-button-closed",
+ "ui-button ui-widget" );
+
+ icon = $( "<span>" ).appendTo( this.button );
+ this._addClass( icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button );
+ this.buttonItem = this._renderButtonItem( item )
+ .appendTo( this.button );
+
+ if ( this.options.width !== false ) {
+ this._resizeButton();
+ }
+
+ this._on( this.button, this._buttonEvents );
+ this.button.one( "focusin", function() {
+
+ // Delay rendering the menu items until the button receives focus.
+ // The menu may have already been rendered via a programmatic open.
+ if ( !that._rendered ) {
+ that._refreshMenu();
+ }
+ } );
+ },
+
+ _drawMenu: function() {
+ var that = this;
+
+ // Create menu
+ this.menu = $( "<ul>", {
+ "aria-hidden": "true",
+ "aria-labelledby": this.ids.button,
+ id: this.ids.menu
+ } );
+
+ // Wrap menu
+ this.menuWrap = $( "<div>" ).append( this.menu );
+ this._addClass( this.menuWrap, "ui-selectmenu-menu", "ui-front" );
+ this.menuWrap.appendTo( this._appendTo() );
+
+ // Initialize menu widget
+ this.menuInstance = this.menu
+ .menu( {
+ classes: {
+ "ui-menu": "ui-corner-bottom"
+ },
+ role: "listbox",
+ select: function( event, ui ) {
+ event.preventDefault();
+
+ // Support: IE8
+ // If the item was selected via a click, the text selection
+ // will be destroyed in IE
+ that._setSelection();
+
+ that._select( ui.item.data( "ui-selectmenu-item" ), event );
+ },
+ focus: function( event, ui ) {
+ var item = ui.item.data( "ui-selectmenu-item" );
+
+ // Prevent inital focus from firing and check if its a newly focused item
+ if ( that.focusIndex != null && item.index !== that.focusIndex ) {
+ that._trigger( "focus", event, { item: item } );
+ if ( !that.isOpen ) {
+ that._select( item, event );
+ }
+ }
+ that.focusIndex = item.index;
+
+ that.button.attr( "aria-activedescendant",
+ that.menuItems.eq( item.index ).attr( "id" ) );
+ }
+ } )
+ .menu( "instance" );
+
+ // Don't close the menu on mouseleave
+ this.menuInstance._off( this.menu, "mouseleave" );
+
+ // Cancel the menu's collapseAll on document click
+ this.menuInstance._closeOnDocumentClick = function() {
+ return false;
+ };
+
+ // Selects often contain empty items, but never contain dividers
+ this.menuInstance._isDivider = function() {
+ return false;
+ };
+ },
+
+ refresh: function() {
+ this._refreshMenu();
+ this.buttonItem.replaceWith(
+ this.buttonItem = this._renderButtonItem(
+
+ // Fall back to an empty object in case there are no options
+ this._getSelectedItem().data( "ui-selectmenu-item" ) || {}
+ )
+ );
+ if ( this.options.width === null ) {
+ this._resizeButton();
+ }
+ },
+
+ _refreshMenu: function() {
+ var item,
+ options = this.element.find( "option" );
+
+ this.menu.empty();
+
+ this._parseOptions( options );
+ this._renderMenu( this.menu, this.items );
+
+ this.menuInstance.refresh();
+ this.menuItems = this.menu.find( "li" )
+ .not( ".ui-selectmenu-optgroup" )
+ .find( ".ui-menu-item-wrapper" );
+
+ this._rendered = true;
+
+ if ( !options.length ) {
+ return;
+ }
+
+ item = this._getSelectedItem();
+
+ // Update the menu to have the correct item focused
+ this.menuInstance.focus( null, item );
+ this._setAria( item.data( "ui-selectmenu-item" ) );
+
+ // Set disabled state
+ this._setOption( "disabled", this.element.prop( "disabled" ) );
+ },
+
+ open: function( event ) {
+ if ( this.options.disabled ) {
+ return;
+ }
+
+ // If this is the first time the menu is being opened, render the items
+ if ( !this._rendered ) {
+ this._refreshMenu();
+ } else {
+
+ // Menu clears focus on close, reset focus to selected item
+ this._removeClass( this.menu.find( ".ui-state-active" ), null, "ui-state-active" );
+ this.menuInstance.focus( null, this._getSelectedItem() );
+ }
+
+ // If there are no options, don't open the menu
+ if ( !this.menuItems.length ) {
+ return;
+ }
+
+ this.isOpen = true;
+ this._toggleAttr();
+ this._resizeMenu();
+ this._position();
+
+ this._on( this.document, this._documentClick );
+
+ this._trigger( "open", event );
+ },
+
+ _position: function() {
+ this.menuWrap.position( $.extend( { of: this.button }, this.options.position ) );
+ },
+
+ close: function( event ) {
+ if ( !this.isOpen ) {
+ return;
+ }
+
+ this.isOpen = false;
+ this._toggleAttr();
+
+ this.range = null;
+ this._off( this.document );
+
+ this._trigger( "close", event );
+ },
+
+ widget: function() {
+ return this.button;
+ },
+
+ menuWidget: function() {
+ return this.menu;
+ },
+
+ _renderButtonItem: function( item ) {
+ var buttonItem = $( "<span>" );
+
+ this._setText( buttonItem, item.label );
+ this._addClass( buttonItem, "ui-selectmenu-text" );
+
+ return buttonItem;
+ },
- if ( newVal !== this.values( index ) ) {
- newValues = this.values();
- newValues[ index ] = newVal;
- // A slide can be canceled by returning false from the slide callback
- allowed = this._trigger( "slide", event, {
- handle: this.handles[ index ],
- value: newVal,
- values: newValues
+ _renderMenu: function( ul, items ) {
+ var that = this,
+ currentOptgroup = "";
+
+ $.each( items, function( index, item ) {
+ var li;
+
+ if ( item.optgroup !== currentOptgroup ) {
+ li = $( "<li>", {
+ text: item.optgroup
} );
- otherVal = this.values( index ? 0 : 1 );
- if ( allowed !== false ) {
- this.values( index, newVal, true );
+ that._addClass( li, "ui-selectmenu-optgroup", "ui-menu-divider" +
+ ( item.element.parent( "optgroup" ).prop( "disabled" ) ?
+ " ui-state-disabled" :
+ "" ) );
+
+ li.appendTo( ul );
+
+ currentOptgroup = item.optgroup;
+ }
+
+ that._renderItemData( ul, item );
+ } );
+ },
+
+ _renderItemData: function( ul, item ) {
+ return this._renderItem( ul, item ).data( "ui-selectmenu-item", item );
+ },
+
+ _renderItem: function( ul, item ) {
+ var li = $( "<li>" ),
+ wrapper = $( "<div>", {
+ title: item.element.attr( "title" )
+ } );
+
+ if ( item.disabled ) {
+ this._addClass( li, null, "ui-state-disabled" );
+ }
+ this._setText( wrapper, item.label );
+
+ return li.append( wrapper ).appendTo( ul );
+ },
+
+ _setText: function( element, value ) {
+ if ( value ) {
+ element.text( value );
+ } else {
+ element.html( " " );
+ }
+ },
+
+ _move: function( direction, event ) {
+ var item, next,
+ filter = ".ui-menu-item";
+
+ if ( this.isOpen ) {
+ item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+ } else {
+ item = this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+ filter += ":not(.ui-state-disabled)";
+ }
+
+ if ( direction === "first" || direction === "last" ) {
+ next = item[ direction === "first" ? "prevAll" : "nextAll" ]( filter ).eq( -1 );
+ } else {
+ next = item[ direction + "All" ]( filter ).eq( 0 );
+ }
+
+ if ( next.length ) {
+ this.menuInstance.focus( event, next );
+ }
+ },
+
+ _getSelectedItem: function() {
+ return this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+ },
+
+ _toggle: function( event ) {
+ this[ this.isOpen ? "close" : "open" ]( event );
+ },
+
+ _setSelection: function() {
+ var selection;
+
+ if ( !this.range ) {
+ return;
+ }
+
+ if ( window.getSelection ) {
+ selection = window.getSelection();
+ selection.removeAllRanges();
+ selection.addRange( this.range );
+
+ // Support: IE8
+ } else {
+ this.range.select();
+ }
+
+ // Support: IE
+ // Setting the text selection kills the button focus in IE, but
+ // restoring the focus doesn't kill the selection.
+ this.button.focus();
+ },
+
+ _documentClick: {
+ mousedown: function( event ) {
+ if ( !this.isOpen ) {
+ return;
+ }
+
+ if ( !$( event.target ).closest( ".ui-selectmenu-menu, #" +
+ $.ui.escapeSelector( this.ids.button ) ).length ) {
+ this.close( event );
+ }
+ }
+ },
+
+ _buttonEvents: {
+
+ // Prevent text selection from being reset when interacting with the selectmenu (#10144)
+ mousedown: function() {
+ var selection;
+
+ if ( window.getSelection ) {
+ selection = window.getSelection();
+ if ( selection.rangeCount ) {
+ this.range = selection.getRangeAt( 0 );
+ }
+
+ // Support: IE8
+ } else {
+ this.range = document.selection.createRange();
+ }
+ },
+
+ click: function( event ) {
+ this._setSelection();
+ this._toggle( event );
+ },
+
+ keydown: function( event ) {
+ var preventDefault = true;
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.TAB:
+ case $.ui.keyCode.ESCAPE:
+ this.close( event );
+ preventDefault = false;
+ break;
+ case $.ui.keyCode.ENTER:
+ if ( this.isOpen ) {
+ this._selectFocusedItem( event );
+ }
+ break;
+ case $.ui.keyCode.UP:
+ if ( event.altKey ) {
+ this._toggle( event );
+ } else {
+ this._move( "prev", event );
+ }
+ break;
+ case $.ui.keyCode.DOWN:
+ if ( event.altKey ) {
+ this._toggle( event );
+ } else {
+ this._move( "next", event );
+ }
+ break;
+ case $.ui.keyCode.SPACE:
+ if ( this.isOpen ) {
+ this._selectFocusedItem( event );
+ } else {
+ this._toggle( event );
}
+ break;
+ case $.ui.keyCode.LEFT:
+ this._move( "prev", event );
+ break;
+ case $.ui.keyCode.RIGHT:
+ this._move( "next", event );
+ break;
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.PAGE_UP:
+ this._move( "first", event );
+ break;
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_DOWN:
+ this._move( "last", event );
+ break;
+ default:
+ this.menu.trigger( event );
+ preventDefault = false;
+ }
+
+ if ( preventDefault ) {
+ event.preventDefault();
}
+ }
+ },
+
+ _selectFocusedItem: function( event ) {
+ var item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+ if ( !item.hasClass( "ui-state-disabled" ) ) {
+ this._select( item.data( "ui-selectmenu-item" ), event );
+ }
+ },
+
+ _select: function( item, event ) {
+ var oldIndex = this.element[ 0 ].selectedIndex;
+
+ // Change native select element
+ this.element[ 0 ].selectedIndex = item.index;
+ this.buttonItem.replaceWith( this.buttonItem = this._renderButtonItem( item ) );
+ this._setAria( item );
+ this._trigger( "select", event, { item: item } );
+
+ if ( item.index !== oldIndex ) {
+ this._trigger( "change", event, { item: item } );
+ }
+
+ this.close( event );
+ },
+
+ _setAria: function( item ) {
+ var id = this.menuItems.eq( item.index ).attr( "id" );
+
+ this.button.attr( {
+ "aria-labelledby": id,
+ "aria-activedescendant": id
+ } );
+ this.menu.attr( "aria-activedescendant", id );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "icons" ) {
+ var icon = this.button.find( "span.ui-icon" );
+ this._removeClass( icon, null, this.options.icons.button )
+ ._addClass( icon, null, value.button );
+ }
+
+ this._super( key, value );
+
+ if ( key === "appendTo" ) {
+ this.menuWrap.appendTo( this._appendTo() );
+ }
+
+ if ( key === "width" ) {
+ this._resizeButton();
+ }
+ },
+
+ _setOptionDisabled: function( value ) {
+ this._super( value );
+
+ this.menuInstance.option( "disabled", value );
+ this.button.attr( "aria-disabled", value );
+ this._toggleClass( this.button, null, "ui-state-disabled", value );
+
+ this.element.prop( "disabled", value );
+ if ( value ) {
+ this.button.attr( "tabindex", -1 );
+ this.close();
} else {
- if ( newVal !== this.value() ) {
- // A slide can be canceled by returning false from the slide callback
- allowed = this._trigger( "slide", event, {
- handle: this.handles[ index ],
- value: newVal
- } );
- if ( allowed !== false ) {
- this.value( newVal );
+ this.button.attr( "tabindex", 0 );
+ }
+ },
+
+ _appendTo: function() {
+ var element = this.options.appendTo;
+
+ if ( element ) {
+ element = element.jquery || element.nodeType ?
+ $( element ) :
+ this.document.find( element ).eq( 0 );
+ }
+
+ if ( !element || !element[ 0 ] ) {
+ element = this.element.closest( ".ui-front, dialog" );
+ }
+
+ if ( !element.length ) {
+ element = this.document[ 0 ].body;
+ }
+
+ return element;
+ },
+
+ _toggleAttr: function() {
+ this.button.attr( "aria-expanded", this.isOpen );
+
+ // We can't use two _toggleClass() calls here, because we need to make sure
+ // we always remove classes first and add them second, otherwise if both classes have the
+ // same theme class, it will be removed after we add it.
+ this._removeClass( this.button, "ui-selectmenu-button-" +
+ ( this.isOpen ? "closed" : "open" ) )
+ ._addClass( this.button, "ui-selectmenu-button-" +
+ ( this.isOpen ? "open" : "closed" ) )
+ ._toggleClass( this.menuWrap, "ui-selectmenu-open", null, this.isOpen );
+
+ this.menu.attr( "aria-hidden", !this.isOpen );
+ },
+
+ _resizeButton: function() {
+ var width = this.options.width;
+
+ // For `width: false`, just remove inline style and stop
+ if ( width === false ) {
+ this.button.css( "width", "" );
+ return;
+ }
+
+ // For `width: null`, match the width of the original element
+ if ( width === null ) {
+ width = this.element.show().outerWidth();
+ this.element.hide();
+ }
+
+ this.button.outerWidth( width );
+ },
+
+ _resizeMenu: function() {
+ this.menu.outerWidth( Math.max(
+ this.button.outerWidth(),
+
+ // Support: IE10
+ // IE10 wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping
+ this.menu.width( "" ).outerWidth() + 1
+ ) );
+ },
+
+ _getCreateOptions: function() {
+ var options = this._super();
+
+ options.disabled = this.element.prop( "disabled" );
+
+ return options;
+ },
+
+ _parseOptions: function( options ) {
+ var that = this,
+ data = [];
+ options.each( function( index, item ) {
+ data.push( that._parseOption( $( item ), index ) );
+ } );
+ this.items = data;
+ },
+
+ _parseOption: function( option, index ) {
+ var optgroup = option.parent( "optgroup" );
+
+ return {
+ element: option,
+ index: index,
+ value: option.val(),
+ label: option.text(),
+ optgroup: optgroup.attr( "label" ) || "",
+ disabled: optgroup.prop( "disabled" ) || option.prop( "disabled" )
+ };
+ },
+
+ _destroy: function() {
+ this._unbindFormResetHandler();
+ this.menuWrap.remove();
+ this.button.remove();
+ this.element.show();
+ this.element.removeUniqueId();
+ this.labels.attr( "for", this.ids.element );
+ }
+} ] );
+
+
+/*!
+ * jQuery UI Slider 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Slider
+//>>group: Widgets
+//>>description: Displays a flexible slider with ranges and accessibility via keyboard.
+//>>docs: http://api.jqueryui.com/slider/
+//>>demos: http://jqueryui.com/slider/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/slider.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+var widgetsSlider = $.widget( "ui.slider", $.ui.mouse, {
+ version: "1.12.1",
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ classes: {
+ "ui-slider": "ui-corner-all",
+ "ui-slider-handle": "ui-corner-all",
+
+ // Note: ui-widget-header isn't the most fittingly semantic framework class for this
+ // element, but worked best visually with a variety of themes
+ "ui-slider-range": "ui-corner-all ui-widget-header"
+ },
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null,
+
+ // Callbacks
+ change: null,
+ slide: null,
+ start: null,
+ stop: null
+ },
+
+ // Number of pages in a slider
+ // (how many times can you page up/down to go through the whole range)
+ numPages: 5,
+
+ _create: function() {
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+ this._calculateNewMax();
+
+ this._addClass( "ui-slider ui-slider-" + this.orientation,
+ "ui-widget ui-widget-content" );
+
+ this._refresh();
+
+ this._animateOff = false;
+ },
+
+ _refresh: function() {
+ this._createRange();
+ this._createHandles();
+ this._setupEvents();
+ this._refreshValue();
+ },
+
+ _createHandles: function() {
+ var i, handleCount,
+ options = this.options,
+ existingHandles = this.element.find( ".ui-slider-handle" ),
+ handle = "<span tabindex='0'></span>",
+ handles = [];
+
+ handleCount = ( options.values && options.values.length ) || 1;
+
+ if ( existingHandles.length > handleCount ) {
+ existingHandles.slice( handleCount ).remove();
+ existingHandles = existingHandles.slice( 0, handleCount );
+ }
+
+ for ( i = existingHandles.length; i < handleCount; i++ ) {
+ handles.push( handle );
+ }
+
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) );
+
+ this._addClass( this.handles, "ui-slider-handle", "ui-state-default" );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.each( function( i ) {
+ $( this )
+ .data( "ui-slider-handle-index", i )
+ .attr( "tabIndex", 0 );
+ } );
+ },
+
+ _createRange: function() {
+ var options = this.options;
+
+ if ( options.range ) {
+ if ( options.range === true ) {
+ if ( !options.values ) {
+ options.values = [ this._valueMin(), this._valueMin() ];
+ } else if ( options.values.length && options.values.length !== 2 ) {
+ options.values = [ options.values[ 0 ], options.values[ 0 ] ];
+ } else if ( $.isArray( options.values ) ) {
+ options.values = options.values.slice( 0 );
}
}
+
+ if ( !this.range || !this.range.length ) {
+ this.range = $( "<div>" )
+ .appendTo( this.element );
+
+ this._addClass( this.range, "ui-slider-range" );
+ } else {
+ this._removeClass( this.range, "ui-slider-range-min ui-slider-range-max" );
+
+ // Handle range switching from true to min/max
+ this.range.css( {
+ "left": "",
+ "bottom": ""
+ } );
+ }
+ if ( options.range === "min" || options.range === "max" ) {
+ this._addClass( this.range, "ui-slider-range-" + options.range );
+ }
+ } else {
+ if ( this.range ) {
+ this.range.remove();
+ }
+ this.range = null;
+ }
+ },
+
+ _setupEvents: function() {
+ this._off( this.handles );
+ this._on( this.handles, this._handleEvents );
+ this._hoverable( this.handles );
+ this._focusable( this.handles );
+ },
+
+ _destroy: function() {
+ this.handles.remove();
+ if ( this.range ) {
+ this.range.remove();
+ }
+
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function( event ) {
+ var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+ that = this,
+ o = this.options;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ this.handles.each( function( i ) {
+ var thisDistance = Math.abs( normValue - that.values( i ) );
+ if ( ( distance > thisDistance ) ||
+ ( distance === thisDistance &&
+ ( i === that._lastChangedValue || that.values( i ) === o.min ) ) ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ } );
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ this._handleIndex = index;
+
+ this._addClass( closestHandle, null, "ui-state-active" );
+ closestHandle.trigger( "focus" );
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css( "borderTopWidth" ), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css( "borderBottomWidth" ), 10 ) || 0 ) +
+ ( parseInt( closestHandle.css( "marginTop" ), 10 ) || 0 )
+ };
+
+ if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+ this._slide( event, index, normValue );
+ }
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function() {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this._removeClass( this.handles, null, "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left -
+ ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top -
+ ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
}
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
},
- _stop: function( event, index ) {
+ _uiHash: function( index, value, values ) {
var uiHash = {
handle: this.handles[ index ],
- value: this.value()
+ handleIndex: index,
+ value: value !== undefined ? value : this.value()
};
- if ( this.options.values && this.options.values.length ) {
- uiHash.value = this.values( index );
- uiHash.values = this.values();
+
+ if ( this._hasMultipleValues() ) {
+ uiHash.value = value !== undefined ? value : this.values( index );
+ uiHash.values = values || this.values();
+ }
+
+ return uiHash;
+ },
+
+ _hasMultipleValues: function() {
+ return this.options.values && this.options.values.length;
+ },
+
+ _start: function( event, index ) {
+ return this._trigger( "start", event, this._uiHash( index ) );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var allowed, otherVal,
+ currentValue = this.value(),
+ newValues = this.values();
+
+ if ( this._hasMultipleValues() ) {
+ otherVal = this.values( index ? 0 : 1 );
+ currentValue = this.values( index );
+
+ if ( this.options.values.length === 2 && this.options.range === true ) {
+ newVal = index === 0 ? Math.min( otherVal, newVal ) : Math.max( otherVal, newVal );
+ }
+
+ newValues[ index ] = newVal;
+ }
+
+ if ( newVal === currentValue ) {
+ return;
+ }
+
+ allowed = this._trigger( "slide", event, this._uiHash( index, newVal, newValues ) );
+
+ // A slide can be canceled by returning false from the slide callback
+ if ( allowed === false ) {
+ return;
+ }
+
+ if ( this._hasMultipleValues() ) {
+ this.values( index, newVal );
+ } else {
+ this.value( newVal );
}
+ },
- this._trigger( "stop", event, uiHash );
+ _stop: function( event, index ) {
+ this._trigger( "stop", event, this._uiHash( index ) );
},
_change: function( event, index ) {
if ( !this._keySliding && !this._mouseSliding ) {
- var uiHash = {
- handle: this.handles[ index ],
- value: this.value()
- };
- if ( this.options.values && this.options.values.length ) {
- uiHash.value = this.values( index );
- uiHash.values = this.values();
- }
- this._trigger( "change", event, uiHash );
+ //store the last changed value index for reference when handles overlap
+ this._lastChangedValue = index;
+ this._trigger( "change", event, this._uiHash( index ) );
}
},
}
this._refreshValue();
} else {
- if ( this.options.values && this.options.values.length ) {
+ if ( this._hasMultipleValues() ) {
return this._values( index );
} else {
return this.value();
var i,
valsLength = 0;
+ if ( key === "range" && this.options.range === true ) {
+ if ( value === "min" ) {
+ this.options.value = this._values( 0 );
+ this.options.values = null;
+ } else if ( value === "max" ) {
+ this.options.value = this._values( this.options.values.length - 1 );
+ this.options.values = null;
+ }
+ }
+
if ( $.isArray( this.options.values ) ) {
valsLength = this.options.values.length;
}
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
switch ( key ) {
- case "disabled":
- if ( value ) {
- this.handles.filter( ".ui-state-focus" ).blur();
- this.handles.removeClass( "ui-state-hover" );
- this.handles.propAttr( "disabled", true );
- this.element.addClass( "ui-disabled" );
- } else {
- this.handles.propAttr( "disabled", false );
- this.element.removeClass( "ui-disabled" );
- }
- break;
case "orientation":
this._detectOrientation();
- this.element
- .removeClass( "ui-slider-horizontal ui-slider-vertical" )
- .addClass( "ui-slider-" + this.orientation );
+ this._removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ ._addClass( "ui-slider-" + this.orientation );
this._refreshValue();
+ if ( this.options.range ) {
+ this._refreshRange( value );
+ }
+
+ // Reset positioning from previous orientation
+ this.handles.css( value === "horizontal" ? "bottom" : "left", "" );
break;
case "value":
this._animateOff = true;
case "values":
this._animateOff = true;
this._refreshValue();
- for ( i = 0; i < valsLength; i += 1 ) {
+
+ // Start from the last handle to prevent unreachable handles (#9046)
+ for ( i = valsLength - 1; i >= 0; i-- ) {
this._change( null, i );
}
this._animateOff = false;
break;
+ case "step":
+ case "min":
+ case "max":
+ this._animateOff = true;
+ this._calculateNewMax();
+ this._refreshValue();
+ this._animateOff = false;
+ break;
+ case "range":
+ this._animateOff = true;
+ this._refresh();
+ this._animateOff = false;
+ break;
}
},
+ _setOptionDisabled: function( value ) {
+ this._super( value );
+
+ this._toggleClass( null, "ui-state-disabled", !!value );
+ },
+
//internal value getter
// _value() returns value trimmed by min and max, aligned by step
_value: function() {
val = this._trimAlignValue( val );
return val;
- } else {
+ } else if ( this._hasMultipleValues() ) {
+
// .slice() creates a copy of the array
// this copy gets trimmed by min and max and then returned
vals = this.options.values.slice();
- for ( i = 0; i < vals.length; i+= 1) {
+ for ( i = 0; i < vals.length; i += 1 ) {
vals[ i ] = this._trimAlignValue( vals[ i ] );
}
return vals;
+ } else {
+ return [];
+ }
+ },
+
+ // Returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val <= this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val >= this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = ( this.options.step > 0 ) ? this.options.step : 1,
+ valModStep = ( val - this._valueMin() ) % step,
+ alignValue = val - valModStep;
+
+ if ( Math.abs( valModStep ) * 2 >= step ) {
+ alignValue += ( valModStep > 0 ) ? step : ( -step );
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed( 5 ) );
+ },
+
+ _calculateNewMax: function() {
+ var max = this.options.max,
+ min = this._valueMin(),
+ step = this.options.step,
+ aboveMin = Math.round( ( max - min ) / step ) * step;
+ max = aboveMin + min;
+ if ( max > this.options.max ) {
+
+ //If max is not divisible by step, rounding off may increase its value
+ max -= step;
+ }
+ this.max = parseFloat( max.toFixed( this._precision() ) );
+ },
+
+ _precision: function() {
+ var precision = this._precisionOf( this.options.step );
+ if ( this.options.min !== null ) {
+ precision = Math.max( precision, this._precisionOf( this.options.min ) );
+ }
+ return precision;
+ },
+
+ _precisionOf: function( num ) {
+ var str = num.toString(),
+ decimal = str.indexOf( "." );
+ return decimal === -1 ? 0 : str.length - decimal - 1;
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.max;
+ },
+
+ _refreshRange: function( orientation ) {
+ if ( orientation === "vertical" ) {
+ this.range.css( { "width": "", "left": "" } );
+ }
+ if ( orientation === "horizontal" ) {
+ this.range.css( { "height": "", "bottom": "" } );
+ }
+ },
+
+ _refreshValue: function() {
+ var lastValPercent, valPercent, value, valueMin, valueMax,
+ oRange = this.options.range,
+ o = this.options,
+ that = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ _set = {};
+
+ if ( this._hasMultipleValues() ) {
+ this.handles.each( function( i ) {
+ valPercent = ( that.values( i ) - that._valueMin() ) / ( that._valueMax() -
+ that._valueMin() ) * 100;
+ _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( that.options.range === true ) {
+ if ( that.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ left: valPercent + "%"
+ }, o.animate );
+ }
+ if ( i === 1 ) {
+ that.range[ animate ? "animate" : "css" ]( {
+ width: ( valPercent - lastValPercent ) + "%"
+ }, {
+ queue: false,
+ duration: o.animate
+ } );
+ }
+ } else {
+ if ( i === 0 ) {
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ bottom: ( valPercent ) + "%"
+ }, o.animate );
+ }
+ if ( i === 1 ) {
+ that.range[ animate ? "animate" : "css" ]( {
+ height: ( valPercent - lastValPercent ) + "%"
+ }, {
+ queue: false,
+ duration: o.animate
+ } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ } );
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ width: valPercent + "%"
+ }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ width: ( 100 - valPercent ) + "%"
+ }, o.animate );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ height: valPercent + "%"
+ }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+ height: ( 100 - valPercent ) + "%"
+ }, o.animate );
+ }
+ }
+ },
+
+ _handleEvents: {
+ keydown: function( event ) {
+ var allowed, curVal, newVal, step,
+ index = $( event.target ).data( "ui-slider-handle-index" );
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ event.preventDefault();
+ if ( !this._keySliding ) {
+ this._keySliding = true;
+ this._addClass( $( event.target ), null, "ui-state-active" );
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = this.options.step;
+ if ( this._hasMultipleValues() ) {
+ curVal = newVal = this.values( index );
+ } else {
+ curVal = newVal = this.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = this._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = this._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = this._trimAlignValue(
+ curVal + ( ( this._valueMax() - this._valueMin() ) / this.numPages )
+ );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = this._trimAlignValue(
+ curVal - ( ( this._valueMax() - this._valueMin() ) / this.numPages ) );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === this._valueMax() ) {
+ return;
+ }
+ newVal = this._trimAlignValue( curVal + step );
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === this._valueMin() ) {
+ return;
+ }
+ newVal = this._trimAlignValue( curVal - step );
+ break;
+ }
+
+ this._slide( event, index, newVal );
+ },
+ keyup: function( event ) {
+ var index = $( event.target ).data( "ui-slider-handle-index" );
+
+ if ( this._keySliding ) {
+ this._keySliding = false;
+ this._stop( event, index );
+ this._change( event, index );
+ this._removeClass( $( event.target ), null, "ui-state-active" );
+ }
+ }
+ }
+} );
+
+
+/*!
+ * jQuery UI Sortable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Sortable
+//>>group: Interactions
+//>>description: Enables items in a list to be sorted using the mouse.
+//>>docs: http://api.jqueryui.com/sortable/
+//>>demos: http://jqueryui.com/sortable/
+//>>css.structure: ../../themes/base/sortable.css
+
+
+
+var widgetsSortable = $.widget( "ui.sortable", $.ui.mouse, {
+ version: "1.12.1",
+ widgetEventPrefix: "sort",
+ ready: false,
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: "> *",
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000,
+
+ // Callbacks
+ activate: null,
+ beforeStop: null,
+ change: null,
+ deactivate: null,
+ out: null,
+ over: null,
+ receive: null,
+ remove: null,
+ sort: null,
+ start: null,
+ stop: null,
+ update: null
+ },
+
+ _isOverAxis: function( x, reference, size ) {
+ return ( x >= reference ) && ( x < ( reference + size ) );
+ },
+
+ _isFloating: function( item ) {
+ return ( /left|right/ ).test( item.css( "float" ) ) ||
+ ( /inline|table-cell/ ).test( item.css( "display" ) );
+ },
+
+ _create: function() {
+ this.containerCache = {};
+ this._addClass( "ui-sortable" );
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ this._setHandleClassName();
+
+ //We're ready to go
+ this.ready = true;
+
+ },
+
+ _setOption: function( key, value ) {
+ this._super( key, value );
+
+ if ( key === "handle" ) {
+ this._setHandleClassName();
+ }
+ },
+
+ _setHandleClassName: function() {
+ var that = this;
+ this._removeClass( this.element.find( ".ui-sortable-handle" ), "ui-sortable-handle" );
+ $.each( this.items, function() {
+ that._addClass(
+ this.instance.options.handle ?
+ this.item.find( this.instance.options.handle ) :
+ this.item,
+ "ui-sortable-handle"
+ );
+ } );
+ },
+
+ _destroy: function() {
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- ) {
+ this.items[ i ].item.removeData( this.widgetName + "-item" );
+ }
+
+ return this;
+ },
+
+ _mouseCapture: function( event, overrideHandle ) {
+ var currentItem = null,
+ validHandle = false,
+ that = this;
+
+ if ( this.reverting ) {
+ return false;
+ }
+
+ if ( this.options.disabled || this.options.type === "static" ) {
+ return false;
+ }
+
+ //We have to refresh the items data once first
+ this._refreshItems( event );
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ $( event.target ).parents().each( function() {
+ if ( $.data( this, that.widgetName + "-item" ) === that ) {
+ currentItem = $( this );
+ return false;
+ }
+ } );
+ if ( $.data( event.target, that.widgetName + "-item" ) === that ) {
+ currentItem = $( event.target );
}
- },
-
- // returns the step-aligned value that val is closest to, between (inclusive) min and max
- _trimAlignValue: function( val ) {
- if ( val <= this._valueMin() ) {
- return this._valueMin();
+
+ if ( !currentItem ) {
+ return false;
}
- if ( val >= this._valueMax() ) {
- return this._valueMax();
+ if ( this.options.handle && !overrideHandle ) {
+ $( this.options.handle, currentItem ).find( "*" ).addBack().each( function() {
+ if ( this === event.target ) {
+ validHandle = true;
+ }
+ } );
+ if ( !validHandle ) {
+ return false;
+ }
}
- var step = ( this.options.step > 0 ) ? this.options.step : 1,
- valModStep = (val - this._valueMin()) % step,
- alignValue = val - valModStep;
- if ( Math.abs(valModStep) * 2 >= step ) {
- alignValue += ( valModStep > 0 ) ? step : ( -step );
- }
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
- // Since JavaScript has problems with large floats, round
- // the final value to 5 digits after the decimal point (see #4124)
- return parseFloat( alignValue.toFixed(5) );
},
- _valueMin: function() {
- return this.options.min;
- },
+ _mouseStart: function( event, overrideHandle, noActivation ) {
- _valueMax: function() {
- return this.options.max;
- },
-
- _refreshValue: function() {
- var oRange = this.options.range,
- o = this.options,
- self = this,
- animate = ( !this._animateOff ) ? o.animate : false,
- valPercent,
- _set = {},
- lastValPercent,
- value,
- valueMin,
- valueMax;
-
- if ( this.options.values && this.options.values.length ) {
- this.handles.each(function( i, j ) {
- valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
- _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
- $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
- if ( self.options.range === true ) {
- if ( self.orientation === "horizontal" ) {
- if ( i === 0 ) {
- self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
- }
- if ( i === 1 ) {
- self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
- }
- } else {
- if ( i === 0 ) {
- self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
- }
- if ( i === 1 ) {
- self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
- }
- }
- }
- lastValPercent = valPercent;
- });
- } else {
- value = this.value();
- valueMin = this._valueMin();
- valueMax = this._valueMax();
- valPercent = ( valueMax !== valueMin ) ?
- ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
- 0;
- _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
- this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ var i, body,
+ o = this.options;
- if ( oRange === "min" && this.orientation === "horizontal" ) {
- this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
- }
- if ( oRange === "max" && this.orientation === "horizontal" ) {
- this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
- }
- if ( oRange === "min" && this.orientation === "vertical" ) {
- this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
- }
- if ( oRange === "max" && this.orientation === "vertical" ) {
- this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
- }
- }
- }
+ this.currentContainer = this;
-});
+ //We only need to call refreshPositions, because the refreshItems call has been moved to
+ // mouseCapture
+ this.refreshPositions();
-$.extend( $.ui.slider, {
- version: "1.8.21"
-});
+ //Create and append the visible helper
+ this.helper = this._createHelper( event );
-}(jQuery));
-/*!
- * jQuery UI Tabs 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
+ //Cache the helper size
+ this._cacheHelperProportions();
-var tabId = 0,
- listId = 0;
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
-function getNextTabId() {
- return ++tabId;
-}
+ //Cache the margins of the original element
+ this._cacheMargins();
-function getNextListId() {
- return ++listId;
-}
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
-$.widget( "ui.tabs", {
- options: {
- add: null,
- ajaxOptions: null,
- cache: false,
- cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
- collapsible: false,
- disable: null,
- disabled: [],
- enable: null,
- event: "click",
- fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
- idPrefix: "ui-tabs-",
- load: null,
- panelTemplate: "<div></div>",
- remove: null,
- select: null,
- show: null,
- spinner: "<em>Loading…</em>",
- tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
- },
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
- _create: function() {
- this._tabify( true );
- },
+ $.extend( this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
- _setOption: function( key, value ) {
- if ( key == "selected" ) {
- if (this.options.collapsible && value == this.options.selected ) {
- return;
- }
- this.select( value );
- } else {
- this.options[ key ] = value;
- this._tabify();
- }
- },
+ // This is a relative to absolute position minus the actual position calculation -
+ // only used for relative positioned helper
+ relative: this._getRelativeOffset()
+ } );
- _tabId: function( a ) {
- return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
- this.options.idPrefix + getNextTabId();
- },
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css( "position", "absolute" );
+ this.cssPosition = this.helper.css( "position" );
- _sanitizeSelector: function( hash ) {
- // we need this because an id may contain a ":"
- return hash.replace( /:/g, "\\:" );
- },
+ //Generate the original position
+ this.originalPosition = this._generatePosition( event );
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
- _cookie: function() {
- var cookie = this.cookie ||
- ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
- return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
- },
+ //Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+ ( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
- _ui: function( tab, panel ) {
- return {
- tab: tab,
- panel: panel,
- index: this.anchors.index( tab )
+ //Cache the former DOM position
+ this.domPosition = {
+ prev: this.currentItem.prev()[ 0 ],
+ parent: this.currentItem.parent()[ 0 ]
};
- },
- _cleanup: function() {
- // restore all former loading tabs labels
- this.lis.filter( ".ui-state-processing" )
- .removeClass( "ui-state-processing" )
- .find( "span:data(label.tabs)" )
- .each(function() {
- var el = $( this );
- el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
- });
- },
+ // If the helper is not the original, hide the original so it's not playing any role during
+ // the drag, won't cause anything bad this way
+ if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+ this.currentItem.hide();
+ }
- _tabify: function( init ) {
- var self = this,
- o = this.options,
- fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ //Create the placeholder
+ this._createPlaceholder();
- this.list = this.element.find( "ol,ul" ).eq( 0 );
- this.lis = $( " > li:has(a[href])", this.list );
- this.anchors = this.lis.map(function() {
- return $( "a", this )[ 0 ];
- });
- this.panels = $( [] );
-
- this.anchors.each(function( i, a ) {
- var href = $( a ).attr( "href" );
- // For dynamically created HTML that contains a hash as href IE < 8 expands
- // such href to the full page url with hash and then misinterprets tab as ajax.
- // Same consideration applies for an added tab with a fragment identifier
- // since a[href=#fragment-identifier] does unexpectedly not match.
- // Thus normalize href attribute...
- var hrefBase = href.split( "#" )[ 0 ],
- baseEl;
- if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
- ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
- href = a.hash;
- a.href = href;
- }
-
- // inline tab
- if ( fragmentId.test( href ) ) {
- self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
- // remote tab
- // prevent loading the page itself if href is just "#"
- } else if ( href && href !== "#" ) {
- // required for restore on destroy
- $.data( a, "href.tabs", href );
-
- // TODO until #3808 is fixed strip fragment identifier from url
- // (IE fails to load from such url)
- $.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
-
- var id = self._tabId( a );
- a.href = "#" + id;
- var $panel = self.element.find( "#" + id );
- if ( !$panel.length ) {
- $panel = $( o.panelTemplate )
- .attr( "id", id )
- .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
- .insertAfter( self.panels[ i - 1 ] || self.list );
- $panel.data( "destroy.tabs", true );
- }
- self.panels = self.panels.add( $panel );
- // invalid tab href
- } else {
- o.disabled.push( i );
- }
- });
-
- // initialization from scratch
- if ( init ) {
- // attach necessary classes for styling
- this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
- this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
- this.lis.addClass( "ui-state-default ui-corner-top" );
- this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
-
- // Selected tab
- // use "selected" option or try to retrieve:
- // 1. from fragment identifier in url
- // 2. from cookie
- // 3. from selected class attribute on <li>
- if ( o.selected === undefined ) {
- if ( location.hash ) {
- this.anchors.each(function( i, a ) {
- if ( a.hash == location.hash ) {
- o.selected = i;
- return false;
- }
- });
- }
- if ( typeof o.selected !== "number" && o.cookie ) {
- o.selected = parseInt( self._cookie(), 10 );
- }
- if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
- o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
- }
- o.selected = o.selected || ( this.lis.length ? 0 : -1 );
- } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
- o.selected = -1;
- }
+ //Set a containment if given in the options
+ if ( o.containment ) {
+ this._setContainment();
+ }
- // sanity check - default to first tab...
- o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
- ? o.selected
- : 0;
+ if ( o.cursor && o.cursor !== "auto" ) { // cursor option
+ body = this.document.find( "body" );
- // Take disabling tabs via class attribute from HTML
- // into account and update option properly.
- // A selected tab cannot become disabled.
- o.disabled = $.unique( o.disabled.concat(
- $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
- return self.lis.index( n );
- })
- ) ).sort();
+ // Support: IE
+ this.storedCursor = body.css( "cursor" );
+ body.css( "cursor", o.cursor );
+
+ this.storedStylesheet =
+ $( "<style>*{ cursor: " + o.cursor + " !important; }</style>" ).appendTo( body );
+ }
- if ( $.inArray( o.selected, o.disabled ) != -1 ) {
- o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+ if ( o.opacity ) { // opacity option
+ if ( this.helper.css( "opacity" ) ) {
+ this._storedOpacity = this.helper.css( "opacity" );
}
+ this.helper.css( "opacity", o.opacity );
+ }
- // highlight selected tab
- this.panels.addClass( "ui-tabs-hide" );
- this.lis.removeClass( "ui-tabs-selected ui-state-active" );
- // check for length avoids error when initializing empty list
- if ( o.selected >= 0 && this.anchors.length ) {
- self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
- this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+ if ( o.zIndex ) { // zIndex option
+ if ( this.helper.css( "zIndex" ) ) {
+ this._storedZIndex = this.helper.css( "zIndex" );
+ }
+ this.helper.css( "zIndex", o.zIndex );
+ }
- // seems to be expected behavior that the show callback is fired
- self.element.queue( "tabs", function() {
- self._trigger( "show", null,
- self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
- });
+ //Prepare scrolling
+ if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ this.scrollParent[ 0 ].tagName !== "HTML" ) {
+ this.overflowOffset = this.scrollParent.offset();
+ }
- this.load( o.selected );
- }
+ //Call callbacks
+ this._trigger( "start", event, this._uiHash() );
- // clean up to avoid memory leaks in certain versions of IE 6
- // TODO: namespace this event
- $( window ).bind( "unload", function() {
- self.lis.add( self.anchors ).unbind( ".tabs" );
- self.lis = self.anchors = self.panels = null;
- });
- // update selected after add/remove
- } else {
- o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ //Recache the helper size
+ if ( !this._preserveHelperProportions ) {
+ this._cacheHelperProportions();
}
- // update collapsible
- // TODO: use .toggleClass()
- this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+ //Post "activate" events to possible containers
+ if ( !noActivation ) {
+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
+ this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) );
+ }
+ }
- // set or update cookie after init and add/remove respectively
- if ( o.cookie ) {
- this._cookie( o.selected, o.cookie );
+ //Prepare possible droppables
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.current = this;
}
- // disable tabs
- for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
- $( li )[ $.inArray( i, o.disabled ) != -1 &&
- // TODO: use .toggleClass()
- !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+ if ( $.ui.ddmanager && !o.dropBehaviour ) {
+ $.ui.ddmanager.prepareOffsets( this, event );
}
- // reset cache if switching from cached to not cached
- if ( o.cache === false ) {
- this.anchors.removeData( "cache.tabs" );
+ this.dragging = true;
+
+ this._addClass( this.helper, "ui-sortable-helper" );
+
+ // Execute the drag once - this causes the helper not to be visiblebefore getting its
+ // correct position
+ this._mouseDrag( event );
+ return true;
+
+ },
+
+ _mouseDrag: function( event ) {
+ var i, item, itemElement, intersection,
+ o = this.options,
+ scrolled = false;
+
+ //Compute the helpers position
+ this.position = this._generatePosition( event );
+ this.positionAbs = this._convertPositionTo( "absolute" );
+
+ if ( !this.lastPositionAbs ) {
+ this.lastPositionAbs = this.positionAbs;
}
- // remove all handlers before, tabify may run on existing tabs after add or option change
- this.lis.add( this.anchors ).unbind( ".tabs" );
+ //Do scrolling
+ if ( this.options.scroll ) {
+ if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ this.scrollParent[ 0 ].tagName !== "HTML" ) {
+
+ if ( ( this.overflowOffset.top + this.scrollParent[ 0 ].offsetHeight ) -
+ event.pageY < o.scrollSensitivity ) {
+ this.scrollParent[ 0 ].scrollTop =
+ scrolled = this.scrollParent[ 0 ].scrollTop + o.scrollSpeed;
+ } else if ( event.pageY - this.overflowOffset.top < o.scrollSensitivity ) {
+ this.scrollParent[ 0 ].scrollTop =
+ scrolled = this.scrollParent[ 0 ].scrollTop - o.scrollSpeed;
+ }
- if ( o.event !== "mouseover" ) {
- var addState = function( state, el ) {
- if ( el.is( ":not(.ui-state-disabled)" ) ) {
- el.addClass( "ui-state-" + state );
+ if ( ( this.overflowOffset.left + this.scrollParent[ 0 ].offsetWidth ) -
+ event.pageX < o.scrollSensitivity ) {
+ this.scrollParent[ 0 ].scrollLeft = scrolled =
+ this.scrollParent[ 0 ].scrollLeft + o.scrollSpeed;
+ } else if ( event.pageX - this.overflowOffset.left < o.scrollSensitivity ) {
+ this.scrollParent[ 0 ].scrollLeft = scrolled =
+ this.scrollParent[ 0 ].scrollLeft - o.scrollSpeed;
}
- };
- var removeState = function( state, el ) {
- el.removeClass( "ui-state-" + state );
- };
- this.lis.bind( "mouseover.tabs" , function() {
- addState( "hover", $( this ) );
- });
- this.lis.bind( "mouseout.tabs", function() {
- removeState( "hover", $( this ) );
- });
- this.anchors.bind( "focus.tabs", function() {
- addState( "focus", $( this ).closest( "li" ) );
- });
- this.anchors.bind( "blur.tabs", function() {
- removeState( "focus", $( this ).closest( "li" ) );
- });
- }
-
- // set up animations
- var hideFx, showFx;
- if ( o.fx ) {
- if ( $.isArray( o.fx ) ) {
- hideFx = o.fx[ 0 ];
- showFx = o.fx[ 1 ];
+
} else {
- hideFx = showFx = o.fx;
+
+ if ( event.pageY - this.document.scrollTop() < o.scrollSensitivity ) {
+ scrolled = this.document.scrollTop( this.document.scrollTop() - o.scrollSpeed );
+ } else if ( this.window.height() - ( event.pageY - this.document.scrollTop() ) <
+ o.scrollSensitivity ) {
+ scrolled = this.document.scrollTop( this.document.scrollTop() + o.scrollSpeed );
+ }
+
+ if ( event.pageX - this.document.scrollLeft() < o.scrollSensitivity ) {
+ scrolled = this.document.scrollLeft(
+ this.document.scrollLeft() - o.scrollSpeed
+ );
+ } else if ( this.window.width() - ( event.pageX - this.document.scrollLeft() ) <
+ o.scrollSensitivity ) {
+ scrolled = this.document.scrollLeft(
+ this.document.scrollLeft() + o.scrollSpeed
+ );
+ }
+
}
- }
- // Reset certain styles left over from animation
- // and prevent IE's ClearType bug...
- function resetStyle( $el, fx ) {
- $el.css( "display", "" );
- if ( !$.support.opacity && fx.opacity ) {
- $el[ 0 ].style.removeAttribute( "filter" );
+ if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+ $.ui.ddmanager.prepareOffsets( this, event );
}
}
- // Show a tab...
- var showTab = showFx
- ? function( clicked, $show ) {
- $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
- $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
- .animate( showFx, showFx.duration || "normal", function() {
- resetStyle( $show, showFx );
- self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
- });
- }
- : function( clicked, $show ) {
- $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
- $show.removeClass( "ui-tabs-hide" );
- self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
- };
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo( "absolute" );
- // Hide a tab, $show is optional...
- var hideTab = hideFx
- ? function( clicked, $hide ) {
- $hide.animate( hideFx, hideFx.duration || "normal", function() {
- self.lis.removeClass( "ui-tabs-selected ui-state-active" );
- $hide.addClass( "ui-tabs-hide" );
- resetStyle( $hide, hideFx );
- self.element.dequeue( "tabs" );
- });
- }
- : function( clicked, $hide, $show ) {
- self.lis.removeClass( "ui-tabs-selected ui-state-active" );
- $hide.addClass( "ui-tabs-hide" );
- self.element.dequeue( "tabs" );
- };
+ //Set the helper position
+ if ( !this.options.axis || this.options.axis !== "y" ) {
+ this.helper[ 0 ].style.left = this.position.left + "px";
+ }
+ if ( !this.options.axis || this.options.axis !== "x" ) {
+ this.helper[ 0 ].style.top = this.position.top + "px";
+ }
- // attach tab event handler, unbind to avoid duplicates from former tabifying...
- this.anchors.bind( o.event + ".tabs", function() {
- var el = this,
- $li = $(el).closest( "li" ),
- $hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
- $show = self.element.find( self._sanitizeSelector( el.hash ) );
-
- // If tab is already selected and not collapsible or tab disabled or
- // or is already loading or click callback returns false stop here.
- // Check if click handler returns false last so that it is not executed
- // for a disabled or loading tab!
- if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
- $li.hasClass( "ui-state-disabled" ) ||
- $li.hasClass( "ui-state-processing" ) ||
- self.panels.filter( ":animated" ).length ||
- self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
- this.blur();
- return false;
+ //Rearrange
+ for ( i = this.items.length - 1; i >= 0; i-- ) {
+
+ //Cache variables and intersection, continue if no intersection
+ item = this.items[ i ];
+ itemElement = item.item[ 0 ];
+ intersection = this._intersectsWithPointer( item );
+ if ( !intersection ) {
+ continue;
}
- o.selected = self.anchors.index( this );
+ // Only put the placeholder inside the current Container, skip all
+ // items from other containers. This works because when moving
+ // an item from one container to another the
+ // currentContainer is switched before the placeholder is moved.
+ //
+ // Without this, moving items in "sub-sortables" can cause
+ // the placeholder to jitter between the outer and inner container.
+ if ( item.instance !== this.currentContainer ) {
+ continue;
+ }
- self.abort();
+ // Cannot intersect with itself
+ // no useless actions that have been done before
+ // no action if the item moved is the parent of the item checked
+ if ( itemElement !== this.currentItem[ 0 ] &&
+ this.placeholder[ intersection === 1 ? "next" : "prev" ]()[ 0 ] !== itemElement &&
+ !$.contains( this.placeholder[ 0 ], itemElement ) &&
+ ( this.options.type === "semi-dynamic" ?
+ !$.contains( this.element[ 0 ], itemElement ) :
+ true
+ )
+ ) {
- // if tab may be closed
- if ( o.collapsible ) {
- if ( $li.hasClass( "ui-tabs-selected" ) ) {
- o.selected = -1;
+ this.direction = intersection === 1 ? "down" : "up";
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
- }
+ if ( this.options.tolerance === "pointer" || this._intersectsWithSides( item ) ) {
+ this._rearrange( event, item );
+ } else {
+ break;
+ }
- self.element.queue( "tabs", function() {
- hideTab( el, $hide );
- }).dequeue( "tabs" );
+ this._trigger( "change", event, this._uiHash() );
+ break;
+ }
+ }
- this.blur();
- return false;
- } else if ( !$hide.length ) {
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
- }
+ //Post events to containers
+ this._contactContainers( event );
+
+ //Interconnect with droppables
+ if ( $.ui.ddmanager ) {
+ $.ui.ddmanager.drag( this, event );
+ }
- self.element.queue( "tabs", function() {
- showTab( el, $show );
- });
+ //Call callbacks
+ this._trigger( "sort", event, this._uiHash() );
- // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
- self.load( self.anchors.index( this ) );
+ this.lastPositionAbs = this.positionAbs;
+ return false;
- this.blur();
- return false;
- }
- }
+ },
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
- }
+ _mouseStop: function( event, noPropagation ) {
+
+ if ( !event ) {
+ return;
+ }
- // show new tab
- if ( $show.length ) {
- if ( $hide.length ) {
- self.element.queue( "tabs", function() {
- hideTab( el, $hide );
- });
+ //If we are using droppables, inform the manager about the drop
+ if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+ $.ui.ddmanager.drop( this, event );
+ }
+
+ if ( this.options.revert ) {
+ var that = this,
+ cur = this.placeholder.offset(),
+ axis = this.options.axis,
+ animation = {};
+
+ if ( !axis || axis === "x" ) {
+ animation.left = cur.left - this.offset.parent.left - this.margins.left +
+ ( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+ 0 :
+ this.offsetParent[ 0 ].scrollLeft
+ );
+ }
+ if ( !axis || axis === "y" ) {
+ animation.top = cur.top - this.offset.parent.top - this.margins.top +
+ ( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+ 0 :
+ this.offsetParent[ 0 ].scrollTop
+ );
+ }
+ this.reverting = true;
+ $( this.helper ).animate(
+ animation,
+ parseInt( this.options.revert, 10 ) || 500,
+ function() {
+ that._clear( event );
}
- self.element.queue( "tabs", function() {
- showTab( el, $show );
- });
+ );
+ } else {
+ this._clear( event, noPropagation );
+ }
+
+ return false;
+
+ },
- self.load( self.anchors.index( this ) );
+ cancel: function() {
+
+ if ( this.dragging ) {
+
+ this._mouseUp( new $.Event( "mouseup", { target: null } ) );
+
+ if ( this.options.helper === "original" ) {
+ this.currentItem.css( this._storedCSS );
+ this._removeClass( this.currentItem, "ui-sortable-helper" );
} else {
- throw "jQuery UI Tabs: Mismatching fragment identifier.";
+ this.currentItem.show();
}
- // Prevent IE from keeping other link focussed when using the back button
- // and remove dotted border from clicked link. This is controlled via CSS
- // in modern browsers; blur() removes focus from address bar in Firefox
- // which can become a usability and annoying problem with tabs('rotate').
- if ( $.browser.msie ) {
- this.blur();
+ //Post deactivating events to containers
+ for ( var i = this.containers.length - 1; i >= 0; i-- ) {
+ this.containers[ i ]._trigger( "deactivate", null, this._uiHash( this ) );
+ if ( this.containers[ i ].containerCache.over ) {
+ this.containers[ i ]._trigger( "out", null, this._uiHash( this ) );
+ this.containers[ i ].containerCache.over = 0;
+ }
}
- });
-
- // disable click in any case
- this.anchors.bind( "click.tabs", function(){
- return false;
- });
- },
- _getIndex: function( index ) {
- // meta-function to give users option to provide a href string instead of a numerical index.
- // also sanitizes numerical indexes to valid values.
- if ( typeof index == "string" ) {
- index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) );
}
- return index;
- },
+ if ( this.placeholder ) {
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+ // it unbinds ALL events from the original node!
+ if ( this.placeholder[ 0 ].parentNode ) {
+ this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+ }
+ if ( this.options.helper !== "original" && this.helper &&
+ this.helper[ 0 ].parentNode ) {
+ this.helper.remove();
+ }
+
+ $.extend( this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ } );
+
+ if ( this.domPosition.prev ) {
+ $( this.domPosition.prev ).after( this.currentItem );
+ } else {
+ $( this.domPosition.parent ).prepend( this.currentItem );
+ }
+ }
- destroy: function() {
- var o = this.options;
+ return this;
- this.abort();
+ },
- this.element
- .unbind( ".tabs" )
- .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
- .removeData( "tabs" );
+ serialize: function( o ) {
- this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+ var items = this._getItemsAsjQuery( o && o.connected ),
+ str = [];
+ o = o || {};
- this.anchors.each(function() {
- var href = $.data( this, "href.tabs" );
- if ( href ) {
- this.href = href;
+ $( items ).each( function() {
+ var res = ( $( o.item || this ).attr( o.attribute || "id" ) || "" )
+ .match( o.expression || ( /(.+)[\-=_](.+)/ ) );
+ if ( res ) {
+ str.push(
+ ( o.key || res[ 1 ] + "[]" ) +
+ "=" + ( o.key && o.expression ? res[ 1 ] : res[ 2 ] ) );
}
- var $this = $( this ).unbind( ".tabs" );
- $.each( [ "href", "load", "cache" ], function( i, prefix ) {
- $this.removeData( prefix + ".tabs" );
- });
- });
+ } );
- this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
- if ( $.data( this, "destroy.tabs" ) ) {
- $( this ).remove();
- } else {
- $( this ).removeClass([
- "ui-state-default",
- "ui-corner-top",
- "ui-tabs-selected",
- "ui-state-active",
- "ui-state-hover",
- "ui-state-focus",
- "ui-state-disabled",
- "ui-tabs-panel",
- "ui-widget-content",
- "ui-corner-bottom",
- "ui-tabs-hide"
- ].join( " " ) );
- }
- });
-
- if ( o.cookie ) {
- this._cookie( null, o.cookie );
+ if ( !str.length && o.key ) {
+ str.push( o.key + "=" );
}
- return this;
+ return str.join( "&" );
+
},
- add: function( url, label, index ) {
- if ( index === undefined ) {
- index = this.anchors.length;
- }
+ toArray: function( o ) {
- var self = this,
- o = this.options,
- $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
- id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+ var items = this._getItemsAsjQuery( o && o.connected ),
+ ret = [];
- $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+ o = o || {};
- // try to find an existing element before creating a new one
- var $panel = self.element.find( "#" + id );
- if ( !$panel.length ) {
- $panel = $( o.panelTemplate )
- .attr( "id", id )
- .data( "destroy.tabs", true );
- }
- $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+ items.each( function() {
+ ret.push( $( o.item || this ).attr( o.attribute || "id" ) || "" );
+ } );
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function( item ) {
- if ( index >= this.lis.length ) {
- $li.appendTo( this.list );
- $panel.appendTo( this.list[ 0 ].parentNode );
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height,
+ l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height,
+ dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left,
+ isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t &&
+ ( y1 + dyClick ) < b ),
+ isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l &&
+ ( x1 + dxClick ) < r ),
+ isOverElement = isOverElementHeight && isOverElementWidth;
+
+ if ( this.options.tolerance === "pointer" ||
+ this.options.forcePointerForContainers ||
+ ( this.options.tolerance !== "pointer" &&
+ this.helperProportions[ this.floating ? "width" : "height" ] >
+ item[ this.floating ? "width" : "height" ] )
+ ) {
+ return isOverElement;
} else {
- $li.insertBefore( this.lis[ index ] );
- $panel.insertBefore( this.panels[ index ] );
- }
- o.disabled = $.map( o.disabled, function( n, i ) {
- return n >= index ? ++n : n;
- });
+ return ( l < x1 + ( this.helperProportions.width / 2 ) && // Right Half
+ x2 - ( this.helperProportions.width / 2 ) < r && // Left Half
+ t < y1 + ( this.helperProportions.height / 2 ) && // Bottom Half
+ y2 - ( this.helperProportions.height / 2 ) < b ); // Top Half
- this._tabify();
+ }
+ },
- if ( this.anchors.length == 1 ) {
- o.selected = 0;
- $li.addClass( "ui-tabs-selected ui-state-active" );
- $panel.removeClass( "ui-tabs-hide" );
- this.element.queue( "tabs", function() {
- self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
- });
+ _intersectsWithPointer: function( item ) {
+ var verticalDirection, horizontalDirection,
+ isOverElementHeight = ( this.options.axis === "x" ) ||
+ this._isOverAxis(
+ this.positionAbs.top + this.offset.click.top, item.top, item.height ),
+ isOverElementWidth = ( this.options.axis === "y" ) ||
+ this._isOverAxis(
+ this.positionAbs.left + this.offset.click.left, item.left, item.width ),
+ isOverElement = isOverElementHeight && isOverElementWidth;
- this.load( 0 );
+ if ( !isOverElement ) {
+ return false;
}
- this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
- return this;
+ verticalDirection = this._getDragVerticalDirection();
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ return this.floating ?
+ ( ( horizontalDirection === "right" || verticalDirection === "down" ) ? 2 : 1 )
+ : ( verticalDirection && ( verticalDirection === "down" ? 2 : 1 ) );
+
},
- remove: function( index ) {
- index = this._getIndex( index );
- var o = this.options,
- $li = this.lis.eq( index ).remove(),
- $panel = this.panels.eq( index ).remove();
+ _intersectsWithSides: function( item ) {
- // If selected tab was removed focus tab to the right or
- // in case the last tab was removed the tab to the left.
- if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
- this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+ var isOverBottomHalf = this._isOverAxis( this.positionAbs.top +
+ this.offset.click.top, item.top + ( item.height / 2 ), item.height ),
+ isOverRightHalf = this._isOverAxis( this.positionAbs.left +
+ this.offset.click.left, item.left + ( item.width / 2 ), item.width ),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if ( this.floating && horizontalDirection ) {
+ return ( ( horizontalDirection === "right" && isOverRightHalf ) ||
+ ( horizontalDirection === "left" && !isOverRightHalf ) );
+ } else {
+ return verticalDirection && ( ( verticalDirection === "down" && isOverBottomHalf ) ||
+ ( verticalDirection === "up" && !isOverBottomHalf ) );
}
- o.disabled = $.map(
- $.grep( o.disabled, function(n, i) {
- return n != index;
- }),
- function( n, i ) {
- return n >= index ? --n : n;
- });
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta !== 0 && ( delta > 0 ? "down" : "up" );
+ },
- this._tabify();
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta !== 0 && ( delta > 0 ? "right" : "left" );
+ },
- this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
+ refresh: function( event ) {
+ this._refreshItems( event );
+ this._setHandleClassName();
+ this.refreshPositions();
return this;
},
- enable: function( index ) {
- index = this._getIndex( index );
- var o = this.options;
- if ( $.inArray( index, o.disabled ) == -1 ) {
- return;
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor === String ?
+ [ options.connectWith ] :
+ options.connectWith;
+ },
+
+ _getItemsAsjQuery: function( connected ) {
+
+ var i, j, cur, inst,
+ items = [],
+ queries = [],
+ connectWith = this._connectWith();
+
+ if ( connectWith && connected ) {
+ for ( i = connectWith.length - 1; i >= 0; i-- ) {
+ cur = $( connectWith[ i ], this.document[ 0 ] );
+ for ( j = cur.length - 1; j >= 0; j-- ) {
+ inst = $.data( cur[ j ], this.widgetFullName );
+ if ( inst && inst !== this && !inst.options.disabled ) {
+ queries.push( [ $.isFunction( inst.options.items ) ?
+ inst.options.items.call( inst.element ) :
+ $( inst.options.items, inst.element )
+ .not( ".ui-sortable-helper" )
+ .not( ".ui-sortable-placeholder" ), inst ] );
+ }
+ }
+ }
}
- this.lis.eq( index ).removeClass( "ui-state-disabled" );
- o.disabled = $.grep( o.disabled, function( n, i ) {
- return n != index;
- });
+ queries.push( [ $.isFunction( this.options.items ) ?
+ this.options.items
+ .call( this.element, null, { options: this.options, item: this.currentItem } ) :
+ $( this.options.items, this.element )
+ .not( ".ui-sortable-helper" )
+ .not( ".ui-sortable-placeholder" ), this ] );
+
+ function addItems() {
+ items.push( this );
+ }
+ for ( i = queries.length - 1; i >= 0; i-- ) {
+ queries[ i ][ 0 ].each( addItems );
+ }
+
+ return $( items );
- this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
- return this;
},
- disable: function( index ) {
- index = this._getIndex( index );
- var self = this, o = this.options;
- // cannot disable already selected tab
- if ( index != o.selected ) {
- this.lis.eq( index ).addClass( "ui-state-disabled" );
+ _removeCurrentsFromItems: function() {
- o.disabled.push( index );
- o.disabled.sort();
+ var list = this.currentItem.find( ":data(" + this.widgetName + "-item)" );
- this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
- }
+ this.items = $.grep( this.items, function( item ) {
+ for ( var j = 0; j < list.length; j++ ) {
+ if ( list[ j ] === item.item[ 0 ] ) {
+ return false;
+ }
+ }
+ return true;
+ } );
- return this;
},
- select: function( index ) {
- index = this._getIndex( index );
- if ( index == -1 ) {
- if ( this.options.collapsible && this.options.selected != -1 ) {
- index = this.options.selected;
- } else {
- return this;
+ _refreshItems: function( event ) {
+
+ this.items = [];
+ this.containers = [ this ];
+
+ var i, j, cur, inst, targetData, _queries, item, queriesLength,
+ items = this.items,
+ queries = [ [ $.isFunction( this.options.items ) ?
+ this.options.items.call( this.element[ 0 ], event, { item: this.currentItem } ) :
+ $( this.options.items, this.element ), this ] ],
+ connectWith = this._connectWith();
+
+ //Shouldn't be run the first time through due to massive slow-down
+ if ( connectWith && this.ready ) {
+ for ( i = connectWith.length - 1; i >= 0; i-- ) {
+ cur = $( connectWith[ i ], this.document[ 0 ] );
+ for ( j = cur.length - 1; j >= 0; j-- ) {
+ inst = $.data( cur[ j ], this.widgetFullName );
+ if ( inst && inst !== this && !inst.options.disabled ) {
+ queries.push( [ $.isFunction( inst.options.items ) ?
+ inst.options.items
+ .call( inst.element[ 0 ], event, { item: this.currentItem } ) :
+ $( inst.options.items, inst.element ), inst ] );
+ this.containers.push( inst );
+ }
+ }
}
}
- this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
- return this;
- },
- load: function( index ) {
- index = this._getIndex( index );
- var self = this,
- o = this.options,
- a = this.anchors.eq( index )[ 0 ],
- url = $.data( a, "load.tabs" );
+ for ( i = queries.length - 1; i >= 0; i-- ) {
+ targetData = queries[ i ][ 1 ];
+ _queries = queries[ i ][ 0 ];
- this.abort();
+ for ( j = 0, queriesLength = _queries.length; j < queriesLength; j++ ) {
+ item = $( _queries[ j ] );
- // not remote or from cache
- if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
- this.element.dequeue( "tabs" );
- return;
+ // Data for target checking (mouse manager)
+ item.data( this.widgetName + "-item", targetData );
+
+ items.push( {
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ } );
+ }
}
- // load remote from here on
- this.lis.eq( index ).addClass( "ui-state-processing" );
+ },
+
+ refreshPositions: function( fast ) {
+
+ // Determine whether items are being displayed horizontally
+ this.floating = this.items.length ?
+ this.options.axis === "x" || this._isFloating( this.items[ 0 ].item ) :
+ false;
- if ( o.spinner ) {
- var span = $( "span", a );
- span.data( "label.tabs", span.html() ).html( o.spinner );
+ //This has to be redone because due to the item being moved out/into the offsetParent,
+ // the offsetParent's position will change
+ if ( this.offsetParent && this.helper ) {
+ this.offset.parent = this._getParentOffset();
}
- this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
- url: url,
- success: function( r, s ) {
- self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+ var i, item, t, p;
- // take care of tab labels
- self._cleanup();
+ for ( i = this.items.length - 1; i >= 0; i-- ) {
+ item = this.items[ i ];
- if ( o.cache ) {
- $.data( a, "cache.tabs", true );
- }
+ //We ignore calculating positions of all connected containers when we're not over them
+ if ( item.instance !== this.currentContainer && this.currentContainer &&
+ item.item[ 0 ] !== this.currentItem[ 0 ] ) {
+ continue;
+ }
- self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
- try {
- o.ajaxOptions.success( r, s );
- }
- catch ( e ) {}
- },
- error: function( xhr, s, e ) {
- // take care of tab labels
- self._cleanup();
+ t = this.options.toleranceElement ?
+ $( this.options.toleranceElement, item.item ) :
+ item.item;
- self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
- try {
- // Passing index avoid a race condition when this method is
- // called after the user has selected another tab.
- // Pass the anchor that initiated this request allows
- // loadError to manipulate the tab content panel via $(a.hash)
- o.ajaxOptions.error( xhr, s, index, a );
- }
- catch ( e ) {}
+ if ( !fast ) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
}
- } ) );
- // last, so that load event is fired before show...
- self.element.dequeue( "tabs" );
+ p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ }
+
+ if ( this.options.custom && this.options.custom.refreshContainers ) {
+ this.options.custom.refreshContainers.call( this );
+ } else {
+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
+ p = this.containers[ i ].element.offset();
+ this.containers[ i ].containerCache.left = p.left;
+ this.containers[ i ].containerCache.top = p.top;
+ this.containers[ i ].containerCache.width =
+ this.containers[ i ].element.outerWidth();
+ this.containers[ i ].containerCache.height =
+ this.containers[ i ].element.outerHeight();
+ }
+ }
return this;
},
- abort: function() {
- // stop possibly running animations
- this.element.queue( [] );
- this.panels.stop( false, true );
+ _createPlaceholder: function( that ) {
+ that = that || this;
+ var className,
+ o = that.options;
+
+ if ( !o.placeholder || o.placeholder.constructor === String ) {
+ className = o.placeholder;
+ o.placeholder = {
+ element: function() {
- // "tabs" queue must not contain more than two elements,
- // which are the callbacks for the latest clicked tab...
- this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+ var nodeName = that.currentItem[ 0 ].nodeName.toLowerCase(),
+ element = $( "<" + nodeName + ">", that.document[ 0 ] );
+
+ that._addClass( element, "ui-sortable-placeholder",
+ className || that.currentItem[ 0 ].className )
+ ._removeClass( element, "ui-sortable-helper" );
+
+ if ( nodeName === "tbody" ) {
+ that._createTrPlaceholder(
+ that.currentItem.find( "tr" ).eq( 0 ),
+ $( "<tr>", that.document[ 0 ] ).appendTo( element )
+ );
+ } else if ( nodeName === "tr" ) {
+ that._createTrPlaceholder( that.currentItem, element );
+ } else if ( nodeName === "img" ) {
+ element.attr( "src", that.currentItem.attr( "src" ) );
+ }
- // terminate pending requests from other tabs
- if ( this.xhr ) {
- this.xhr.abort();
- delete this.xhr;
+ if ( !className ) {
+ element.css( "visibility", "hidden" );
+ }
+
+ return element;
+ },
+ update: function( container, p ) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes -
+ // the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a
+ // class name is specified
+ if ( className && !o.forcePlaceholderSize ) {
+ return;
+ }
+
+ //If the element doesn't have a actual height by itself (without styles coming
+ // from a stylesheet), it receives the inline height from the dragged item
+ if ( !p.height() ) {
+ p.height(
+ that.currentItem.innerHeight() -
+ parseInt( that.currentItem.css( "paddingTop" ) || 0, 10 ) -
+ parseInt( that.currentItem.css( "paddingBottom" ) || 0, 10 ) );
+ }
+ if ( !p.width() ) {
+ p.width(
+ that.currentItem.innerWidth() -
+ parseInt( that.currentItem.css( "paddingLeft" ) || 0, 10 ) -
+ parseInt( that.currentItem.css( "paddingRight" ) || 0, 10 ) );
+ }
+ }
+ };
}
- // take care of tab labels
- this._cleanup();
- return this;
+ //Create the placeholder
+ that.placeholder = $( o.placeholder.element.call( that.element, that.currentItem ) );
+
+ //Append it after the actual current item
+ that.currentItem.after( that.placeholder );
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update( that, that.placeholder );
+
},
- url: function( index, url ) {
- this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
- return this;
+ _createTrPlaceholder: function( sourceTr, targetTr ) {
+ var that = this;
+
+ sourceTr.children().each( function() {
+ $( "<td> </td>", that.document[ 0 ] )
+ .attr( "colspan", $( this ).attr( "colspan" ) || 1 )
+ .appendTo( targetTr );
+ } );
},
- length: function() {
- return this.anchors.length;
- }
-});
+ _contactContainers: function( event ) {
+ var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom,
+ floating, axis,
+ innermostContainer = null,
+ innermostIndex = null;
-$.extend( $.ui.tabs, {
- version: "1.8.21"
-});
+ // Get innermost container that intersects with item
+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
-/*
- * Tabs Extensions
- */
+ // Never consider a container that's located within the item itself
+ if ( $.contains( this.currentItem[ 0 ], this.containers[ i ].element[ 0 ] ) ) {
+ continue;
+ }
-/*
- * Rotate
- */
-$.extend( $.ui.tabs.prototype, {
- rotation: null,
- rotate: function( ms, continuing ) {
- var self = this,
- o = this.options;
+ if ( this._intersectsWith( this.containers[ i ].containerCache ) ) {
- var rotate = self._rotate || ( self._rotate = function( e ) {
- clearTimeout( self.rotation );
- self.rotation = setTimeout(function() {
- var t = o.selected;
- self.select( ++t < self.anchors.length ? t : 0 );
- }, ms );
-
- if ( e ) {
- e.stopPropagation();
- }
- });
-
- var stop = self._unrotate || ( self._unrotate = !continuing
- ? function(e) {
- if (e.clientX) { // in case of a true click
- self.rotate(null);
- }
- }
- : function( e ) {
- rotate();
- });
-
- // start rotation
- if ( ms ) {
- this.element.bind( "tabsshow", rotate );
- this.anchors.bind( o.event + ".tabs", stop );
- rotate();
- // stop rotation
- } else {
- clearTimeout( self.rotation );
- this.element.unbind( "tabsshow", rotate );
- this.anchors.unbind( o.event + ".tabs", stop );
- delete this._rotate;
- delete this._unrotate;
- }
+ // If we've already found a container and it's more "inner" than this, then continue
+ if ( innermostContainer &&
+ $.contains(
+ this.containers[ i ].element[ 0 ],
+ innermostContainer.element[ 0 ] ) ) {
+ continue;
+ }
- return this;
- }
-});
+ innermostContainer = this.containers[ i ];
+ innermostIndex = i;
-})( jQuery );
-/*!
- * jQuery UI Datepicker 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- * jquery.ui.core.js
- */
-(function( $, undefined ) {
+ } else {
-$.extend($.ui, { datepicker: { version: "1.8.21" } });
+ // container doesn't intersect. trigger "out" event if necessary
+ if ( this.containers[ i ].containerCache.over ) {
+ this.containers[ i ]._trigger( "out", event, this._uiHash( this ) );
+ this.containers[ i ].containerCache.over = 0;
+ }
+ }
-var PROP_NAME = 'datepicker';
-var dpuuid = new Date().getTime();
-var instActive;
+ }
-/* Date picker manager.
- Use the singleton instance of this class, $.datepicker, to interact with the date picker.
- Settings for (groups of) date pickers are maintained in an instance object,
- allowing multiple different settings on the same page. */
+ // If no intersecting containers found, return
+ if ( !innermostContainer ) {
+ return;
+ }
-function Datepicker() {
- this.debug = false; // Change this to true to start debugging
- this._curInst = null; // The current instance in use
- this._keyEvent = false; // If the last event was a key event
- this._disabledInputs = []; // List of date picker inputs that have been disabled
- this._datepickerShowing = false; // True if the popup picker is showing , false if not
- this._inDialog = false; // True if showing within a "dialog", false if not
- this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
- this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
- this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
- this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
- this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
- this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
- this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
- this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
- this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
- this.regional = []; // Available regional settings, indexed by language code
- this.regional[''] = { // Default regional settings
- closeText: 'Done', // Display text for close link
- prevText: 'Prev', // Display text for previous month link
- nextText: 'Next', // Display text for next month link
- currentText: 'Today', // Display text for current month link
- monthNames: ['January','February','March','April','May','June',
- 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
- monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
- dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
- dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
- dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
- weekHeader: 'Wk', // Column header for week of the year
- dateFormat: 'mm/dd/yy', // See format options on parseDate
- firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
- isRTL: false, // True if right-to-left language, false if left-to-right
- showMonthAfterYear: false, // True if the year select precedes month, false for month then year
- yearSuffix: '' // Additional text to append to the year in the month headers
- };
- this._defaults = { // Global defaults for all the date picker instances
- showOn: 'focus', // 'focus' for popup on focus,
- // 'button' for trigger button, or 'both' for either
- showAnim: 'fadeIn', // Name of jQuery animation for popup
- showOptions: {}, // Options for enhanced animations
- defaultDate: null, // Used when field is blank: actual date,
- // +/-number for offset from today, null for today
- appendText: '', // Display text following the input box, e.g. showing the format
- buttonText: '...', // Text for trigger button
- buttonImage: '', // URL for trigger button image
- buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
- hideIfNoPrevNext: false, // True to hide next/previous month links
- // if not applicable, false to just disable them
- navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
- gotoCurrent: false, // True if today link goes back to current selection instead
- changeMonth: false, // True if month can be selected directly, false if only prev/next
- changeYear: false, // True if year can be selected directly, false if only prev/next
- yearRange: 'c-10:c+10', // Range of years to display in drop-down,
- // either relative to today's year (-nn:+nn), relative to currently displayed year
- // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
- showOtherMonths: false, // True to show dates in other months, false to leave blank
- selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
- showWeek: false, // True to show week of the year, false to not show it
- calculateWeek: this.iso8601Week, // How to calculate the week of the year,
- // takes a Date and returns the number of the week for it
- shortYearCutoff: '+10', // Short year values < this are in the current century,
- // > this are in the previous century,
- // string value starting with '+' for current year + value
- minDate: null, // The earliest selectable date, or null for no limit
- maxDate: null, // The latest selectable date, or null for no limit
- duration: 'fast', // Duration of display/closure
- beforeShowDay: null, // Function that takes a date and returns an array with
- // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
- // [2] = cell title (optional), e.g. $.datepicker.noWeekends
- beforeShow: null, // Function that takes an input field and
- // returns a set of custom settings for the date picker
- onSelect: null, // Define a callback function when a date is selected
- onChangeMonthYear: null, // Define a callback function when the month or year is changed
- onClose: null, // Define a callback function when the datepicker is closed
- numberOfMonths: 1, // Number of months to show at a time
- showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
- stepMonths: 1, // Number of months to step back/forward
- stepBigMonths: 12, // Number of months to step back/forward for the big links
- altField: '', // Selector for an alternate field to store selected dates into
- altFormat: '', // The date format to use for the alternate field
- constrainInput: true, // The input is constrained by the current date format
- showButtonPanel: false, // True to show button panel, false to not show it
- autoSize: false, // True to size the input for the date format, false to leave as is
- disabled: false // The initial disabled state
- };
- $.extend(this._defaults, this.regional['']);
- this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'));
-}
+ // Move the item into the container if it's not there already
+ if ( this.containers.length === 1 ) {
+ if ( !this.containers[ innermostIndex ].containerCache.over ) {
+ this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+ this.containers[ innermostIndex ].containerCache.over = 1;
+ }
+ } else {
-$.extend(Datepicker.prototype, {
- /* Class name added to elements to indicate already configured with a date picker. */
- markerClassName: 'hasDatepicker',
-
- //Keep track of the maximum number of rows displayed (see #7043)
- maxRows: 4,
+ // When entering a new container, we will find the item with the least distance and
+ // append our item near it
+ dist = 10000;
+ itemWithLeastDistance = null;
+ floating = innermostContainer.floating || this._isFloating( this.currentItem );
+ posProperty = floating ? "left" : "top";
+ sizeProperty = floating ? "width" : "height";
+ axis = floating ? "pageX" : "pageY";
+
+ for ( j = this.items.length - 1; j >= 0; j-- ) {
+ if ( !$.contains(
+ this.containers[ innermostIndex ].element[ 0 ], this.items[ j ].item[ 0 ] )
+ ) {
+ continue;
+ }
+ if ( this.items[ j ].item[ 0 ] === this.currentItem[ 0 ] ) {
+ continue;
+ }
- /* Debug logging (if enabled). */
- log: function () {
- if (this.debug)
- console.log.apply('', arguments);
- },
-
- // TODO rename to "widget" when switching to widget factory
- _widgetDatepicker: function() {
- return this.dpDiv;
- },
+ cur = this.items[ j ].item.offset()[ posProperty ];
+ nearBottom = false;
+ if ( event[ axis ] - cur > this.items[ j ][ sizeProperty ] / 2 ) {
+ nearBottom = true;
+ }
- /* Override the default settings for all instances of the date picker.
- @param settings object - the new settings to use as defaults (anonymous object)
- @return the manager object */
- setDefaults: function(settings) {
- extendRemove(this._defaults, settings || {});
- return this;
- },
+ if ( Math.abs( event[ axis ] - cur ) < dist ) {
+ dist = Math.abs( event[ axis ] - cur );
+ itemWithLeastDistance = this.items[ j ];
+ this.direction = nearBottom ? "up" : "down";
+ }
+ }
- /* Attach the date picker to a jQuery selection.
- @param target element - the target input field or division or span
- @param settings object - the new settings to use for this date picker instance (anonymous) */
- _attachDatepicker: function(target, settings) {
- // check for settings on the control itself - in namespace 'date:'
- var inlineSettings = null;
- for (var attrName in this._defaults) {
- var attrValue = target.getAttribute('date:' + attrName);
- if (attrValue) {
- inlineSettings = inlineSettings || {};
- try {
- inlineSettings[attrName] = eval(attrValue);
- } catch (err) {
- inlineSettings[attrName] = attrValue;
+ //Check if dropOnEmpty is enabled
+ if ( !itemWithLeastDistance && !this.options.dropOnEmpty ) {
+ return;
+ }
+
+ if ( this.currentContainer === this.containers[ innermostIndex ] ) {
+ if ( !this.currentContainer.containerCache.over ) {
+ this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash() );
+ this.currentContainer.containerCache.over = 1;
}
+ return;
}
+
+ itemWithLeastDistance ?
+ this._rearrange( event, itemWithLeastDistance, null, true ) :
+ this._rearrange( event, null, this.containers[ innermostIndex ].element, true );
+ this._trigger( "change", event, this._uiHash() );
+ this.containers[ innermostIndex ]._trigger( "change", event, this._uiHash( this ) );
+ this.currentContainer = this.containers[ innermostIndex ];
+
+ //Update the placeholder
+ this.options.placeholder.update( this.currentContainer, this.placeholder );
+
+ this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+ this.containers[ innermostIndex ].containerCache.over = 1;
+ }
+
+ },
+
+ _createHelper: function( event ) {
+
+ var o = this.options,
+ helper = $.isFunction( o.helper ) ?
+ $( o.helper.apply( this.element[ 0 ], [ event, this.currentItem ] ) ) :
+ ( o.helper === "clone" ? this.currentItem.clone() : this.currentItem );
+
+ //Add the helper to the DOM if that didn't happen already
+ if ( !helper.parents( "body" ).length ) {
+ $( o.appendTo !== "parent" ?
+ o.appendTo :
+ this.currentItem[ 0 ].parentNode )[ 0 ].appendChild( helper[ 0 ] );
+ }
+
+ if ( helper[ 0 ] === this.currentItem[ 0 ] ) {
+ this._storedCSS = {
+ width: this.currentItem[ 0 ].style.width,
+ height: this.currentItem[ 0 ].style.height,
+ position: this.currentItem.css( "position" ),
+ top: this.currentItem.css( "top" ),
+ left: this.currentItem.css( "left" )
+ };
}
- var nodeName = target.nodeName.toLowerCase();
- var inline = (nodeName == 'div' || nodeName == 'span');
- if (!target.id) {
- this.uuid += 1;
- target.id = 'dp' + this.uuid;
+
+ if ( !helper[ 0 ].style.width || o.forceHelperSize ) {
+ helper.width( this.currentItem.width() );
}
- var inst = this._newInst($(target), inline);
- inst.settings = $.extend({}, settings || {}, inlineSettings || {});
- if (nodeName == 'input') {
- this._connectDatepicker(target, inst);
- } else if (inline) {
- this._inlineDatepicker(target, inst);
+ if ( !helper[ 0 ].style.height || o.forceHelperSize ) {
+ helper.height( this.currentItem.height() );
}
- },
- /* Create a new instance object. */
- _newInst: function(target, inline) {
- var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars
- return {id: id, input: target, // associated target
- selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
- drawMonth: 0, drawYear: 0, // month being drawn
- inline: inline, // is datepicker inline or not
- dpDiv: (!inline ? this.dpDiv : // presentation div
- bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))};
- },
+ return helper;
- /* Attach the date picker to an input field. */
- _connectDatepicker: function(target, inst) {
- var input = $(target);
- inst.append = $([]);
- inst.trigger = $([]);
- if (input.hasClass(this.markerClassName))
- return;
- this._attachments(input, inst);
- input.addClass(this.markerClassName).keydown(this._doKeyDown).
- keypress(this._doKeyPress).keyup(this._doKeyUp).
- bind("setData.datepicker", function(event, key, value) {
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key) {
- return this._get(inst, key);
- });
- this._autoSize(inst);
- $.data(target, PROP_NAME, inst);
- //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
- if( inst.settings.disabled ) {
- this._disableDatepicker( target );
- }
},
- /* Make attachments based on settings. */
- _attachments: function(input, inst) {
- var appendText = this._get(inst, 'appendText');
- var isRTL = this._get(inst, 'isRTL');
- if (inst.append)
- inst.append.remove();
- if (appendText) {
- inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
- input[isRTL ? 'before' : 'after'](inst.append);
+ _adjustOffsetFromHelper: function( obj ) {
+ if ( typeof obj === "string" ) {
+ obj = obj.split( " " );
}
- input.unbind('focus', this._showDatepicker);
- if (inst.trigger)
- inst.trigger.remove();
- var showOn = this._get(inst, 'showOn');
- if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
- input.focus(this._showDatepicker);
- if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
- var buttonText = this._get(inst, 'buttonText');
- var buttonImage = this._get(inst, 'buttonImage');
- inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
- $('<img/>').addClass(this._triggerClass).
- attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
- $('<button type="button"></button>').addClass(this._triggerClass).
- html(buttonImage == '' ? buttonText : $('<img/>').attr(
- { src:buttonImage, alt:buttonText, title:buttonText })));
- input[isRTL ? 'before' : 'after'](inst.trigger);
- inst.trigger.click(function() {
- if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
- $.datepicker._hideDatepicker();
- else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) {
- $.datepicker._hideDatepicker();
- $.datepicker._showDatepicker(input[0]);
- } else
- $.datepicker._showDatepicker(input[0]);
- return false;
- });
+ if ( $.isArray( obj ) ) {
+ obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+ }
+ if ( "left" in obj ) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ( "right" in obj ) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ( "top" in obj ) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ( "bottom" in obj ) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
}
},
- /* Apply the maximum length for the date format. */
- _autoSize: function(inst) {
- if (this._get(inst, 'autoSize') && !inst.inline) {
- var date = new Date(2009, 12 - 1, 20); // Ensure double digits
- var dateFormat = this._get(inst, 'dateFormat');
- if (dateFormat.match(/[DM]/)) {
- var findMax = function(names) {
- var max = 0;
- var maxI = 0;
- for (var i = 0; i < names.length; i++) {
- if (names[i].length > max) {
- max = names[i].length;
- maxI = i;
- }
- }
- return maxI;
- };
- date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
- 'monthNames' : 'monthNamesShort'))));
- date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
- 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
- }
- inst.input.attr('size', this._formatDate(inst, date).length);
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the
+ // following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the
+ // next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+ // the document, which means that the scroll is included in the initial calculation of the
+ // offset of the parent, and never recalculated upon drag
+ if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
}
- },
- /* Attach an inline date picker to a div. */
- _inlineDatepicker: function(target, inst) {
- var divSpan = $(target);
- if (divSpan.hasClass(this.markerClassName))
- return;
- divSpan.addClass(this.markerClassName).append(inst.dpDiv).
- bind("setData.datepicker", function(event, key, value){
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key){
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- this._setDate(inst, this._getDefaultDate(inst), true);
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- //If disabled option is true, disable the datepicker before showing it (see ticket #5665)
- if( inst.settings.disabled ) {
- this._disableDatepicker( target );
+ // This needs to be actually done for all browsers, since pageX/pageY includes this
+ // information with an ugly IE fix
+ if ( this.offsetParent[ 0 ] === this.document[ 0 ].body ||
+ ( this.offsetParent[ 0 ].tagName &&
+ this.offsetParent[ 0 ].tagName.toLowerCase() === "html" && $.ui.ie ) ) {
+ po = { top: 0, left: 0 };
}
- // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
- // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
- inst.dpDiv.css( "display", "block" );
+
+ return {
+ top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+ left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+ };
+
},
- /* Pop-up the date picker in a "dialog" box.
- @param input element - ignored
- @param date string or Date - the initial date to display
- @param onSelect function - the function to call when a date is selected
- @param settings object - update the dialog date picker instance's settings (anonymous object)
- @param pos int[2] - coordinates for the dialog's position within the screen or
- event - with x/y coordinates or
- leave empty for default (screen centre)
- @return the manager object */
- _dialogDatepicker: function(input, date, onSelect, settings, pos) {
- var inst = this._dialogInst; // internal instance
- if (!inst) {
- this.uuid += 1;
- var id = 'dp' + this.uuid;
- this._dialogInput = $('<input type="text" id="' + id +
- '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
- this._dialogInput.keydown(this._doKeyDown);
- $('body').append(this._dialogInput);
- inst = this._dialogInst = this._newInst(this._dialogInput, false);
- inst.settings = {};
- $.data(this._dialogInput[0], PROP_NAME, inst);
- }
- extendRemove(inst.settings, settings || {});
- date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
- this._dialogInput.val(date);
-
- this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
- if (!this._pos) {
- var browserWidth = document.documentElement.clientWidth;
- var browserHeight = document.documentElement.clientHeight;
- var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
- var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
- this._pos = // should use actual width/height below
- [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ _getRelativeOffset: function() {
+
+ if ( this.cssPosition === "relative" ) {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+ this.scrollParent.scrollTop(),
+ left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+ this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
}
- // move input on screen for focus, but hidden behind dialog
- this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
- inst.settings.onSelect = onSelect;
- this._inDialog = true;
- this.dpDiv.addClass(this._dialogClass);
- this._showDatepicker(this._dialogInput[0]);
- if ($.blockUI)
- $.blockUI(this.dpDiv);
- $.data(this._dialogInput[0], PROP_NAME, inst);
- return this;
},
- /* Detach a datepicker from its control.
- @param target element - the target input field or division or span */
- _destroyDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- $.removeData(target, PROP_NAME);
- if (nodeName == 'input') {
- inst.append.remove();
- inst.trigger.remove();
- $target.removeClass(this.markerClassName).
- unbind('focus', this._showDatepicker).
- unbind('keydown', this._doKeyDown).
- unbind('keypress', this._doKeyPress).
- unbind('keyup', this._doKeyUp);
- } else if (nodeName == 'div' || nodeName == 'span')
- $target.removeClass(this.markerClassName).empty();
+ _cacheMargins: function() {
+ this.margins = {
+ left: ( parseInt( this.currentItem.css( "marginLeft" ), 10 ) || 0 ),
+ top: ( parseInt( this.currentItem.css( "marginTop" ), 10 ) || 0 )
+ };
},
- /* Enable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _enableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = false;
- inst.trigger.filter('button').
- each(function() { this.disabled = false; }).end().
- filter('img').css({opacity: '1.0', cursor: ''});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().removeClass('ui-state-disabled');
- inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
- removeAttr("disabled");
- }
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
},
- /* Disable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _disableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = true;
- inst.trigger.filter('button').
- each(function() { this.disabled = true; }).end().
- filter('img').css({opacity: '0.5', cursor: 'default'});
+ _setContainment: function() {
+
+ var ce, co, over,
+ o = this.options;
+ if ( o.containment === "parent" ) {
+ o.containment = this.helper[ 0 ].parentNode;
}
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().addClass('ui-state-disabled');
- inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
- attr("disabled", "disabled");
+ if ( o.containment === "document" || o.containment === "window" ) {
+ this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ o.containment === "document" ?
+ this.document.width() :
+ this.window.width() - this.helperProportions.width - this.margins.left,
+ ( o.containment === "document" ?
+ ( this.document.height() || document.body.parentNode.scrollHeight ) :
+ this.window.height() || this.document[ 0 ].body.parentNode.scrollHeight
+ ) - this.helperProportions.height - this.margins.top
+ ];
}
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- this._disabledInputs[this._disabledInputs.length] = target;
- },
- /* Is the first field in a jQuery collection disabled as a datepicker?
- @param target element - the target input field or division or span
- @return boolean - true if disabled, false if enabled */
- _isDisabledDatepicker: function(target) {
- if (!target) {
- return false;
- }
- for (var i = 0; i < this._disabledInputs.length; i++) {
- if (this._disabledInputs[i] == target)
- return true;
+ if ( !( /^(document|window|parent)$/ ).test( o.containment ) ) {
+ ce = $( o.containment )[ 0 ];
+ co = $( o.containment ).offset();
+ over = ( $( ce ).css( "overflow" ) !== "hidden" );
+
+ this.containment = [
+ co.left + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) +
+ ( parseInt( $( ce ).css( "paddingLeft" ), 10 ) || 0 ) - this.margins.left,
+ co.top + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) +
+ ( parseInt( $( ce ).css( "paddingTop" ), 10 ) || 0 ) - this.margins.top,
+ co.left + ( over ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+ ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) -
+ ( parseInt( $( ce ).css( "paddingRight" ), 10 ) || 0 ) -
+ this.helperProportions.width - this.margins.left,
+ co.top + ( over ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+ ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) -
+ ( parseInt( $( ce ).css( "paddingBottom" ), 10 ) || 0 ) -
+ this.helperProportions.height - this.margins.top
+ ];
}
- return false;
+
},
- /* Retrieve the instance data for the target control.
- @param target element - the target input field or division or span
- @return object - the associated instance data
- @throws error if a jQuery problem getting data */
- _getInst: function(target) {
- try {
- return $.data(target, PROP_NAME);
- }
- catch (err) {
- throw 'Missing instance data for this datepicker';
+ _convertPositionTo: function( d, pos ) {
+
+ if ( !pos ) {
+ pos = this.position;
}
+ var mod = d === "absolute" ? 1 : -1,
+ scroll = this.cssPosition === "absolute" &&
+ !( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+ this.offsetParent :
+ this.scrollParent,
+ scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+ return {
+ top: (
+
+ // The absolute mouse position
+ pos.top +
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.top * mod +
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.top * mod -
+ ( ( this.cssPosition === "fixed" ?
+ -this.scrollParent.scrollTop() :
+ ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod )
+ ),
+ left: (
+
+ // The absolute mouse position
+ pos.left +
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.left * mod +
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.left * mod -
+ ( ( this.cssPosition === "fixed" ?
+ -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 :
+ scroll.scrollLeft() ) * mod )
+ )
+ };
+
},
- /* Update or retrieve the settings for a date picker attached to an input field or division.
- @param target element - the target input field or division or span
- @param name object - the new settings to update or
- string - the name of the setting to change or retrieve,
- when retrieving also 'all' for all instance settings or
- 'defaults' for all global defaults
- @param value any - the new value for the setting
- (omit if above is an object or to retrieve a value) */
- _optionDatepicker: function(target, name, value) {
- var inst = this._getInst(target);
- if (arguments.length == 2 && typeof name == 'string') {
- return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
- (inst ? (name == 'all' ? $.extend({}, inst.settings) :
- this._get(inst, name)) : null));
- }
- var settings = name || {};
- if (typeof name == 'string') {
- settings = {};
- settings[name] = value;
+ _generatePosition: function( event ) {
+
+ var top, left,
+ o = this.options,
+ pageX = event.pageX,
+ pageY = event.pageY,
+ scroll = this.cssPosition === "absolute" &&
+ !( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ $.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+ this.offsetParent :
+ this.scrollParent,
+ scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if ( this.cssPosition === "relative" && !( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+ this.scrollParent[ 0 ] !== this.offsetParent[ 0 ] ) ) {
+ this.offset.relative = this._getRelativeOffset();
}
- if (inst) {
- if (this._curInst == inst) {
- this._hideDatepicker();
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if ( this.originalPosition ) { //If we are not dragging yet, we won't check for options
+
+ if ( this.containment ) {
+ if ( event.pageX - this.offset.click.left < this.containment[ 0 ] ) {
+ pageX = this.containment[ 0 ] + this.offset.click.left;
+ }
+ if ( event.pageY - this.offset.click.top < this.containment[ 1 ] ) {
+ pageY = this.containment[ 1 ] + this.offset.click.top;
+ }
+ if ( event.pageX - this.offset.click.left > this.containment[ 2 ] ) {
+ pageX = this.containment[ 2 ] + this.offset.click.left;
+ }
+ if ( event.pageY - this.offset.click.top > this.containment[ 3 ] ) {
+ pageY = this.containment[ 3 ] + this.offset.click.top;
+ }
}
- var date = this._getDateDatepicker(target, true);
- var minDate = this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- extendRemove(inst.settings, settings);
- // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
- if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined)
- inst.settings.minDate = this._formatDate(inst, minDate);
- if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined)
- inst.settings.maxDate = this._formatDate(inst, maxDate);
- this._attachments($(target), inst);
- this._autoSize(inst);
- this._setDate(inst, date);
- this._updateAlternate(inst);
- this._updateDatepicker(inst);
- }
- },
- // change method deprecated
- _changeDatepicker: function(target, name, value) {
- this._optionDatepicker(target, name, value);
- },
+ if ( o.grid ) {
+ top = this.originalPageY + Math.round( ( pageY - this.originalPageY ) /
+ o.grid[ 1 ] ) * o.grid[ 1 ];
+ pageY = this.containment ?
+ ( ( top - this.offset.click.top >= this.containment[ 1 ] &&
+ top - this.offset.click.top <= this.containment[ 3 ] ) ?
+ top :
+ ( ( top - this.offset.click.top >= this.containment[ 1 ] ) ?
+ top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) :
+ top;
+
+ left = this.originalPageX + Math.round( ( pageX - this.originalPageX ) /
+ o.grid[ 0 ] ) * o.grid[ 0 ];
+ pageX = this.containment ?
+ ( ( left - this.offset.click.left >= this.containment[ 0 ] &&
+ left - this.offset.click.left <= this.containment[ 2 ] ) ?
+ left :
+ ( ( left - this.offset.click.left >= this.containment[ 0 ] ) ?
+ left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) :
+ left;
+ }
- /* Redraw the date picker attached to an input field or division.
- @param target element - the target input field or division or span */
- _refreshDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst) {
- this._updateDatepicker(inst);
}
- },
- /* Set the dates for a jQuery selection.
- @param target element - the target input field or division or span
- @param date Date - the new date */
- _setDateDatepicker: function(target, date) {
- var inst = this._getInst(target);
- if (inst) {
- this._setDate(inst, date);
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- }
- },
+ return {
+ top: (
+
+ // The absolute mouse position
+ pageY -
+
+ // Click offset (relative to the element)
+ this.offset.click.top -
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.top -
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.top +
+ ( ( this.cssPosition === "fixed" ?
+ -this.scrollParent.scrollTop() :
+ ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) )
+ ),
+ left: (
+
+ // The absolute mouse position
+ pageX -
+
+ // Click offset (relative to the element)
+ this.offset.click.left -
+
+ // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.relative.left -
+
+ // The offsetParent's offset without borders (offset + border)
+ this.offset.parent.left +
+ ( ( this.cssPosition === "fixed" ?
+ -this.scrollParent.scrollLeft() :
+ scrollIsRootNode ? 0 : scroll.scrollLeft() ) )
+ )
+ };
- /* Get the date(s) for the first entry in a jQuery selection.
- @param target element - the target input field or division or span
- @param noDefault boolean - true if no default date is to be used
- @return Date - the current date */
- _getDateDatepicker: function(target, noDefault) {
- var inst = this._getInst(target);
- if (inst && !inst.inline)
- this._setDateFromField(inst, noDefault);
- return (inst ? this._getDate(inst) : null);
},
- /* Handle keystrokes. */
- _doKeyDown: function(event) {
- var inst = $.datepicker._getInst(event.target);
- var handled = true;
- var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
- inst._keyEvent = true;
- if ($.datepicker._datepickerShowing)
- switch (event.keyCode) {
- case 9: $.datepicker._hideDatepicker();
- handled = false;
- break; // hide on tab out
- case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
- $.datepicker._currentClass + ')', inst.dpDiv);
- if (sel[0])
- $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
- var onSelect = $.datepicker._get(inst, 'onSelect');
- if (onSelect) {
- var dateStr = $.datepicker._formatDate(inst);
-
- // trigger custom callback
- onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);
- }
- else
- $.datepicker._hideDatepicker();
- return false; // don't submit the form
- break; // select the value on enter
- case 27: $.datepicker._hideDatepicker();
- break; // hide on escape
- case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // previous month/year on page up/+ ctrl
- case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // next month/year on page down/+ ctrl
- case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // clear on ctrl or command +end
- case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // current on ctrl or command +home
- case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // -1 day on ctrl or command +left
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +left on Mac
- break;
- case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // -1 week on ctrl or command +up
- case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // +1 day on ctrl or command +right
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +right
- break;
- case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // +1 week on ctrl or command +down
- default: handled = false;
+ _rearrange: function( event, i, a, hardRefresh ) {
+
+ a ? a[ 0 ].appendChild( this.placeholder[ 0 ] ) :
+ i.item[ 0 ].parentNode.insertBefore( this.placeholder[ 0 ],
+ ( this.direction === "down" ? i.item[ 0 ] : i.item[ 0 ].nextSibling ) );
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout,
+ // if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var counter = this.counter;
+
+ this._delay( function() {
+ if ( counter === this.counter ) {
+
+ //Precompute after each DOM insertion, NOT on mousemove
+ this.refreshPositions( !hardRefresh );
}
- else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
- $.datepicker._showDatepicker(this);
- else {
- handled = false;
- }
- if (handled) {
- event.preventDefault();
- event.stopPropagation();
- }
+ } );
+
},
- /* Filter entered characters - based on date format. */
- _doKeyPress: function(event) {
- var inst = $.datepicker._getInst(event.target);
- if ($.datepicker._get(inst, 'constrainInput')) {
- var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
- var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
- return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ _clear: function( event, noPropagation ) {
+
+ this.reverting = false;
+
+ // We delay all events that have to be triggered to after the point where the placeholder
+ // has been removed and everything else normalized again
+ var i,
+ delayedTriggers = [];
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets
+ // reappended (see #4088)
+ if ( !this._noFinalSort && this.currentItem.parent().length ) {
+ this.placeholder.before( this.currentItem );
}
- },
+ this._noFinalSort = null;
- /* Synchronise manual entry and field/alternate field. */
- _doKeyUp: function(event) {
- var inst = $.datepicker._getInst(event.target);
- if (inst.input.val() != inst.lastVal) {
- try {
- var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
- (inst.input ? inst.input.val() : null),
- $.datepicker._getFormatConfig(inst));
- if (date) { // only if valid
- $.datepicker._setDateFromField(inst);
- $.datepicker._updateAlternate(inst);
- $.datepicker._updateDatepicker(inst);
+ if ( this.helper[ 0 ] === this.currentItem[ 0 ] ) {
+ for ( i in this._storedCSS ) {
+ if ( this._storedCSS[ i ] === "auto" || this._storedCSS[ i ] === "static" ) {
+ this._storedCSS[ i ] = "";
}
}
- catch (err) {
- $.datepicker.log(err);
+ this.currentItem.css( this._storedCSS );
+ this._removeClass( this.currentItem, "ui-sortable-helper" );
+ } else {
+ this.currentItem.show();
+ }
+
+ if ( this.fromOutside && !noPropagation ) {
+ delayedTriggers.push( function( event ) {
+ this._trigger( "receive", event, this._uiHash( this.fromOutside ) );
+ } );
+ }
+ if ( ( this.fromOutside ||
+ this.domPosition.prev !==
+ this.currentItem.prev().not( ".ui-sortable-helper" )[ 0 ] ||
+ this.domPosition.parent !== this.currentItem.parent()[ 0 ] ) && !noPropagation ) {
+
+ // Trigger update callback if the DOM position has changed
+ delayedTriggers.push( function( event ) {
+ this._trigger( "update", event, this._uiHash() );
+ } );
+ }
+
+ // Check if the items Container has Changed and trigger appropriate
+ // events.
+ if ( this !== this.currentContainer ) {
+ if ( !noPropagation ) {
+ delayedTriggers.push( function( event ) {
+ this._trigger( "remove", event, this._uiHash() );
+ } );
+ delayedTriggers.push( ( function( c ) {
+ return function( event ) {
+ c._trigger( "receive", event, this._uiHash( this ) );
+ };
+ } ).call( this, this.currentContainer ) );
+ delayedTriggers.push( ( function( c ) {
+ return function( event ) {
+ c._trigger( "update", event, this._uiHash( this ) );
+ };
+ } ).call( this, this.currentContainer ) );
}
}
- return true;
- },
- /* Pop-up the date picker for a given input field.
- If false returned from beforeShow event handler do not show.
- @param input element - the input field attached to the date picker or
- event - if triggered by focus */
- _showDatepicker: function(input) {
- input = input.target || input;
- if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
- input = $('input', input.parentNode)[0];
- if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
- return;
- var inst = $.datepicker._getInst(input);
- if ($.datepicker._curInst && $.datepicker._curInst != inst) {
- $.datepicker._curInst.dpDiv.stop(true, true);
- if ( inst && $.datepicker._datepickerShowing ) {
- $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
+ //Post events to containers
+ function delayEvent( type, instance, container ) {
+ return function( event ) {
+ container._trigger( type, event, instance._uiHash( instance ) );
+ };
+ }
+ for ( i = this.containers.length - 1; i >= 0; i-- ) {
+ if ( !noPropagation ) {
+ delayedTriggers.push( delayEvent( "deactivate", this, this.containers[ i ] ) );
}
+ if ( this.containers[ i ].containerCache.over ) {
+ delayedTriggers.push( delayEvent( "out", this, this.containers[ i ] ) );
+ this.containers[ i ].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if ( this.storedCursor ) {
+ this.document.find( "body" ).css( "cursor", this.storedCursor );
+ this.storedStylesheet.remove();
+ }
+ if ( this._storedOpacity ) {
+ this.helper.css( "opacity", this._storedOpacity );
+ }
+ if ( this._storedZIndex ) {
+ this.helper.css( "zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex );
}
- var beforeShow = $.datepicker._get(inst, 'beforeShow');
- var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
- if(beforeShowSettings === false){
- //false
- return;
+
+ this.dragging = false;
+
+ if ( !noPropagation ) {
+ this._trigger( "beforeStop", event, this._uiHash() );
}
- extendRemove(inst.settings, beforeShowSettings);
- inst.lastVal = null;
- $.datepicker._lastInput = input;
- $.datepicker._setDateFromField(inst);
- if ($.datepicker._inDialog) // hide cursor
- input.value = '';
- if (!$.datepicker._pos) { // position below input
- $.datepicker._pos = $.datepicker._findPos(input);
- $.datepicker._pos[1] += input.offsetHeight; // add the height
- }
- var isFixed = false;
- $(input).parents().each(function() {
- isFixed |= $(this).css('position') == 'fixed';
- return !isFixed;
- });
- if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
- $.datepicker._pos[0] -= document.documentElement.scrollLeft;
- $.datepicker._pos[1] -= document.documentElement.scrollTop;
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+ // it unbinds ALL events from the original node!
+ this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+
+ if ( !this.cancelHelperRemoval ) {
+ if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+ this.helper.remove();
+ }
+ this.helper = null;
}
- var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
- $.datepicker._pos = null;
- //to avoid flashes on Firefox
- inst.dpDiv.empty();
- // determine sizing offscreen
- inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
- $.datepicker._updateDatepicker(inst);
- // fix width for dynamic number of date pickers
- // and adjust position before showing
- offset = $.datepicker._checkOffset(inst, offset, isFixed);
- inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
- 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
- left: offset.left + 'px', top: offset.top + 'px'});
- if (!inst.inline) {
- var showAnim = $.datepicker._get(inst, 'showAnim');
- var duration = $.datepicker._get(inst, 'duration');
- var postProcess = function() {
- var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
- if( !! cover.length ){
- var borders = $.datepicker._getBorders(inst.dpDiv);
- cover.css({left: -borders[0], top: -borders[1],
- width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
- }
- };
- inst.dpDiv.zIndex($(input).zIndex()+1);
- $.datepicker._datepickerShowing = true;
- if ($.effects && $.effects[showAnim])
- inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
- else
- inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
- if (!showAnim || !duration)
- postProcess();
- if (inst.input.is(':visible') && !inst.input.is(':disabled'))
- inst.input.focus();
- $.datepicker._curInst = inst;
+
+ if ( !noPropagation ) {
+ for ( i = 0; i < delayedTriggers.length; i++ ) {
+
+ // Trigger all delayed events
+ delayedTriggers[ i ].call( this, event );
+ }
+ this._trigger( "stop", event, this._uiHash() );
}
+
+ this.fromOutside = false;
+ return !this.cancelHelperRemoval;
+
},
- /* Generate the date picker content. */
- _updateDatepicker: function(inst) {
- var self = this;
- self.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
- var borders = $.datepicker._getBorders(inst.dpDiv);
- instActive = inst; // for delegate hover events
- inst.dpDiv.empty().append(this._generateHTML(inst));
- var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
- if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
- cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
- }
- inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover();
- var numMonths = this._getNumberOfMonths(inst);
- var cols = numMonths[1];
- var width = 17;
- inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
- if (cols > 1)
- inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
- inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
- 'Class']('ui-datepicker-multi');
- inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
- 'Class']('ui-datepicker-rtl');
- if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
- // #6694 - don't focus the input if it's already focused
- // this breaks the change event in IE
- inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
- inst.input.focus();
- // deffered render of the years select (to avoid flashes on Firefox)
- if( inst.yearshtml ){
- var origyearshtml = inst.yearshtml;
- setTimeout(function(){
- //assure that inst.yearshtml didn't change.
- if( origyearshtml === inst.yearshtml && inst.yearshtml ){
- inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml);
- }
- origyearshtml = inst.yearshtml = null;
- }, 0);
+ _trigger: function() {
+ if ( $.Widget.prototype._trigger.apply( this, arguments ) === false ) {
+ this.cancel();
}
},
- /* Retrieve the size of left and top borders for an element.
- @param elem (jQuery object) the element of interest
- @return (number[2]) the left and top borders */
- _getBorders: function(elem) {
- var convert = function(value) {
- return {thin: 1, medium: 2, thick: 3}[value] || value;
+ _uiHash: function( _inst ) {
+ var inst = _inst || this;
+ return {
+ helper: inst.helper,
+ placeholder: inst.placeholder || $( [] ),
+ position: inst.position,
+ originalPosition: inst.originalPosition,
+ offset: inst.positionAbs,
+ item: inst.currentItem,
+ sender: _inst ? _inst.element : null
};
- return [parseFloat(convert(elem.css('border-left-width'))),
- parseFloat(convert(elem.css('border-top-width')))];
- },
+ }
- /* Check positioning to remain on screen. */
- _checkOffset: function(inst, offset, isFixed) {
- var dpWidth = inst.dpDiv.outerWidth();
- var dpHeight = inst.dpDiv.outerHeight();
- var inputWidth = inst.input ? inst.input.outerWidth() : 0;
- var inputHeight = inst.input ? inst.input.outerHeight() : 0;
- var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
- var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
-
- offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
- offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
- offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
-
- // now check if datepicker is showing outside window viewport - move to a better place if so.
- offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
- Math.abs(offset.left + dpWidth - viewWidth) : 0);
- offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
- Math.abs(dpHeight + inputHeight) : 0);
+} );
- return offset;
- },
- /* Find an object's position on the screen. */
- _findPos: function(obj) {
- var inst = this._getInst(obj);
- var isRTL = this._get(inst, 'isRTL');
- while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
- obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
- }
- var position = $(obj).offset();
- return [position.left, position.top];
- },
+/*!
+ * jQuery UI Spinner 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
- /* Hide the date picker from view.
- @param input element - the input field attached to the date picker */
- _hideDatepicker: function(input) {
- var inst = this._curInst;
- if (!inst || (input && inst != $.data(input, PROP_NAME)))
- return;
- if (this._datepickerShowing) {
- var showAnim = this._get(inst, 'showAnim');
- var duration = this._get(inst, 'duration');
- var postProcess = function() {
- $.datepicker._tidyDialog(inst);
- };
- if ($.effects && $.effects[showAnim])
- inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
- else
- inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
- (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
- if (!showAnim)
- postProcess();
- this._datepickerShowing = false;
- var onClose = this._get(inst, 'onClose');
- if (onClose)
- onClose.apply((inst.input ? inst.input[0] : null),
- [(inst.input ? inst.input.val() : ''), inst]);
- this._lastInput = null;
- if (this._inDialog) {
- this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
- if ($.blockUI) {
- $.unblockUI();
- $('body').append(this.dpDiv);
- }
- }
- this._inDialog = false;
+//>>label: Spinner
+//>>group: Widgets
+//>>description: Displays buttons to easily input numbers via the keyboard or mouse.
+//>>docs: http://api.jqueryui.com/spinner/
+//>>demos: http://jqueryui.com/spinner/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/spinner.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+function spinnerModifer( fn ) {
+ return function() {
+ var previous = this.element.val();
+ fn.apply( this, arguments );
+ this._refresh();
+ if ( previous !== this.element.val() ) {
+ this._trigger( "change" );
}
- },
+ };
+}
- /* Tidy up after a dialog display. */
- _tidyDialog: function(inst) {
- inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+$.widget( "ui.spinner", {
+ version: "1.12.1",
+ defaultElement: "<input>",
+ widgetEventPrefix: "spin",
+ options: {
+ classes: {
+ "ui-spinner": "ui-corner-all",
+ "ui-spinner-down": "ui-corner-br",
+ "ui-spinner-up": "ui-corner-tr"
+ },
+ culture: null,
+ icons: {
+ down: "ui-icon-triangle-1-s",
+ up: "ui-icon-triangle-1-n"
+ },
+ incremental: true,
+ max: null,
+ min: null,
+ numberFormat: null,
+ page: 10,
+ step: 1,
+
+ change: null,
+ spin: null,
+ start: null,
+ stop: null
},
- /* Close date picker if clicked elsewhere. */
- _checkExternalClick: function(event) {
- if (!$.datepicker._curInst)
- return;
+ _create: function() {
- var $target = $(event.target),
- inst = $.datepicker._getInst($target[0]);
+ // handle string values that need to be parsed
+ this._setOption( "max", this.options.max );
+ this._setOption( "min", this.options.min );
+ this._setOption( "step", this.options.step );
- if ( ( ( $target[0].id != $.datepicker._mainDivId &&
- $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
- !$target.hasClass($.datepicker.markerClassName) &&
- !$target.closest("." + $.datepicker._triggerClass).length &&
- $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
- ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) )
- $.datepicker._hideDatepicker();
- },
+ // Only format if there is a value, prevents the field from being marked
+ // as invalid in Firefox, see #9573.
+ if ( this.value() !== "" ) {
- /* Adjust one of the date sub-fields. */
- _adjustDate: function(id, offset, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._isDisabledDatepicker(target[0])) {
- return;
+ // Format the value, but don't constrain.
+ this._value( this.element.val(), true );
}
- this._adjustInstDate(inst, offset +
- (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
- period);
- this._updateDatepicker(inst);
- },
- /* Action for current link. */
- _gotoToday: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
- inst.selectedDay = inst.currentDay;
- inst.drawMonth = inst.selectedMonth = inst.currentMonth;
- inst.drawYear = inst.selectedYear = inst.currentYear;
- }
- else {
- var date = new Date();
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- }
- this._notifyChange(inst);
- this._adjustDate(target);
- },
+ this._draw();
+ this._on( this._events );
+ this._refresh();
- /* Action for selecting a new month/year. */
- _selectMonthYear: function(id, select, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
- inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
- parseInt(select.options[select.selectedIndex].value,10);
- this._notifyChange(inst);
- this._adjustDate(target);
+ // Turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ } );
},
- /* Action for selecting a day. */
- _selectDay: function(id, month, year, td) {
- var target = $(id);
- if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
- return;
- }
- var inst = this._getInst(target[0]);
- inst.selectedDay = inst.currentDay = $('a', td).html();
- inst.selectedMonth = inst.currentMonth = month;
- inst.selectedYear = inst.currentYear = year;
- this._selectDate(id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
+ _getCreateOptions: function() {
+ var options = this._super();
+ var element = this.element;
+
+ $.each( [ "min", "max", "step" ], function( i, option ) {
+ var value = element.attr( option );
+ if ( value != null && value.length ) {
+ options[ option ] = value;
+ }
+ } );
+
+ return options;
},
- /* Erase the input field and hide the date picker. */
- _clearDate: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- this._selectDate(target, '');
+ _events: {
+ keydown: function( event ) {
+ if ( this._start( event ) && this._keydown( event ) ) {
+ event.preventDefault();
+ }
+ },
+ keyup: "_stop",
+ focus: function() {
+ this.previous = this.element.val();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ this._stop();
+ this._refresh();
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event );
+ }
+ },
+ mousewheel: function( event, delta ) {
+ if ( !delta ) {
+ return;
+ }
+ if ( !this.spinning && !this._start( event ) ) {
+ return false;
+ }
+
+ this._spin( ( delta > 0 ? 1 : -1 ) * this.options.step, event );
+ clearTimeout( this.mousewheelTimer );
+ this.mousewheelTimer = this._delay( function() {
+ if ( this.spinning ) {
+ this._stop( event );
+ }
+ }, 100 );
+ event.preventDefault();
+ },
+ "mousedown .ui-spinner-button": function( event ) {
+ var previous;
+
+ // We never want the buttons to have focus; whenever the user is
+ // interacting with the spinner, the focus should be on the input.
+ // If the input is focused then this.previous is properly set from
+ // when the input first received focus. If the input is not focused
+ // then we need to set this.previous based on the value before spinning.
+ previous = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] ) ?
+ this.previous : this.element.val();
+ function checkFocus() {
+ var isActive = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] );
+ if ( !isActive ) {
+ this.element.trigger( "focus" );
+ this.previous = previous;
+
+ // support: IE
+ // IE sets focus asynchronously, so we need to check if focus
+ // moved off of the input because the user clicked on the button.
+ this._delay( function() {
+ this.previous = previous;
+ } );
+ }
+ }
+
+ // Ensure focus is on (or stays on) the text field
+ event.preventDefault();
+ checkFocus.call( this );
+
+ // Support: IE
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ // and check (again) if focus moved off of the input.
+ this.cancelBlur = true;
+ this._delay( function() {
+ delete this.cancelBlur;
+ checkFocus.call( this );
+ } );
+
+ if ( this._start( event ) === false ) {
+ return;
+ }
+
+ this._repeat( null, $( event.currentTarget )
+ .hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+ "mouseup .ui-spinner-button": "_stop",
+ "mouseenter .ui-spinner-button": function( event ) {
+
+ // button will add ui-state-active if mouse was down while mouseleave and kept down
+ if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) {
+ return;
+ }
+
+ if ( this._start( event ) === false ) {
+ return false;
+ }
+ this._repeat( null, $( event.currentTarget )
+ .hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+
+ // TODO: do we really want to consider this a stop?
+ // shouldn't we just stop the repeater and wait until mouseup before
+ // we trigger the stop event?
+ "mouseleave .ui-spinner-button": "_stop"
},
- /* Update the input field with the selected date. */
- _selectDate: function(id, dateStr) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
- if (inst.input)
- inst.input.val(dateStr);
- this._updateAlternate(inst);
- var onSelect = this._get(inst, 'onSelect');
- if (onSelect)
- onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
- else if (inst.input)
- inst.input.trigger('change'); // fire the change event
- if (inst.inline)
- this._updateDatepicker(inst);
- else {
- this._hideDatepicker();
- this._lastInput = inst.input[0];
- if (typeof(inst.input[0]) != 'object')
- inst.input.focus(); // restore focus
- this._lastInput = null;
- }
+ // Support mobile enhanced option and make backcompat more sane
+ _enhance: function() {
+ this.uiSpinner = this.element
+ .attr( "autocomplete", "off" )
+ .wrap( "<span>" )
+ .parent()
+
+ // Add buttons
+ .append(
+ "<a></a><a></a>"
+ );
},
- /* Update any alternate field to synchronise with the main field. */
- _updateAlternate: function(inst) {
- var altField = this._get(inst, 'altField');
- if (altField) { // update alternate field too
- var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
- var date = this._getDate(inst);
- var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
- $(altField).each(function() { $(this).val(dateStr); });
+ _draw: function() {
+ this._enhance();
+
+ this._addClass( this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content" );
+ this._addClass( "ui-spinner-input" );
+
+ this.element.attr( "role", "spinbutton" );
+
+ // Button bindings
+ this.buttons = this.uiSpinner.children( "a" )
+ .attr( "tabIndex", -1 )
+ .attr( "aria-hidden", true )
+ .button( {
+ classes: {
+ "ui-button": ""
+ }
+ } );
+
+ // TODO: Right now button does not support classes this is already updated in button PR
+ this._removeClass( this.buttons, "ui-corner-all" );
+
+ this._addClass( this.buttons.first(), "ui-spinner-button ui-spinner-up" );
+ this._addClass( this.buttons.last(), "ui-spinner-button ui-spinner-down" );
+ this.buttons.first().button( {
+ "icon": this.options.icons.up,
+ "showLabel": false
+ } );
+ this.buttons.last().button( {
+ "icon": this.options.icons.down,
+ "showLabel": false
+ } );
+
+ // IE 6 doesn't understand height: 50% for the buttons
+ // unless the wrapper has an explicit height
+ if ( this.buttons.height() > Math.ceil( this.uiSpinner.height() * 0.5 ) &&
+ this.uiSpinner.height() > 0 ) {
+ this.uiSpinner.height( this.uiSpinner.height() );
}
},
- /* Set as beforeShowDay function to prevent selection of weekends.
- @param date Date - the date to customise
- @return [boolean, string] - is this date selectable?, what is its CSS class? */
- noWeekends: function(date) {
- var day = date.getDay();
- return [(day > 0 && day < 6), ''];
- },
+ _keydown: function( event ) {
+ var options = this.options,
+ keyCode = $.ui.keyCode;
- /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
- @param date Date - the date to get the week for
- @return number - the number of the week within the year that contains this date */
- iso8601Week: function(date) {
- var checkDate = new Date(date.getTime());
- // Find Thursday of this week starting on Monday
- checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
- var time = checkDate.getTime();
- checkDate.setMonth(0); // Compare with Jan 1
- checkDate.setDate(1);
- return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ switch ( event.keyCode ) {
+ case keyCode.UP:
+ this._repeat( null, 1, event );
+ return true;
+ case keyCode.DOWN:
+ this._repeat( null, -1, event );
+ return true;
+ case keyCode.PAGE_UP:
+ this._repeat( null, options.page, event );
+ return true;
+ case keyCode.PAGE_DOWN:
+ this._repeat( null, -options.page, event );
+ return true;
+ }
+
+ return false;
},
- /* Parse a string value into a date object.
- See formatDate below for the possible formats.
-
- @param format string - the expected format of the date
- @param value string - the date in the above format
- @param settings Object - attributes include:
- shortYearCutoff number - the cutoff year for determining the century (optional)
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return Date - the extracted date value or null if value is blank */
- parseDate: function (format, value, settings) {
- if (format == null || value == null)
- throw 'Invalid arguments';
- value = (typeof value == 'object' ? value.toString() : value + '');
- if (value == '')
- return null;
- var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
- shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
- new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- var year = -1;
- var month = -1;
- var day = -1;
- var doy = -1;
- var literal = false;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Extract a number from the string value
- var getNumber = function(match) {
- var isDoubled = lookAhead(match);
- var size = (match == '@' ? 14 : (match == '!' ? 20 :
- (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2))));
- var digits = new RegExp('^\\d{1,' + size + '}');
- var num = value.substring(iValue).match(digits);
- if (!num)
- throw 'Missing number at position ' + iValue;
- iValue += num[0].length;
- return parseInt(num[0], 10);
- };
- // Extract a name from the string value and convert to an index
- var getName = function(match, shortNames, longNames) {
- var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
- return [ [k, v] ];
- }).sort(function (a, b) {
- return -(a[1].length - b[1].length);
- });
- var index = -1;
- $.each(names, function (i, pair) {
- var name = pair[1];
- if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) {
- index = pair[0];
- iValue += name.length;
- return false;
- }
- });
- if (index != -1)
- return index + 1;
- else
- throw 'Unknown name at position ' + iValue;
- };
- // Confirm that a literal character matches the string value
- var checkLiteral = function() {
- if (value.charAt(iValue) != format.charAt(iFormat))
- throw 'Unexpected literal at position ' + iValue;
- iValue++;
- };
- var iValue = 0;
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- checkLiteral();
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- day = getNumber('d');
- break;
- case 'D':
- getName('D', dayNamesShort, dayNames);
- break;
- case 'o':
- doy = getNumber('o');
- break;
- case 'm':
- month = getNumber('m');
- break;
- case 'M':
- month = getName('M', monthNamesShort, monthNames);
- break;
- case 'y':
- year = getNumber('y');
- break;
- case '@':
- var date = new Date(getNumber('@'));
- year = date.getFullYear();
- month = date.getMonth() + 1;
- day = date.getDate();
- break;
- case '!':
- var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
- year = date.getFullYear();
- month = date.getMonth() + 1;
- day = date.getDate();
- break;
- case "'":
- if (lookAhead("'"))
- checkLiteral();
- else
- literal = true;
- break;
- default:
- checkLiteral();
- }
- }
- if (iValue < value.length){
- throw "Extra/unparsed characters found in date: " + value.substring(iValue);
+ _start: function( event ) {
+ if ( !this.spinning && this._trigger( "start", event ) === false ) {
+ return false;
}
- if (year == -1)
- year = new Date().getFullYear();
- else if (year < 100)
- year += new Date().getFullYear() - new Date().getFullYear() % 100 +
- (year <= shortYearCutoff ? 0 : -100);
- if (doy > -1) {
- month = 1;
- day = doy;
- do {
- var dim = this._getDaysInMonth(year, month - 1);
- if (day <= dim)
- break;
- month++;
- day -= dim;
- } while (true);
+
+ if ( !this.counter ) {
+ this.counter = 1;
}
- var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
- if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
- throw 'Invalid date'; // E.g. 31/02/00
- return date;
+ this.spinning = true;
+ return true;
},
- /* Standard date formats. */
- ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
- COOKIE: 'D, dd M yy',
- ISO_8601: 'yy-mm-dd',
- RFC_822: 'D, d M y',
- RFC_850: 'DD, dd-M-y',
- RFC_1036: 'D, d M y',
- RFC_1123: 'D, d M yy',
- RFC_2822: 'D, d M yy',
- RSS: 'D, d M y', // RFC 822
- TICKS: '!',
- TIMESTAMP: '@',
- W3C: 'yy-mm-dd', // ISO 8601
-
- _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
- Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+ _repeat: function( i, steps, event ) {
+ i = i || 500;
- /* Format a date object into a string value.
- The format can be combinations of the following:
- d - day of month (no leading zero)
- dd - day of month (two digit)
- o - day of year (no leading zeros)
- oo - day of year (three digit)
- D - day name short
- DD - day name long
- m - month of year (no leading zero)
- mm - month of year (two digit)
- M - month name short
- MM - month name long
- y - year (two digit)
- yy - year (four digit)
- @ - Unix timestamp (ms since 01/01/1970)
- ! - Windows ticks (100ns since 01/01/0001)
- '...' - literal text
- '' - single quote
-
- @param format string - the desired format of the date
- @param date Date - the date value to format
- @param settings Object - attributes include:
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return string - the date in the above format */
- formatDate: function (format, date, settings) {
- if (!date)
- return '';
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Format a number, with leading zero if necessary
- var formatNumber = function(match, value, len) {
- var num = '' + value;
- if (lookAhead(match))
- while (num.length < len)
- num = '0' + num;
- return num;
- };
- // Format a name, short or long as requested
- var formatName = function(match, value, shortNames, longNames) {
- return (lookAhead(match) ? longNames[value] : shortNames[value]);
- };
- var output = '';
- var literal = false;
- if (date)
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- output += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- output += formatNumber('d', date.getDate(), 2);
- break;
- case 'D':
- output += formatName('D', date.getDay(), dayNamesShort, dayNames);
- break;
- case 'o':
- output += formatNumber('o',
- Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3);
- break;
- case 'm':
- output += formatNumber('m', date.getMonth() + 1, 2);
- break;
- case 'M':
- output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
- break;
- case 'y':
- output += (lookAhead('y') ? date.getFullYear() :
- (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
- break;
- case '@':
- output += date.getTime();
- break;
- case '!':
- output += date.getTime() * 10000 + this._ticksTo1970;
- break;
- case "'":
- if (lookAhead("'"))
- output += "'";
- else
- literal = true;
- break;
- default:
- output += format.charAt(iFormat);
- }
- }
- return output;
- },
+ clearTimeout( this.timer );
+ this.timer = this._delay( function() {
+ this._repeat( 40, steps, event );
+ }, i );
- /* Extract all possible characters from the date format. */
- _possibleChars: function (format) {
- var chars = '';
- var literal = false;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- for (var iFormat = 0; iFormat < format.length; iFormat++)
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- chars += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd': case 'm': case 'y': case '@':
- chars += '0123456789';
- break;
- case 'D': case 'M':
- return null; // Accept anything
- case "'":
- if (lookAhead("'"))
- chars += "'";
- else
- literal = true;
- break;
- default:
- chars += format.charAt(iFormat);
- }
- return chars;
+ this._spin( steps * this.options.step, event );
},
- /* Get a setting value, defaulting if necessary. */
- _get: function(inst, name) {
- return inst.settings[name] !== undefined ?
- inst.settings[name] : this._defaults[name];
- },
+ _spin: function( step, event ) {
+ var value = this.value() || 0;
- /* Parse existing date and initialise date picker. */
- _setDateFromField: function(inst, noDefault) {
- if (inst.input.val() == inst.lastVal) {
- return;
+ if ( !this.counter ) {
+ this.counter = 1;
}
- var dateFormat = this._get(inst, 'dateFormat');
- var dates = inst.lastVal = inst.input ? inst.input.val() : null;
- var date, defaultDate;
- date = defaultDate = this._getDefaultDate(inst);
- var settings = this._getFormatConfig(inst);
- try {
- date = this.parseDate(dateFormat, dates, settings) || defaultDate;
- } catch (event) {
- this.log(event);
- dates = (noDefault ? '' : dates);
+
+ value = this._adjustValue( value + step * this._increment( this.counter ) );
+
+ if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false ) {
+ this._value( value );
+ this.counter++;
}
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- inst.currentDay = (dates ? date.getDate() : 0);
- inst.currentMonth = (dates ? date.getMonth() : 0);
- inst.currentYear = (dates ? date.getFullYear() : 0);
- this._adjustInstDate(inst);
},
- /* Retrieve the default date shown on opening. */
- _getDefaultDate: function(inst) {
- return this._restrictMinMax(inst,
- this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ _increment: function( i ) {
+ var incremental = this.options.incremental;
+
+ if ( incremental ) {
+ return $.isFunction( incremental ) ?
+ incremental( i ) :
+ Math.floor( i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1 );
+ }
+
+ return 1;
},
- /* A date may be specified as an exact value or a relative one. */
- _determineDate: function(inst, date, defaultDate) {
- var offsetNumeric = function(offset) {
- var date = new Date();
- date.setDate(date.getDate() + offset);
- return date;
- };
- var offsetString = function(offset) {
- try {
- return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
- offset, $.datepicker._getFormatConfig(inst));
- }
- catch (e) {
- // Ignore
- }
- var date = (offset.toLowerCase().match(/^c/) ?
- $.datepicker._getDate(inst) : null) || new Date();
- var year = date.getFullYear();
- var month = date.getMonth();
- var day = date.getDate();
- var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
- var matches = pattern.exec(offset);
- while (matches) {
- switch (matches[2] || 'd') {
- case 'd' : case 'D' :
- day += parseInt(matches[1],10); break;
- case 'w' : case 'W' :
- day += parseInt(matches[1],10) * 7; break;
- case 'm' : case 'M' :
- month += parseInt(matches[1],10);
- day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
- break;
- case 'y': case 'Y' :
- year += parseInt(matches[1],10);
- day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
- break;
- }
- matches = pattern.exec(offset);
- }
- return new Date(year, month, day);
- };
- var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) :
- (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime()))));
- newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate);
- if (newDate) {
- newDate.setHours(0);
- newDate.setMinutes(0);
- newDate.setSeconds(0);
- newDate.setMilliseconds(0);
+ _precision: function() {
+ var precision = this._precisionOf( this.options.step );
+ if ( this.options.min !== null ) {
+ precision = Math.max( precision, this._precisionOf( this.options.min ) );
}
- return this._daylightSavingAdjust(newDate);
+ return precision;
},
- /* Handle switch to/from daylight saving.
- Hours may be non-zero on daylight saving cut-over:
- > 12 when midnight changeover, but then cannot generate
- midnight datetime, so jump to 1AM, otherwise reset.
- @param date (Date) the date to check
- @return (Date) the corrected date */
- _daylightSavingAdjust: function(date) {
- if (!date) return null;
- date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
- return date;
+ _precisionOf: function( num ) {
+ var str = num.toString(),
+ decimal = str.indexOf( "." );
+ return decimal === -1 ? 0 : str.length - decimal - 1;
},
- /* Set the date(s) directly. */
- _setDate: function(inst, date, noChange) {
- var clear = !date;
- var origMonth = inst.selectedMonth;
- var origYear = inst.selectedYear;
- var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
- inst.selectedDay = inst.currentDay = newDate.getDate();
- inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
- inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
- if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
- this._notifyChange(inst);
- this._adjustInstDate(inst);
- if (inst.input) {
- inst.input.val(clear ? '' : this._formatDate(inst));
+ _adjustValue: function( value ) {
+ var base, aboveMin,
+ options = this.options;
+
+ // Make sure we're at a valid step
+ // - find out where we are relative to the base (min or 0)
+ base = options.min !== null ? options.min : 0;
+ aboveMin = value - base;
+
+ // - round to the nearest step
+ aboveMin = Math.round( aboveMin / options.step ) * options.step;
+
+ // - rounding is based on 0, so adjust back to our base
+ value = base + aboveMin;
+
+ // Fix precision from bad JS floating point math
+ value = parseFloat( value.toFixed( this._precision() ) );
+
+ // Clamp the value
+ if ( options.max !== null && value > options.max ) {
+ return options.max;
+ }
+ if ( options.min !== null && value < options.min ) {
+ return options.min;
}
+
+ return value;
},
- /* Retrieve the date(s) directly. */
- _getDate: function(inst) {
- var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
- this._daylightSavingAdjust(new Date(
- inst.currentYear, inst.currentMonth, inst.currentDay)));
- return startDate;
+ _stop: function( event ) {
+ if ( !this.spinning ) {
+ return;
+ }
+
+ clearTimeout( this.timer );
+ clearTimeout( this.mousewheelTimer );
+ this.counter = 0;
+ this.spinning = false;
+ this._trigger( "stop", event );
},
- /* Generate the HTML for the current state of the date picker. */
- _generateHTML: function(inst) {
- var today = new Date();
- today = this._daylightSavingAdjust(
- new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
- var isRTL = this._get(inst, 'isRTL');
- var showButtonPanel = this._get(inst, 'showButtonPanel');
- var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
- var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
- var numMonths = this._getNumberOfMonths(inst);
- var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
- var stepMonths = this._get(inst, 'stepMonths');
- var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
- var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- var minDate = this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- var drawMonth = inst.drawMonth - showCurrentAtPos;
- var drawYear = inst.drawYear;
- if (drawMonth < 0) {
- drawMonth += 12;
- drawYear--;
+ _setOption: function( key, value ) {
+ var prevValue, first, last;
+
+ if ( key === "culture" || key === "numberFormat" ) {
+ prevValue = this._parse( this.element.val() );
+ this.options[ key ] = value;
+ this.element.val( this._format( prevValue ) );
+ return;
}
- if (maxDate) {
- var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
- maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
- maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
- while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
- drawMonth--;
- if (drawMonth < 0) {
- drawMonth = 11;
- drawYear--;
- }
+
+ if ( key === "max" || key === "min" || key === "step" ) {
+ if ( typeof value === "string" ) {
+ value = this._parse( value );
}
}
- inst.drawMonth = drawMonth;
- inst.drawYear = drawYear;
- var prevText = this._get(inst, 'prevText');
- prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
- this._getFormatConfig(inst)));
- var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
- ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
- var nextText = this._get(inst, 'nextText');
- nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
- this._getFormatConfig(inst)));
- var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
- ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
- var currentText = this._get(inst, 'currentText');
- var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
- currentText = (!navigationAsDateFormat ? currentText :
- this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
- var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
- var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
- (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
- '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
- var firstDay = parseInt(this._get(inst, 'firstDay'),10);
- firstDay = (isNaN(firstDay) ? 0 : firstDay);
- var showWeek = this._get(inst, 'showWeek');
- var dayNames = this._get(inst, 'dayNames');
- var dayNamesShort = this._get(inst, 'dayNamesShort');
- var dayNamesMin = this._get(inst, 'dayNamesMin');
- var monthNames = this._get(inst, 'monthNames');
- var monthNamesShort = this._get(inst, 'monthNamesShort');
- var beforeShowDay = this._get(inst, 'beforeShowDay');
- var showOtherMonths = this._get(inst, 'showOtherMonths');
- var selectOtherMonths = this._get(inst, 'selectOtherMonths');
- var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
- var defaultDate = this._getDefaultDate(inst);
- var html = '';
- for (var row = 0; row < numMonths[0]; row++) {
- var group = '';
- this.maxRows = 4;
- for (var col = 0; col < numMonths[1]; col++) {
- var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
- var cornerClass = ' ui-corner-all';
- var calender = '';
- if (isMultiMonth) {
- calender += '<div class="ui-datepicker-group';
- if (numMonths[1] > 1)
- switch (col) {
- case 0: calender += ' ui-datepicker-group-first';
- cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
- case numMonths[1]-1: calender += ' ui-datepicker-group-last';
- cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
- default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
- }
- calender += '">';
- }
- calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
- (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
- (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
- this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
- row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
- '</div><table class="ui-datepicker-calendar"><thead>' +
- '<tr>';
- var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
- for (var dow = 0; dow < 7; dow++) { // days of the week
- var day = (dow + firstDay) % 7;
- thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
- '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
- }
- calender += thead + '</tr></thead><tbody>';
- var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
- if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
- inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
- var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
- var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate
- var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043)
- this.maxRows = numRows;
- var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
- for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
- calender += '<tr>';
- var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
- this._get(inst, 'calculateWeek')(printDate) + '</td>');
- for (var dow = 0; dow < 7; dow++) { // create date picker days
- var daySettings = (beforeShowDay ?
- beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
- var otherMonth = (printDate.getMonth() != drawMonth);
- var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
- (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
- tbody += '<td class="' +
- ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
- (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
- ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
- (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
- // or defaultDate is current printedDate and defaultDate is selectedDate
- ' ' + this._dayOverClass : '') + // highlight selected day
- (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
- (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
- (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
- (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
- ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
- (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
- inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
- (otherMonth && !showOtherMonths ? ' ' : // display for other months
- (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
- (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
- (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
- (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
- '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
- printDate.setDate(printDate.getDate() + 1);
- printDate = this._daylightSavingAdjust(printDate);
- }
- calender += tbody + '</tr>';
- }
- drawMonth++;
- if (drawMonth > 11) {
- drawMonth = 0;
- drawYear++;
- }
- calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
- ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
- group += calender;
- }
- html += group;
+ if ( key === "icons" ) {
+ first = this.buttons.first().find( ".ui-icon" );
+ this._removeClass( first, null, this.options.icons.up );
+ this._addClass( first, null, value.up );
+ last = this.buttons.last().find( ".ui-icon" );
+ this._removeClass( last, null, this.options.icons.down );
+ this._addClass( last, null, value.down );
}
- html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
- '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
- inst._keyEvent = false;
- return html;
- },
- /* Generate the month and year header. */
- _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
- secondary, monthNames, monthNamesShort) {
- var changeMonth = this._get(inst, 'changeMonth');
- var changeYear = this._get(inst, 'changeYear');
- var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
- var html = '<div class="ui-datepicker-title">';
- var monthHtml = '';
- // month selection
- if (secondary || !changeMonth)
- monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
- else {
- var inMinYear = (minDate && minDate.getFullYear() == drawYear);
- var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
- monthHtml += '<select class="ui-datepicker-month" ' +
- 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
- '>';
- for (var month = 0; month < 12; month++) {
- if ((!inMinYear || month >= minDate.getMonth()) &&
- (!inMaxYear || month <= maxDate.getMonth()))
- monthHtml += '<option value="' + month + '"' +
- (month == drawMonth ? ' selected="selected"' : '') +
- '>' + monthNamesShort[month] + '</option>';
- }
- monthHtml += '</select>';
- }
- if (!showMonthAfterYear)
- html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
- // year selection
- if ( !inst.yearshtml ) {
- inst.yearshtml = '';
- if (secondary || !changeYear)
- html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
- else {
- // determine range of years to display
- var years = this._get(inst, 'yearRange').split(':');
- var thisYear = new Date().getFullYear();
- var determineYear = function(value) {
- var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
- (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
- parseInt(value, 10)));
- return (isNaN(year) ? thisYear : year);
- };
- var year = determineYear(years[0]);
- var endYear = Math.max(year, determineYear(years[1] || ''));
- year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
- endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
- inst.yearshtml += '<select class="ui-datepicker-year" ' +
- 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
- '>';
- for (; year <= endYear; year++) {
- inst.yearshtml += '<option value="' + year + '"' +
- (year == drawYear ? ' selected="selected"' : '') +
- '>' + year + '</option>';
- }
- inst.yearshtml += '</select>';
-
- html += inst.yearshtml;
- inst.yearshtml = null;
- }
- }
- html += this._get(inst, 'yearSuffix');
- if (showMonthAfterYear)
- html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
- html += '</div>'; // Close datepicker_header
- return html;
+ this._super( key, value );
},
- /* Adjust one of the date sub-fields. */
- _adjustInstDate: function(inst, offset, period) {
- var year = inst.drawYear + (period == 'Y' ? offset : 0);
- var month = inst.drawMonth + (period == 'M' ? offset : 0);
- var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
- (period == 'D' ? offset : 0);
- var date = this._restrictMinMax(inst,
- this._daylightSavingAdjust(new Date(year, month, day)));
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- if (period == 'M' || period == 'Y')
- this._notifyChange(inst);
- },
+ _setOptionDisabled: function( value ) {
+ this._super( value );
- /* Ensure a date is within any min/max bounds. */
- _restrictMinMax: function(inst, date) {
- var minDate = this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- var newDate = (minDate && date < minDate ? minDate : date);
- newDate = (maxDate && newDate > maxDate ? maxDate : newDate);
- return newDate;
+ this._toggleClass( this.uiSpinner, null, "ui-state-disabled", !!value );
+ this.element.prop( "disabled", !!value );
+ this.buttons.button( value ? "disable" : "enable" );
},
- /* Notify change of month/year. */
- _notifyChange: function(inst) {
- var onChange = this._get(inst, 'onChangeMonthYear');
- if (onChange)
- onChange.apply((inst.input ? inst.input[0] : null),
- [inst.selectedYear, inst.selectedMonth + 1, inst]);
- },
+ _setOptions: spinnerModifer( function( options ) {
+ this._super( options );
+ } ),
- /* Determine the number of months to show. */
- _getNumberOfMonths: function(inst) {
- var numMonths = this._get(inst, 'numberOfMonths');
- return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ _parse: function( val ) {
+ if ( typeof val === "string" && val !== "" ) {
+ val = window.Globalize && this.options.numberFormat ?
+ Globalize.parseFloat( val, 10, this.options.culture ) : +val;
+ }
+ return val === "" || isNaN( val ) ? null : val;
},
- /* Determine the current maximum date - ensure no time components are set. */
- _getMinMaxDate: function(inst, minMax) {
- return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ _format: function( value ) {
+ if ( value === "" ) {
+ return "";
+ }
+ return window.Globalize && this.options.numberFormat ?
+ Globalize.format( value, this.options.numberFormat, this.options.culture ) :
+ value;
},
- /* Find the number of days in a given month. */
- _getDaysInMonth: function(year, month) {
- return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate();
+ _refresh: function() {
+ this.element.attr( {
+ "aria-valuemin": this.options.min,
+ "aria-valuemax": this.options.max,
+
+ // TODO: what should we do with values that can't be parsed?
+ "aria-valuenow": this._parse( this.element.val() )
+ } );
},
- /* Find the day of the week of the first of a month. */
- _getFirstDayOfMonth: function(year, month) {
- return new Date(year, month, 1).getDay();
+ isValid: function() {
+ var value = this.value();
+
+ // Null is invalid
+ if ( value === null ) {
+ return false;
+ }
+
+ // If value gets adjusted, it's invalid
+ return value === this._adjustValue( value );
},
- /* Determines if we should allow a "next/prev" month display change. */
- _canAdjustMonth: function(inst, offset, curYear, curMonth) {
- var numMonths = this._getNumberOfMonths(inst);
- var date = this._daylightSavingAdjust(new Date(curYear,
- curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
- if (offset < 0)
- date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
- return this._isInRange(inst, date);
+ // Update the value without triggering change
+ _value: function( value, allowAny ) {
+ var parsed;
+ if ( value !== "" ) {
+ parsed = this._parse( value );
+ if ( parsed !== null ) {
+ if ( !allowAny ) {
+ parsed = this._adjustValue( parsed );
+ }
+ value = this._format( parsed );
+ }
+ }
+ this.element.val( value );
+ this._refresh();
},
- /* Is the given date in the accepted range? */
- _isInRange: function(inst, date) {
- var minDate = this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- return ((!minDate || date.getTime() >= minDate.getTime()) &&
- (!maxDate || date.getTime() <= maxDate.getTime()));
+ _destroy: function() {
+ this.element
+ .prop( "disabled", false )
+ .removeAttr( "autocomplete role aria-valuemin aria-valuemax aria-valuenow" );
+
+ this.uiSpinner.replaceWith( this.element );
},
- /* Provide the configuration settings for formatting/parsing. */
- _getFormatConfig: function(inst) {
- var shortYearCutoff = this._get(inst, 'shortYearCutoff');
- shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
- new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
- return {shortYearCutoff: shortYearCutoff,
- dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
- monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ stepUp: spinnerModifer( function( steps ) {
+ this._stepUp( steps );
+ } ),
+ _stepUp: function( steps ) {
+ if ( this._start() ) {
+ this._spin( ( steps || 1 ) * this.options.step );
+ this._stop();
+ }
},
- /* Format the given date for display. */
- _formatDate: function(inst, day, month, year) {
- if (!day) {
- inst.currentDay = inst.selectedDay;
- inst.currentMonth = inst.selectedMonth;
- inst.currentYear = inst.selectedYear;
+ stepDown: spinnerModifer( function( steps ) {
+ this._stepDown( steps );
+ } ),
+ _stepDown: function( steps ) {
+ if ( this._start() ) {
+ this._spin( ( steps || 1 ) * -this.options.step );
+ this._stop();
}
- var date = (day ? (typeof day == 'object' ? day :
- this._daylightSavingAdjust(new Date(year, month, day))) :
- this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
- }
-});
+ },
-/*
- * Bind hover events for datepicker elements.
- * Done via delegate so the binding only occurs once in the lifetime of the parent div.
- * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
- */
-function bindHover(dpDiv) {
- var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
- return dpDiv.bind('mouseout', function(event) {
- var elem = $( event.target ).closest( selector );
- if ( !elem.length ) {
- return;
- }
- elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" );
- })
- .bind('mouseover', function(event) {
- var elem = $( event.target ).closest( selector );
- if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) ||
- !elem.length ) {
- return;
- }
- elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
- elem.addClass('ui-state-hover');
- if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover');
- if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover');
- });
-}
+ pageUp: spinnerModifer( function( pages ) {
+ this._stepUp( ( pages || 1 ) * this.options.page );
+ } ),
-/* jQuery extend now ignores nulls! */
-function extendRemove(target, props) {
- $.extend(target, props);
- for (var name in props)
- if (props[name] == null || props[name] == undefined)
- target[name] = props[name];
- return target;
-};
+ pageDown: spinnerModifer( function( pages ) {
+ this._stepDown( ( pages || 1 ) * this.options.page );
+ } ),
-/* Determine whether an object is an array. */
-function isArray(a) {
- return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
- (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
+ value: function( newVal ) {
+ if ( !arguments.length ) {
+ return this._parse( this.element.val() );
+ }
+ spinnerModifer( this._value ).call( this, newVal );
+ },
-/* Invoke the datepicker functionality.
- @param options string - a command, optionally followed by additional parameters or
- Object - settings for attaching new datepicker functionality
- @return jQuery object */
-$.fn.datepicker = function(options){
-
- /* Verify an empty collection wasn't passed - Fixes #6976 */
- if ( !this.length ) {
- return this;
- }
-
- /* Initialise the date picker. */
- if (!$.datepicker.initialized) {
- $(document).mousedown($.datepicker._checkExternalClick).
- find('body').append($.datepicker.dpDiv);
- $.datepicker.initialized = true;
+ widget: function() {
+ return this.uiSpinner;
}
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+ // Backcompat for spinner html extension points
+ $.widget( "ui.spinner", $.ui.spinner, {
+ _enhance: function() {
+ this.uiSpinner = this.element
+ .attr( "autocomplete", "off" )
+ .wrap( this._uiSpinnerHtml() )
+ .parent()
- var otherArgs = Array.prototype.slice.call(arguments, 1);
- if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- return this.each(function() {
- typeof options == 'string' ?
- $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this].concat(otherArgs)) :
- $.datepicker._attachDatepicker(this, options);
- });
-};
+ // Add buttons
+ .append( this._buttonHtml() );
+ },
+ _uiSpinnerHtml: function() {
+ return "<span>";
+ },
-$.datepicker = new Datepicker(); // singleton instance
-$.datepicker.initialized = false;
-$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "1.8.21";
+ _buttonHtml: function() {
+ return "<a></a><a></a>";
+ }
+ } );
+}
+
+var widgetsSpinner = $.ui.spinner;
-// Workaround for #4055
-// Add another global to avoid noConflict issues with inline event handlers
-window['DP_jQuery_' + dpuuid] = $;
-})(jQuery);
/*!
- * jQuery UI Progressbar 1.8.21
+ * jQuery UI Tabs 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
*/
-(function( $, undefined ) {
-$.widget( "ui.progressbar", {
+//>>label: Tabs
+//>>group: Widgets
+//>>description: Transforms a set of container elements into a tab structure.
+//>>docs: http://api.jqueryui.com/tabs/
+//>>demos: http://jqueryui.com/tabs/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tabs.css
+//>>css.theme: ../../themes/base/theme.css
+
+
+
+$.widget( "ui.tabs", {
+ version: "1.12.1",
+ delay: 300,
options: {
- value: 0,
- max: 100
+ active: null,
+ classes: {
+ "ui-tabs": "ui-corner-all",
+ "ui-tabs-nav": "ui-corner-all",
+ "ui-tabs-panel": "ui-corner-bottom",
+ "ui-tabs-tab": "ui-corner-top"
+ },
+ collapsible: false,
+ event: "click",
+ heightStyle: "content",
+ hide: null,
+ show: null,
+
+ // Callbacks
+ activate: null,
+ beforeActivate: null,
+ beforeLoad: null,
+ load: null
},
- min: 0,
+ _isLocal: ( function() {
+ var rhash = /#.*$/;
+
+ return function( anchor ) {
+ var anchorUrl, locationUrl;
+
+ anchorUrl = anchor.href.replace( rhash, "" );
+ locationUrl = location.href.replace( rhash, "" );
+
+ // Decoding may throw an error if the URL isn't UTF-8 (#9518)
+ try {
+ anchorUrl = decodeURIComponent( anchorUrl );
+ } catch ( error ) {}
+ try {
+ locationUrl = decodeURIComponent( locationUrl );
+ } catch ( error ) {}
+
+ return anchor.hash.length > 1 && anchorUrl === locationUrl;
+ };
+ } )(),
_create: function() {
- this.element
- .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
- .attr({
- role: "progressbar",
- "aria-valuemin": this.min,
- "aria-valuemax": this.options.max,
- "aria-valuenow": this._value()
- });
+ var that = this,
+ options = this.options;
- this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
- .appendTo( this.element );
+ this.running = false;
- this.oldValue = this._value();
- this._refreshValue();
+ this._addClass( "ui-tabs", "ui-widget ui-widget-content" );
+ this._toggleClass( "ui-tabs-collapsible", null, options.collapsible );
+
+ this._processTabs();
+ options.active = this._initialActive();
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ if ( $.isArray( options.disabled ) ) {
+ options.disabled = $.unique( options.disabled.concat(
+ $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) {
+ return that.tabs.index( li );
+ } )
+ ) ).sort();
+ }
+
+ // Check for length avoids error when initializing empty list
+ if ( this.options.active !== false && this.anchors.length ) {
+ this.active = this._findActive( options.active );
+ } else {
+ this.active = $();
+ }
+
+ this._refresh();
+
+ if ( this.active.length ) {
+ this.load( options.active );
+ }
},
- destroy: function() {
- this.element
- .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
- .removeAttr( "role" )
- .removeAttr( "aria-valuemin" )
- .removeAttr( "aria-valuemax" )
- .removeAttr( "aria-valuenow" );
+ _initialActive: function() {
+ var active = this.options.active,
+ collapsible = this.options.collapsible,
+ locationHash = location.hash.substring( 1 );
- this.valueDiv.remove();
+ if ( active === null ) {
- $.Widget.prototype.destroy.apply( this, arguments );
+ // check the fragment identifier in the URL
+ if ( locationHash ) {
+ this.tabs.each( function( i, tab ) {
+ if ( $( tab ).attr( "aria-controls" ) === locationHash ) {
+ active = i;
+ return false;
+ }
+ } );
+ }
+
+ // Check for a tab marked active via a class
+ if ( active === null ) {
+ active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) );
+ }
+
+ // No active tab, set to false
+ if ( active === null || active === -1 ) {
+ active = this.tabs.length ? 0 : false;
+ }
+ }
+
+ // Handle numbers: negative, out of range
+ if ( active !== false ) {
+ active = this.tabs.index( this.tabs.eq( active ) );
+ if ( active === -1 ) {
+ active = collapsible ? false : 0;
+ }
+ }
+
+ // Don't allow collapsible: false and active: false
+ if ( !collapsible && active === false && this.anchors.length ) {
+ active = 0;
+ }
+
+ return active;
},
- value: function( newValue ) {
- if ( newValue === undefined ) {
- return this._value();
+ _getCreateEventData: function() {
+ return {
+ tab: this.active,
+ panel: !this.active.length ? $() : this._getPanelForTab( this.active )
+ };
+ },
+
+ _tabKeydown: function( event ) {
+ var focusedTab = $( $.ui.safeActiveElement( this.document[ 0 ] ) ).closest( "li" ),
+ selectedIndex = this.tabs.index( focusedTab ),
+ goingForward = true;
+
+ if ( this._handlePageNav( event ) ) {
+ return;
}
- this._setOption( "value", newValue );
- return this;
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ selectedIndex++;
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.LEFT:
+ goingForward = false;
+ selectedIndex--;
+ break;
+ case $.ui.keyCode.END:
+ selectedIndex = this.anchors.length - 1;
+ break;
+ case $.ui.keyCode.HOME:
+ selectedIndex = 0;
+ break;
+ case $.ui.keyCode.SPACE:
+
+ // Activate only, no collapsing
+ event.preventDefault();
+ clearTimeout( this.activating );
+ this._activate( selectedIndex );
+ return;
+ case $.ui.keyCode.ENTER:
+
+ // Toggle (cancel delayed activation, allow collapsing)
+ event.preventDefault();
+ clearTimeout( this.activating );
+
+ // Determine if we should collapse or activate
+ this._activate( selectedIndex === this.options.active ? false : selectedIndex );
+ return;
+ default:
+ return;
+ }
+
+ // Focus the appropriate tab, based on which key was pressed
+ event.preventDefault();
+ clearTimeout( this.activating );
+ selectedIndex = this._focusNextTab( selectedIndex, goingForward );
+
+ // Navigating with control/command key will prevent automatic activation
+ if ( !event.ctrlKey && !event.metaKey ) {
+
+ // Update aria-selected immediately so that AT think the tab is already selected.
+ // Otherwise AT may confuse the user by stating that they need to activate the tab,
+ // but the tab will already be activated by the time the announcement finishes.
+ focusedTab.attr( "aria-selected", "false" );
+ this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" );
+
+ this.activating = this._delay( function() {
+ this.option( "active", selectedIndex );
+ }, this.delay );
+ }
},
- _setOption: function( key, value ) {
- if ( key === "value" ) {
- this.options.value = value;
- this._refreshValue();
- if ( this._value() === this.options.max ) {
- this._trigger( "complete" );
- }
+ _panelKeydown: function( event ) {
+ if ( this._handlePageNav( event ) ) {
+ return;
}
- $.Widget.prototype._setOption.apply( this, arguments );
+ // Ctrl+up moves focus to the current tab
+ if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) {
+ event.preventDefault();
+ this.active.trigger( "focus" );
+ }
},
- _value: function() {
- var val = this.options.value;
- // normalize invalid value
- if ( typeof val !== "number" ) {
- val = 0;
+ // Alt+page up/down moves focus to the previous/next tab (and activates)
+ _handlePageNav: function( event ) {
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) {
+ this._activate( this._focusNextTab( this.options.active - 1, false ) );
+ return true;
+ }
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) {
+ this._activate( this._focusNextTab( this.options.active + 1, true ) );
+ return true;
}
- return Math.min( this.options.max, Math.max( this.min, val ) );
},
- _percentage: function() {
- return 100 * this._value() / this.options.max;
+ _findNextTab: function( index, goingForward ) {
+ var lastTabIndex = this.tabs.length - 1;
+
+ function constrain() {
+ if ( index > lastTabIndex ) {
+ index = 0;
+ }
+ if ( index < 0 ) {
+ index = lastTabIndex;
+ }
+ return index;
+ }
+
+ while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) {
+ index = goingForward ? index + 1 : index - 1;
+ }
+
+ return index;
},
- _refreshValue: function() {
- var value = this.value();
- var percentage = this._percentage();
+ _focusNextTab: function( index, goingForward ) {
+ index = this._findNextTab( index, goingForward );
+ this.tabs.eq( index ).trigger( "focus" );
+ return index;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "active" ) {
+
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
+
+ this._super( key, value );
+
+ if ( key === "collapsible" ) {
+ this._toggleClass( "ui-tabs-collapsible", null, value );
+
+ // Setting collapsible: false while collapsed; open first panel
+ if ( !value && this.options.active === false ) {
+ this._activate( 0 );
+ }
+ }
+
+ if ( key === "event" ) {
+ this._setupEvents( value );
+ }
- if ( this.oldValue !== value ) {
- this.oldValue = value;
- this._trigger( "change" );
+ if ( key === "heightStyle" ) {
+ this._setupHeightStyle( value );
}
+ },
- this.valueDiv
- .toggle( value > this.min )
- .toggleClass( "ui-corner-right", value === this.options.max )
- .width( percentage.toFixed(0) + "%" );
- this.element.attr( "aria-valuenow", value );
- }
-});
+ _sanitizeSelector: function( hash ) {
+ return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : "";
+ },
-$.extend( $.ui.progressbar, {
- version: "1.8.21"
-});
+ refresh: function() {
+ var options = this.options,
+ lis = this.tablist.children( ":has(a[href])" );
-})( jQuery );
-/*!
- * jQuery UI Effects 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/
- */
-;jQuery.effects || (function($, undefined) {
+ // Get disabled tabs from class attribute from HTML
+ // this will get converted to a boolean if needed in _refresh()
+ options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) {
+ return lis.index( tab );
+ } );
-$.effects = {};
+ this._processTabs();
+ // Was collapsed or no tabs
+ if ( options.active === false || !this.anchors.length ) {
+ options.active = false;
+ this.active = $();
+ // was active, but active tab is gone
+ } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) {
-/******************************************************************************/
-/****************************** COLOR ANIMATIONS ******************************/
-/******************************************************************************/
+ // all remaining tabs are disabled
+ if ( this.tabs.length === options.disabled.length ) {
+ options.active = false;
+ this.active = $();
-// override the animation for color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
- 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
-function(i, attr) {
- $.fx.step[attr] = function(fx) {
- if (!fx.colorInit) {
- fx.start = getColor(fx.elem, attr);
- fx.end = getRGB(fx.end);
- fx.colorInit = true;
- }
-
- fx.elem.style[attr] = 'rgb(' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
- };
-});
+ // activate previous tab
+ } else {
+ this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) );
+ }
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
+ // was active, active tab still exists
+ } else {
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
+ // make sure active index is correct
+ options.active = this.tabs.index( this.active );
+ }
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
+ this._refresh();
+ },
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+ _refresh: function() {
+ this._setOptionDisabled( this.options.disabled );
+ this._setupEvents( this.options.event );
+ this._setupHeightStyle( this.options.heightStyle );
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+ this.tabs.not( this.active ).attr( {
+ "aria-selected": "false",
+ "aria-expanded": "false",
+ tabIndex: -1
+ } );
+ this.panels.not( this._getPanelForTab( this.active ) )
+ .hide()
+ .attr( {
+ "aria-hidden": "true"
+ } );
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+ // Make sure one tab is in the tab order
+ if ( !this.active.length ) {
+ this.tabs.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ this.active
+ .attr( {
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ } );
+ this._addClass( this.active, "ui-tabs-active", "ui-state-active" );
+ this._getPanelForTab( this.active )
+ .show()
+ .attr( {
+ "aria-hidden": "false"
+ } );
+ }
+ },
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+ _processTabs: function() {
+ var that = this,
+ prevTabs = this.tabs,
+ prevAnchors = this.anchors,
+ prevPanels = this.panels;
+
+ this.tablist = this._getList().attr( "role", "tablist" );
+ this._addClass( this.tablist, "ui-tabs-nav",
+ "ui-helper-reset ui-helper-clearfix ui-widget-header" );
+
+ // Prevent users from focusing disabled tabs via click
+ this.tablist
+ .on( "mousedown" + this.eventNamespace, "> li", function( event ) {
+ if ( $( this ).is( ".ui-state-disabled" ) ) {
+ event.preventDefault();
+ }
+ } )
+
+ // Support: IE <9
+ // Preventing the default action in mousedown doesn't prevent IE
+ // from focusing the element, so if the anchor gets focused, blur.
+ // We don't have to worry about focusing the previously focused
+ // element since clicking on a non-focusable element should focus
+ // the body anyway.
+ .on( "focus" + this.eventNamespace, ".ui-tabs-anchor", function() {
+ if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) {
+ this.blur();
+ }
+ } );
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
+ this.tabs = this.tablist.find( "> li:has(a[href])" )
+ .attr( {
+ role: "tab",
+ tabIndex: -1
+ } );
+ this._addClass( this.tabs, "ui-tabs-tab", "ui-state-default" );
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
-}
+ this.anchors = this.tabs.map( function() {
+ return $( "a", this )[ 0 ];
+ } )
+ .attr( {
+ role: "presentation",
+ tabIndex: -1
+ } );
+ this._addClass( this.anchors, "ui-tabs-anchor" );
-function getColor(elem, attr) {
- var color;
+ this.panels = $();
- do {
- color = $.curCSS(elem, attr);
+ this.anchors.each( function( i, anchor ) {
+ var selector, panel, panelId,
+ anchorId = $( anchor ).uniqueId().attr( "id" ),
+ tab = $( anchor ).closest( "li" ),
+ originalAriaControls = tab.attr( "aria-controls" );
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
+ // Inline tab
+ if ( that._isLocal( anchor ) ) {
+ selector = anchor.hash;
+ panelId = selector.substring( 1 );
+ panel = that.element.find( that._sanitizeSelector( selector ) );
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
+ // remote tab
+ } else {
- return getRGB(color);
-};
+ // If the tab doesn't already have aria-controls,
+ // generate an id by using a throw-away element
+ panelId = tab.attr( "aria-controls" ) || $( {} ).uniqueId()[ 0 ].id;
+ selector = "#" + panelId;
+ panel = that.element.find( selector );
+ if ( !panel.length ) {
+ panel = that._createPanel( panelId );
+ panel.insertAfter( that.panels[ i - 1 ] || that.tablist );
+ }
+ panel.attr( "aria-live", "polite" );
+ }
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
-};
+ if ( panel.length ) {
+ that.panels = that.panels.add( panel );
+ }
+ if ( originalAriaControls ) {
+ tab.data( "ui-tabs-aria-controls", originalAriaControls );
+ }
+ tab.attr( {
+ "aria-controls": panelId,
+ "aria-labelledby": anchorId
+ } );
+ panel.attr( "aria-labelledby", anchorId );
+ } );
+ this.panels.attr( "role", "tabpanel" );
+ this._addClass( this.panels, "ui-tabs-panel", "ui-widget-content" );
+ // Avoid memory leaks (#10056)
+ if ( prevTabs ) {
+ this._off( prevTabs.not( this.tabs ) );
+ this._off( prevAnchors.not( this.anchors ) );
+ this._off( prevPanels.not( this.panels ) );
+ }
+ },
-/******************************************************************************/
-/****************************** CLASS ANIMATIONS ******************************/
-/******************************************************************************/
+ // Allow overriding how to find the list for rare usage scenarios (#7715)
+ _getList: function() {
+ return this.tablist || this.element.find( "ol, ul" ).eq( 0 );
+ },
-var classAnimationActions = ['add', 'remove', 'toggle'],
- shorthandStyles = {
- border: 1,
- borderBottom: 1,
- borderColor: 1,
- borderLeft: 1,
- borderRight: 1,
- borderTop: 1,
- borderWidth: 1,
- margin: 1,
- padding: 1
- };
+ _createPanel: function( id ) {
+ return $( "<div>" )
+ .attr( "id", id )
+ .data( "ui-tabs-destroy", true );
+ },
+
+ _setOptionDisabled: function( disabled ) {
+ var currentItem, li, i;
-function getElementStyles() {
- var style = document.defaultView
- ? document.defaultView.getComputedStyle(this, null)
- : this.currentStyle,
- newStyle = {},
- key,
- camelCase;
-
- // webkit enumerates style porperties
- if (style && style.length && style[0] && style[style[0]]) {
- var len = style.length;
- while (len--) {
- key = style[len];
- if (typeof style[key] == 'string') {
- camelCase = key.replace(/\-(\w)/g, function(all, letter){
- return letter.toUpperCase();
- });
- newStyle[camelCase] = style[key];
+ if ( $.isArray( disabled ) ) {
+ if ( !disabled.length ) {
+ disabled = false;
+ } else if ( disabled.length === this.anchors.length ) {
+ disabled = true;
}
}
- } else {
- for (key in style) {
- if (typeof style[key] === 'string') {
- newStyle[key] = style[key];
+
+ // Disable tabs
+ for ( i = 0; ( li = this.tabs[ i ] ); i++ ) {
+ currentItem = $( li );
+ if ( disabled === true || $.inArray( i, disabled ) !== -1 ) {
+ currentItem.attr( "aria-disabled", "true" );
+ this._addClass( currentItem, null, "ui-state-disabled" );
+ } else {
+ currentItem.removeAttr( "aria-disabled" );
+ this._removeClass( currentItem, null, "ui-state-disabled" );
}
}
- }
-
- return newStyle;
-}
-function filterStyles(styles) {
- var name, value;
- for (name in styles) {
- value = styles[name];
- if (
- // ignore null and undefined values
- value == null ||
- // ignore functions (when does this occur?)
- $.isFunction(value) ||
- // shorthand styles that need to be expanded
- name in shorthandStyles ||
- // ignore scrollbars (break in IE)
- (/scrollbar/).test(name) ||
-
- // only colors or values that can be converted to numbers
- (!(/color/i).test(name) && isNaN(parseFloat(value)))
- ) {
- delete styles[name];
- }
- }
-
- return styles;
-}
+ this.options.disabled = disabled;
-function styleDifference(oldStyle, newStyle) {
- var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
- name;
+ this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null,
+ disabled === true );
+ },
- for (name in newStyle) {
- if (oldStyle[name] != newStyle[name]) {
- diff[name] = newStyle[name];
+ _setupEvents: function( event ) {
+ var events = {};
+ if ( event ) {
+ $.each( event.split( " " ), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ } );
}
- }
- return diff;
-}
+ this._off( this.anchors.add( this.tabs ).add( this.panels ) );
-$.effects.animateClass = function(value, duration, easing, callback) {
- if ($.isFunction(easing)) {
- callback = easing;
- easing = null;
- }
+ // Always prevent the default action, even when disabled
+ this._on( true, this.anchors, {
+ click: function( event ) {
+ event.preventDefault();
+ }
+ } );
+ this._on( this.anchors, events );
+ this._on( this.tabs, { keydown: "_tabKeydown" } );
+ this._on( this.panels, { keydown: "_panelKeydown" } );
- return this.queue(function() {
- var that = $(this),
- originalStyleAttr = that.attr('style') || ' ',
- originalStyle = filterStyles(getElementStyles.call(this)),
- newStyle,
- className = that.attr('class') || "";
+ this._focusable( this.tabs );
+ this._hoverable( this.tabs );
+ },
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) {
- that[action + 'Class'](value[action]);
- }
- });
- newStyle = filterStyles(getElementStyles.call(this));
- that.attr('class', className);
+ _setupHeightStyle: function( heightStyle ) {
+ var maxHeight,
+ parent = this.element.parent();
- that.animate(styleDifference(originalStyle, newStyle), {
- queue: false,
- duration: duration,
- easing: easing,
- complete: function() {
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) { that[action + 'Class'](value[action]); }
- });
- // work around bug in IE by clearing the cssText before setting it
- if (typeof that.attr('style') == 'object') {
- that.attr('style').cssText = '';
- that.attr('style').cssText = originalStyleAttr;
- } else {
- that.attr('style', originalStyleAttr);
- }
- if (callback) { callback.apply(this, arguments); }
- $.dequeue( this );
- }
- });
- });
-};
+ if ( heightStyle === "fill" ) {
+ maxHeight = parent.height();
+ maxHeight -= this.element.outerHeight() - this.element.height();
-$.fn.extend({
- _addClass: $.fn.addClass,
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
- },
+ this.element.siblings( ":visible" ).each( function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
- _removeClass: $.fn.removeClass,
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
- },
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
+ } );
- _toggleClass: $.fn.toggleClass,
- toggleClass: function(classNames, force, speed, easing, callback) {
- if ( typeof force == "boolean" || force === undefined ) {
- if ( !speed ) {
- // without speed parameter;
- return this._toggleClass(classNames, force);
- } else {
- return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
- }
- } else {
- // without switch parameter;
- return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ this.element.children().not( this.panels ).each( function() {
+ maxHeight -= $( this ).outerHeight( true );
+ } );
+
+ this.panels.each( function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ } )
+ .css( "overflow", "auto" );
+ } else if ( heightStyle === "auto" ) {
+ maxHeight = 0;
+ this.panels.each( function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ } ).height( maxHeight );
}
},
- switchClass: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
- }
-});
+ _eventHandler: function( event ) {
+ var options = this.options,
+ active = this.active,
+ anchor = $( event.currentTarget ),
+ tab = anchor.closest( "li" ),
+ clickedIsActive = tab[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : this._getPanelForTab( tab ),
+ toHide = !active.length ? $() : this._getPanelForTab( active ),
+ eventData = {
+ oldTab: active,
+ oldPanel: toHide,
+ newTab: collapsing ? $() : tab,
+ newPanel: toShow
+ };
+ event.preventDefault();
+ if ( tab.hasClass( "ui-state-disabled" ) ||
-/******************************************************************************/
-/*********************************** EFFECTS **********************************/
-/******************************************************************************/
+ // tab is already loading
+ tab.hasClass( "ui-tabs-loading" ) ||
+
+ // can't switch durning an animation
+ this.running ||
-$.extend($.effects, {
- version: "1.8.21",
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
- // Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+ return;
}
- },
- // Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ options.active = collapsing ? false : this.tabs.index( tab );
+
+ this.active = clickedIsActive ? $() : tab;
+ if ( this.xhr ) {
+ this.xhr.abort();
}
- },
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
- return mode;
- },
+ if ( !toHide.length && !toShow.length ) {
+ $.error( "jQuery UI Tabs: Mismatching fragment identifier." );
+ }
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
- var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
- };
- return {x: x, y: y};
+ if ( toShow.length ) {
+ this.load( this.tabs.index( tab ), event );
+ }
+ this._toggle( event, eventData );
},
- // Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
+ // Handles show/hide for selecting tabs
+ _toggle: function( event, eventData ) {
+ var that = this,
+ toShow = eventData.newPanel,
+ toHide = eventData.oldPanel;
- // if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper')) {
- return element.parent();
- }
+ this.running = true;
- // wrap the element
- var props = {
- width: element.outerWidth(true),
- height: element.outerHeight(true),
- 'float': element.css('float')
- },
- wrapper = $('<div></div>')
- .addClass('ui-effects-wrapper')
- .css({
- fontSize: '100%',
- background: 'transparent',
- border: 'none',
- margin: 0,
- padding: 0
- }),
- active = document.activeElement;
-
- // support: Firefox
- // Firefox incorrectly exposes anonymous content
- // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
- try {
- active.id;
- } catch( e ) {
- active = document.body;
+ function complete() {
+ that.running = false;
+ that._trigger( "activate", event, eventData );
}
- element.wrap( wrapper );
+ function show() {
+ that._addClass( eventData.newTab.closest( "li" ), "ui-tabs-active", "ui-state-active" );
- // Fixes #7595 - Elements lose focus when wrapped.
- if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
- $( active ).focus();
+ if ( toShow.length && that.options.show ) {
+ that._show( toShow, that.options.show, complete );
+ } else {
+ toShow.show();
+ complete();
+ }
}
-
- wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
- // transfer positioning properties to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative' });
+ // Start out by hiding, then showing, then completing
+ if ( toHide.length && this.options.hide ) {
+ this._hide( toHide, this.options.hide, function() {
+ that._removeClass( eventData.oldTab.closest( "li" ),
+ "ui-tabs-active", "ui-state-active" );
+ show();
+ } );
} else {
- $.extend(props, {
- position: element.css('position'),
- zIndex: element.css('z-index')
- });
- $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
- props[pos] = element.css(pos);
- if (isNaN(parseInt(props[pos], 10))) {
- props[pos] = 'auto';
- }
- });
- element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
+ this._removeClass( eventData.oldTab.closest( "li" ),
+ "ui-tabs-active", "ui-state-active" );
+ toHide.hide();
+ show();
+ }
+
+ toHide.attr( "aria-hidden", "true" );
+ eventData.oldTab.attr( {
+ "aria-selected": "false",
+ "aria-expanded": "false"
+ } );
+
+ // If we're switching tabs, remove the old tab from the tab order.
+ // If we're opening from collapsed state, remove the previous tab from the tab order.
+ // If we're collapsing, then keep the collapsing tab in the tab order.
+ if ( toShow.length && toHide.length ) {
+ eventData.oldTab.attr( "tabIndex", -1 );
+ } else if ( toShow.length ) {
+ this.tabs.filter( function() {
+ return $( this ).attr( "tabIndex" ) === 0;
+ } )
+ .attr( "tabIndex", -1 );
+ }
+
+ toShow.attr( "aria-hidden", "false" );
+ eventData.newTab.attr( {
+ "aria-selected": "true",
+ "aria-expanded": "true",
+ tabIndex: 0
+ } );
+ },
+
+ _activate: function( index ) {
+ var anchor,
+ active = this._findActive( index );
+
+ // Trying to activate the already active panel
+ if ( active[ 0 ] === this.active[ 0 ] ) {
+ return;
}
- return wrapper.css(props).show();
- },
-
- removeWrapper: function(element) {
- var parent,
- active = document.activeElement;
-
- if (element.parent().is('.ui-effects-wrapper')) {
- parent = element.parent().replaceWith(element);
- // Fixes #7595 - Elements lose focus when wrapped.
- if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
- $( active ).focus();
- }
- return parent;
+ // Trying to collapse, simulate a click on the current active header
+ if ( !active.length ) {
+ active = this.active;
}
-
- return element;
- },
- setTransition: function(element, list, factor, value) {
- value = value || {};
- $.each(list, function(i, x){
- var unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
- });
- return value;
- }
-});
+ anchor = active.find( ".ui-tabs-anchor" )[ 0 ];
+ this._eventHandler( {
+ target: anchor,
+ currentTarget: anchor,
+ preventDefault: $.noop
+ } );
+ },
+ _findActive: function( index ) {
+ return index === false ? $() : this.tabs.eq( index );
+ },
-function _normalizeArguments(effect, options, speed, callback) {
- // shift params for method overloading
- if (typeof effect == 'object') {
- callback = options;
- speed = null;
- options = effect;
- effect = options.effect;
- }
- if ($.isFunction(options)) {
- callback = options;
- speed = null;
- options = {};
- }
- if (typeof options == 'number' || $.fx.speeds[options]) {
- callback = speed;
- speed = options;
- options = {};
- }
- if ($.isFunction(speed)) {
- callback = speed;
- speed = null;
- }
+ _getIndex: function( index ) {
- options = options || {};
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ if ( typeof index === "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$='" +
+ $.ui.escapeSelector( index ) + "']" ) );
+ }
- speed = speed || options.duration;
- speed = $.fx.off ? 0 : typeof speed == 'number'
- ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
+ return index;
+ },
- callback = callback || options.complete;
+ _destroy: function() {
+ if ( this.xhr ) {
+ this.xhr.abort();
+ }
- return [effect, options, speed, callback];
-}
+ this.tablist
+ .removeAttr( "role" )
+ .off( this.eventNamespace );
-function standardSpeed( speed ) {
- // valid standard speeds
- if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
- return true;
- }
-
- // invalid strings - treat as "normal" speed
- if ( typeof speed === "string" && !$.effects[ speed ] ) {
- return true;
- }
-
- return false;
-}
+ this.anchors
+ .removeAttr( "role tabIndex" )
+ .removeUniqueId();
-$.fn.extend({
- effect: function(effect, options, speed, callback) {
- var args = _normalizeArguments.apply(this, arguments),
- // TODO: make effects take actual parameters instead of a hash
- args2 = {
- options: args[1],
- duration: args[2],
- callback: args[3]
- },
- mode = args2.options.mode,
- effectMethod = $.effects[effect];
-
- if ( $.fx.off || !effectMethod ) {
- // delegate to the original method (e.g., .show()) if possible
- if ( mode ) {
- return this[ mode ]( args2.duration, args2.callback );
+ this.tabs.add( this.panels ).each( function() {
+ if ( $.data( this, "ui-tabs-destroy" ) ) {
+ $( this ).remove();
} else {
- return this.each(function() {
- if ( args2.callback ) {
- args2.callback.call( this );
- }
- });
+ $( this ).removeAttr( "role tabIndex " +
+ "aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded" );
}
- }
-
- return effectMethod.call(this, args2);
- },
+ } );
+
+ this.tabs.each( function() {
+ var li = $( this ),
+ prev = li.data( "ui-tabs-aria-controls" );
+ if ( prev ) {
+ li
+ .attr( "aria-controls", prev )
+ .removeData( "ui-tabs-aria-controls" );
+ } else {
+ li.removeAttr( "aria-controls" );
+ }
+ } );
- _show: $.fn.show,
- show: function(speed) {
- if ( standardSpeed( speed ) ) {
- return this._show.apply(this, arguments);
- } else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'show';
- return this.effect.apply(this, args);
+ this.panels.show();
+
+ if ( this.options.heightStyle !== "content" ) {
+ this.panels.css( "height", "" );
}
},
- _hide: $.fn.hide,
- hide: function(speed) {
- if ( standardSpeed( speed ) ) {
- return this._hide.apply(this, arguments);
- } else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'hide';
- return this.effect.apply(this, args);
+ enable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === false ) {
+ return;
}
- },
- // jQuery core overloads toggle and creates _toggle
- __toggle: $.fn.toggle,
- toggle: function(speed) {
- if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
- return this.__toggle.apply(this, arguments);
+ if ( index === undefined ) {
+ disabled = false;
} else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'toggle';
- return this.effect.apply(this, args);
+ index = this._getIndex( index );
+ if ( $.isArray( disabled ) ) {
+ disabled = $.map( disabled, function( num ) {
+ return num !== index ? num : null;
+ } );
+ } else {
+ disabled = $.map( this.tabs, function( li, num ) {
+ return num !== index ? num : null;
+ } );
+ }
}
+ this._setOptionDisabled( disabled );
},
- // helper functions
- cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
- });
- return val;
- }
-});
-
-
-
-/******************************************************************************/
-/*********************************** EASING ***********************************/
-/******************************************************************************/
-
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
+ disable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === true ) {
+ return;
+ }
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
- },
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
- },
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
- },
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
- },
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
- },
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
- },
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
- },
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- },
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
- },
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
- },
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
- },
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
- },
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
- },
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
- },
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ if ( index === undefined ) {
+ disabled = true;
} else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ index = this._getIndex( index );
+ if ( $.inArray( index, disabled ) !== -1 ) {
+ return;
+ }
+ if ( $.isArray( disabled ) ) {
+ disabled = $.merge( [ index ], disabled ).sort();
+ } else {
+ disabled = [ index ];
+ }
}
+ this._setOptionDisabled( disabled );
},
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
- }
-});
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
+ load: function( index, event ) {
+ index = this._getIndex( index );
+ var that = this,
+ tab = this.tabs.eq( index ),
+ anchor = tab.find( ".ui-tabs-anchor" ),
+ panel = this._getPanelForTab( tab ),
+ eventData = {
+ tab: tab,
+ panel: panel
+ },
+ complete = function( jqXHR, status ) {
+ if ( status === "abort" ) {
+ that.panels.stop( false, true );
+ }
-})(jQuery);
-/*!
- * jQuery UI Effects Blind 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ that._removeClass( tab, "ui-tabs-loading" );
+ panel.removeAttr( "aria-busy" );
-$.effects.blind = function(o) {
+ if ( jqXHR === that.xhr ) {
+ delete that.xhr;
+ }
+ };
- return this.queue(function() {
+ // Not remote
+ if ( this._isLocal( anchor[ 0 ] ) ) {
+ return;
+ }
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
+ this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) );
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'vertical') ? 'height' : 'width';
- var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
- if(mode == 'show') wrapper.css(ref, 0); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = mode == 'show' ? distance : 0;
-
- // Animate
- wrapper.animate(animation, o.duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
+ // Support: jQuery <1.8
+ // jQuery <1.8 returns false if the request is canceled in beforeSend,
+ // but as of 1.8, $.ajax() always returns a jqXHR object.
+ if ( this.xhr && this.xhr.statusText !== "canceled" ) {
+ this._addClass( tab, "ui-tabs-loading" );
+ panel.attr( "aria-busy", "true" );
-};
+ this.xhr
+ .done( function( response, status, jqXHR ) {
-})(jQuery);
-/*!
- * jQuery UI Effects Bounce 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout( function() {
+ panel.html( response );
+ that._trigger( "load", event, eventData );
-$.effects.bounce = function(o) {
+ complete( jqXHR, status );
+ }, 1 );
+ } )
+ .fail( function( jqXHR, status ) {
- return this.queue(function() {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout( function() {
+ complete( jqXHR, status );
+ }, 1 );
+ } );
+ }
+ },
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
+ _ajaxSettings: function( anchor, event, eventData ) {
+ var that = this;
+ return {
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'up'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 5; // Default # of times
- var speed = o.duration || 250; // Default speed per bounce
- if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- if (mode == 'hide') distance = distance / (times * 2);
- if (mode != 'hide') times--;
-
- // Animate
- if (mode == 'show') { // Show Bounce
- var animation = {opacity: 1};
- animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation, speed / 2, o.options.easing);
- distance = distance / 2;
- times--;
- };
- for (var i = 0; i < times; i++) { // Bounces
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
- distance = (mode == 'hide') ? distance * 2 : distance / 2;
- };
- if (mode == 'hide') { // Last Bounce
- var animation = {opacity: 0};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- el.animate(animation, speed / 2, o.options.easing, function(){
- el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
+ // Support: IE <11 only
+ // Strip any hash that exists to prevent errors with the Ajax request
+ url: anchor.attr( "href" ).replace( /#.*$/, "" ),
+ beforeSend: function( jqXHR, settings ) {
+ return that._trigger( "beforeLoad", event,
+ $.extend( { jqXHR: jqXHR, ajaxSettings: settings }, eventData ) );
+ }
};
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
+ },
+
+ _getPanelForTab: function( tab ) {
+ var id = $( tab ).attr( "aria-controls" );
+ return this.element.find( this._sanitizeSelector( "#" + id ) );
+ }
+} );
+
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+ // Backcompat for ui-tab class (now ui-tabs-tab)
+ $.widget( "ui.tabs", $.ui.tabs, {
+ _processTabs: function() {
+ this._superApply( arguments );
+ this._addClass( this.tabs, "ui-tab" );
+ }
+ } );
+}
+
+var widgetsTabs = $.ui.tabs;
-};
-})(jQuery);
/*!
- * jQuery UI Effects Clip 1.8.21
+ * jQuery UI Tooltip 1.12.1
+ * http://jqueryui.com
*
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- * jquery.effects.core.js
*/
-(function( $, undefined ) {
-$.effects.clip = function(o) {
+//>>label: Tooltip
+//>>group: Widgets
+//>>description: Shows additional information for any element on hover or focus.
+//>>docs: http://api.jqueryui.com/tooltip/
+//>>demos: http://jqueryui.com/tooltip/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tooltip.css
+//>>css.theme: ../../themes/base/theme.css
- return this.queue(function() {
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','height','width'];
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var animate = el[0].tagName == 'IMG' ? wrapper : el;
- var ref = {
- size: (direction == 'vertical') ? 'height' : 'width',
- position: (direction == 'vertical') ? 'top' : 'left'
- };
- var distance = (direction == 'vertical') ? animate.height() : animate.width();
- if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+$.widget( "ui.tooltip", {
+ version: "1.12.1",
+ options: {
+ classes: {
+ "ui-tooltip": "ui-corner-all ui-widget-shadow"
+ },
+ content: function() {
- // Animation
- var animation = {};
- animation[ref.size] = mode == 'show' ? distance : 0;
- animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+ // support: IE<9, Opera in jQuery <1.7
+ // .text() can't accept undefined, so coerce to a string
+ var title = $( this ).attr( "title" ) || "";
- // Animate
- animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- }});
+ // Escape title, since we're going from an attribute to raw HTML
+ return $( "<a>" ).text( title ).html();
+ },
+ hide: true,
- });
+ // Disabled elements have inconsistent behavior across browsers (#8661)
+ items: "[title]:not([disabled])",
+ position: {
+ my: "left top+15",
+ at: "left bottom",
+ collision: "flipfit flip"
+ },
+ show: true,
+ track: false,
-};
+ // Callbacks
+ close: null,
+ open: null
+ },
-})(jQuery);
-/*!
- * jQuery UI Effects Drop 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ _addDescribedBy: function( elem, id ) {
+ var describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ );
+ describedby.push( id );
+ elem
+ .data( "ui-tooltip-id", id )
+ .attr( "aria-describedby", $.trim( describedby.join( " " ) ) );
+ },
-$.effects.drop = function(o) {
+ _removeDescribedBy: function( elem ) {
+ var id = elem.data( "ui-tooltip-id" ),
+ describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ ),
+ index = $.inArray( id, describedby );
- return this.queue(function() {
+ if ( index !== -1 ) {
+ describedby.splice( index, 1 );
+ }
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','opacity'];
+ elem.removeData( "ui-tooltip-id" );
+ describedby = $.trim( describedby.join( " " ) );
+ if ( describedby ) {
+ elem.attr( "aria-describedby", describedby );
+ } else {
+ elem.removeAttr( "aria-describedby" );
+ }
+ },
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {opacity: mode == 'show' ? 1 : 0};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
+ _create: function() {
+ this._on( {
+ mouseover: "open",
+ focusin: "open"
+ } );
-};
+ // IDs of generated tooltips, needed for destroy
+ this.tooltips = {};
-})(jQuery);
-/*!
- * jQuery UI Effects Explode 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ // IDs of parent tooltips where we removed the title attribute
+ this.parents = {};
-$.effects.explode = function(o) {
+ // Append the aria-live region so tooltips announce correctly
+ this.liveRegion = $( "<div>" )
+ .attr( {
+ role: "log",
+ "aria-live": "assertive",
+ "aria-relevant": "additions"
+ } )
+ .appendTo( this.document[ 0 ].body );
+ this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
- return this.queue(function() {
+ this.disabledTitles = $( [] );
+ },
- var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ _setOption: function( key, value ) {
+ var that = this;
- o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
- var el = $(this).show().css('visibility', 'hidden');
- var offset = el.offset();
+ this._super( key, value );
- //Substract the margins - not fixing the problem yet.
- offset.top -= parseInt(el.css("marginTop"),10) || 0;
- offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+ if ( key === "content" ) {
+ $.each( this.tooltips, function( id, tooltipData ) {
+ that._updateContent( tooltipData.element );
+ } );
+ }
+ },
- var width = el.outerWidth(true);
- var height = el.outerHeight(true);
+ _setOptionDisabled: function( value ) {
+ this[ value ? "_disable" : "_enable" ]();
+ },
- for(var i=0;i<rows;i++) { // =
- for(var j=0;j<cells;j++) { // ||
- el
- .clone()
- .appendTo('body')
- .wrap('<div></div>')
- .css({
- position: 'absolute',
- visibility: 'visible',
- left: -j*(width/cells),
- top: -i*(height/rows)
- })
- .parent()
- .addClass('ui-effects-explode')
- .css({
- position: 'absolute',
- overflow: 'hidden',
- width: width/cells,
- height: height/rows,
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
- opacity: o.options.mode == 'show' ? 0 : 1
- }).animate({
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
- opacity: o.options.mode == 'show' ? 1 : 0
- }, o.duration || 500);
- }
- }
+ _disable: function() {
+ var that = this;
- // Set a timeout, to call the callback approx. when the other animations have finished
- setTimeout(function() {
+ // Close open tooltips
+ $.each( this.tooltips, function( id, tooltipData ) {
+ var event = $.Event( "blur" );
+ event.target = event.currentTarget = tooltipData.element[ 0 ];
+ that.close( event, true );
+ } );
+
+ // Remove title attributes to prevent native tooltips
+ this.disabledTitles = this.disabledTitles.add(
+ this.element.find( this.options.items ).addBack()
+ .filter( function() {
+ var element = $( this );
+ if ( element.is( "[title]" ) ) {
+ return element
+ .data( "ui-tooltip-title", element.attr( "title" ) )
+ .removeAttr( "title" );
+ }
+ } )
+ );
+ },
- o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
- if(o.callback) o.callback.apply(el[0]); // Callback
- el.dequeue();
+ _enable: function() {
- $('div.ui-effects-explode').remove();
+ // restore title attributes
+ this.disabledTitles.each( function() {
+ var element = $( this );
+ if ( element.data( "ui-tooltip-title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ }
+ } );
+ this.disabledTitles = $( [] );
+ },
- }, o.duration || 500);
+ open: function( event ) {
+ var that = this,
+ target = $( event ? event.target : this.element )
+ // we need closest here due to mouseover bubbling,
+ // but always pointing at the same event target
+ .closest( this.options.items );
- });
+ // No element to show a tooltip for or the tooltip is already open
+ if ( !target.length || target.data( "ui-tooltip-id" ) ) {
+ return;
+ }
-};
+ if ( target.attr( "title" ) ) {
+ target.data( "ui-tooltip-title", target.attr( "title" ) );
+ }
-})(jQuery);
-/*!
- * jQuery UI Effects Fade 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Fade
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ target.data( "ui-tooltip-open", true );
-$.effects.fade = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'hide');
+ // Kill parent tooltips, custom or native, for hover
+ if ( event && event.type === "mouseover" ) {
+ target.parents().each( function() {
+ var parent = $( this ),
+ blurEvent;
+ if ( parent.data( "ui-tooltip-open" ) ) {
+ blurEvent = $.Event( "blur" );
+ blurEvent.target = blurEvent.currentTarget = this;
+ that.close( blurEvent, true );
+ }
+ if ( parent.attr( "title" ) ) {
+ parent.uniqueId();
+ that.parents[ this.id ] = {
+ element: this,
+ title: parent.attr( "title" )
+ };
+ parent.attr( "title", "" );
+ }
+ } );
+ }
- elem.animate({ opacity: mode }, {
- queue: false,
- duration: o.duration,
- easing: o.options.easing,
- complete: function() {
- (o.callback && o.callback.apply(this, arguments));
- elem.dequeue();
- }
- });
- });
-};
+ this._registerCloseHandlers( event, target );
+ this._updateContent( target, event );
+ },
-})(jQuery);
-/*!
- * jQuery UI Effects Fold 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Fold
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ _updateContent: function( target, event ) {
+ var content,
+ contentOption = this.options.content,
+ that = this,
+ eventType = event ? event.type : null;
-$.effects.fold = function(o) {
+ if ( typeof contentOption === "string" || contentOption.nodeType ||
+ contentOption.jquery ) {
+ return this._open( event, target, contentOption );
+ }
- return this.queue(function() {
+ content = contentOption.call( target[ 0 ], function( response ) {
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
+ // IE may instantly serve a cached response for ajax requests
+ // delay this call to _open so the other call to _open runs first
+ that._delay( function() {
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var size = o.options.size || 15; // Default fold size
- var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var widthFirst = ((mode == 'show') != horizFirst);
- var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
- var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
- var percent = /([0-9]+)%/.exec(size);
- if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
- if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
-
- // Animation
- var animation1 = {}, animation2 = {};
- animation1[ref[0]] = mode == 'show' ? distance[0] : size;
- animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
-
- // Animate
- wrapper.animate(animation1, duration, o.options.easing)
- .animate(animation2, duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
+ // Ignore async response if tooltip was closed already
+ if ( !target.data( "ui-tooltip-open" ) ) {
+ return;
+ }
-};
+ // JQuery creates a special event for focusin when it doesn't
+ // exist natively. To improve performance, the native event
+ // object is reused and the type is changed. Therefore, we can't
+ // rely on the type being correct after the event finished
+ // bubbling, so we set it back to the previous value. (#8740)
+ if ( event ) {
+ event.type = eventType;
+ }
+ this._open( event, target, response );
+ } );
+ } );
+ if ( content ) {
+ this._open( event, target, content );
+ }
+ },
-})(jQuery);
-/*!
- * jQuery UI Effects Highlight 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ _open: function( event, target, content ) {
+ var tooltipData, tooltip, delayedShow, a11yContent,
+ positionOption = $.extend( {}, this.options.position );
-$.effects.highlight = function(o) {
- return this.queue(function() {
- var elem = $(this),
- props = ['backgroundImage', 'backgroundColor', 'opacity'],
- mode = $.effects.setMode(elem, o.options.mode || 'show'),
- animation = {
- backgroundColor: elem.css('backgroundColor')
- };
+ if ( !content ) {
+ return;
+ }
- if (mode == 'hide') {
- animation.opacity = 0;
+ // Content can be updated multiple times. If the tooltip already
+ // exists, then just update the content and bail.
+ tooltipData = this._find( target );
+ if ( tooltipData ) {
+ tooltipData.tooltip.find( ".ui-tooltip-content" ).html( content );
+ return;
}
- $.effects.save(elem, props);
- elem
- .show()
- .css({
- backgroundImage: 'none',
- backgroundColor: o.options.color || '#ffff99'
- })
- .animate(animation, {
- queue: false,
- duration: o.duration,
- easing: o.options.easing,
- complete: function() {
- (mode == 'hide' && elem.hide());
- $.effects.restore(elem, props);
- (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
- (o.callback && o.callback.apply(this, arguments));
- elem.dequeue();
- }
- });
- });
-};
+ // If we have a title, clear it to prevent the native tooltip
+ // we have to check first to avoid defining a title if none exists
+ // (we don't want to cause an element to start matching [title])
+ //
+ // We use removeAttr only for key events, to allow IE to export the correct
+ // accessible attributes. For mouse events, set to empty string to avoid
+ // native tooltip showing up (happens only when removing inside mouseover).
+ if ( target.is( "[title]" ) ) {
+ if ( event && event.type === "mouseover" ) {
+ target.attr( "title", "" );
+ } else {
+ target.removeAttr( "title" );
+ }
+ }
-})(jQuery);
-/*!
- * jQuery UI Effects Pulsate 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ tooltipData = this._tooltip( target );
+ tooltip = tooltipData.tooltip;
+ this._addDescribedBy( target, tooltip.attr( "id" ) );
+ tooltip.find( ".ui-tooltip-content" ).html( content );
-$.effects.pulsate = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'show'),
- times = ((o.options.times || 5) * 2) - 1,
- duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
- isVisible = elem.is(':visible'),
- animateTo = 0;
+ // Support: Voiceover on OS X, JAWS on IE <= 9
+ // JAWS announces deletions even when aria-relevant="additions"
+ // Voiceover will sometimes re-read the entire log region's contents from the beginning
+ this.liveRegion.children().hide();
+ a11yContent = $( "<div>" ).html( tooltip.find( ".ui-tooltip-content" ).html() );
+ a11yContent.removeAttr( "name" ).find( "[name]" ).removeAttr( "name" );
+ a11yContent.removeAttr( "id" ).find( "[id]" ).removeAttr( "id" );
+ a11yContent.appendTo( this.liveRegion );
- if (!isVisible) {
- elem.css('opacity', 0).show();
- animateTo = 1;
+ function position( event ) {
+ positionOption.of = event;
+ if ( tooltip.is( ":hidden" ) ) {
+ return;
+ }
+ tooltip.position( positionOption );
}
+ if ( this.options.track && event && /^mouse/.test( event.type ) ) {
+ this._on( this.document, {
+ mousemove: position
+ } );
- if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
- times--;
+ // trigger once to override element-relative positioning
+ position( event );
+ } else {
+ tooltip.position( $.extend( {
+ of: target
+ }, this.options.position ) );
}
- for (var i = 0; i < times; i++) {
- elem.animate({ opacity: animateTo }, duration, o.options.easing);
- animateTo = (animateTo + 1) % 2;
+ tooltip.hide();
+
+ this._show( tooltip, this.options.show );
+
+ // Handle tracking tooltips that are shown with a delay (#8644). As soon
+ // as the tooltip is visible, position the tooltip using the most recent
+ // event.
+ // Adds the check to add the timers only when both delay and track options are set (#14682)
+ if ( this.options.track && this.options.show && this.options.show.delay ) {
+ delayedShow = this.delayedShow = setInterval( function() {
+ if ( tooltip.is( ":visible" ) ) {
+ position( positionOption.of );
+ clearInterval( delayedShow );
+ }
+ }, $.fx.interval );
}
- elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
- if (animateTo == 0) {
- elem.hide();
+ this._trigger( "open", event, { tooltip: tooltip } );
+ },
+
+ _registerCloseHandlers: function( event, target ) {
+ var events = {
+ keyup: function( event ) {
+ if ( event.keyCode === $.ui.keyCode.ESCAPE ) {
+ var fakeEvent = $.Event( event );
+ fakeEvent.currentTarget = target[ 0 ];
+ this.close( fakeEvent, true );
+ }
}
- (o.callback && o.callback.apply(this, arguments));
- });
+ };
- elem
- .queue('fx', function() { elem.dequeue(); })
- .dequeue();
- });
-};
+ // Only bind remove handler for delegated targets. Non-delegated
+ // tooltips will handle this in destroy.
+ if ( target[ 0 ] !== this.element[ 0 ] ) {
+ events.remove = function() {
+ this._removeTooltip( this._find( target ).tooltip );
+ };
+ }
-})(jQuery);
-/*!
- * jQuery UI Effects Scale 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.puff = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'hide'),
- percent = parseInt(o.options.percent, 10) || 150,
- factor = percent / 100,
- original = { height: elem.height(), width: elem.width() };
-
- $.extend(o.options, {
- fade: true,
- mode: mode,
- percent: mode == 'hide' ? percent : 100,
- from: mode == 'hide'
- ? original
- : {
- height: original.height * factor,
- width: original.width * factor
- }
- });
-
- elem.effect('scale', o.options, o.duration, o.callback);
- elem.dequeue();
- });
-};
+ if ( !event || event.type === "mouseover" ) {
+ events.mouseleave = "close";
+ }
+ if ( !event || event.type === "focusin" ) {
+ events.focusout = "close";
+ }
+ this._on( true, target, events );
+ },
-$.effects.scale = function(o) {
+ close: function( event ) {
+ var tooltip,
+ that = this,
+ target = $( event ? event.currentTarget : this.element ),
+ tooltipData = this._find( target );
+
+ // The tooltip may already be closed
+ if ( !tooltipData ) {
+
+ // We set ui-tooltip-open immediately upon open (in open()), but only set the
+ // additional data once there's actually content to show (in _open()). So even if the
+ // tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
+ // the period between open() and _open().
+ target.removeData( "ui-tooltip-open" );
+ return;
+ }
- return this.queue(function() {
+ tooltip = tooltipData.tooltip;
- // Create element
- var el = $(this);
+ // Disabling closes the tooltip, so we need to track when we're closing
+ // to avoid an infinite loop in case the tooltip becomes disabled on close
+ if ( tooltipData.closing ) {
+ return;
+ }
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
- var direction = o.options.direction || 'both'; // Set default axis
- var origin = o.options.origin; // The origin of the scaling
- if (mode != 'effect') { // Set default origin and restore for show/hide
- options.origin = origin || ['middle','center'];
- options.restore = true;
- }
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
-
- // Adjust
- var factor = { // Set scaling factor
- y: direction != 'horizontal' ? (percent / 100) : 1,
- x: direction != 'vertical' ? (percent / 100) : 1
- };
- el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+ // Clear the interval for delayed tracking tooltips
+ clearInterval( this.delayedShow );
- if (o.options.fade) { // Fade option to support puff
- if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
- if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
- };
+ // Only set title if we had one before (see comment in _open())
+ // If the title attribute has changed since open(), don't restore
+ if ( target.data( "ui-tooltip-title" ) && !target.attr( "title" ) ) {
+ target.attr( "title", target.data( "ui-tooltip-title" ) );
+ }
- // Animation
- options.from = el.from; options.to = el.to; options.mode = mode;
+ this._removeDescribedBy( target );
- // Animate
- el.effect('size', options, o.duration, o.callback);
- el.dequeue();
- });
+ tooltipData.hiding = true;
+ tooltip.stop( true );
+ this._hide( tooltip, this.options.hide, function() {
+ that._removeTooltip( $( this ) );
+ } );
-};
+ target.removeData( "ui-tooltip-open" );
+ this._off( target, "mouseleave focusout keyup" );
-$.effects.size = function(o) {
+ // Remove 'remove' binding only on delegated targets
+ if ( target[ 0 ] !== this.element[ 0 ] ) {
+ this._off( target, "remove" );
+ }
+ this._off( this.document, "mousemove" );
- return this.queue(function() {
+ if ( event && event.type === "mouseleave" ) {
+ $.each( this.parents, function( id, parent ) {
+ $( parent.element ).attr( "title", parent.title );
+ delete that.parents[ id ];
+ } );
+ }
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
- var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
- var props2 = ['width','height','overflow']; // Copy for children
- var cProps = ['fontSize'];
- var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
- var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+ tooltipData.closing = true;
+ this._trigger( "close", event, { tooltip: tooltip } );
+ if ( !tooltipData.hiding ) {
+ tooltipData.closing = false;
+ }
+ },
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var restore = o.options.restore || false; // Default restore
- var scale = o.options.scale || 'both'; // Default scale mode
- var origin = o.options.origin; // The origin of the sizing
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || original; // Default from state
- el.to = o.options.to || original; // Default to state
- // Adjust
- if (origin) { // Calculate baseline shifts
- var baseline = $.effects.getBaseline(origin, original);
- el.from.top = (original.height - el.from.height) * baseline.y;
- el.from.left = (original.width - el.from.width) * baseline.x;
- el.to.top = (original.height - el.to.height) * baseline.y;
- el.to.left = (original.width - el.to.width) * baseline.x;
- };
- var factor = { // Set scaling factor
- from: {y: el.from.height / original.height, x: el.from.width / original.width},
- to: {y: el.to.height / original.height, x: el.to.width / original.width}
- };
- if (scale == 'box' || scale == 'both') { // Scale the css box
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(vProps);
- el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- props = props.concat(hProps);
- el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
- el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
- };
- };
- if (scale == 'content' || scale == 'both') { // Scale the content
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(cProps);
- el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
- };
- };
- $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- el.css('overflow','hidden').css(el.from); // Shift
-
- // Animate
- if (scale == 'content' || scale == 'both') { // Scale the children
- vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
- hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
- props2 = props.concat(vProps).concat(hProps); // Concat
- el.find("*[width]").each(function(){
- var child = $(this);
- if (restore) $.effects.save(child, props2);
- var c_original = {height: child.height(), width: child.width()}; // Save original
- child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
- child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
- child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
- child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
- };
- child.css(child.from); // Shift children
- child.animate(child.to, o.duration, o.options.easing, function(){
- if (restore) $.effects.restore(child, props2); // Restore children
- }); // Animate children
- });
+ _tooltip: function( element ) {
+ var tooltip = $( "<div>" ).attr( "role", "tooltip" ),
+ content = $( "<div>" ).appendTo( tooltip ),
+ id = tooltip.uniqueId().attr( "id" );
+
+ this._addClass( content, "ui-tooltip-content" );
+ this._addClass( tooltip, "ui-tooltip", "ui-widget ui-widget-content" );
+
+ tooltip.appendTo( this._appendTo( element ) );
+
+ return this.tooltips[ id ] = {
+ element: element,
+ tooltip: tooltip
};
+ },
- // Animate
- el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if (el.to.opacity === 0) {
- el.css('opacity', el.from.opacity);
- }
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
+ _find: function( target ) {
+ var id = target.data( "ui-tooltip-id" );
+ return id ? this.tooltips[ id ] : null;
+ },
- });
+ _removeTooltip: function( tooltip ) {
+ tooltip.remove();
+ delete this.tooltips[ tooltip.attr( "id" ) ];
+ },
-};
+ _appendTo: function( target ) {
+ var element = target.closest( ".ui-front, dialog" );
-})(jQuery);
-/*!
- * jQuery UI Effects Shake 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ if ( !element.length ) {
+ element = this.document[ 0 ].body;
+ }
-$.effects.shake = function(o) {
+ return element;
+ },
- return this.queue(function() {
+ _destroy: function() {
+ var that = this;
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
+ // Close open tooltips
+ $.each( this.tooltips, function( id, tooltipData ) {
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'left'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 3; // Default # of times
- var speed = o.duration || o.options.duration || 140; // Default speed per shake
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-
- // Animation
- var animation = {}, animation1 = {}, animation2 = {};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
- animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
-
- // Animate
- el.animate(animation, speed, o.options.easing);
- for (var i = 1; i < times; i++) { // Shakes
- el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
- };
- el.animate(animation1, speed, o.options.easing).
- animate(animation, speed / 2, o.options.easing, function(){ // Last shake
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
+ // Delegate to close method to handle common cleanup
+ var event = $.Event( "blur" ),
+ element = tooltipData.element;
+ event.target = event.currentTarget = element[ 0 ];
+ that.close( event, true );
-};
+ // Remove immediately; destroying an open tooltip doesn't use the
+ // hide animation
+ $( "#" + id ).remove();
-})(jQuery);
-/*!
- * jQuery UI Effects Slide 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
+ // Restore the title
+ if ( element.data( "ui-tooltip-title" ) ) {
-$.effects.slide = function(o) {
+ // If the title attribute has changed since open(), don't restore
+ if ( !element.attr( "title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ }
+ element.removeData( "ui-tooltip-title" );
+ }
+ } );
+ this.liveRegion.remove();
+ }
+} );
- return this.queue(function() {
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
+ // Backcompat for tooltipClass option
+ $.widget( "ui.tooltip", $.ui.tooltip, {
+ options: {
+ tooltipClass: null
+ },
+ _tooltip: function() {
+ var tooltipData = this._superApply( arguments );
+ if ( this.options.tooltipClass ) {
+ tooltipData.tooltip.addClass( this.options.tooltipClass );
+ }
+ return tooltipData;
+ }
+ } );
+}
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
- if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
+var widgetsTooltip = $.ui.tooltip;
-};
-})(jQuery);
-/*!
- * jQuery UI Effects Transfer 1.8.21
- *
- * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-$.effects.transfer = function(o) {
- return this.queue(function() {
- var elem = $(this),
- target = $(o.options.to),
- endPosition = target.offset(),
- animation = {
- top: endPosition.top,
- left: endPosition.left,
- height: target.innerHeight(),
- width: target.innerWidth()
- },
- startPosition = elem.offset(),
- transfer = $('<div class="ui-effects-transfer"></div>')
- .appendTo(document.body)
- .addClass(o.options.className)
- .css({
- top: startPosition.top,
- left: startPosition.left,
- height: elem.innerHeight(),
- width: elem.innerWidth(),
- position: 'absolute'
- })
- .animate(animation, o.duration, o.options.easing, function() {
- transfer.remove();
- (o.callback && o.callback.apply(elem[0], arguments));
- elem.dequeue();
- });
- });
-};
-})(jQuery);
+}));
\ No newline at end of file