+++ /dev/null
-jQuery UI Authors (http://ui.jquery.com/about)
-
-This software consists of voluntary contributions made by many
-individuals. For exact contribution history, see the revision history
-and logs, available at http://jquery-ui.googlecode.com/svn/
-
-Brandon Aaron
-Paul Bakaus (paulbakaus.com)
-David Bolter
-Rich Caloggero
-Chi Cheng (cloudream@gmail.com)
-Colin Clark (http://colin.atrc.utoronto.ca/)
-Michelle D'Souza
-Aaron Eisenberger (aaronchi@gmail.com)
-Ariel Flesler
-Bohdan Ganicky
-Scott González
-Marc Grabanski (m@marcgrabanski.com)
-Klaus Hartl (stilbuero.de)
-Scott Jehl
-Cody Lindley
-Eduardo Lundgren (eduardolundgren@gmail.com)
-Todd Parker
-John Resig
-Patty Toland
-Ca-Phun Ung (yelotofu.com)
-Keith Wood (kbwood@virginbroadband.com.au)
-Maggie Costello Wachs
-Richard D. Worth (rdworth.org)
-Jörn Zaefferer (bassistance.de)
+++ /dev/null
- GNU GENERAL PUBLIC LICENSE
- Version 2, June 1991
-
- Copyright (C) 1989, 1991 Free Software Foundation, Inc.
- 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
- Everyone is permitted to copy and distribute verbatim copies
- of this license document, but changing it is not allowed.
-
- Preamble
-
- The licenses for most software are designed to take away your
-freedom to share and change it. By contrast, the GNU General Public
-License is intended to guarantee your freedom to share and change free
-software--to make sure the software is free for all its users. This
-General Public License applies to most of the Free Software
-Foundation's software and to any other program whose authors commit to
-using it. (Some other Free Software Foundation software is covered by
-the GNU Lesser General Public License instead.) You can apply it to
-your programs, too.
-
- When we speak of free software, we are referring to freedom, not
-price. Our General Public Licenses are designed to make sure that you
-have the freedom to distribute copies of free software (and charge for
-this service if you wish), that you receive source code or can get it
-if you want it, that you can change the software or use pieces of it
-in new free programs; and that you know you can do these things.
-
- To protect your rights, we need to make restrictions that forbid
-anyone to deny you these rights or to ask you to surrender the rights.
-These restrictions translate to certain responsibilities for you if you
-distribute copies of the software, or if you modify it.
-
- For example, if you distribute copies of such a program, whether
-gratis or for a fee, you must give the recipients all the rights that
-you have. You must make sure that they, too, receive or can get the
-source code. And you must show them these terms so they know their
-rights.
-
- We protect your rights with two steps: (1) copyright the software, and
-(2) offer you this license which gives you legal permission to copy,
-distribute and/or modify the software.
-
- Also, for each author's protection and ours, we want to make certain
-that everyone understands that there is no warranty for this free
-software. If the software is modified by someone else and passed on, we
-want its recipients to know that what they have is not the original, so
-that any problems introduced by others will not reflect on the original
-authors' reputations.
-
- Finally, any free program is threatened constantly by software
-patents. We wish to avoid the danger that redistributors of a free
-program will individually obtain patent licenses, in effect making the
-program proprietary. To prevent this, we have made it clear that any
-patent must be licensed for everyone's free use or not licensed at all.
-
- The precise terms and conditions for copying, distribution and
-modification follow.
-
- GNU GENERAL PUBLIC LICENSE
- TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
-
- 0. This License applies to any program or other work which contains
-a notice placed by the copyright holder saying it may be distributed
-under the terms of this General Public License. The "Program", below,
-refers to any such program or work, and a "work based on the Program"
-means either the Program or any derivative work under copyright law:
-that is to say, a work containing the Program or a portion of it,
-either verbatim or with modifications and/or translated into another
-language. (Hereinafter, translation is included without limitation in
-the term "modification".) Each licensee is addressed as "you".
-
-Activities other than copying, distribution and modification are not
-covered by this License; they are outside its scope. The act of
-running the Program is not restricted, and the output from the Program
-is covered only if its contents constitute a work based on the
-Program (independent of having been made by running the Program).
-Whether that is true depends on what the Program does.
-
- 1. You may copy and distribute verbatim copies of the Program's
-source code as you receive it, in any medium, provided that you
-conspicuously and appropriately publish on each copy an appropriate
-copyright notice and disclaimer of warranty; keep intact all the
-notices that refer to this License and to the absence of any warranty;
-and give any other recipients of the Program a copy of this License
-along with the Program.
-
-You may charge a fee for the physical act of transferring a copy, and
-you may at your option offer warranty protection in exchange for a fee.
-
- 2. You may modify your copy or copies of the Program or any portion
-of it, thus forming a work based on the Program, and copy and
-distribute such modifications or work under the terms of Section 1
-above, provided that you also meet all of these conditions:
-
- a) You must cause the modified files to carry prominent notices
- stating that you changed the files and the date of any change.
-
- b) You must cause any work that you distribute or publish, that in
- whole or in part contains or is derived from the Program or any
- part thereof, to be licensed as a whole at no charge to all third
- parties under the terms of this License.
-
- c) If the modified program normally reads commands interactively
- when run, you must cause it, when started running for such
- interactive use in the most ordinary way, to print or display an
- announcement including an appropriate copyright notice and a
- notice that there is no warranty (or else, saying that you provide
- a warranty) and that users may redistribute the program under
- these conditions, and telling the user how to view a copy of this
- License. (Exception: if the Program itself is interactive but
- does not normally print such an announcement, your work based on
- the Program is not required to print an announcement.)
-
-These requirements apply to the modified work as a whole. If
-identifiable sections of that work are not derived from the Program,
-and can be reasonably considered independent and separate works in
-themselves, then this License, and its terms, do not apply to those
-sections when you distribute them as separate works. But when you
-distribute the same sections as part of a whole which is a work based
-on the Program, the distribution of the whole must be on the terms of
-this License, whose permissions for other licensees extend to the
-entire whole, and thus to each and every part regardless of who wrote it.
-
-Thus, it is not the intent of this section to claim rights or contest
-your rights to work written entirely by you; rather, the intent is to
-exercise the right to control the distribution of derivative or
-collective works based on the Program.
-
-In addition, mere aggregation of another work not based on the Program
-with the Program (or with a work based on the Program) on a volume of
-a storage or distribution medium does not bring the other work under
-the scope of this License.
-
- 3. You may copy and distribute the Program (or a work based on it,
-under Section 2) in object code or executable form under the terms of
-Sections 1 and 2 above provided that you also do one of the following:
-
- a) Accompany it with the complete corresponding machine-readable
- source code, which must be distributed under the terms of Sections
- 1 and 2 above on a medium customarily used for software interchange; or,
-
- b) Accompany it with a written offer, valid for at least three
- years, to give any third party, for a charge no more than your
- cost of physically performing source distribution, a complete
- machine-readable copy of the corresponding source code, to be
- distributed under the terms of Sections 1 and 2 above on a medium
- customarily used for software interchange; or,
-
- c) Accompany it with the information you received as to the offer
- to distribute corresponding source code. (This alternative is
- allowed only for noncommercial distribution and only if you
- received the program in object code or executable form with such
- an offer, in accord with Subsection b above.)
-
-The source code for a work means the preferred form of the work for
-making modifications to it. For an executable work, complete source
-code means all the source code for all modules it contains, plus any
-associated interface definition files, plus the scripts used to
-control compilation and installation of the executable. However, as a
-special exception, the source code distributed need not include
-anything that is normally distributed (in either source or binary
-form) with the major components (compiler, kernel, and so on) of the
-operating system on which the executable runs, unless that component
-itself accompanies the executable.
-
-If distribution of executable or object code is made by offering
-access to copy from a designated place, then offering equivalent
-access to copy the source code from the same place counts as
-distribution of the source code, even though third parties are not
-compelled to copy the source along with the object code.
-
- 4. You may not copy, modify, sublicense, or distribute the Program
-except as expressly provided under this License. Any attempt
-otherwise to copy, modify, sublicense or distribute the Program is
-void, and will automatically terminate your rights under this License.
-However, parties who have received copies, or rights, from you under
-this License will not have their licenses terminated so long as such
-parties remain in full compliance.
-
- 5. You are not required to accept this License, since you have not
-signed it. However, nothing else grants you permission to modify or
-distribute the Program or its derivative works. These actions are
-prohibited by law if you do not accept this License. Therefore, by
-modifying or distributing the Program (or any work based on the
-Program), you indicate your acceptance of this License to do so, and
-all its terms and conditions for copying, distributing or modifying
-the Program or works based on it.
-
- 6. Each time you redistribute the Program (or any work based on the
-Program), the recipient automatically receives a license from the
-original licensor to copy, distribute or modify the Program subject to
-these terms and conditions. You may not impose any further
-restrictions on the recipients' exercise of the rights granted herein.
-You are not responsible for enforcing compliance by third parties to
-this License.
-
- 7. If, as a consequence of a court judgment or allegation of patent
-infringement or for any other reason (not limited to patent issues),
-conditions are imposed on you (whether by court order, agreement or
-otherwise) that contradict the conditions of this License, they do not
-excuse you from the conditions of this License. If you cannot
-distribute so as to satisfy simultaneously your obligations under this
-License and any other pertinent obligations, then as a consequence you
-may not distribute the Program at all. For example, if a patent
-license would not permit royalty-free redistribution of the Program by
-all those who receive copies directly or indirectly through you, then
-the only way you could satisfy both it and this License would be to
-refrain entirely from distribution of the Program.
-
-If any portion of this section is held invalid or unenforceable under
-any particular circumstance, the balance of the section is intended to
-apply and the section as a whole is intended to apply in other
-circumstances.
-
-It is not the purpose of this section to induce you to infringe any
-patents or other property right claims or to contest validity of any
-such claims; this section has the sole purpose of protecting the
-integrity of the free software distribution system, which is
-implemented by public license practices. Many people have made
-generous contributions to the wide range of software distributed
-through that system in reliance on consistent application of that
-system; it is up to the author/donor to decide if he or she is willing
-to distribute software through any other system and a licensee cannot
-impose that choice.
-
-This section is intended to make thoroughly clear what is believed to
-be a consequence of the rest of this License.
-
- 8. If the distribution and/or use of the Program is restricted in
-certain countries either by patents or by copyrighted interfaces, the
-original copyright holder who places the Program under this License
-may add an explicit geographical distribution limitation excluding
-those countries, so that distribution is permitted only in or among
-countries not thus excluded. In such case, this License incorporates
-the limitation as if written in the body of this License.
-
- 9. The Free Software Foundation may publish revised and/or new versions
-of the General Public License from time to time. Such new versions will
-be similar in spirit to the present version, but may differ in detail to
-address new problems or concerns.
-
-Each version is given a distinguishing version number. If the Program
-specifies a version number of this License which applies to it and "any
-later version", you have the option of following the terms and conditions
-either of that version or of any later version published by the Free
-Software Foundation. If the Program does not specify a version number of
-this License, you may choose any version ever published by the Free Software
-Foundation.
-
- 10. If you wish to incorporate parts of the Program into other free
-programs whose distribution conditions are different, write to the author
-to ask for permission. For software which is copyrighted by the Free
-Software Foundation, write to the Free Software Foundation; we sometimes
-make exceptions for this. Our decision will be guided by the two goals
-of preserving the free status of all derivatives of our free software and
-of promoting the sharing and reuse of software generally.
-
- NO WARRANTY
-
- 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
-FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
-OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
-PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
-OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
-MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
-TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
-PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
-REPAIR OR CORRECTION.
-
- 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
-WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
-REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
-INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
-OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
-TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
-YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
-PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
-POSSIBILITY OF SUCH DAMAGES.
+++ /dev/null
-Copyright (c) 2009 Paul Bakaus, http://jqueryui.com/
-
-This software consists of voluntary contributions made by many
-individuals (AUTHORS.txt, http://jqueryui.com/about) For exact
-contribution history, see the revision history and logs, available
-at http://jquery-ui.googlecode.com/svn/
-
-Permission is hereby granted, free of charge, to any person obtaining
-a copy of this software and associated documentation files (the
-"Software"), to deal in the Software without restriction, including
-without limitation the rights to use, copy, modify, merge, publish,
-distribute, sublicense, and/or sell copies of the Software, and to
-permit persons to whom the Software is furnished to do so, subject to
-the following conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
-MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
-LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
-OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
-WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+++ /dev/null
-== New and Noteworthy ==
-
-== 2.1.1 ==
-
-* Removed $.browser.version for jQuery < 1.1.3
-
-== 2.1 ==
-
-* Updated to work with jQuery 1.1.3
-* Added $.browser.version for jQuery < 1.1.3
-* Optimized duplication check by using child selector and using .length test
-
-== 2.0 ==
-
-* Added ability change settings like width, height, src and more.
-
-== 1.0 ==
-
-* Only adds iframe once per an element
-* Works with SSL enabled pages
\ No newline at end of file
+++ /dev/null
-{
- "name": "jQuery-bgiframe",
- "version": 2.1,
- "author": [
- "Brandon Aaron <brandon.aaron@gmail.com>"
- ],
- "abstract": "jQuery plugin for fixing z-index issues in IE6",
- "license": "mit, gpl",
- "distribution_type": "plugin",
- "requires": {
- "jQuery": ">=1.0.3"
- },
- "provides": {
- "jQuery.bgiframe": {
- "version": 2.1,
- "file": "jquery.bgiframe.js"
- }
- },
- "keywords": [
- "iframe",
- "hack",
- "zIndex",
- "z-index",
- "ie6"
- ],
- "stability": "Official",
- "meta-spec": {
- "version": 1.3,
- "url": "http://module-build.sourceforge.net/META-spec-v1.3.html"
- },
- "generated_by": "Brandon Aaron"
-}
+++ /dev/null
-<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN"
- "http://www.w3.org/TR/html4/strict.dtd">
-<html>
- <head>
- <meta http-equiv="Content-type" content="text/html; charset=utf-8">
- <title>bgiframe 2.1.1 docs</title>
- <link rel="stylesheet" type="text/css" href="http://yui.yahooapis.com/2.2.2/build/reset/reset-min.css">
- <link rel="stylesheet" type="text/css" href="http://yui.yahooapis.com/2.2.2/build/fonts/fonts-min.css">
- <style type="text/css" media="screen">
- body { margin: 25px; }
- h1 { margin: 1.0em 0; font-size: 167%; font-weight: bold; }
- #toc { margin: 0 0 3.0em; }
- #toc li { margin: 0.4em 0; font-size: 100%; }
- #qa { margin: 0 0 3.0em; }
- #qa dt.question { margin: 2.0em 0 1.0em; font-size: 122%; font-weight: bold; }
- #qa dd.answer { margin: 0 2.0em; }
- #qa dd.answer p { margin: 0 0 1.5em; }
- #qa dd.answer code { font-size: 92%; }
-
- #qa dd.answer #options dt { margin: 2.0em 0 1.0em; }
- #qa dd.answer #options dd { margin: 0 2.0em; }
-
- </style>
- </head>
- <body>
- <div id="wrapper">
- <div id="container">
- <h1>bgiframe 2.1.1</h1>
- <ul id="toc">
- <li><a href="#what_does_it_do">What does it do</a></li>
- <li><a href="#when_should_i_use_it">When should I use it</a></li>
- <li><a href="#how_do_i_use_it">How do I use it</a></li>
- <li><a href="#how_does_it_work">How does it work</a></li>
- <li><a href="#where_can_i_get_it">Where can I get it</a></li>
- <li><a href="#what_has_changed">What has changed</a></li>
- <li><a href="#suggestions_bugs_patches">Suggestions? Bugs? Patches?</a></li>
- </ul>
- <dl id="qa">
- <dt id="what_does_it_do" class="question">What does it do?</dt>
- <dd class="answer">
- <p>Have you ever experienced the select form element z-index issue in Internet Explorer 6? Most likely you have if you've implemented some sort of drop down menu navigation that shows up over a select form element.</p>
- <p>The background iframe (bgiframe) plugin provides a very small, quick and easy way to fix that problem so you don't have to worry about it. No matter the size, borders or position the bgiframe plugin can fix it.</p>
- </dd>
-
- <dt id="when_should_i_use_it" class="question">When should I use it?</dt>
- <dd class="answer">
- <p>The bgiframe plugin should be used when you are trying to show elements above a select form control in Internet Explorer 6.</p>
- </dd>
-
- <dt id="how_do_i_use_it" class="question">How do I use it?</dt>
- <dd class="answer">
- <p>The usage is simple. Just call <code>bgiframe</code> on a jQuery collection of elements.</p>
- <p><code>$('.fix-z-index').bgiframe();</code></p>
- <p>The plugin tries its best to handle most situations but sometimes some configuration is necessary. For example if your borders are defined in a unit other than pixels, you will need to manually set the <code>top</code> and <code>left</code> properties to the negative width of the border. Here are the options/settings available to configure the output.</p>
- <dl id="options">
- <dt><code>top</code></dt>
- <dd>
- <p>The iframe must be offset to the top by the width of the top border. This should be a negative number representing the border-top-width. If a number is is used here, pixels will be assumed. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the border-top-width if it is in pixels.</p>
- <p><code>$('.fix-z-index').bgiframe({ top: '-1em' });</code></p>
- </dd>
- <dt><code>left</code></dt>
- <dd>
- <p>The iframe must be offset to the left by the width of the left border. This should be a negative number representing the border-left-width. If a number is used here, pixels will be assumed. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the border-left-width if it is in pixels.</p>
- <p><code>$('.fix-z-index').bgiframe({ left: '-1em' });</code></p>
- </dd>
- <dt><code>width</code></dt>
- <dd>
- <p>This is the width of the iframe. If a number is used here, pixels will be assume. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the offsetWidth.</p>
- <p><code>$('.fix-z-index').bgiframe({ width: 100 });</code></p>
- </dd>
- <dt><code>height</code></dt>
- <dd>
- <p>This is the height of the iframe. If a number is used here, pixels will be assume. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the offsetHeight.</p>
- <p><code>$('.fix-z-index').bgiframe({ height: 100 });</code></p>
- </dd>
- <dt><code>opacity</code></dt>
- <dd>
- <p>This is a boolean representing whether or not to use opacity. If set to true, the opacity of 0 is applied. If set to false, the opacity filter is not applied. Default: true.</p>
- <p><code>$('.fix-z-index').bgiframe({ opacity: false });</code></p>
- </dd>
- <dt><code>src</code></dt>
- <dd>
- <p>This setting is provided so that one could change the src of the iframe to whatever they need. Default: "javascript:false;"</p>
- <p><code>$('.fix-z-index').bgiframe({ src: '#' });</code></p>
- </dd>
- </dl>
- </dd>
-
- <dt id="how_does_it_work" class="question">How does it work?</dt>
- <dd class="answer">
- <p>The bgiframe plugin works by prepending an iframe to the element. The iframe is given a class of bgiframe and positioned below all the other children of the element. In the default configuration it automatically adjusts to the width and height of the element (including the borders) and the opacity is set to 0. The element needs to have position (relative or absolute) and should have a background (color or image).</p>
- <p>Check out the <a href="http://brandonaaron.net/jquery/plugins/bgiframe/test/">test page</a> to see the plugin in action.</p>
- </dd>
-
- <dt id="where_can_i_get_it" class="question">Where can I get it?</dt>
- <dd class="answer">
- <ul>
- <li><a href="http://jquery.com/plugins/files/bgiframe-2.1.zip">2.1 zip</a> from the bgiframe <a href="http://jquery.com/plugins/project/bgiframe">project page</a>.</li>
- <li>Latest SVN: http://jqueryjs.googlecode.com/svn/trunk/plugins/bgiframe/</li>
- <li>Tagged Versions in SVN: Latest SVN: http://jqueryjs.googlecode.com/svn/tags/plugins/bgiframe/</li>
- </ul>
- </dd>
-
- <dt id="suggestions_bugs_patches" class="question">Suggestions? Bugs? Patches?</dt>
- <dd class="answer">
- <p>Feel free to make any suggestions, bug reports or add any patches via the <a href="http://jquery.com/plugins/project/bgiframe">project page</a>.</p>
- </dd>
- </dl>
- <p>The bgiframe plugin is authored by <a href="http://blog.brandonaaron.net/">Brandon Aaron (http://brandonaaron.net/)</a></p>
- </div>
- </div>
- </body>
-</html>
\ No newline at end of file
+++ /dev/null
-/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
- * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
- * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
- *
- * $LastChangedDate: 2007-07-21 18:44:59 -0500 (Sat, 21 Jul 2007) $
- * $Rev: 2446 $
- *
- * Version 2.1.1
- */
-
-(function($){
-
-/**
- * The bgiframe is chainable and applies the iframe hack to get
- * around zIndex issues in IE6. It will only apply itself in IE6
- * and adds a class to the iframe called 'bgiframe'. The iframe
- * is appeneded as the first child of the matched element(s)
- * with a tabIndex and zIndex of -1.
- *
- * By default the plugin will take borders, sized with pixel units,
- * into account. If a different unit is used for the border's width,
- * then you will need to use the top and left settings as explained below.
- *
- * NOTICE: This plugin has been reported to cause perfromance problems
- * when used on elements that change properties (like width, height and
- * opacity) a lot in IE6. Most of these problems have been caused by
- * the expressions used to calculate the elements width, height and
- * borders. Some have reported it is due to the opacity filter. All
- * these settings can be changed if needed as explained below.
- *
- * @example $('div').bgiframe();
- * @before <div><p>Paragraph</p></div>
- * @result <div><iframe class="bgiframe".../><p>Paragraph</p></div>
- *
- * @param Map settings Optional settings to configure the iframe.
- * @option String|Number top The iframe must be offset to the top
- * by the width of the top border. This should be a negative
- * number representing the border-top-width. If a number is
- * is used here, pixels will be assumed. Otherwise, be sure
- * to specify a unit. An expression could also be used.
- * By default the value is "auto" which will use an expression
- * to get the border-top-width if it is in pixels.
- * @option String|Number left The iframe must be offset to the left
- * by the width of the left border. This should be a negative
- * number representing the border-left-width. If a number is
- * is used here, pixels will be assumed. Otherwise, be sure
- * to specify a unit. An expression could also be used.
- * By default the value is "auto" which will use an expression
- * to get the border-left-width if it is in pixels.
- * @option String|Number width This is the width of the iframe. If
- * a number is used here, pixels will be assume. Otherwise, be sure
- * to specify a unit. An experssion could also be used.
- * By default the value is "auto" which will use an experssion
- * to get the offsetWidth.
- * @option String|Number height This is the height of the iframe. If
- * a number is used here, pixels will be assume. Otherwise, be sure
- * to specify a unit. An experssion could also be used.
- * By default the value is "auto" which will use an experssion
- * to get the offsetHeight.
- * @option Boolean opacity This is a boolean representing whether or not
- * to use opacity. If set to true, the opacity of 0 is applied. If
- * set to false, the opacity filter is not applied. Default: true.
- * @option String src This setting is provided so that one could change
- * the src of the iframe to whatever they need.
- * Default: "javascript:false;"
- *
- * @name bgiframe
- * @type jQuery
- * @cat Plugins/bgiframe
- * @author Brandon Aaron (brandon.aaron@gmail.com || http://brandonaaron.net)
- */
-$.fn.bgIframe = $.fn.bgiframe = function(s) {
- // This is only for IE6
- if ( $.browser.msie && /6.0/.test(navigator.userAgent) ) {
- s = $.extend({
- top : 'auto', // auto == .currentStyle.borderTopWidth
- left : 'auto', // auto == .currentStyle.borderLeftWidth
- width : 'auto', // auto == offsetWidth
- height : 'auto', // auto == offsetHeight
- opacity : true,
- src : 'javascript:false;'
- }, s || {});
- var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
- html = '<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+
- 'style="display:block;position:absolute;z-index:-1;'+
- (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
- 'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+
- 'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+
- 'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
- 'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
- '"/>';
- return this.each(function() {
- if ( $('> iframe.bgiframe', this).length == 0 )
- this.insertBefore( document.createElement(html), this.firstChild );
- });
- }
- return this;
-};
-
-})(jQuery);
\ No newline at end of file
+++ /dev/null
-/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
- * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
- * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
- *
- * $LastChangedDate: 2007-07-21 18:45:56 -0500 (Sat, 21 Jul 2007) $
- * $Rev: 2447 $
- *
- * Version 2.1.1
- */
-(function($){$.fn.bgIframe=$.fn.bgiframe=function(s){if($.browser.msie&&/6.0/.test(navigator.userAgent)){s=$.extend({top:'auto',left:'auto',width:'auto',height:'auto',opacity:true,src:'javascript:false;'},s||{});var prop=function(n){return n&&n.constructor==Number?n+'px':n;},html='<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+'style="display:block;position:absolute;z-index:-1;'+(s.opacity!==false?'filter:Alpha(Opacity=\'0\');':'')+'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+'"/>';return this.each(function(){if($('> iframe.bgiframe',this).length==0)this.insertBefore(document.createElement(html),this.firstChild);});}return this;};})(jQuery);
\ No newline at end of file
+++ /dev/null
-/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
- * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
- * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
- *
- * $LastChangedDate: 2007-07-21 18:44:59 -0500 (Sat, 21 Jul 2007) $
- * $Rev: 2446 $
- *
- * Version 2.1.1
- */
-eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('(b($){$.m.E=$.m.g=b(s){h($.x.10&&/6.0/.I(D.B)){s=$.w({c:\'3\',5:\'3\',8:\'3\',d:\'3\',k:M,e:\'F:i;\'},s||{});C a=b(n){f n&&n.t==r?n+\'4\':n},p=\'<o Y="g"W="0"R="-1"e="\'+s.e+\'"\'+\'Q="P:O;N:L;z-H:-1;\'+(s.k!==i?\'G:J(K=\\\'0\\\');\':\'\')+\'c:\'+(s.c==\'3\'?\'7(((l(2.9.j.A)||0)*-1)+\\\'4\\\')\':a(s.c))+\';\'+\'5:\'+(s.5==\'3\'?\'7(((l(2.9.j.y)||0)*-1)+\\\'4\\\')\':a(s.5))+\';\'+\'8:\'+(s.8==\'3\'?\'7(2.9.S+\\\'4\\\')\':a(s.8))+\';\'+\'d:\'+(s.d==\'3\'?\'7(2.9.v+\\\'4\\\')\':a(s.d))+\';\'+\'"/>\';f 2.T(b(){h($(\'> o.g\',2).U==0)2.V(q.X(p),2.u)})}f 2}})(Z);',62,63,'||this|auto|px|left||expression|width|parentNode||function|top|height|src|return|bgiframe|if|false|currentStyle|opacity|parseInt|fn||iframe|html|document|Number||constructor|firstChild|offsetHeight|extend|browser|borderLeftWidth||borderTopWidth|userAgent|var|navigator|bgIframe|javascript|filter|index|test|Alpha|Opacity|absolute|true|position|block|display|style|tabindex|offsetWidth|each|length|insertBefore|frameborder|createElement|class|jQuery|msie'.split('|'),0,{}))
\ No newline at end of file
+++ /dev/null
-<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN"
- "http://www.w3.org/TR/html4/strict.dtd">
-<html debug="true">
- <head>
- <meta http-equiv="Content-type" content="text/html; charset=utf-8">
- <title>jQuery bgiframe Visual Test</title>
-
- <!-- load latest build of jquery.js -->
- <script type="text/javascript" src="../../../jquery/dist/jquery.js"></script>
-
- <!-- load dimensions.js (this is what we're testing! -->
- <script type="text/javascript" src="../jquery.bgiframe.js"></script>
-
- <!-- load firebug lite
- <script type="text/javascript" src="http://brandon.jquery.com/firebuglite/firebug.js"></script>-->
-
- <link rel="Stylesheet" media="screen" href="../../../jquery/test/data/testsuite.css" />
-
- <script type="text/javascript" charset="utf-8">
- $(function() {
- $('#userAgent').html(navigator.userAgent);
- $('#box2').bgiframe();
- $('#box3').bgiframe({top: -5, left: -5});
- $('#box4').bgiframe({top: -5, left: -5, width: 270, height: 120});
- $('#box5').bgiframe({top: 0, left: 0, width: 260, height: 110});
- $('#box6').bgiframe({top: '-5px', left: '-5px', width: '270px', height: '120px'});
- $('#box7').bgiframe({top: '-.5em', left: '-.5em', width: '17em', height: '12em'});
- $('#box8').bgiframe({top: '-.5em', left: '-.5em'});
- $('#box9').bgiframe({opacity:false});
- });
- </script>
-
- <style type="text/css" media="screen">
- #wrapper { position: relative; width: 100%; font: 12px Arial; }
- form { position: absolute; top: 0; left: 0; width: 100%; }
- select { position: relative; width: 100%; margin: 0 0 2px; z-index: 1; }
-
- .box { position: relative; z-index: 2; float: left; margin: 5px; border: 5px solid #666; padding: 5px; width: 250px; height: 100px; color: #000; background-color: #999; }
- dl { margin: 0; padding: 0; }
- dt { float: left; margin: 0; padding: 0; width: 50px; }
- dd { margin: 0; padding: 0; }
- #box7, #box8 { border-width: .5em; padding: .5em; width: 15em; height: 10em; }
- </style>
- </head>
- <body>
- <h1 id="banner">jQuery bgiframe - Visual Test</h1>
- <h2 id="userAgent"></h2>
- <div id="wrapper">
- <form action="#" method="get" accept-charset="utf-8">
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
- </form>
-
- <div id="box1" class="box">nothing</div>
- <div id="box2" class="box">
- <dl>
- <dt>top:</dt>
- <dd>'auto'</dd>
-
- <dt>left:</dt>
- <dd>'auto'</dd>
-
- <dt>width:</dt>
- <dd>'auto'</dd>
-
- <dt>height:</dt>
- <dd>'auto'</dd>
- </dl>
- </div>
- <div id="box3" class="box">
- <dl>
- <dt>top:</dt>
- <dd>0</dd>
-
- <dt>left:</dt>
- <dd>0</dd>
-
- <dt>width:</dt>
- <dd>'auto'</dd>
-
- <dt>height:</dt>
- <dd>'auto'</dd>
- </dl>
- </div>
- <div id="box4" class="box">
- <dl>
- <dt>top:</dt>
- <dd>-5</dd>
-
- <dt>left:</dt>
- <dd>-5</dd>
-
- <dt>width:</dt>
- <dd>270</dd>
-
- <dt>height:</dt>
- <dd>120</dd>
- </dl>
- </div>
- <div id="box5" class="box">
- <dl>
- <dt>top:</dt>
- <dd>0</dd>
-
- <dt>left:</dt>
- <dd>0</dd>
-
- <dt>width:</dt>
- <dd>260</dd>
-
- <dt>height:</dt>
- <dd>110</dd>
- </dl>
- </div>
- <div id="box6" class="box">
- <dl>
- <dt>top:</dt>
- <dd>'-5px'</dd>
-
- <dt>left:</dt>
- <dd>'-5px'</dd>
-
- <dt>width:</dt>
- <dd>'270px'</dd>
-
- <dt>height:</dt>
- <dd>'120px'</dd>
- </dl>
- </div>
- <div id="box7" class="box">
- <dl>
- <dt>top:</dt>
- <dd>'-.5em'</dd>
-
- <dt>left:</dt>
- <dd>'-.5em'</dd>
-
- <dt>width:</dt>
- <dd>'17em'</dd>
-
- <dt>height:</dt>
- <dd>'12em'</dd>
- </dl>
- </div>
- <div id="box8" class="box">
- <dl>
- <dt>top:</dt>
- <dd>'-.5em'</dd>
-
- <dt>left:</dt>
- <dd>'-.5em'</dd>
-
- <dt>width:</dt>
- <dd>'auto'</dd>
-
- <dt>height:</dt>
- <dd>'auto'</dd>
- </dl>
- </div>
- <div id="box9" class="box">
- <dl>
- <dt>top:</dt>
- <dd>'auto'</dd>
-
- <dt>left:</dt>
- <dd>'auto'</dd>
-
- <dt>width:</dt>
- <dd>'auto'</dd>
-
- <dt>height:</dt>
- <dd>'auto'</dd>
-
- <dt>opacity:</dt>
- <dd>false</dd>
- </dl>
- </div>
- </div>
- </body>
-</html>
\ No newline at end of file
+++ /dev/null
-/**
- * Cookie plugin
- *
- * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
- * Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
- *
- */
-jQuery.cookie=function(name,value,options){if(typeof value!='undefined'){options=options||{};if(value===null){value='';options=$.extend({},options);options.expires=-1;}var expires='';if(options.expires&&(typeof options.expires=='number'||options.expires.toUTCString)){var date;if(typeof options.expires=='number'){date=new Date();date.setTime(date.getTime()+(options.expires*24*60*60*1000));}else{date=options.expires;}expires='; expires='+date.toUTCString();}var path=options.path?'; path='+(options.path):'';var domain=options.domain?'; domain='+(options.domain):'';var secure=options.secure?'; secure':'';document.cookie=[name,'=',encodeURIComponent(value),expires,path,domain,secure].join('');}else{var cookieValue=null;if(document.cookie&&document.cookie!=''){var cookies=document.cookie.split(';');for(var i=0;i<cookies.length;i++){var cookie=jQuery.trim(cookies[i]);if(cookie.substring(0,name.length+1)==(name+'=')){cookieValue=decodeURIComponent(cookie.substring(name.length+1));break;}}}return cookieValue;}};
\ No newline at end of file
+++ /dev/null
-/**
- * Cookie plugin
- *
- * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
- * Dual licensed under the MIT and GPL licenses:
- * http://www.opensource.org/licenses/mit-license.php
- * http://www.gnu.org/licenses/gpl.html
- *
- */
-eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('q.5=x(k,d,a){4(m d!=\'H\'){a=a||{};4(d===p){d=\'\';a=$.A({},a);a.3=-1}2 g=\'\';4(a.3&&(m a.3==\'u\'||a.3.s)){2 f;4(m a.3==\'u\'){f=F C();f.B(f.z()+(a.3*y*o*o*v))}n{f=a.3}g=\'; 3=\'+f.s()}2 b=a.7?\'; 7=\'+(a.7):\'\';2 e=a.9?\'; 9=\'+(a.9):\'\';2 l=a.t?\'; t\':\'\';6.5=[k,\'=\',L(d),g,b,e,l].K(\'\')}n{2 h=p;4(6.5&&6.5!=\'\'){2 c=6.5.E(\';\');D(2 i=0;i<c.8;i++){2 j=q.G(c[i]);4(j.r(0,k.8+1)==(k+\'=\')){h=I(j.r(k.8+1));J}}}w h}};',48,48,'||var|expires|if|cookie|document|path|length|domain|||||||||||||typeof|else|60|null|jQuery|substring|toUTCString|secure|number|1000|return|function|24|getTime|extend|setTime|Date|for|split|new|trim|undefined|decodeURIComponent|break|join|encodeURIComponent'.split('|'),0,{}))
\ No newline at end of file
+++ /dev/null
-/*
- * Javascript Diff Algorithm
- * By John Resig (http://ejohn.org/)
- * Modified by Chu Alan "sprite"
- *
- * More Info:
- * http://ejohn.org/projects/javascript-diff-algorithm/
- */
-
-function escape(s) {
- var n = s;
- n = n.replace(/&/g, "&");
- n = n.replace(/</g, "<");
- n = n.replace(/>/g, ">");
- n = n.replace(/"/g, """);
-
- return n;
-}
-
-function diffString( o, n ) {
- o = o.replace(/\s+$/, '');
- n = n.replace(/\s+$/, '');
-
- var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/) );
- var str = "";
-
- var oSpace = o.match(/\s+/g);
- if (oSpace == null) {
- oSpace = ["\n"];
- } else {
- oSpace.push("\n");
- }
- var nSpace = n.match(/\s+/g);
- if (nSpace == null) {
- nSpace = ["\n"];
- } else {
- nSpace.push("\n");
- }
-
- if (out.n.length == 0) {
- for (var i = 0; i < out.o.length; i++) {
- str += '<del>' + escape(out.o[i]) + oSpace[i] + "</del>";
- }
- } else {
- if (out.n[0].text == null) {
- for (n = 0; n < out.o.length && out.o[n].text == null; n++) {
- str += '<del>' + escape(out.o[n]) + oSpace[n] + "</del>";
- }
- }
-
- for ( var i = 0; i < out.n.length; i++ ) {
- if (out.n[i].text == null) {
- str += '<ins>' + escape(out.n[i]) + nSpace[i] + "</ins>";
- } else {
- var pre = "";
-
- for (n = out.n[i].row + 1; n < out.o.length && out.o[n].text == null; n++ ) {
- pre += '<del>' + escape(out.o[n]) + oSpace[n] + "</del>";
- }
- str += " " + out.n[i].text + nSpace[i] + pre;
- }
- }
- }
-
- return str;
-}
-
-function randomColor() {
- return "rgb(" + (Math.random() * 100) + "%, " +
- (Math.random() * 100) + "%, " +
- (Math.random() * 100) + "%)";
-}
-function diffString2( o, n ) {
- o = o.replace(/\s+$/, '');
- n = n.replace(/\s+$/, '');
-
- var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/) );
-
- var oSpace = o.match(/\s+/g);
- if (oSpace == null) {
- oSpace = ["\n"];
- } else {
- oSpace.push("\n");
- }
- var nSpace = n.match(/\s+/g);
- if (nSpace == null) {
- nSpace = ["\n"];
- } else {
- nSpace.push("\n");
- }
-
- var os = "";
- var colors = new Array();
- for (var i = 0; i < out.o.length; i++) {
- colors[i] = randomColor();
-
- if (out.o[i].text != null) {
- os += '<span style="background-color: ' +colors[i]+ '">' +
- escape(out.o[i].text) + oSpace[i] + "</span>";
- } else {
- os += "<del>" + escape(out.o[i]) + oSpace[i] + "</del>";
- }
- }
-
- var ns = "";
- for (var i = 0; i < out.n.length; i++) {
- if (out.n[i].text != null) {
- ns += '<span style="background-color: ' +colors[out.n[i].row]+ '">' +
- escape(out.n[i].text) + nSpace[i] + "</span>";
- } else {
- ns += "<ins>" + escape(out.n[i]) + nSpace[i] + "</ins>";
- }
- }
-
- return { o : os , n : ns };
-}
-
-function diff( o, n ) {
- var ns = new Object();
- var os = new Object();
-
- for ( var i = 0; i < n.length; i++ ) {
- if ( ns[ n[i] ] == null )
- ns[ n[i] ] = { rows: new Array(), o: null };
- ns[ n[i] ].rows.push( i );
- }
-
- for ( var i = 0; i < o.length; i++ ) {
- if ( os[ o[i] ] == null )
- os[ o[i] ] = { rows: new Array(), n: null };
- os[ o[i] ].rows.push( i );
- }
-
- for ( var i in ns ) {
- if ( ns[i].rows.length == 1 && typeof(os[i]) != "undefined" && os[i].rows.length == 1 ) {
- n[ ns[i].rows[0] ] = { text: n[ ns[i].rows[0] ], row: os[i].rows[0] };
- o[ os[i].rows[0] ] = { text: o[ os[i].rows[0] ], row: ns[i].rows[0] };
- }
- }
-
- for ( var i = 0; i < n.length - 1; i++ ) {
- if ( n[i].text != null && n[i+1].text == null && n[i].row + 1 < o.length && o[ n[i].row + 1 ].text == null &&
- n[i+1] == o[ n[i].row + 1 ] ) {
- n[i+1] = { text: n[i+1], row: n[i].row + 1 };
- o[n[i].row+1] = { text: o[n[i].row+1], row: i + 1 };
- }
- }
-
- for ( var i = n.length - 1; i > 0; i-- ) {
- if ( n[i].text != null && n[i-1].text == null && n[i].row > 0 && o[ n[i].row - 1 ].text == null &&
- n[i-1] == o[ n[i].row - 1 ] ) {
- n[i-1] = { text: n[i-1], row: n[i].row - 1 };
- o[n[i].row-1] = { text: o[n[i].row-1], row: i - 1 };
- }
- }
-
- return { o: o, n: n };
-}
-
+++ /dev/null
-/*
- * QUnit - jQuery unit testrunner
- *
- * http://docs.jquery.com/QUnit
- *
- * Copyright (c) 2008 John Resig, Jörn Zaefferer
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * $Id: testrunner.js 6173 2009-02-02 20:09:32Z jeresig $
- */
-
-(function($) {
-
-// Tests for equality any JavaScript type and structure without unexpected results.
-// Discussions and reference: http://philrathe.com/articles/equiv
-// Test suites: http://philrathe.com/tests/equiv
-// Author: Philippe Rathé <prathe@gmail.com>
-var equiv = function () {
-
- var innerEquiv; // the real equiv function
- var callers = []; // stack to decide between skip/abort functions
-
- // Determine what is o.
- function hoozit(o) {
- if (typeof o === "string") {
- return "string";
-
- } else if (typeof o === "boolean") {
- return "boolean";
-
- } else if (typeof o === "number") {
-
- if (isNaN(o)) {
- return "nan";
- } else {
- return "number";
- }
-
- } else if (typeof o === "undefined") {
- return "undefined";
-
- // consider: typeof null === object
- } else if (o === null) {
- return "null";
-
- // consider: typeof [] === object
- } else if (o instanceof Array) {
- return "array";
-
- // consider: typeof new Date() === object
- } else if (o instanceof Date) {
- return "date";
-
- // consider: /./ instanceof Object;
- // /./ instanceof RegExp;
- // typeof /./ === "function"; // => false in IE and Opera,
- // true in FF and Safari
- } else if (o instanceof RegExp) {
- return "regexp";
-
- } else if (typeof o === "object") {
- return "object";
-
- } else if (o instanceof Function) {
- return "function";
- }
- }
-
- // Call the o related callback with the given arguments.
- function bindCallbacks(o, callbacks, args) {
- var prop = hoozit(o);
- if (prop) {
- if (hoozit(callbacks[prop]) === "function") {
- return callbacks[prop].apply(callbacks, args);
- } else {
- return callbacks[prop]; // or undefined
- }
- }
- }
-
- var callbacks = function () {
-
- // for string, boolean, number and null
- function useStrictEquality(b, a) {
- return a === b;
- }
-
- return {
- "string": useStrictEquality,
- "boolean": useStrictEquality,
- "number": useStrictEquality,
- "null": useStrictEquality,
- "undefined": useStrictEquality,
-
- "nan": function (b) {
- return isNaN(b);
- },
-
- "date": function (b, a) {
- return hoozit(b) === "date" && a.valueOf() === b.valueOf();
- },
-
- "regexp": function (b, a) {
- return hoozit(b) === "regexp" &&
- a.source === b.source && // the regex itself
- a.global === b.global && // and its modifers (gmi) ...
- a.ignoreCase === b.ignoreCase &&
- a.multiline === b.multiline;
- },
-
- // - skip when the property is a method of an instance (OOP)
- // - abort otherwise,
- // initial === would have catch identical references anyway
- "function": function () {
- var caller = callers[callers.length - 1];
- return caller !== Object &&
- typeof caller !== "undefined";
- },
-
- "array": function (b, a) {
- var i;
- var len;
-
- // b could be an object literal here
- if ( ! (hoozit(b) === "array")) {
- return false;
- }
-
- len = a.length;
- if (len !== b.length) { // safe and faster
- return false;
- }
- for (i = 0; i < len; i++) {
- if( ! innerEquiv(a[i], b[i])) {
- return false;
- }
- }
- return true;
- },
-
- "object": function (b, a) {
- var i;
- var eq = true; // unless we can proove it
- var aProperties = [], bProperties = []; // collection of strings
-
- // comparing constructors is more strict than using instanceof
- if ( a.constructor !== b.constructor) {
- return false;
- }
-
- // stack constructor before traversing properties
- callers.push(a.constructor);
-
- for (i in a) { // be strict: don't ensures hasOwnProperty and go deep
-
- aProperties.push(i); // collect a's properties
-
- if ( ! innerEquiv(a[i], b[i])) {
- eq = false;
- }
- }
-
- callers.pop(); // unstack, we are done
-
- for (i in b) {
- bProperties.push(i); // collect b's properties
- }
-
- // Ensures identical properties name
- return eq && innerEquiv(aProperties.sort(), bProperties.sort());
- }
- };
- }();
-
- innerEquiv = function () { // can take multiple arguments
- var args = Array.prototype.slice.apply(arguments);
- if (args.length < 2) {
- return true; // end transition
- }
-
- return (function (a, b) {
- if (a === b) {
- return true; // catch the most you can
-
- } else if (typeof a !== typeof b || a === null || b === null || typeof a === "undefined" || typeof b === "undefined") {
- return false; // don't lose time with error prone cases
-
- } else {
- return bindCallbacks(a, callbacks, [b, a]);
- }
-
- // apply transition with (1..n) arguments
- })(args[0], args[1]) && arguments.callee.apply(this, args.splice(1, args.length -1));
- };
-
- return innerEquiv;
-}(); // equiv
-
-var GETParams = $.map( location.search.slice(1).split('&'), decodeURIComponent ),
- ngindex = $.inArray("noglobals", GETParams),
- noglobals = ngindex !== -1;
-
-if( noglobals )
- GETParams.splice( ngindex, 1 );
-
-var config = {
- stats: {
- all: 0,
- bad: 0
- },
- queue: [],
- // block until document ready
- blocking: true,
- //restrict modules/tests by get parameters
- filters: GETParams,
- isLocal: !!(window.location.protocol == 'file:')
-};
-
-// public API as global methods
-$.extend(window, {
- test: test,
- module: module,
- expect: expect,
- ok: ok,
- equals: equals,
- start: start,
- stop: stop,
- reset: reset,
- isLocal: config.isLocal,
- same: function(a, b, message) {
- push(equiv(a, b), a, b, message);
- },
- QUnit: {
- equiv: equiv,
- ok: ok,
- done: function(failures, total){},
- log: function(result, message){}
- },
- // legacy methods below
- isSet: isSet,
- isObj: isObj,
- compare: function() {
- throw "compare is deprecated - use same() instead";
- },
- compare2: function() {
- throw "compare2 is deprecated - use same() instead";
- },
- serialArray: function() {
- throw "serialArray is deprecated - use jsDump.parse() instead";
- },
- q: q,
- t: t,
- url: url,
- triggerEvent: triggerEvent
-});
-
-$(window).load(function() {
- $('#userAgent').html(navigator.userAgent);
- var head = $('<div class="testrunner-toolbar"><label for="filter-pass">Hide passed tests</label></div>').insertAfter("#userAgent");
- $('<input type="checkbox" id="filter-pass" />').attr("disabled", true).prependTo(head).click(function() {
- $('li.pass')[this.checked ? 'hide' : 'show']();
- });
- $('<input type="checkbox" id="filter-missing">').attr("disabled", true).appendTo(head).click(function() {
- $("li.fail:contains('missing test - untested code is broken code')").parent('ol').parent('li.fail')[this.checked ? 'hide' : 'show']();
- });
- $("#filter-missing").after('<label for="filter-missing">Hide missing tests (untested code is broken code)</label>');
- runTest();
-});
-
-function synchronize(callback) {
- config.queue.push(callback);
- if(!config.blocking) {
- process();
- }
-}
-
-function process() {
- while(config.queue.length && !config.blocking) {
- config.queue.shift()();
- }
-}
-
-function stop(timeout) {
- config.blocking = true;
- if (timeout)
- config.timeout = setTimeout(function() {
- QUnit.ok( false, "Test timed out" );
- start();
- }, timeout);
-}
-function start() {
- // A slight delay, to avoid any current callbacks
- setTimeout(function() {
- if(config.timeout)
- clearTimeout(config.timeout);
- config.blocking = false;
- process();
- }, 13);
-}
-
-function validTest( name ) {
- var i = config.filters.length,
- run = false;
-
- if( !i )
- return true;
-
- while( i-- ){
- var filter = config.filters[i],
- not = filter.charAt(0) == '!';
- if( not )
- filter = filter.slice(1);
- if( name.indexOf(filter) != -1 )
- return !not;
- if( not )
- run = true;
- }
- return run;
-}
-
-function runTest() {
- config.blocking = false;
- var started = +new Date;
- config.fixture = document.getElementById('main').innerHTML;
- config.ajaxSettings = $.ajaxSettings;
- synchronize(function() {
- $('<p id="testresult" class="result"/>').html(['Tests completed in ',
- +new Date - started, ' milliseconds.<br/>',
- '<span class="bad">', config.stats.bad, '</span> tests of <span class="all">', config.stats.all, '</span> failed.']
- .join(''))
- .appendTo("body");
- $("#banner").addClass(config.stats.bad ? "fail" : "pass");
- QUnit.done( config.stats.bad, config.stats.all );
- });
-}
-
-var pollution;
-
-function saveGlobal(){
- pollution = [ ];
-
- if( noglobals )
- for( var key in window )
- pollution.push(key);
-}
-function checkPollution( name ){
- var old = pollution;
- saveGlobal();
-
- if( pollution.length > old.length ){
- ok( false, "Introduced global variable(s): " + diff(old, pollution).join(", ") );
- config.expected++;
- }
-}
-
-function diff( clean, dirty ){
- return $.grep( dirty, function(name){
- return $.inArray( name, clean ) == -1;
- });
-}
-
-function test(name, callback) {
- if(config.currentModule)
- name = config.currentModule + " module: " + name;
- var lifecycle = $.extend({
- setup: function() {},
- teardown: function() {}
- }, config.moduleLifecycle);
-
- if ( !validTest(name) )
- return;
-
- synchronize(function() {
- config.assertions = [];
- config.expected = null;
- try {
- if( !pollution )
- saveGlobal();
- lifecycle.setup();
- } catch(e) {
- QUnit.ok( false, "Setup failed on " + name + ": " + e.message );
- }
- })
- synchronize(function() {
- try {
- callback();
- } catch(e) {
- if( typeof console != "undefined" && console.error && console.warn ) {
- console.error("Test " + name + " died, exception and test follows");
- console.error(e);
- console.warn(callback.toString());
- }
- QUnit.ok( false, "Died on test #" + (config.assertions.length + 1) + ": " + e.message );
- // else next test will carry the responsibility
- saveGlobal();
- }
- });
- synchronize(function() {
- try {
- checkPollution();
- lifecycle.teardown();
- } catch(e) {
- QUnit.ok( false, "Teardown failed on " + name + ": " + e.message );
- }
- })
- synchronize(function() {
- try {
- reset();
- } catch(e) {
- if( typeof console != "undefined" && console.error && console.warn ) {
- console.error("reset() failed, following Test " + name + ", exception and reset fn follows");
- console.error(e);
- console.warn(reset.toString());
- }
- }
-
- if(config.expected && config.expected != config.assertions.length) {
- QUnit.ok( false, "Expected " + config.expected + " assertions, but " + config.assertions.length + " were run" );
- }
-
- var good = 0, bad = 0;
- var ol = $("<ol/>").hide();
- config.stats.all += config.assertions.length;
- for ( var i = 0; i < config.assertions.length; i++ ) {
- var assertion = config.assertions[i];
- $("<li/>").addClass(assertion.result ? "pass" : "fail").text(assertion.message || "(no message)").appendTo(ol);
- assertion.result ? good++ : bad++;
- }
- config.stats.bad += bad;
-
- var b = $("<strong/>").html(name + " <b style='color:black;'>(<b class='fail'>" + bad + "</b>, <b class='pass'>" + good + "</b>, " + config.assertions.length + ")</b>")
- .click(function(){
- $(this).next().toggle();
- })
- .dblclick(function(event) {
- var target = $(event.target).filter("strong").clone();
- if ( target.length ) {
- target.children().remove();
- location.href = location.href.match(/^(.+?)(\?.*)?$/)[1] + "?" + encodeURIComponent($.trim(target.text()));
- }
- });
-
- $("<li/>").addClass(bad ? "fail" : "pass").append(b).append(ol).appendTo("#tests");
-
- if(bad) {
- $("#filter-pass").attr("disabled", null);
- $("#filter-missing").attr("disabled", null);
- }
- });
-}
-
-// call on start of module test to prepend name to all tests
-function module(name, lifecycle) {
- config.currentModule = name;
- config.moduleLifecycle = lifecycle;
-}
-
-/**
- * Specify the number of expected assertions to gurantee that failed test (no assertions are run at all) don't slip through.
- */
-function expect(asserts) {
- config.expected = asserts;
-}
-
-/**
- * Resets the test setup. Useful for tests that modify the DOM.
- */
-function reset() {
- $("#main").html( config.fixture );
- $.event.global = {};
- $.ajaxSettings = $.extend({}, config.ajaxSettings);
-}
-
-/**
- * Asserts true.
- * @example ok( $("a").size() > 5, "There must be at least 5 anchors" );
- */
-function ok(a, msg) {
- QUnit.log(a, msg);
-
- config.assertions.push({
- result: !!a,
- message: msg
- });
-}
-
-/**
- * Asserts that two arrays are the same
- */
-function isSet(a, b, msg) {
- function serialArray( a ) {
- var r = [];
-
- if ( a && a.length )
- for ( var i = 0; i < a.length; i++ ) {
- var str = a[i].nodeName;
- if ( str ) {
- str = str.toLowerCase();
- if ( a[i].id )
- str += "#" + a[i].id;
- } else
- str = a[i];
- r.push( str );
- }
-
- return "[ " + r.join(", ") + " ]";
- }
- var ret = true;
- if ( a && b && a.length != undefined && a.length == b.length ) {
- for ( var i = 0; i < a.length; i++ )
- if ( a[i] != b[i] )
- ret = false;
- } else
- ret = false;
- QUnit.ok( ret, !ret ? (msg + " expected: " + serialArray(b) + " result: " + serialArray(a)) : msg );
-}
-
-/**
- * Asserts that two objects are equivalent
- */
-function isObj(a, b, msg) {
- var ret = true;
-
- if ( a && b ) {
- for ( var i in a )
- if ( a[i] != b[i] )
- ret = false;
-
- for ( i in b )
- if ( a[i] != b[i] )
- ret = false;
- } else
- ret = false;
-
- QUnit.ok( ret, msg );
-}
-
-/**
- * Returns an array of elements with the given IDs, eg.
- * @example q("main", "foo", "bar")
- * @result [<div id="main">, <span id="foo">, <input id="bar">]
- */
-function q() {
- var r = [];
- for ( var i = 0; i < arguments.length; i++ )
- r.push( document.getElementById( arguments[i] ) );
- return r;
-}
-
-/**
- * Asserts that a select matches the given IDs
- * @example t("Check for something", "//[a]", ["foo", "baar"]);
- * @result returns true if "//[a]" return two elements with the IDs 'foo' and 'baar'
- */
-function t(a,b,c) {
- var f = $(b);
- var s = "";
- for ( var i = 0; i < f.length; i++ )
- s += (s && ",") + '"' + f[i].id + '"';
- isSet(f, q.apply(q,c), a + " (" + b + ")");
-}
-
-/**
- * Add random number to url to stop IE from caching
- *
- * @example url("data/test.html")
- * @result "data/test.html?10538358428943"
- *
- * @example url("data/test.php?foo=bar")
- * @result "data/test.php?foo=bar&10538358345554"
- */
-function url(value) {
- return value + (/\?/.test(value) ? "&" : "?") + new Date().getTime() + "" + parseInt(Math.random()*100000);
-}
-
-/**
- * Checks that the first two arguments are equal, with an optional message.
- * Prints out both actual and expected values.
- *
- * Prefered to ok( actual == expected, message )
- *
- * @example equals( $.format("Received {0} bytes.", 2), "Received 2 bytes." );
- *
- * @param Object actual
- * @param Object expected
- * @param String message (optional)
- */
-function equals(actual, expected, message) {
- push(expected == actual, actual, expected, message);
-}
-
-function push(result, actual, expected, message) {
- message = message || (result ? "okay" : "failed");
- QUnit.ok( result, result ? message + ": " + expected : message + ", expected: " + jsDump.parse(expected) + " result: " + jsDump.parse(actual) );
-}
-
-/**
- * Trigger an event on an element.
- *
- * @example triggerEvent( document.body, "click" );
- *
- * @param DOMElement elem
- * @param String type
- */
-function triggerEvent( elem, type, event ) {
- if ( $.browser.mozilla || $.browser.opera ) {
- event = document.createEvent("MouseEvents");
- event.initMouseEvent(type, true, true, elem.ownerDocument.defaultView,
- 0, 0, 0, 0, 0, false, false, false, false, 0, null);
- elem.dispatchEvent( event );
- } else if ( $.browser.msie ) {
- elem.fireEvent("on"+type);
- }
-}
-
-})(jQuery);
-
-/**
- * jsDump
- * Copyright (c) 2008 Ariel Flesler - aflesler(at)gmail(dot)com | http://flesler.blogspot.com
- * Licensed under BSD (http://www.opensource.org/licenses/bsd-license.php)
- * Date: 5/15/2008
- * @projectDescription Advanced and extensible data dumping for Javascript.
- * @version 1.0.0
- * @author Ariel Flesler
- * @link {http://flesler.blogspot.com/2008/05/jsdump-pretty-dump-of-any-javascript.html}
- */
-(function(){
- function quote( str ){
- return '"' + str.toString().replace(/"/g, '\\"') + '"';
- };
- function literal( o ){
- return o + '';
- };
- function join( pre, arr, post ){
- var s = jsDump.separator(),
- base = jsDump.indent();
- inner = jsDump.indent(1);
- if( arr.join )
- arr = arr.join( ',' + s + inner );
- if( !arr )
- return pre + post;
- return [ pre, inner + arr, base + post ].join(s);
- };
- function array( arr ){
- var i = arr.length, ret = Array(i);
- this.up();
- while( i-- )
- ret[i] = this.parse( arr[i] );
- this.down();
- return join( '[', ret, ']' );
- };
-
- var reName = /^function (\w+)/;
-
- var jsDump = window.jsDump = {
- parse:function( obj, type ){//type is used mostly internally, you can fix a (custom)type in advance
- var parser = this.parsers[ type || this.typeOf(obj) ];
- type = typeof parser;
-
- return type == 'function' ? parser.call( this, obj ) :
- type == 'string' ? parser :
- this.parsers.error;
- },
- typeOf:function( obj ){
- var type = typeof obj,
- f = 'function';//we'll use it 3 times, save it
- return type != 'object' && type != f ? type :
- !obj ? 'null' :
- obj.exec ? 'regexp' :// some browsers (FF) consider regexps functions
- obj.getHours ? 'date' :
- obj.scrollBy ? 'window' :
- obj.nodeName == '#document' ? 'document' :
- obj.nodeName ? 'node' :
- obj.item ? 'nodelist' : // Safari reports nodelists as functions
- obj.callee ? 'arguments' :
- obj.call || obj.constructor != Array && //an array would also fall on this hack
- (obj+'').indexOf(f) != -1 ? f : //IE reports functions like alert, as objects
- 'length' in obj ? 'array' :
- type;
- },
- separator:function(){
- return this.multiline ? this.HTML ? '<br />' : '\n' : this.HTML ? ' ' : ' ';
- },
- indent:function( extra ){// extra can be a number, shortcut for increasing-calling-decreasing
- if( !this.multiline )
- return '';
- var chr = this.indentChar;
- if( this.HTML )
- chr = chr.replace(/\t/g,' ').replace(/ /g,' ');
- return Array( this._depth_ + (extra||0) ).join(chr);
- },
- up:function( a ){
- this._depth_ += a || 1;
- },
- down:function( a ){
- this._depth_ -= a || 1;
- },
- setParser:function( name, parser ){
- this.parsers[name] = parser;
- },
- // The next 3 are exposed so you can use them
- quote:quote,
- literal:literal,
- join:join,
- //
- _depth_: 1,
- // This is the list of parsers, to modify them, use jsDump.setParser
- parsers:{
- window: '[Window]',
- document: '[Document]',
- error:'[ERROR]', //when no parser is found, shouldn't happen
- unknown: '[Unknown]',
- 'null':'null',
- undefined:'undefined',
- 'function':function( fn ){
- var ret = 'function',
- name = 'name' in fn ? fn.name : (reName.exec(fn)||[])[1];//functions never have name in IE
- if( name )
- ret += ' ' + name;
- ret += '(';
-
- ret = [ ret, this.parse( fn, 'functionArgs' ), '){'].join('');
- return join( ret, this.parse(fn,'functionCode'), '}' );
- },
- array: array,
- nodelist: array,
- arguments: array,
- object:function( map ){
- var ret = [ ];
- this.up();
- for( var key in map )
- ret.push( this.parse(key,'key') + ': ' + this.parse(map[key]) );
- this.down();
- return join( '{', ret, '}' );
- },
- node:function( node ){
- var open = this.HTML ? '<' : '<',
- close = this.HTML ? '>' : '>';
-
- var tag = node.nodeName.toLowerCase(),
- ret = open + tag;
-
- for( var a in this.DOMAttrs ){
- var val = node[this.DOMAttrs[a]];
- if( val )
- ret += ' ' + a + '=' + this.parse( val, 'attribute' );
- }
- return ret + close + open + '/' + tag + close;
- },
- functionArgs:function( fn ){//function calls it internally, it's the arguments part of the function
- var l = fn.length;
- if( !l ) return '';
-
- var args = Array(l);
- while( l-- )
- args[l] = String.fromCharCode(97+l);//97 is 'a'
- return ' ' + args.join(', ') + ' ';
- },
- key:quote, //object calls it internally, the key part of an item in a map
- functionCode:'[code]', //function calls it internally, it's the content of the function
- attribute:quote, //node calls it internally, it's an html attribute value
- string:quote,
- date:quote,
- regexp:literal, //regex
- number:literal,
- 'boolean':literal
- },
- DOMAttrs:{//attributes to dump from nodes, name=>realName
- id:'id',
- name:'name',
- 'class':'className'
- },
- HTML:false,//if true, entities are escaped ( <, >, \t, space and \n )
- indentChar:' ',//indentation unit
- multiline:true //if true, items in a collection, are separated by a \n, else just a space.
- };
-
-})();
+++ /dev/null
-body, div, h1 { font-family: 'trebuchet ms', verdana, arial; margin: 0; padding: 0 }
-body {font-size: 10pt; }
-h1 { padding: 15px; font-size: large; background-color: #06b; color: white; }
-h1 a { color: white; }
-h2 { padding: 10px; background-color: #eee; color: black; margin: 0; font-size: small; font-weight: normal }
-
-.pass { color: green; }
-.fail { color: red; }
-p.result { margin-left: 1em; }
-
-#banner { height: 2em; border-bottom: 1px solid white; }
-h2.pass { background-color: green; }
-h2.fail { background-color: red; }
-
-div.testrunner-toolbar { background: #eee; border-top: 1px solid black; padding: 10px; }
-
-ol#tests > li > strong { cursor:pointer; }
-
-div#fx-tests h4 {
- background: red;
-}
-
-div#fx-tests h4.pass {
- background: green;
-}
-
-div#fx-tests div.box {
- background: red url(data/cow.jpg) no-repeat;
- overflow: hidden;
- border: 2px solid #000;
-}
-
-div#fx-tests div.overflow {
- overflow: visible;
-}
-
-div.inline {
- display: inline;
-}
-
-div.autoheight {
- height: auto;
-}
-
-div.autowidth {
- width: auto;
-}
-
-div.autoopacity {
- opacity: auto;
-}
-
-div.largewidth {
- width: 100px;
-}
-
-div.largeheight {
- height: 100px;
-}
-
-div.largeopacity {
- filter: progid:DXImageTransform.Microsoft.Alpha(opacity=100);
-}
-
-div.medwidth {
- width: 50px;
-}
-
-div.medheight {
- height: 50px;
-}
-
-div.medopacity {
- opacity: 0.5;
- filter: progid:DXImageTransform.Microsoft.Alpha(opacity=50);
-}
-
-div.nowidth {
- width: 0px;
-}
-
-div.noheight {
- height: 0px;
-}
-
-div.noopacity {
- opacity: 0;
- filter: progid:DXImageTransform.Microsoft.Alpha(opacity=0);
-}
-
-div.hidden {
- display: none;
-}
-
-div#fx-tests div.widewidth {
- background-repeat: repeat-x;
-}
-
-div#fx-tests div.wideheight {
- background-repeat: repeat-y;
-}
-
-div#fx-tests div.widewidth.wideheight {
- background-repeat: repeat;
-}
-
-div#fx-tests div.noback {
- background-image: none;
-}
-
-div.chain, div.chain div { width: 100px; height: 20px; position: relative; float: left; }
-div.chain div { position: absolute; top: 0px; left: 0px; }
-
-div.chain.test { background: red; }
-div.chain.test div { background: green; }
-
-div.chain.out { background: green; }
-div.chain.out div { background: red; display: none; }
-
-div#show-tests * { display: none; }
+++ /dev/null
-/*
- * jquery.simulate - simulate browser mouse and keyboard events
- *
- * Copyright (c) 2009 Eduardo Lundgren (eduardolundgren@gmail.com)
- * and Richard D. Worth (rdworth@gmail.com)
- *
- * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
- * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
- *
- */
-
-;(function($) {
-
-$.fn.extend({
- simulate: function(type, options) {
- return this.each(function() {
- var opt = $.extend({}, $.simulate.defaults, options || {});
- new $.simulate(this, type, opt);
- });
- }
-});
-
-$.simulate = function(el, type, options) {
- this.target = el;
- this.options = options;
-
- if (/^drag$/.test(type)) {
- this[type].apply(this, [this.target, options]);
- } else {
- this.simulateEvent(el, type, options);
- }
-}
-
-$.extend($.simulate.prototype, {
- simulateEvent: function(el, type, options) {
- var evt = this.createEvent(type, options);
- this.dispatchEvent(el, type, evt, options);
- return evt;
- },
- createEvent: function(type, options) {
- if (/^mouse(over|out|down|up|move)|(dbl)?click$/.test(type)) {
- return this.mouseEvent(type, options);
- } else if (/^key(up|down|press)$/.test(type)) {
- return this.keyboardEvent(type, options);
- }
- },
- mouseEvent: function(type, options) {
- var evt;
- var e = $.extend({
- bubbles: true, cancelable: (type != "mousemove"), view: window, detail: 0,
- screenX: 0, screenY: 0, clientX: 0, clientY: 0,
- ctrlKey: false, altKey: false, shiftKey: false, metaKey: false,
- button: 0, relatedTarget: undefined
- }, options);
-
- var relatedTarget = $(e.relatedTarget)[0];
-
- if ($.isFunction(document.createEvent)) {
- evt = document.createEvent("MouseEvents");
- evt.initMouseEvent(type, e.bubbles, e.cancelable, e.view, e.detail,
- e.screenX, e.screenY, e.clientX, e.clientY,
- e.ctrlKey, e.altKey, e.shiftKey, e.metaKey,
- e.button, e.relatedTarget || document.body.parentNode);
- } else if (document.createEventObject) {
- evt = document.createEventObject();
- $.extend(evt, e);
- evt.button = { 0:1, 1:4, 2:2 }[evt.button] || evt.button;
- }
- return evt;
- },
- keyboardEvent: function(type, options) {
- var evt;
-
- var e = $.extend({ bubbles: true, cancelable: true, view: window,
- ctrlKey: false, altKey: false, shiftKey: false, metaKey: false,
- keyCode: 0, charCode: 0
- }, options);
-
- if ($.isFunction(document.createEvent)) {
- try {
- evt = document.createEvent("KeyEvents");
- evt.initKeyEvent(type, e.bubbles, e.cancelable, e.view,
- e.ctrlKey, e.altKey, e.shiftKey, e.metaKey,
- e.keyCode, e.charCode);
- } catch(err) {
- evt = document.createEvent("Events");
- evt.initEvent(type, e.bubbles, e.cancelable);
- $.extend(evt, { view: e.view,
- ctrlKey: e.ctrlKey, altKey: e.altKey, shiftKey: e.shiftKey, metaKey: e.metaKey,
- keyCode: e.keyCode, charCode: e.charCode
- });
- }
- } else if (document.createEventObject) {
- evt = document.createEventObject();
- $.extend(evt, e);
- }
- if ($.browser.msie || $.browser.opera) {
- evt.keyCode = (e.charCode > 0) ? e.charCode : e.keyCode;
- evt.charCode = undefined;
- }
- return evt;
- },
-
- dispatchEvent: function(el, type, evt) {
- if (el.dispatchEvent) {
- el.dispatchEvent(evt);
- } else if (el.fireEvent) {
- el.fireEvent('on' + type, evt);
- }
- return evt;
- },
-
- drag: function(el) {
- var self = this, center = this.findCenter(this.target),
- options = this.options, x = Math.floor(center.x), y = Math.floor(center.y),
- dx = options.dx || 0, dy = options.dy || 0, target = this.target;
- var coord = { clientX: x, clientY: y };
- this.simulateEvent(target, "mousedown", coord);
- coord = { clientX: x + 1, clientY: y + 1 };
- this.simulateEvent(document, "mousemove", coord);
- coord = { clientX: x + dx, clientY: y + dy };
- this.simulateEvent(document, "mousemove", coord);
- this.simulateEvent(document, "mousemove", coord);
- this.simulateEvent(target, "mouseup", coord);
- },
- findCenter: function(el) {
- var el = $(this.target), o = el.offset();
- return {
- x: o.left + el.outerWidth() / 2,
- y: o.top + el.outerHeight() / 2
- };
- }
-});
-
-$.extend($.simulate, {
- defaults: {
- speed: 'sync'
- },
- VK_TAB: 9,
- VK_ENTER: 13,
- VK_ESC: 27,
- VK_PGUP: 33,
- VK_PGDN: 34,
- VK_END: 35,
- VK_HOME: 36,
- VK_LEFT: 37,
- VK_UP: 38,
- VK_RIGHT: 39,
- VK_DOWN: 40
-});
-
-})(jQuery);
+++ /dev/null
-\r
-/*\r
-* jQuery UI CSS Framework\r
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)\r
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.\r
-* To view and modify this theme, visit http://jqueryui.com/themeroller/\r
-*/\r
-\r
-/*** Begin CORE ***/\r
-\r
-/* Layout helpers\r
-----------------------------------*/\r
-.ui-helper-hidden { display: none; }\r
-.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }\r
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }\r
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }\r
-.ui-helper-clearfix { display: inline-block; }\r
-/* required comment for clearfix to work in Opera \*/\r
-* html .ui-helper-clearfix { height:1%; }\r
-.ui-helper-clearfix { display:block; }\r
-/* end clearfix */\r
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }*/\r
-\r
-\r
-/* Interaction Cues\r
-----------------------------------*/\r
-.ui-state-disabled { cursor: default !important; }\r
-\r
-\r
-/* Icons\r
-----------------------------------*/\r
-\r
-/* states and images */\r
-.ui-icon { display: block; text-indents: -99999px; overflow: hidden; background-repeat: no-repeat; }\r
-\r
-\r
-/* Misc visuals\r
-----------------------------------*/\r
-\r
-/* Overlays */\r
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }\r
-\r
-/*** End Core ***/\r
-\r
-\r
-/*** Begin THEME ***/\r
-\r
-/* Component containers\r
-----------------------------------*/\r
-.ui-widget { font-family: Arial,sans-serif/*{ffDefault}*/; font-size: 11px/*{fsDefault}*/; }\r
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Arial,sans-serif/*{ffDefault}*/; font-size: 11px; }\r
-.ui-widget-content { border: none/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png) 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*//*{bgContentRepeat}*/; color: #A9A9A9/*{fcContent}*/; }\r
-.ui-widget-content a { color: #A9A9A9/*{fcContent}*/; }\r
-.ui-widget-header { border: none/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*//*{bgHeaderRepeat}*/; color: #565656/*{fcHeader}*/; font-weight: bold; }\r
-.ui-widget-header a { color: #000/*{fcHeader}*/; }\r
-\r
-\r
-\r
-/* Interaction states\r
-----------------------------------*/\r
-.ui-state-default, .ui-widget-content .ui-state-default { border: none/*{borderColorDefault}*/; background: none/*{bgColorDefault}*/ /*{bgDefaultXPos}*/ /*{bgDefaultYPos}*/ /*{bgDefaultRepeat}*//*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #333/*{fcDefault}*/; outline: none; }\r
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #000/*{fcDefault}*/; text-decoration: none; outline: none; }\r
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: none/*{borderColorHover}*/; background: none/*{bgColorHover}*/ none /*{bgHoverXPos}*/ /*{bgHoverYPos}*/ /*{bgHoverRepeat}*//*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #222/*{fcHover}*/; outline: none; }\r
-.ui-state-hover a, .ui-state-hover a:hover { color: #000/*{fcHover}*/; text-decoration: none; outline: none; }\r
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #ccc/*{borderColorActive}*/; background: none/*{bgColorActive}*/ /*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*//*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; }\r
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; }\r
-\r
-/* Interaction Cues\r
-----------------------------------*/\r
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*//*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }\r
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }\r
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png) 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*//*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }\r
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a/*{fcError}*/; }\r
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }\r
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }\r
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }\r
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }\r
-\r
-/* Icons\r
-----------------------------------*/\r
-\r
-/* states and images */\r
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }\r
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }\r
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }\r
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }\r
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }\r
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }\r
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }\r
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }\r
-\r
-/* positioning */\r
-.ui-icon-carat-1-n { background-position: 0 0; }\r
-.ui-icon-carat-1-ne { background-position: -16px 0; }\r
-.ui-icon-carat-1-e { background-position: -32px 0; }\r
-.ui-icon-carat-1-se { background-position: -48px 0; }\r
-.ui-icon-carat-1-s { background-position: -64px 0; }\r
-.ui-icon-carat-1-sw { background-position: -80px 0; }\r
-.ui-icon-carat-1-w { background-position: -96px 0; }\r
-.ui-icon-carat-1-nw { background-position: -112px 0; }\r
-.ui-icon-carat-2-n-s { background-position: -128px 0; }\r
-.ui-icon-carat-2-e-w { background-position: -144px 0; }\r
-.ui-icon-triangle-1-n { background-position: 0 -16px; }\r
-.ui-icon-triangle-1-ne { background-position: -16px -16px; }\r
-.ui-icon-triangle-1-e { background-position: -32px -16px; }\r
-.ui-icon-triangle-1-se { background-position: -48px -16px; }\r
-.ui-icon-triangle-1-s { background-position: -64px -16px; }\r
-.ui-icon-triangle-1-sw { background-position: -80px -16px; }\r
-.ui-icon-triangle-1-w { background-position: -96px -16px; }\r
-.ui-icon-triangle-1-nw { background-position: -112px -16px; }\r
-.ui-icon-triangle-2-n-s { background-position: -128px -16px; }\r
-.ui-icon-triangle-2-e-w { background-position: -144px -16px; }\r
-.ui-icon-arrow-1-n { background-position: 0 -32px; }\r
-.ui-icon-arrow-1-ne { background-position: -16px -32px; }\r
-.ui-icon-arrow-1-e { background-position: -32px -32px; }\r
-.ui-icon-arrow-1-se { background-position: -48px -32px; }\r
-.ui-icon-arrow-1-s { background-position: -64px -32px; }\r
-.ui-icon-arrow-1-sw { background-position: -80px -32px; }\r
-.ui-icon-arrow-1-w { background-position: -96px -32px; }\r
-.ui-icon-arrow-1-nw { background-position: -112px -32px; }\r
-.ui-icon-arrow-2-n-s { background-position: -128px -32px; }\r
-.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }\r
-.ui-icon-arrow-2-e-w { background-position: -160px -32px; }\r
-.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }\r
-.ui-icon-arrowstop-1-n { background-position: -192px -32px; }\r
-.ui-icon-arrowstop-1-e { background-position: -208px -32px; }\r
-.ui-icon-arrowstop-1-s { background-position: -224px -32px; }\r
-.ui-icon-arrowstop-1-w { background-position: -240px -32px; }\r
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }\r
-.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }\r
-.ui-icon-arrowthick-1-e { background-position: -32px -48px; }\r
-.ui-icon-arrowthick-1-se { background-position: -48px -48px; }\r
-.ui-icon-arrowthick-1-s { background-position: -64px -48px; }\r
-.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }\r
-.ui-icon-arrowthick-1-w { background-position: -96px -48px; }\r
-.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }\r
-.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }\r
-.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }\r
-.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }\r
-.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }\r
-.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }\r
-.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }\r
-.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }\r
-.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }\r
-.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }\r
-.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }\r
-.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }\r
-.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }\r
-.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }\r
-.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }\r
-.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }\r
-.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }\r
-.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }\r
-.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }\r
-.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }\r
-.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }\r
-.ui-icon-arrow-4 { background-position: 0 -80px; }\r
-.ui-icon-arrow-4-diag { background-position: -16px -80px; }\r
-.ui-icon-extlink { background-position: -32px -80px; }\r
-.ui-icon-newwin { background-position: -48px -80px; }\r
-.ui-icon-refresh { background-position: -64px -80px; }\r
-.ui-icon-shuffle { background-position: -80px -80px; }\r
-.ui-icon-transfer-e-w { background-position: -96px -80px; }\r
-.ui-icon-transferthick-e-w { background-position: -112px -80px; }\r
-.ui-icon-folder-collapsed { background-position: 0 -96px; }\r
-.ui-icon-folder-open { background-position: -16px -96px; }\r
-.ui-icon-document { background-position: -32px -96px; }\r
-.ui-icon-document-b { background-position: -48px -96px; }\r
-.ui-icon-note { background-position: -64px -96px; }\r
-.ui-icon-mail-closed { background-position: -80px -96px; }\r
-.ui-icon-mail-open { background-position: -96px -96px; }\r
-.ui-icon-suitcase { background-position: -112px -96px; }\r
-.ui-icon-comment { background-position: -128px -96px; }\r
-.ui-icon-person { background-position: -144px -96px; }\r
-.ui-icon-print { background-position: -160px -96px; }\r
-.ui-icon-trash { background-position: -176px -96px; }\r
-.ui-icon-locked { background-position: -192px -96px; }\r
-.ui-icon-unlocked { background-position: -208px -96px; }\r
-.ui-icon-bookmark { background-position: -224px -96px; }\r
-.ui-icon-tag { background-position: -240px -96px; }\r
-.ui-icon-home { background-position: 0 -112px; }\r
-.ui-icon-flag { background-position: -16px -112px; }\r
-.ui-icon-calendar { background-position: -32px -112px; }\r
-.ui-icon-cart { background-position: -48px -112px; }\r
-.ui-icon-pencil { background-position: -64px -112px; }\r
-.ui-icon-clock { background-position: -80px -112px; }\r
-.ui-icon-disk { background-position: -96px -112px; }\r
-.ui-icon-calculator { background-position: -112px -112px; }\r
-.ui-icon-zoomin { background-position: -128px -112px; }\r
-.ui-icon-zoomout { background-position: -144px -112px; }\r
-.ui-icon-search { background-position: -160px -112px; }\r
-.ui-icon-wrench { background-position: -176px -112px; }\r
-.ui-icon-gear { background-position: -192px -112px; }\r
-.ui-icon-heart { background-position: -208px -112px; }\r
-.ui-icon-star { background-position: -224px -112px; }\r
-.ui-icon-link { background-position: -240px -112px; }\r
-.ui-icon-cancel { background-position: 0 -128px; }\r
-.ui-icon-plus { background-position: -16px -128px; }\r
-.ui-icon-plusthick { background-position: -32px -128px; }\r
-.ui-icon-minus { background-position: -48px -128px; }\r
-.ui-icon-minusthick { background-position: -64px -128px; }\r
-.ui-icon-close { background-position: -80px -128px; }\r
-.ui-icon-closethick { background-position: -96px -128px; }\r
-.ui-icon-key { background-position: -112px -128px; }\r
-.ui-icon-lightbulb { background-position: -128px -128px; }\r
-.ui-icon-scissors { background-position: -144px -128px; }\r
-.ui-icon-clipboard { background-position: -160px -128px; }\r
-.ui-icon-copy { background-position: -176px -128px; }\r
-.ui-icon-contact { background-position: -192px -128px; }\r
-.ui-icon-image { background-position: -208px -128px; }\r
-.ui-icon-video { background-position: -224px -128px; }\r
-.ui-icon-script { background-position: -240px -128px; }\r
-.ui-icon-alert { background-position: 0 -144px; }\r
-.ui-icon-info { background-position: -16px -144px; }\r
-.ui-icon-notice { background-position: -32px -144px; }\r
-.ui-icon-help { background-position: -48px -144px; }\r
-.ui-icon-check { background-position: -64px -144px; }\r
-.ui-icon-bullet { background-position: -80px -144px; }\r
-.ui-icon-radio-off { background-position: -96px -144px; }\r
-.ui-icon-radio-on { background-position: -112px -144px; }\r
-.ui-icon-pin-w { background-position: -128px -144px; }\r
-.ui-icon-pin-s { background-position: -144px -144px; }\r
-.ui-icon-play { background-position: 0 -160px; }\r
-.ui-icon-pause { background-position: -16px -160px; }\r
-.ui-icon-seek-next { background-position: -32px -160px; }\r
-.ui-icon-seek-prev { background-position: -48px -160px; }\r
-.ui-icon-seek-end { background-position: -64px -160px; }\r
-.ui-icon-seek-first { background-position: -80px -160px; }\r
-.ui-icon-stop { background-position: -96px -160px; }\r
-.ui-icon-eject { background-position: -112px -160px; }\r
-.ui-icon-volume-off { background-position: -128px -160px; }\r
-.ui-icon-volume-on { background-position: -144px -160px; }\r
-.ui-icon-power { background-position: 0 -176px; }\r
-.ui-icon-signal-diag { background-position: -16px -176px; }\r
-.ui-icon-signal { background-position: -32px -176px; }\r
-.ui-icon-battery-0 { background-position: -48px -176px; }\r
-.ui-icon-battery-1 { background-position: -64px -176px; }\r
-.ui-icon-battery-2 { background-position: -80px -176px; }\r
-.ui-icon-battery-3 { background-position: -96px -176px; }\r
-.ui-icon-circle-plus { background-position: 0 -192px; }\r
-.ui-icon-circle-minus { background-position: -16px -192px; }\r
-.ui-icon-circle-close { background-position: -32px -192px; }\r
-.ui-icon-circle-triangle-e { background-position: -48px -192px; }\r
-.ui-icon-circle-triangle-s { background-position: -64px -192px; }\r
-.ui-icon-circle-triangle-w { background-position: -80px -192px; }\r
-.ui-icon-circle-triangle-n { background-position: -96px -192px; }\r
-.ui-icon-circle-arrow-e { background-position: -112px -192px; }\r
-.ui-icon-circle-arrow-s { background-position: -128px -192px; }\r
-.ui-icon-circle-arrow-w { background-position: -144px -192px; }\r
-.ui-icon-circle-arrow-n { background-position: -160px -192px; }\r
-.ui-icon-circle-zoomin { background-position: -176px -192px; }\r
-.ui-icon-circle-zoomout { background-position: -192px -192px; }\r
-.ui-icon-circle-check { background-position: -208px -192px; }\r
-.ui-icon-circlesmall-plus { background-position: 0 -208px; }\r
-.ui-icon-circlesmall-minus { background-position: -16px -208px; }\r
-.ui-icon-circlesmall-close { background-position: -32px -208px; }\r
-.ui-icon-squaresmall-plus { background-position: -48px -208px; }\r
-.ui-icon-squaresmall-minus { background-position: -64px -208px; }\r
-.ui-icon-squaresmall-close { background-position: -80px -208px; }\r
-.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }\r
-.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }\r
-.ui-icon-grip-solid-vertical { background-position: -32px -224px; }\r
-.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }\r
-.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }\r
-.ui-icon-grip-diagonal-se { background-position: -80px -224px; }\r
-\r
-\r
-/* Misc visuals\r
-----------------------------------*/\r
-\r
-/* Corner radius */\r
-.ui-corner-tl { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-tr { -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-bl { -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-br { -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-top { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-bottom { -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-right { -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-left { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; }\r
-.ui-corner-all { -moz-border-radius: 5px/*{cornerRadius}*/; -webkit-border-radius: 5px/*{cornerRadius}*/; }\r
-\r
-/* Overlays */\r
-.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*//*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }\r
-.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*//*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; }\r
-\r
-\r
-
+++ /dev/null
-/* Accordion
-----------------------------------*/
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
-.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
+++ /dev/null
-@import "ui.base.css";
-@import "ui.theme.css";
+++ /dev/null
-@import url("ui.core.css");
-@import url("ui.resizable.css");
-@import url("ui.accordion.css");
-@import url("ui.dialog.css");
-@import url("ui.slider.css");
-@import url("ui.tabs.css");
-@import url("ui.datepicker.css");
-@import url("ui.progressbar.css");
\ No newline at end of file
+++ /dev/null
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* Layout helpers
-----------------------------------*/
-.ui-helper-hidden { display: none; }
-.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
-.ui-helper-clearfix { display: inline-block; }
-/* required comment for clearfix to work in Opera \*/
-* html .ui-helper-clearfix { height:1%; }
-.ui-helper-clearfix { display:block; }
-/* end clearfix */
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
-
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-disabled { cursor: default !important; }
-
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Overlays */
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file
+++ /dev/null
-/* Datepicker
-----------------------------------*/
-.ui-datepicker { width: 17em; padding: .2em .2em 0; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month,
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
- display: none; /*sorry for IE5*/
- display/**/: block; /*sorry for IE5*/
- position: absolute; /*must have*/
- z-index: -1; /*must have*/
- filter: mask(); /*must have*/
- top: -4px; /*must have*/
- left: -4px; /*must have*/
- width: 200px; /*must have*/
- height: 200px; /*must have*/
-}
\ No newline at end of file
+++ /dev/null
-/* Dialog
-----------------------------------*/
-.ui-dialog { position: relative; padding: .2em; width: 300px; }
-.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
+++ /dev/null
-/* Progressbar
-----------------------------------*/
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
+++ /dev/null
-/* Resizable
-----------------------------------*/
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
+++ /dev/null
-/* Slider
-----------------------------------*/
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
+++ /dev/null
-/* Tabs
-----------------------------------*/
-.ui-tabs { padding: .2em; zoom: 1; }
-.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
-.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
+++ /dev/null
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* To view and modify this theme, visit http://jqueryui.com/themeroller/
-*/
-
-
-/* Component containers
-----------------------------------*/
-.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
-.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_glass_75_ffffff_1x400.png)/*{bgImgUrlContent}*/ 0/*{bgContentXPos}*/ 0/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
-.ui-widget-content a { color: #222222/*{fcContent}*/; }
-.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 0/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; }
-.ui-widget-header a { color: #222222/*{fcHeader}*/; }
-
-/* Interaction states
-----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 0/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; outline: none; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; outline: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 0/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; outline: none; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; outline: none; }
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 0/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; }
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 0/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_inset-soft_95_fef1ec_1x100.png)/*{bgImgUrlError}*/ 0/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #363636/*{fcError}*/; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }
-
-/* positioning */
-.ui-icon-carat-1-n { background-position: 0 0; }
-.ui-icon-carat-1-ne { background-position: -16px 0; }
-.ui-icon-carat-1-e { background-position: -32px 0; }
-.ui-icon-carat-1-se { background-position: -48px 0; }
-.ui-icon-carat-1-s { background-position: -64px 0; }
-.ui-icon-carat-1-sw { background-position: -80px 0; }
-.ui-icon-carat-1-w { background-position: -96px 0; }
-.ui-icon-carat-1-nw { background-position: -112px 0; }
-.ui-icon-carat-2-n-s { background-position: -128px 0; }
-.ui-icon-carat-2-e-w { background-position: -144px 0; }
-.ui-icon-triangle-1-n { background-position: 0 -16px; }
-.ui-icon-triangle-1-ne { background-position: -16px -16px; }
-.ui-icon-triangle-1-e { background-position: -32px -16px; }
-.ui-icon-triangle-1-se { background-position: -48px -16px; }
-.ui-icon-triangle-1-s { background-position: -64px -16px; }
-.ui-icon-triangle-1-sw { background-position: -80px -16px; }
-.ui-icon-triangle-1-w { background-position: -96px -16px; }
-.ui-icon-triangle-1-nw { background-position: -112px -16px; }
-.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
-.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
-.ui-icon-arrow-1-n { background-position: 0 -32px; }
-.ui-icon-arrow-1-ne { background-position: -16px -32px; }
-.ui-icon-arrow-1-e { background-position: -32px -32px; }
-.ui-icon-arrow-1-se { background-position: -48px -32px; }
-.ui-icon-arrow-1-s { background-position: -64px -32px; }
-.ui-icon-arrow-1-sw { background-position: -80px -32px; }
-.ui-icon-arrow-1-w { background-position: -96px -32px; }
-.ui-icon-arrow-1-nw { background-position: -112px -32px; }
-.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
-.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
-.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
-.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
-.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
-.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
-.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
-.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
-.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
-.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
-.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
-.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
-.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
-.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
-.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
-.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
-.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
-.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
-.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
-.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
-.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
-.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
-.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
-.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
-.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
-.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
-.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
-.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
-.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
-.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
-.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
-.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
-.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
-.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
-.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
-.ui-icon-arrow-4 { background-position: 0 -80px; }
-.ui-icon-arrow-4-diag { background-position: -16px -80px; }
-.ui-icon-extlink { background-position: -32px -80px; }
-.ui-icon-newwin { background-position: -48px -80px; }
-.ui-icon-refresh { background-position: -64px -80px; }
-.ui-icon-shuffle { background-position: -80px -80px; }
-.ui-icon-transfer-e-w { background-position: -96px -80px; }
-.ui-icon-transferthick-e-w { background-position: -112px -80px; }
-.ui-icon-folder-collapsed { background-position: 0 -96px; }
-.ui-icon-folder-open { background-position: -16px -96px; }
-.ui-icon-document { background-position: -32px -96px; }
-.ui-icon-document-b { background-position: -48px -96px; }
-.ui-icon-note { background-position: -64px -96px; }
-.ui-icon-mail-closed { background-position: -80px -96px; }
-.ui-icon-mail-open { background-position: -96px -96px; }
-.ui-icon-suitcase { background-position: -112px -96px; }
-.ui-icon-comment { background-position: -128px -96px; }
-.ui-icon-person { background-position: -144px -96px; }
-.ui-icon-print { background-position: -160px -96px; }
-.ui-icon-trash { background-position: -176px -96px; }
-.ui-icon-locked { background-position: -192px -96px; }
-.ui-icon-unlocked { background-position: -208px -96px; }
-.ui-icon-bookmark { background-position: -224px -96px; }
-.ui-icon-tag { background-position: -240px -96px; }
-.ui-icon-home { background-position: 0 -112px; }
-.ui-icon-flag { background-position: -16px -112px; }
-.ui-icon-calendar { background-position: -32px -112px; }
-.ui-icon-cart { background-position: -48px -112px; }
-.ui-icon-pencil { background-position: -64px -112px; }
-.ui-icon-clock { background-position: -80px -112px; }
-.ui-icon-disk { background-position: -96px -112px; }
-.ui-icon-calculator { background-position: -112px -112px; }
-.ui-icon-zoomin { background-position: -128px -112px; }
-.ui-icon-zoomout { background-position: -144px -112px; }
-.ui-icon-search { background-position: -160px -112px; }
-.ui-icon-wrench { background-position: -176px -112px; }
-.ui-icon-gear { background-position: -192px -112px; }
-.ui-icon-heart { background-position: -208px -112px; }
-.ui-icon-star { background-position: -224px -112px; }
-.ui-icon-link { background-position: -240px -112px; }
-.ui-icon-cancel { background-position: 0 -128px; }
-.ui-icon-plus { background-position: -16px -128px; }
-.ui-icon-plusthick { background-position: -32px -128px; }
-.ui-icon-minus { background-position: -48px -128px; }
-.ui-icon-minusthick { background-position: -64px -128px; }
-.ui-icon-close { background-position: -80px -128px; }
-.ui-icon-closethick { background-position: -96px -128px; }
-.ui-icon-key { background-position: -112px -128px; }
-.ui-icon-lightbulb { background-position: -128px -128px; }
-.ui-icon-scissors { background-position: -144px -128px; }
-.ui-icon-clipboard { background-position: -160px -128px; }
-.ui-icon-copy { background-position: -176px -128px; }
-.ui-icon-contact { background-position: -192px -128px; }
-.ui-icon-image { background-position: -208px -128px; }
-.ui-icon-video { background-position: -224px -128px; }
-.ui-icon-script { background-position: -240px -128px; }
-.ui-icon-alert { background-position: 0 -144px; }
-.ui-icon-info { background-position: -16px -144px; }
-.ui-icon-notice { background-position: -32px -144px; }
-.ui-icon-help { background-position: -48px -144px; }
-.ui-icon-check { background-position: -64px -144px; }
-.ui-icon-bullet { background-position: -80px -144px; }
-.ui-icon-radio-off { background-position: -96px -144px; }
-.ui-icon-radio-on { background-position: -112px -144px; }
-.ui-icon-pin-w { background-position: -128px -144px; }
-.ui-icon-pin-s { background-position: -144px -144px; }
-.ui-icon-play { background-position: 0 -160px; }
-.ui-icon-pause { background-position: -16px -160px; }
-.ui-icon-seek-next { background-position: -32px -160px; }
-.ui-icon-seek-prev { background-position: -48px -160px; }
-.ui-icon-seek-end { background-position: -64px -160px; }
-.ui-icon-seek-first { background-position: -80px -160px; }
-.ui-icon-stop { background-position: -96px -160px; }
-.ui-icon-eject { background-position: -112px -160px; }
-.ui-icon-volume-off { background-position: -128px -160px; }
-.ui-icon-volume-on { background-position: -144px -160px; }
-.ui-icon-power { background-position: 0 -176px; }
-.ui-icon-signal-diag { background-position: -16px -176px; }
-.ui-icon-signal { background-position: -32px -176px; }
-.ui-icon-battery-0 { background-position: -48px -176px; }
-.ui-icon-battery-1 { background-position: -64px -176px; }
-.ui-icon-battery-2 { background-position: -80px -176px; }
-.ui-icon-battery-3 { background-position: -96px -176px; }
-.ui-icon-circle-plus { background-position: 0 -192px; }
-.ui-icon-circle-minus { background-position: -16px -192px; }
-.ui-icon-circle-close { background-position: -32px -192px; }
-.ui-icon-circle-triangle-e { background-position: -48px -192px; }
-.ui-icon-circle-triangle-s { background-position: -64px -192px; }
-.ui-icon-circle-triangle-w { background-position: -80px -192px; }
-.ui-icon-circle-triangle-n { background-position: -96px -192px; }
-.ui-icon-circle-arrow-e { background-position: -112px -192px; }
-.ui-icon-circle-arrow-s { background-position: -128px -192px; }
-.ui-icon-circle-arrow-w { background-position: -144px -192px; }
-.ui-icon-circle-arrow-n { background-position: -160px -192px; }
-.ui-icon-circle-zoomin { background-position: -176px -192px; }
-.ui-icon-circle-zoomout { background-position: -192px -192px; }
-.ui-icon-circle-check { background-position: -208px -192px; }
-.ui-icon-circlesmall-plus { background-position: 0 -208px; }
-.ui-icon-circlesmall-minus { background-position: -16px -208px; }
-.ui-icon-circlesmall-close { background-position: -32px -208px; }
-.ui-icon-squaresmall-plus { background-position: -48px -208px; }
-.ui-icon-squaresmall-minus { background-position: -64px -208px; }
-.ui-icon-squaresmall-close { background-position: -80px -208px; }
-.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
-.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
-.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
-.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
-.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
-.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Corner radius */
-.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
-.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; }
-
-/* Overlays */
-.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ none/*{bgImgUrlOverlay}*/ 0/*{bgOverlayXPos}*/ 0/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
-.ui-widget-shadow { margin: -4px/*{offsetTopShadow}*/ 0 0 -4px/*{offsetLeftShadow}*/; padding: 4px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ none/*{bgImgUrlShadow}*/ 0/*{bgShadowXPos}*/ 0/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .35;filter:Alpha(Opacity=35)/*{opacityShadow}*/; -moz-border-radius: 4px/*{cornerRadiusShadow}*/; -webkit-border-radius: 4px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
+++ /dev/null
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* Layout helpers
-----------------------------------*/
-.ui-helper-hidden { display: none; }
-.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
-.ui-helper-clearfix { display: inline-block; }
-/* required comment for clearfix to work in Opera \*/
-* html .ui-helper-clearfix { height:1%; }
-.ui-helper-clearfix { display:block; }
-/* end clearfix */
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
-
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-disabled { cursor: default !important; }
-
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Overlays */
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
-
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=5c9ccc&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=55&borderColorHeader=4297d7&fcHeader=ffffff&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=469bdd&bgColorDefault=dfeffc&bgTextureDefault=02_glass.png&bgImgOpacityDefault=85&borderColorDefault=c5dbec&fcDefault=2e6e9e&iconColorDefault=6da8d5&bgColorHover=d0e5f5&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=79b7e7&fcHover=1d5987&iconColorHover=217bc0&bgColorActive=f5f8f9&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=79b7e7&fcActive=e17009&iconColorActive=f9bd01&bgColorHighlight=fbec88&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fad42e&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
-*/
-
-
-/* Component containers
-----------------------------------*/
-.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; }
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; }
-.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; }
-.ui-widget-content a { color: #222222; }
-.ui-widget-header { border: 1px solid #4297d7; background: #5c9ccc url(images/ui-bg_gloss-wave_55_5c9ccc_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
-.ui-widget-header a { color: #ffffff; }
-
-/* Interaction states
-----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #c5dbec; background: #dfeffc url(images/ui-bg_glass_85_dfeffc_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2e6e9e; outline: none; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2e6e9e; text-decoration: none; outline: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #79b7e7; background: #d0e5f5 url(images/ui-bg_glass_75_d0e5f5_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1d5987; outline: none; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #1d5987; text-decoration: none; outline: none; }
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #79b7e7; background: #f5f8f9 url(images/ui-bg_inset-hard_100_f5f8f9_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #e17009; outline: none; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #e17009; outline: none; text-decoration: none; }
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fad42e; background: #fbec88 url(images/ui-bg_flat_55_fbec88_40x100.png) 50% 50% repeat-x; color: #363636; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_469bdd_256x240.png); }
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_469bdd_256x240.png); }
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); }
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_6da8d5_256x240.png); }
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_217bc0_256x240.png); }
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_f9bd01_256x240.png); }
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
-
-/* positioning */
-.ui-icon-carat-1-n { background-position: 0 0; }
-.ui-icon-carat-1-ne { background-position: -16px 0; }
-.ui-icon-carat-1-e { background-position: -32px 0; }
-.ui-icon-carat-1-se { background-position: -48px 0; }
-.ui-icon-carat-1-s { background-position: -64px 0; }
-.ui-icon-carat-1-sw { background-position: -80px 0; }
-.ui-icon-carat-1-w { background-position: -96px 0; }
-.ui-icon-carat-1-nw { background-position: -112px 0; }
-.ui-icon-carat-2-n-s { background-position: -128px 0; }
-.ui-icon-carat-2-e-w { background-position: -144px 0; }
-.ui-icon-triangle-1-n { background-position: 0 -16px; }
-.ui-icon-triangle-1-ne { background-position: -16px -16px; }
-.ui-icon-triangle-1-e { background-position: -32px -16px; }
-.ui-icon-triangle-1-se { background-position: -48px -16px; }
-.ui-icon-triangle-1-s { background-position: -64px -16px; }
-.ui-icon-triangle-1-sw { background-position: -80px -16px; }
-.ui-icon-triangle-1-w { background-position: -96px -16px; }
-.ui-icon-triangle-1-nw { background-position: -112px -16px; }
-.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
-.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
-.ui-icon-arrow-1-n { background-position: 0 -32px; }
-.ui-icon-arrow-1-ne { background-position: -16px -32px; }
-.ui-icon-arrow-1-e { background-position: -32px -32px; }
-.ui-icon-arrow-1-se { background-position: -48px -32px; }
-.ui-icon-arrow-1-s { background-position: -64px -32px; }
-.ui-icon-arrow-1-sw { background-position: -80px -32px; }
-.ui-icon-arrow-1-w { background-position: -96px -32px; }
-.ui-icon-arrow-1-nw { background-position: -112px -32px; }
-.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
-.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
-.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
-.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
-.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
-.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
-.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
-.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
-.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
-.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
-.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
-.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
-.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
-.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
-.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
-.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
-.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
-.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
-.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
-.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
-.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
-.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
-.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
-.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
-.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
-.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
-.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
-.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
-.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
-.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
-.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
-.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
-.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
-.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
-.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
-.ui-icon-arrow-4 { background-position: 0 -80px; }
-.ui-icon-arrow-4-diag { background-position: -16px -80px; }
-.ui-icon-extlink { background-position: -32px -80px; }
-.ui-icon-newwin { background-position: -48px -80px; }
-.ui-icon-refresh { background-position: -64px -80px; }
-.ui-icon-shuffle { background-position: -80px -80px; }
-.ui-icon-transfer-e-w { background-position: -96px -80px; }
-.ui-icon-transferthick-e-w { background-position: -112px -80px; }
-.ui-icon-folder-collapsed { background-position: 0 -96px; }
-.ui-icon-folder-open { background-position: -16px -96px; }
-.ui-icon-document { background-position: -32px -96px; }
-.ui-icon-document-b { background-position: -48px -96px; }
-.ui-icon-note { background-position: -64px -96px; }
-.ui-icon-mail-closed { background-position: -80px -96px; }
-.ui-icon-mail-open { background-position: -96px -96px; }
-.ui-icon-suitcase { background-position: -112px -96px; }
-.ui-icon-comment { background-position: -128px -96px; }
-.ui-icon-person { background-position: -144px -96px; }
-.ui-icon-print { background-position: -160px -96px; }
-.ui-icon-trash { background-position: -176px -96px; }
-.ui-icon-locked { background-position: -192px -96px; }
-.ui-icon-unlocked { background-position: -208px -96px; }
-.ui-icon-bookmark { background-position: -224px -96px; }
-.ui-icon-tag { background-position: -240px -96px; }
-.ui-icon-home { background-position: 0 -112px; }
-.ui-icon-flag { background-position: -16px -112px; }
-.ui-icon-calendar { background-position: -32px -112px; }
-.ui-icon-cart { background-position: -48px -112px; }
-.ui-icon-pencil { background-position: -64px -112px; }
-.ui-icon-clock { background-position: -80px -112px; }
-.ui-icon-disk { background-position: -96px -112px; }
-.ui-icon-calculator { background-position: -112px -112px; }
-.ui-icon-zoomin { background-position: -128px -112px; }
-.ui-icon-zoomout { background-position: -144px -112px; }
-.ui-icon-search { background-position: -160px -112px; }
-.ui-icon-wrench { background-position: -176px -112px; }
-.ui-icon-gear { background-position: -192px -112px; }
-.ui-icon-heart { background-position: -208px -112px; }
-.ui-icon-star { background-position: -224px -112px; }
-.ui-icon-link { background-position: -240px -112px; }
-.ui-icon-cancel { background-position: 0 -128px; }
-.ui-icon-plus { background-position: -16px -128px; }
-.ui-icon-plusthick { background-position: -32px -128px; }
-.ui-icon-minus { background-position: -48px -128px; }
-.ui-icon-minusthick { background-position: -64px -128px; }
-.ui-icon-close { background-position: -80px -128px; }
-.ui-icon-closethick { background-position: -96px -128px; }
-.ui-icon-key { background-position: -112px -128px; }
-.ui-icon-lightbulb { background-position: -128px -128px; }
-.ui-icon-scissors { background-position: -144px -128px; }
-.ui-icon-clipboard { background-position: -160px -128px; }
-.ui-icon-copy { background-position: -176px -128px; }
-.ui-icon-contact { background-position: -192px -128px; }
-.ui-icon-image { background-position: -208px -128px; }
-.ui-icon-video { background-position: -224px -128px; }
-.ui-icon-script { background-position: -240px -128px; }
-.ui-icon-alert { background-position: 0 -144px; }
-.ui-icon-info { background-position: -16px -144px; }
-.ui-icon-notice { background-position: -32px -144px; }
-.ui-icon-help { background-position: -48px -144px; }
-.ui-icon-check { background-position: -64px -144px; }
-.ui-icon-bullet { background-position: -80px -144px; }
-.ui-icon-radio-off { background-position: -96px -144px; }
-.ui-icon-radio-on { background-position: -112px -144px; }
-.ui-icon-pin-w { background-position: -128px -144px; }
-.ui-icon-pin-s { background-position: -144px -144px; }
-.ui-icon-play { background-position: 0 -160px; }
-.ui-icon-pause { background-position: -16px -160px; }
-.ui-icon-seek-next { background-position: -32px -160px; }
-.ui-icon-seek-prev { background-position: -48px -160px; }
-.ui-icon-seek-end { background-position: -64px -160px; }
-.ui-icon-seek-first { background-position: -80px -160px; }
-.ui-icon-stop { background-position: -96px -160px; }
-.ui-icon-eject { background-position: -112px -160px; }
-.ui-icon-volume-off { background-position: -128px -160px; }
-.ui-icon-volume-on { background-position: -144px -160px; }
-.ui-icon-power { background-position: 0 -176px; }
-.ui-icon-signal-diag { background-position: -16px -176px; }
-.ui-icon-signal { background-position: -32px -176px; }
-.ui-icon-battery-0 { background-position: -48px -176px; }
-.ui-icon-battery-1 { background-position: -64px -176px; }
-.ui-icon-battery-2 { background-position: -80px -176px; }
-.ui-icon-battery-3 { background-position: -96px -176px; }
-.ui-icon-circle-plus { background-position: 0 -192px; }
-.ui-icon-circle-minus { background-position: -16px -192px; }
-.ui-icon-circle-close { background-position: -32px -192px; }
-.ui-icon-circle-triangle-e { background-position: -48px -192px; }
-.ui-icon-circle-triangle-s { background-position: -64px -192px; }
-.ui-icon-circle-triangle-w { background-position: -80px -192px; }
-.ui-icon-circle-triangle-n { background-position: -96px -192px; }
-.ui-icon-circle-arrow-e { background-position: -112px -192px; }
-.ui-icon-circle-arrow-s { background-position: -128px -192px; }
-.ui-icon-circle-arrow-w { background-position: -144px -192px; }
-.ui-icon-circle-arrow-n { background-position: -160px -192px; }
-.ui-icon-circle-zoomin { background-position: -176px -192px; }
-.ui-icon-circle-zoomout { background-position: -192px -192px; }
-.ui-icon-circle-check { background-position: -208px -192px; }
-.ui-icon-circlesmall-plus { background-position: 0 -208px; }
-.ui-icon-circlesmall-minus { background-position: -16px -208px; }
-.ui-icon-circlesmall-close { background-position: -32px -208px; }
-.ui-icon-squaresmall-plus { background-position: -48px -208px; }
-.ui-icon-squaresmall-minus { background-position: -64px -208px; }
-.ui-icon-squaresmall-close { background-position: -80px -208px; }
-.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
-.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
-.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
-.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
-.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
-.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Corner radius */
-.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; }
-.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
-.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
-.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
-.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
-.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
-.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
-.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
-.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; }
-
-/* Overlays */
-.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
-.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }/* Accordion
-----------------------------------*/
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
-.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker
-----------------------------------*/
-.ui-datepicker { width: 17em; padding: .2em .2em 0; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month,
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
- display: none; /*sorry for IE5*/
- display/**/: block; /*sorry for IE5*/
- position: absolute; /*must have*/
- z-index: -1; /*must have*/
- filter: mask(); /*must have*/
- top: -4px; /*must have*/
- left: -4px; /*must have*/
- width: 200px; /*must have*/
- height: 200px; /*must have*/
-}/* Dialog
-----------------------------------*/
-.ui-dialog { position: relative; padding: .2em; width: 300px; }
-.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
-/* Progressbar
-----------------------------------*/
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
-----------------------------------*/
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
-----------------------------------*/
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
-----------------------------------*/
-.ui-tabs { padding: .2em; zoom: 1; }
-.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
-.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
+++ /dev/null
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* Layout helpers
-----------------------------------*/
-.ui-helper-hidden { display: none; }
-.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
-.ui-helper-clearfix { display: inline-block; }
-/* required comment for clearfix to work in Opera \*/
-* html .ui-helper-clearfix { height:1%; }
-.ui-helper-clearfix { display:block; }
-/* end clearfix */
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
-
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-disabled { cursor: default !important; }
-
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Overlays */
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
-
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
-*/
-
-
-/* Component containers
-----------------------------------*/
-.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
-.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
-.ui-widget-content a { color: #222222; }
-.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
-.ui-widget-header a { color: #222222; }
-
-/* Interaction states
-----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; outline: none; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; outline: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; outline: none; }
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; outline: none; text-decoration: none; }
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
-
-/* positioning */
-.ui-icon-carat-1-n { background-position: 0 0; }
-.ui-icon-carat-1-ne { background-position: -16px 0; }
-.ui-icon-carat-1-e { background-position: -32px 0; }
-.ui-icon-carat-1-se { background-position: -48px 0; }
-.ui-icon-carat-1-s { background-position: -64px 0; }
-.ui-icon-carat-1-sw { background-position: -80px 0; }
-.ui-icon-carat-1-w { background-position: -96px 0; }
-.ui-icon-carat-1-nw { background-position: -112px 0; }
-.ui-icon-carat-2-n-s { background-position: -128px 0; }
-.ui-icon-carat-2-e-w { background-position: -144px 0; }
-.ui-icon-triangle-1-n { background-position: 0 -16px; }
-.ui-icon-triangle-1-ne { background-position: -16px -16px; }
-.ui-icon-triangle-1-e { background-position: -32px -16px; }
-.ui-icon-triangle-1-se { background-position: -48px -16px; }
-.ui-icon-triangle-1-s { background-position: -64px -16px; }
-.ui-icon-triangle-1-sw { background-position: -80px -16px; }
-.ui-icon-triangle-1-w { background-position: -96px -16px; }
-.ui-icon-triangle-1-nw { background-position: -112px -16px; }
-.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
-.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
-.ui-icon-arrow-1-n { background-position: 0 -32px; }
-.ui-icon-arrow-1-ne { background-position: -16px -32px; }
-.ui-icon-arrow-1-e { background-position: -32px -32px; }
-.ui-icon-arrow-1-se { background-position: -48px -32px; }
-.ui-icon-arrow-1-s { background-position: -64px -32px; }
-.ui-icon-arrow-1-sw { background-position: -80px -32px; }
-.ui-icon-arrow-1-w { background-position: -96px -32px; }
-.ui-icon-arrow-1-nw { background-position: -112px -32px; }
-.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
-.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
-.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
-.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
-.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
-.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
-.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
-.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
-.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
-.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
-.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
-.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
-.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
-.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
-.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
-.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
-.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
-.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
-.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
-.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
-.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
-.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
-.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
-.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
-.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
-.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
-.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
-.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
-.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
-.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
-.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
-.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
-.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
-.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
-.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
-.ui-icon-arrow-4 { background-position: 0 -80px; }
-.ui-icon-arrow-4-diag { background-position: -16px -80px; }
-.ui-icon-extlink { background-position: -32px -80px; }
-.ui-icon-newwin { background-position: -48px -80px; }
-.ui-icon-refresh { background-position: -64px -80px; }
-.ui-icon-shuffle { background-position: -80px -80px; }
-.ui-icon-transfer-e-w { background-position: -96px -80px; }
-.ui-icon-transferthick-e-w { background-position: -112px -80px; }
-.ui-icon-folder-collapsed { background-position: 0 -96px; }
-.ui-icon-folder-open { background-position: -16px -96px; }
-.ui-icon-document { background-position: -32px -96px; }
-.ui-icon-document-b { background-position: -48px -96px; }
-.ui-icon-note { background-position: -64px -96px; }
-.ui-icon-mail-closed { background-position: -80px -96px; }
-.ui-icon-mail-open { background-position: -96px -96px; }
-.ui-icon-suitcase { background-position: -112px -96px; }
-.ui-icon-comment { background-position: -128px -96px; }
-.ui-icon-person { background-position: -144px -96px; }
-.ui-icon-print { background-position: -160px -96px; }
-.ui-icon-trash { background-position: -176px -96px; }
-.ui-icon-locked { background-position: -192px -96px; }
-.ui-icon-unlocked { background-position: -208px -96px; }
-.ui-icon-bookmark { background-position: -224px -96px; }
-.ui-icon-tag { background-position: -240px -96px; }
-.ui-icon-home { background-position: 0 -112px; }
-.ui-icon-flag { background-position: -16px -112px; }
-.ui-icon-calendar { background-position: -32px -112px; }
-.ui-icon-cart { background-position: -48px -112px; }
-.ui-icon-pencil { background-position: -64px -112px; }
-.ui-icon-clock { background-position: -80px -112px; }
-.ui-icon-disk { background-position: -96px -112px; }
-.ui-icon-calculator { background-position: -112px -112px; }
-.ui-icon-zoomin { background-position: -128px -112px; }
-.ui-icon-zoomout { background-position: -144px -112px; }
-.ui-icon-search { background-position: -160px -112px; }
-.ui-icon-wrench { background-position: -176px -112px; }
-.ui-icon-gear { background-position: -192px -112px; }
-.ui-icon-heart { background-position: -208px -112px; }
-.ui-icon-star { background-position: -224px -112px; }
-.ui-icon-link { background-position: -240px -112px; }
-.ui-icon-cancel { background-position: 0 -128px; }
-.ui-icon-plus { background-position: -16px -128px; }
-.ui-icon-plusthick { background-position: -32px -128px; }
-.ui-icon-minus { background-position: -48px -128px; }
-.ui-icon-minusthick { background-position: -64px -128px; }
-.ui-icon-close { background-position: -80px -128px; }
-.ui-icon-closethick { background-position: -96px -128px; }
-.ui-icon-key { background-position: -112px -128px; }
-.ui-icon-lightbulb { background-position: -128px -128px; }
-.ui-icon-scissors { background-position: -144px -128px; }
-.ui-icon-clipboard { background-position: -160px -128px; }
-.ui-icon-copy { background-position: -176px -128px; }
-.ui-icon-contact { background-position: -192px -128px; }
-.ui-icon-image { background-position: -208px -128px; }
-.ui-icon-video { background-position: -224px -128px; }
-.ui-icon-script { background-position: -240px -128px; }
-.ui-icon-alert { background-position: 0 -144px; }
-.ui-icon-info { background-position: -16px -144px; }
-.ui-icon-notice { background-position: -32px -144px; }
-.ui-icon-help { background-position: -48px -144px; }
-.ui-icon-check { background-position: -64px -144px; }
-.ui-icon-bullet { background-position: -80px -144px; }
-.ui-icon-radio-off { background-position: -96px -144px; }
-.ui-icon-radio-on { background-position: -112px -144px; }
-.ui-icon-pin-w { background-position: -128px -144px; }
-.ui-icon-pin-s { background-position: -144px -144px; }
-.ui-icon-play { background-position: 0 -160px; }
-.ui-icon-pause { background-position: -16px -160px; }
-.ui-icon-seek-next { background-position: -32px -160px; }
-.ui-icon-seek-prev { background-position: -48px -160px; }
-.ui-icon-seek-end { background-position: -64px -160px; }
-.ui-icon-seek-first { background-position: -80px -160px; }
-.ui-icon-stop { background-position: -96px -160px; }
-.ui-icon-eject { background-position: -112px -160px; }
-.ui-icon-volume-off { background-position: -128px -160px; }
-.ui-icon-volume-on { background-position: -144px -160px; }
-.ui-icon-power { background-position: 0 -176px; }
-.ui-icon-signal-diag { background-position: -16px -176px; }
-.ui-icon-signal { background-position: -32px -176px; }
-.ui-icon-battery-0 { background-position: -48px -176px; }
-.ui-icon-battery-1 { background-position: -64px -176px; }
-.ui-icon-battery-2 { background-position: -80px -176px; }
-.ui-icon-battery-3 { background-position: -96px -176px; }
-.ui-icon-circle-plus { background-position: 0 -192px; }
-.ui-icon-circle-minus { background-position: -16px -192px; }
-.ui-icon-circle-close { background-position: -32px -192px; }
-.ui-icon-circle-triangle-e { background-position: -48px -192px; }
-.ui-icon-circle-triangle-s { background-position: -64px -192px; }
-.ui-icon-circle-triangle-w { background-position: -80px -192px; }
-.ui-icon-circle-triangle-n { background-position: -96px -192px; }
-.ui-icon-circle-arrow-e { background-position: -112px -192px; }
-.ui-icon-circle-arrow-s { background-position: -128px -192px; }
-.ui-icon-circle-arrow-w { background-position: -144px -192px; }
-.ui-icon-circle-arrow-n { background-position: -160px -192px; }
-.ui-icon-circle-zoomin { background-position: -176px -192px; }
-.ui-icon-circle-zoomout { background-position: -192px -192px; }
-.ui-icon-circle-check { background-position: -208px -192px; }
-.ui-icon-circlesmall-plus { background-position: 0 -208px; }
-.ui-icon-circlesmall-minus { background-position: -16px -208px; }
-.ui-icon-circlesmall-close { background-position: -32px -208px; }
-.ui-icon-squaresmall-plus { background-position: -48px -208px; }
-.ui-icon-squaresmall-minus { background-position: -64px -208px; }
-.ui-icon-squaresmall-close { background-position: -80px -208px; }
-.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
-.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
-.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
-.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
-.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
-.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Corner radius */
-.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
-.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
-.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
-.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
-.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
-.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
-
-/* Overlays */
-.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .30;filter:Alpha(Opacity=30); }
-.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }/* Accordion
-----------------------------------*/
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
-.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker
-----------------------------------*/
-.ui-datepicker { width: 17em; padding: .2em .2em 0; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month,
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
- display: none; /*sorry for IE5*/
- display/**/: block; /*sorry for IE5*/
- position: absolute; /*must have*/
- z-index: -1; /*must have*/
- filter: mask(); /*must have*/
- top: -4px; /*must have*/
- left: -4px; /*must have*/
- width: 200px; /*must have*/
- height: 200px; /*must have*/
-}/* Dialog
-----------------------------------*/
-.ui-dialog { position: relative; padding: .2em; width: 300px; }
-.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
-/* Progressbar
-----------------------------------*/
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
-----------------------------------*/
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
-----------------------------------*/
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
-----------------------------------*/
-.ui-tabs { padding: .2em; zoom: 1; }
-.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
-.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
+++ /dev/null
-/* Accordion
-----------------------------------*/
-.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
-.ui-accordion .ui-accordion-li-fix { display: inline; }
-.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
-.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
-.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
-.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
-.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
+++ /dev/null
-@import "ui.base.css";
-@import "ui.theme.css";
+++ /dev/null
-@import url("ui.core.css");
-@import url("ui.resizable.css");
-@import url("ui.accordion.css");
-@import url("ui.dialog.css");
-@import url("ui.slider.css");
-@import url("ui.tabs.css");
-@import url("ui.datepicker.css");
-@import url("ui.progressbar.css");
\ No newline at end of file
+++ /dev/null
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-*/
-
-/* Layout helpers
-----------------------------------*/
-.ui-helper-hidden { display: none; }
-.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
-.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
-.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
-.ui-helper-clearfix { display: inline-block; }
-/* required comment for clearfix to work in Opera \*/
-* html .ui-helper-clearfix { height:1%; }
-.ui-helper-clearfix { display:block; }
-/* end clearfix */
-.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
-
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-disabled { cursor: default !important; }
-
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Overlays */
-.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file
+++ /dev/null
-/* Datepicker
-----------------------------------*/
-.ui-datepicker { width: 17em; padding: .2em .2em 0; }
-.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
-.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
-.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
-.ui-datepicker .ui-datepicker-prev { left:2px; }
-.ui-datepicker .ui-datepicker-next { right:2px; }
-.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
-.ui-datepicker .ui-datepicker-next-hover { right:1px; }
-.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
-.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
-.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
-.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
-.ui-datepicker select.ui-datepicker-month,
-.ui-datepicker select.ui-datepicker-year { width: 49%;}
-.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
-.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
-.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
-.ui-datepicker td { border: 0; padding: 1px; }
-.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
-.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
-.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
-.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
-
-/* with multiple calendars */
-.ui-datepicker.ui-datepicker-multi { width:auto; }
-.ui-datepicker-multi .ui-datepicker-group { float:left; }
-.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
-.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
-.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
-.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
-.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
-.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
-.ui-datepicker-row-break { clear:both; width:100%; }
-
-/* RTL support */
-.ui-datepicker-rtl { direction: rtl; }
-.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
-.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
-.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group { float:right; }
-.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
-
-/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
-.ui-datepicker-cover {
- display: none; /*sorry for IE5*/
- display/**/: block; /*sorry for IE5*/
- position: absolute; /*must have*/
- z-index: -1; /*must have*/
- filter: mask(); /*must have*/
- top: -4px; /*must have*/
- left: -4px; /*must have*/
- width: 200px; /*must have*/
- height: 200px; /*must have*/
-}
\ No newline at end of file
+++ /dev/null
-/* Dialog
-----------------------------------*/
-.ui-dialog { position: relative; padding: .2em; width: 300px; }
-.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
-.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
-.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
-.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
-.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
-.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
-.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
-.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
-.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
-.ui-draggable .ui-dialog-titlebar { cursor: move; }
+++ /dev/null
-/* Progressbar
-----------------------------------*/
-.ui-progressbar { height:2em; text-align: left; }
-.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
+++ /dev/null
-/* Resizable
-----------------------------------*/
-.ui-resizable { position: relative;}
-.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
-.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
-.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
-.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
-.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
-.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
-.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
-.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
-.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
-.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
+++ /dev/null
-/* Slider
-----------------------------------*/
-.ui-slider { position: relative; text-align: left; }
-.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
-.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
-
-.ui-slider-horizontal { height: .8em; }
-.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
-.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
-.ui-slider-horizontal .ui-slider-range-min { left: 0; }
-.ui-slider-horizontal .ui-slider-range-max { right: 0; }
-
-.ui-slider-vertical { width: .8em; height: 100px; }
-.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
-.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
-.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
-.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
+++ /dev/null
-/* Tabs
-----------------------------------*/
-.ui-tabs { padding: .2em; zoom: 1; }
-.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
-.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
-.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
-.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
-.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
-.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
-.ui-tabs .ui-tabs-hide { display: none !important; }
+++ /dev/null
-
-
-/*
-* jQuery UI CSS Framework
-* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
-* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
-* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
-*/
-
-
-/* Component containers
-----------------------------------*/
-.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
-.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
-.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
-.ui-widget-content a { color: #222222; }
-.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
-.ui-widget-header a { color: #222222; }
-
-/* Interaction states
-----------------------------------*/
-.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; outline: none; }
-.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; outline: none; }
-.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
-.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; outline: none; }
-.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
-.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; outline: none; text-decoration: none; }
-
-/* Interaction Cues
-----------------------------------*/
-.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
-.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
-.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
-.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
-.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
-.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
-.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
-.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
-
-/* Icons
-----------------------------------*/
-
-/* states and images */
-.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
-.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
-.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
-.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
-.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
-.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
-
-/* positioning */
-.ui-icon-carat-1-n { background-position: 0 0; }
-.ui-icon-carat-1-ne { background-position: -16px 0; }
-.ui-icon-carat-1-e { background-position: -32px 0; }
-.ui-icon-carat-1-se { background-position: -48px 0; }
-.ui-icon-carat-1-s { background-position: -64px 0; }
-.ui-icon-carat-1-sw { background-position: -80px 0; }
-.ui-icon-carat-1-w { background-position: -96px 0; }
-.ui-icon-carat-1-nw { background-position: -112px 0; }
-.ui-icon-carat-2-n-s { background-position: -128px 0; }
-.ui-icon-carat-2-e-w { background-position: -144px 0; }
-.ui-icon-triangle-1-n { background-position: 0 -16px; }
-.ui-icon-triangle-1-ne { background-position: -16px -16px; }
-.ui-icon-triangle-1-e { background-position: -32px -16px; }
-.ui-icon-triangle-1-se { background-position: -48px -16px; }
-.ui-icon-triangle-1-s { background-position: -64px -16px; }
-.ui-icon-triangle-1-sw { background-position: -80px -16px; }
-.ui-icon-triangle-1-w { background-position: -96px -16px; }
-.ui-icon-triangle-1-nw { background-position: -112px -16px; }
-.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
-.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
-.ui-icon-arrow-1-n { background-position: 0 -32px; }
-.ui-icon-arrow-1-ne { background-position: -16px -32px; }
-.ui-icon-arrow-1-e { background-position: -32px -32px; }
-.ui-icon-arrow-1-se { background-position: -48px -32px; }
-.ui-icon-arrow-1-s { background-position: -64px -32px; }
-.ui-icon-arrow-1-sw { background-position: -80px -32px; }
-.ui-icon-arrow-1-w { background-position: -96px -32px; }
-.ui-icon-arrow-1-nw { background-position: -112px -32px; }
-.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
-.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
-.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
-.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
-.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
-.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
-.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
-.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
-.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
-.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
-.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
-.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
-.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
-.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
-.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
-.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
-.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
-.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
-.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
-.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
-.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
-.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
-.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
-.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
-.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
-.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
-.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
-.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
-.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
-.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
-.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
-.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
-.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
-.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
-.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
-.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
-.ui-icon-arrow-4 { background-position: 0 -80px; }
-.ui-icon-arrow-4-diag { background-position: -16px -80px; }
-.ui-icon-extlink { background-position: -32px -80px; }
-.ui-icon-newwin { background-position: -48px -80px; }
-.ui-icon-refresh { background-position: -64px -80px; }
-.ui-icon-shuffle { background-position: -80px -80px; }
-.ui-icon-transfer-e-w { background-position: -96px -80px; }
-.ui-icon-transferthick-e-w { background-position: -112px -80px; }
-.ui-icon-folder-collapsed { background-position: 0 -96px; }
-.ui-icon-folder-open { background-position: -16px -96px; }
-.ui-icon-document { background-position: -32px -96px; }
-.ui-icon-document-b { background-position: -48px -96px; }
-.ui-icon-note { background-position: -64px -96px; }
-.ui-icon-mail-closed { background-position: -80px -96px; }
-.ui-icon-mail-open { background-position: -96px -96px; }
-.ui-icon-suitcase { background-position: -112px -96px; }
-.ui-icon-comment { background-position: -128px -96px; }
-.ui-icon-person { background-position: -144px -96px; }
-.ui-icon-print { background-position: -160px -96px; }
-.ui-icon-trash { background-position: -176px -96px; }
-.ui-icon-locked { background-position: -192px -96px; }
-.ui-icon-unlocked { background-position: -208px -96px; }
-.ui-icon-bookmark { background-position: -224px -96px; }
-.ui-icon-tag { background-position: -240px -96px; }
-.ui-icon-home { background-position: 0 -112px; }
-.ui-icon-flag { background-position: -16px -112px; }
-.ui-icon-calendar { background-position: -32px -112px; }
-.ui-icon-cart { background-position: -48px -112px; }
-.ui-icon-pencil { background-position: -64px -112px; }
-.ui-icon-clock { background-position: -80px -112px; }
-.ui-icon-disk { background-position: -96px -112px; }
-.ui-icon-calculator { background-position: -112px -112px; }
-.ui-icon-zoomin { background-position: -128px -112px; }
-.ui-icon-zoomout { background-position: -144px -112px; }
-.ui-icon-search { background-position: -160px -112px; }
-.ui-icon-wrench { background-position: -176px -112px; }
-.ui-icon-gear { background-position: -192px -112px; }
-.ui-icon-heart { background-position: -208px -112px; }
-.ui-icon-star { background-position: -224px -112px; }
-.ui-icon-link { background-position: -240px -112px; }
-.ui-icon-cancel { background-position: 0 -128px; }
-.ui-icon-plus { background-position: -16px -128px; }
-.ui-icon-plusthick { background-position: -32px -128px; }
-.ui-icon-minus { background-position: -48px -128px; }
-.ui-icon-minusthick { background-position: -64px -128px; }
-.ui-icon-close { background-position: -80px -128px; }
-.ui-icon-closethick { background-position: -96px -128px; }
-.ui-icon-key { background-position: -112px -128px; }
-.ui-icon-lightbulb { background-position: -128px -128px; }
-.ui-icon-scissors { background-position: -144px -128px; }
-.ui-icon-clipboard { background-position: -160px -128px; }
-.ui-icon-copy { background-position: -176px -128px; }
-.ui-icon-contact { background-position: -192px -128px; }
-.ui-icon-image { background-position: -208px -128px; }
-.ui-icon-video { background-position: -224px -128px; }
-.ui-icon-script { background-position: -240px -128px; }
-.ui-icon-alert { background-position: 0 -144px; }
-.ui-icon-info { background-position: -16px -144px; }
-.ui-icon-notice { background-position: -32px -144px; }
-.ui-icon-help { background-position: -48px -144px; }
-.ui-icon-check { background-position: -64px -144px; }
-.ui-icon-bullet { background-position: -80px -144px; }
-.ui-icon-radio-off { background-position: -96px -144px; }
-.ui-icon-radio-on { background-position: -112px -144px; }
-.ui-icon-pin-w { background-position: -128px -144px; }
-.ui-icon-pin-s { background-position: -144px -144px; }
-.ui-icon-play { background-position: 0 -160px; }
-.ui-icon-pause { background-position: -16px -160px; }
-.ui-icon-seek-next { background-position: -32px -160px; }
-.ui-icon-seek-prev { background-position: -48px -160px; }
-.ui-icon-seek-end { background-position: -64px -160px; }
-.ui-icon-seek-first { background-position: -80px -160px; }
-.ui-icon-stop { background-position: -96px -160px; }
-.ui-icon-eject { background-position: -112px -160px; }
-.ui-icon-volume-off { background-position: -128px -160px; }
-.ui-icon-volume-on { background-position: -144px -160px; }
-.ui-icon-power { background-position: 0 -176px; }
-.ui-icon-signal-diag { background-position: -16px -176px; }
-.ui-icon-signal { background-position: -32px -176px; }
-.ui-icon-battery-0 { background-position: -48px -176px; }
-.ui-icon-battery-1 { background-position: -64px -176px; }
-.ui-icon-battery-2 { background-position: -80px -176px; }
-.ui-icon-battery-3 { background-position: -96px -176px; }
-.ui-icon-circle-plus { background-position: 0 -192px; }
-.ui-icon-circle-minus { background-position: -16px -192px; }
-.ui-icon-circle-close { background-position: -32px -192px; }
-.ui-icon-circle-triangle-e { background-position: -48px -192px; }
-.ui-icon-circle-triangle-s { background-position: -64px -192px; }
-.ui-icon-circle-triangle-w { background-position: -80px -192px; }
-.ui-icon-circle-triangle-n { background-position: -96px -192px; }
-.ui-icon-circle-arrow-e { background-position: -112px -192px; }
-.ui-icon-circle-arrow-s { background-position: -128px -192px; }
-.ui-icon-circle-arrow-w { background-position: -144px -192px; }
-.ui-icon-circle-arrow-n { background-position: -160px -192px; }
-.ui-icon-circle-zoomin { background-position: -176px -192px; }
-.ui-icon-circle-zoomout { background-position: -192px -192px; }
-.ui-icon-circle-check { background-position: -208px -192px; }
-.ui-icon-circlesmall-plus { background-position: 0 -208px; }
-.ui-icon-circlesmall-minus { background-position: -16px -208px; }
-.ui-icon-circlesmall-close { background-position: -32px -208px; }
-.ui-icon-squaresmall-plus { background-position: -48px -208px; }
-.ui-icon-squaresmall-minus { background-position: -64px -208px; }
-.ui-icon-squaresmall-close { background-position: -80px -208px; }
-.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
-.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
-.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
-.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
-.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
-.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
-
-
-/* Misc visuals
-----------------------------------*/
-
-/* Corner radius */
-.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
-.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
-.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
-.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
-.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
-.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
-.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
-
-/* Overlays */
-.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
-.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
\ No newline at end of file
+++ /dev/null
-/*
- * jQuery UI Effects Blind 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.blind = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'vertical') ? 'height' : 'width';
- var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
- if(mode == 'show') wrapper.css(ref, 0); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = mode == 'show' ? distance : 0;
-
- // Animate
- wrapper.animate(animation, o.duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Bounce 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.bounce = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'up'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 5; // Default # of times
- var speed = o.duration || 250; // Default speed per bounce
- if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- if (mode == 'hide') distance = distance / (times * 2);
- if (mode != 'hide') times--;
-
- // Animate
- if (mode == 'show') { // Show Bounce
- var animation = {opacity: 1};
- animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation, speed / 2, o.options.easing);
- distance = distance / 2;
- times--;
- };
- for (var i = 0; i < times; i++) { // Bounces
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
- distance = (mode == 'hide') ? distance * 2 : distance / 2;
- };
- if (mode == 'hide') { // Last Bounce
- var animation = {opacity: 0};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- el.animate(animation, speed / 2, o.options.easing, function(){
- el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Clip 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.clip = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','height','width'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var animate = el[0].tagName == 'IMG' ? wrapper : el;
- var ref = {
- size: (direction == 'vertical') ? 'height' : 'width',
- position: (direction == 'vertical') ? 'top' : 'left'
- };
- var distance = (direction == 'vertical') ? animate.height() : animate.width();
- if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
-
- // Animation
- var animation = {};
- animation[ref.size] = mode == 'show' ? distance : 0;
- animation[ref.position] = mode == 'show' ? 0 : distance / 2;
-
- // Animate
- animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/
- */
-;jQuery.effects || (function($) {
-
-$.effects = {
- version: "1.7.1",
-
- // Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
- }
- },
-
- // Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
- }
- },
-
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
- return mode;
- },
-
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
- var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
- };
- return {x: x, y: y};
- },
-
- // Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
-
- //if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent();
-
- //Cache width,height and float properties of the element, and create a wrapper around it
- var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
- element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
- var wrapper = element.parent();
-
- //Transfer the positioning of the element to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative'} );
- } else {
- var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
- var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
- wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
- element.css({position: 'relative', top: 0, left: 0 });
- }
-
- wrapper.css(props);
- return wrapper;
- },
-
- removeWrapper: function(element) {
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent().replaceWith(element);
- return element;
- },
-
- setTransition: function(element, list, factor, value) {
- value = value || {};
- $.each(list, function(i, x){
- unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
- });
- return value;
- },
-
- //Base function to animate from one class to another in a seamless transition
- animateClass: function(value, duration, easing, callback) {
-
- var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
- var ea = (typeof easing == "string" ? easing : null);
-
- return this.each(function() {
-
- var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
- if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
- if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
-
- //Let's get a style offset
- var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
- var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
-
- // The main function to form the object for animation
- for(var n in newStyle) {
- if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
- && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
- && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
- && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
- && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
- ) offset[n] = newStyle[n];
- }
-
- that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
- // Change style attribute back to original. For stupid IE, we need to clear the damn object.
- if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
- if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
- if(cb) cb.apply(this, arguments);
- });
-
- });
- }
-};
-
-
-function _normalizeArguments(a, m) {
-
- var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
- var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
- speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
- var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
-
- return [a[0], o, speed, callback];
-
-}
-
-//Extend the methods of jQuery
-$.fn.extend({
-
- //Save old methods
- _show: $.fn.show,
- _hide: $.fn.hide,
- __toggle: $.fn.toggle,
- _addClass: $.fn.addClass,
- _removeClass: $.fn.removeClass,
- _toggleClass: $.fn.toggleClass,
-
- // New effect methods
- effect: function(fx, options, speed, callback) {
- return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
- },
-
- show: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._show.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
- }
- },
-
- hide: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._hide.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
- }
- },
-
- toggle: function(){
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
- return this.__toggle.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
- }
- },
-
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
- },
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
- },
- toggleClass: function(classNames,speed,easing,callback) {
- return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
- },
- morph: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
- },
- switchClass: function() {
- return this.morph.apply(this, arguments);
- },
-
- // helper functions
- cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
- });
- return val;
- }
-});
-
-/*
- * jQuery Color Animations
- * Copyright 2007 John Resig
- * Released under the MIT and GPL licenses.
- */
-
-// We override the animation for all of these color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
- $.fx.step[attr] = function(fx) {
- if ( fx.state == 0 ) {
- fx.start = getColor( fx.elem, attr );
- fx.end = getRGB( fx.end );
- }
-
- fx.elem.style[attr] = "rgb(" + [
- Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
- ].join(",") + ")";
- };
-});
-
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
-
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
-
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
-
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
-
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
-
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
-
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
-
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
-
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
-}
-
-function getColor(elem, attr) {
- var color;
-
- do {
- color = $.curCSS(elem, attr);
-
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
-
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
-
- return getRGB(color);
-};
-
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
-};
-
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
-
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
- },
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
- },
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
- },
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
- },
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
- },
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
- },
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
- },
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- },
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
- },
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
- },
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
- },
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
- },
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
- },
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
- },
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
- } else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
- }
- },
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
- }
-});
-
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Drop 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.drop = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','opacity'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {opacity: mode == 'show' ? 1 : 0};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Explode 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.explode = function(o) {
-
- return this.queue(function() {
-
- var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-
- o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
- var el = $(this).show().css('visibility', 'hidden');
- var offset = el.offset();
-
- //Substract the margins - not fixing the problem yet.
- offset.top -= parseInt(el.css("marginTop"),10) || 0;
- offset.left -= parseInt(el.css("marginLeft"),10) || 0;
-
- var width = el.outerWidth(true);
- var height = el.outerHeight(true);
-
- for(var i=0;i<rows;i++) { // =
- for(var j=0;j<cells;j++) { // ||
- el
- .clone()
- .appendTo('body')
- .wrap('<div></div>')
- .css({
- position: 'absolute',
- visibility: 'visible',
- left: -j*(width/cells),
- top: -i*(height/rows)
- })
- .parent()
- .addClass('ui-effects-explode')
- .css({
- position: 'absolute',
- overflow: 'hidden',
- width: width/cells,
- height: height/rows,
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
- opacity: o.options.mode == 'show' ? 0 : 1
- }).animate({
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
- opacity: o.options.mode == 'show' ? 1 : 0
- }, o.duration || 500);
- }
- }
-
- // Set a timeout, to call the callback approx. when the other animations have finished
- setTimeout(function() {
-
- o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
- if(o.callback) o.callback.apply(el[0]); // Callback
- el.dequeue();
-
- $('div.ui-effects-explode').remove();
-
- }, o.duration || 500);
-
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Fold 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Fold
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.fold = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var size = o.options.size || 15; // Default fold size
- var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var widthFirst = ((mode == 'show') != horizFirst);
- var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
- var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
- var percent = /([0-9]+)%/.exec(size);
- if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
- if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
-
- // Animation
- var animation1 = {}, animation2 = {};
- animation1[ref[0]] = mode == 'show' ? distance[0] : size;
- animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
-
- // Animate
- wrapper.animate(animation1, duration, o.options.easing)
- .animate(animation2, duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Highlight 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.highlight = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var color = o.options.color || "#ffff99"; // Default highlight color
- var oldColor = el.css("backgroundColor");
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
-
- // Animation
- var animation = {backgroundColor: oldColor };
- if (mode == "hide") animation['opacity'] = 0;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == "hide") el.hide();
- $.effects.restore(el, props);
- if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
- if(o.callback) o.callback.apply(this, arguments);
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Pulsate 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.pulsate = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var times = o.options.times || 5; // Default # of times
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- if (mode == 'hide') times--;
- if (el.is(':hidden')) { // Show fadeIn
- el.css('opacity', 0);
- el.show(); // Show
- el.animate({opacity: 1}, duration, o.options.easing);
- times = times-2;
- }
-
- // Animate
- for (var i = 0; i < times; i++) { // Pulsate
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
- };
- if (mode == 'hide') { // Last Pulse
- el.animate({opacity: 0}, duration, o.options.easing, function(){
- el.hide(); // Hide
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Scale 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.puff = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
- options.fade = true; // It's not a puff if it doesn't fade! :)
- var original = {height: el.height(), width: el.width()}; // Save original
-
- // Adjust
- var factor = percent / 100;
- el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
-
- // Animation
- options.from = el.from;
- options.percent = (mode == 'hide') ? percent : 100;
- options.mode = mode;
-
- // Animate
- el.effect('scale', options, o.duration, o.callback);
- el.dequeue();
- });
-
-};
-
-$.effects.scale = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
- var direction = o.options.direction || 'both'; // Set default axis
- var origin = o.options.origin; // The origin of the scaling
- if (mode != 'effect') { // Set default origin and restore for show/hide
- options.origin = origin || ['middle','center'];
- options.restore = true;
- }
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
-
- // Adjust
- var factor = { // Set scaling factor
- y: direction != 'horizontal' ? (percent / 100) : 1,
- x: direction != 'vertical' ? (percent / 100) : 1
- };
- el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
-
- if (o.options.fade) { // Fade option to support puff
- if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
- if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
- };
-
- // Animation
- options.from = el.from; options.to = el.to; options.mode = mode;
-
- // Animate
- el.effect('size', options, o.duration, o.callback);
- el.dequeue();
- });
-
-};
-
-$.effects.size = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
- var props1 = ['position','top','left','overflow','opacity']; // Always restore
- var props2 = ['width','height','overflow']; // Copy for children
- var cProps = ['fontSize'];
- var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
- var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var restore = o.options.restore || false; // Default restore
- var scale = o.options.scale || 'both'; // Default scale mode
- var origin = o.options.origin; // The origin of the sizing
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || original; // Default from state
- el.to = o.options.to || original; // Default to state
- // Adjust
- if (origin) { // Calculate baseline shifts
- var baseline = $.effects.getBaseline(origin, original);
- el.from.top = (original.height - el.from.height) * baseline.y;
- el.from.left = (original.width - el.from.width) * baseline.x;
- el.to.top = (original.height - el.to.height) * baseline.y;
- el.to.left = (original.width - el.to.width) * baseline.x;
- };
- var factor = { // Set scaling factor
- from: {y: el.from.height / original.height, x: el.from.width / original.width},
- to: {y: el.to.height / original.height, x: el.to.width / original.width}
- };
- if (scale == 'box' || scale == 'both') { // Scale the css box
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(vProps);
- el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- props = props.concat(hProps);
- el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
- el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
- };
- };
- if (scale == 'content' || scale == 'both') { // Scale the content
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(cProps);
- el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
- };
- };
- $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- el.css('overflow','hidden').css(el.from); // Shift
-
- // Animate
- if (scale == 'content' || scale == 'both') { // Scale the children
- vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
- hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
- props2 = props.concat(vProps).concat(hProps); // Concat
- el.find("*[width]").each(function(){
- child = $(this);
- if (restore) $.effects.save(child, props2);
- var c_original = {height: child.height(), width: child.width()}; // Save original
- child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
- child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
- child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
- child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
- };
- child.css(child.from); // Shift children
- child.animate(child.to, o.duration, o.options.easing, function(){
- if (restore) $.effects.restore(child, props2); // Restore children
- }); // Animate children
- });
- };
-
- // Animate
- el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Shake 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.shake = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'left'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 3; // Default # of times
- var speed = o.duration || o.options.duration || 140; // Default speed per shake
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-
- // Animation
- var animation = {}, animation1 = {}, animation2 = {};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
- animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
-
- // Animate
- el.animate(animation, speed, o.options.easing);
- for (var i = 1; i < times; i++) { // Shakes
- el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
- };
- el.animate(animation1, speed, o.options.easing).
- animate(animation, speed / 2, o.options.easing, function(){ // Last shake
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Slide 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.slide = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
- if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Effects Transfer 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.transfer = function(o) {
- return this.queue(function() {
- var elem = $(this),
- target = $(o.options.to),
- endPosition = target.offset(),
- animation = {
- top: endPosition.top,
- left: endPosition.left,
- height: target.innerHeight(),
- width: target.innerWidth()
- },
- startPosition = elem.offset(),
- transfer = $('<div class="ui-effects-transfer"></div>')
- .appendTo(document.body)
- .addClass(o.options.className)
- .css({
- top: startPosition.top,
- left: startPosition.left,
- height: elem.innerHeight(),
- width: elem.innerWidth(),
- position: 'absolute'
- })
- .animate(animation, o.duration, o.options.easing, function() {
- transfer.remove();
- (o.callback && o.callback.apply(elem[0], arguments));
- elem.dequeue();
- });
- });
-};
-
-})(jQuery);
+++ /dev/null
-/* Arabic Translation for jQuery UI date picker plugin. */\r
-/* Khaled Al Horani -- koko.dw@gmail.com */\r
-/* خالد الحوراني -- koko.dw@gmail.com */\r
-/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */\r
-jQuery(function($){\r
- $.datepicker.regional['ar'] = {\r
- closeText: 'إغلاق',\r
- prevText: '<السابق',\r
- nextText: 'التالي>',\r
- currentText: 'اليوم',\r
- monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',\r
- 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],\r
- monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
- dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],\r
- dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
- dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: true};\r
- $.datepicker.setDefaults($.datepicker.regional['ar']);\r
-});/* Bulgarian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Stoyan Kyosev (http://svest.org). */\r
-jQuery(function($){\r
- $.datepicker.regional['bg'] = {\r
- closeText: 'затвори',\r
- prevText: '<назад',\r
- nextText: 'напред>',\r
- nextBigText: '>>',\r
- currentText: 'днес',\r
- monthNames: ['Януари','Февруари','Март','Април','Май','Юни',\r
- 'Юли','Август','Септември','Октомври','Ноември','Декември'],\r
- monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',\r
- 'Юли','Авг','Сеп','Окт','Нов','Дек'],\r
- dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],\r
- dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],\r
- dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['bg']);\r
-});\r
-/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */\r
-/* Writers: (joan.leon@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['ca'] = {\r
- closeText: 'Tancar',\r
- prevText: '<Ant',\r
- nextText: 'Seg>',\r
- currentText: 'Avui',\r
- monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',\r
- 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],\r
- monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',\r
- 'Jul','Ago','Set','Oct','Nov','Des'],\r
- dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],\r
- dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],\r
- dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],\r
- dateFormat: 'mm/dd/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['ca']);\r
-});/* Czech initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Tomas Muller (tomas@tomas-muller.net). */\r
-jQuery(function($){\r
- $.datepicker.regional['cs'] = {\r
- closeText: 'Zavřít',\r
- prevText: '<Dříve',\r
- nextText: 'Později>',\r
- currentText: 'Nyní',\r
- monthNames: ['leden','únor','březen','duben','květen','červen',\r
- 'červenec','srpen','září','říjen','listopad','prosinec'],\r
- monthNamesShort: ['led','úno','bře','dub','kvě','čer',\r
- 'čvc','srp','zář','říj','lis','pro'],\r
- dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],\r
- dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],\r
- dayNamesMin: ['ne','po','út','st','čt','pá','so'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['cs']);\r
-});\r
-/* Danish initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Jan Christensen ( deletestuff@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['da'] = {\r
- closeText: 'Luk',\r
- prevText: '<Forrige',\r
- nextText: 'Næste>',\r
- currentText: 'Idag',\r
- monthNames: ['Januar','Februar','Marts','April','Maj','Juni',\r
- 'Juli','August','September','Oktober','November','December'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
- dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
- dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
- dateFormat: 'dd-mm-yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['da']);\r
-});\r
-/* German initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Milian Wolff (mail@milianw.de). */\r
-jQuery(function($){\r
- $.datepicker.regional['de'] = {\r
- closeText: 'schließen',\r
- prevText: '<zurück',\r
- nextText: 'Vor>',\r
- currentText: 'heute',\r
- monthNames: ['Januar','Februar','März','April','Mai','Juni',\r
- 'Juli','August','September','Oktober','November','Dezember'],\r
- monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',\r
- 'Jul','Aug','Sep','Okt','Nov','Dez'],\r
- dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],\r
- dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
- dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['de']);\r
-});\r
-/* Greek (el) initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Alex Cicovic (http://www.alexcicovic.com) */\r
-jQuery(function($){\r
- $.datepicker.regional['el'] = {\r
- closeText: 'Κλείσιμο',\r
- prevText: 'Προηγούμενος',\r
- nextText: 'Επόμενος',\r
- currentText: 'Τρέχων Μήνας',\r
- monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',\r
- 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],\r
- monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',\r
- 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],\r
- dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],\r
- dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],\r
- dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['el']);\r
-});/* Esperanto initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Olivier M. (olivierweb@ifrance.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['eo'] = {\r
- closeText: 'Fermi',\r
- prevText: '<Anta',\r
- nextText: 'Sekv>',\r
- currentText: 'Nuna',\r
- monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',\r
- 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Aŭg','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],\r
- dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],\r
- dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['eo']);\r
-});\r
-/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */\r
-/* Traducido por Vester (xvester@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['es'] = {\r
- closeText: 'Cerrar',\r
- prevText: '<Ant',\r
- nextText: 'Sig>',\r
- currentText: 'Hoy',\r
- monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',\r
- 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],\r
- monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',\r
- 'Jul','Ago','Sep','Oct','Nov','Dic'],\r
- dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],\r
- dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],\r
- dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['es']);\r
-});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */\r
-/* Javad Mowlanezhad -- jmowla@gmail.com */\r
-/* Jalali calendar should supported soon! (Its implemented but I have to test it) */\r
-jQuery(function($) {\r
- $.datepicker.regional['fa'] = {\r
- closeText: 'بستن',\r
- prevText: '<قبلي',\r
- nextText: 'بعدي>',\r
- currentText: 'امروز',\r
- monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',\r
- 'مهر','آبان','آذر','دي','بهمن','اسفند'],\r
- monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
- dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],\r
- dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],\r
- dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],\r
- dateFormat: 'yy/mm/dd', firstDay: 6,\r
- isRTL: true};\r
- $.datepicker.setDefaults($.datepicker.regional['fa']);\r
-});/* Finnish initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Harri Kilpi� (harrikilpio@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['fi'] = {\r
- closeText: 'Sulje',\r
- prevText: '«Edellinen',\r
- nextText: 'Seuraava»',\r
- currentText: 'Tänään',\r
- monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',\r
- 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],\r
- monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',\r
- 'Heinä','Elo','Syys','Loka','Marras','Joulu'],\r
- dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],\r
- dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],\r
- dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['fi']);\r
-});\r
-/* French initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */\r
-jQuery(function($){\r
- $.datepicker.regional['fr'] = {\r
- closeText: 'Fermer',\r
- prevText: '<Préc',\r
- nextText: 'Suiv>',\r
- currentText: 'Courant',\r
- monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',\r
- 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],\r
- monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',\r
- 'Jul','Aoû','Sep','Oct','Nov','Déc'],\r
- dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],\r
- dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],\r
- dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['fr']);\r
-});/* Hebrew initialisation for the UI Datepicker extension. */\r
-/* Written by Amir Hardon (ahardon at gmail dot com). */\r
-jQuery(function($){\r
- $.datepicker.regional['he'] = {\r
- closeText: 'סגור',\r
- prevText: '<הקודם',\r
- nextText: 'הבא>',\r
- currentText: 'היום',\r
- monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',\r
- 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],\r
- monthNamesShort: ['1','2','3','4','5','6',\r
- '7','8','9','10','11','12'],\r
- dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],\r
- dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
- dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: true};\r
- $.datepicker.setDefaults($.datepicker.regional['he']);\r
-});\r
-/* Croatian i18n for the jQuery UI date picker plugin. */\r
-/* Written by Vjekoslav Nesek. */\r
-jQuery(function($){\r
- $.datepicker.regional['hr'] = {\r
- closeText: 'Zatvori',\r
- prevText: '<',\r
- nextText: '>',\r
- currentText: 'Danas',\r
- monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',\r
- 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],\r
- monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',\r
- 'Srp','Kol','Ruj','Lis','Stu','Pro'],\r
- dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],\r
- dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],\r
- dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
- dateFormat: 'dd.mm.yy.', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['hr']);\r
-});/* Hungarian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */\r
-jQuery(function($){\r
- $.datepicker.regional['hu'] = {\r
- closeText: 'bezárás',\r
- prevText: '« vissza',\r
- nextText: 'előre »',\r
- currentText: 'ma',\r
- monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',\r
- 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],\r
- monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',\r
- 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],\r
- dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],\r
- dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],\r
- dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],\r
- dateFormat: 'yy-mm-dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['hu']);\r
-});\r
-/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/\r
-jQuery(function($){\r
- $.datepicker.regional['hy'] = {\r
- closeText: 'Փակել',\r
- prevText: '<Նախ.',\r
- nextText: 'Հաջ.>',\r
- currentText: 'Այսօր',\r
- monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',\r
- 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],\r
- monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',\r
- 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],\r
- dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],\r
- dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
- dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['hy']);\r
-});/* Indonesian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Deden Fathurahman (dedenf@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['id'] = {\r
- closeText: 'Tutup',\r
- prevText: '<mundur',\r
- nextText: 'maju>',\r
- currentText: 'hari ini',\r
- monthNames: ['Januari','Februari','Maret','April','Mei','Juni',\r
- 'Juli','Agustus','September','Oktober','Nopember','Desember'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',\r
- 'Jul','Agus','Sep','Okt','Nop','Des'],\r
- dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],\r
- dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],\r
- dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['id']);\r
-});/* Icelandic initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Haukur H. Thorsson (haukur@eskill.is). */\r
-jQuery(function($){\r
- $.datepicker.regional['is'] = {\r
- closeText: 'Loka',\r
- prevText: '< Fyrri',\r
- nextText: 'Næsti >',\r
- currentText: 'Í dag',\r
- monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',\r
- 'Júlí','Ágúst','September','Október','Nóvember','Desember'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',\r
- 'Júl','Ágú','Sep','Okt','Nóv','Des'],\r
- dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],\r
- dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],\r
- dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['is']);\r
-});/* Italian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Apaella (apaella@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['it'] = {\r
- closeText: 'Chiudi',\r
- prevText: '<Prec',\r
- nextText: 'Succ>',\r
- currentText: 'Oggi',\r
- monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',\r
- 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],\r
- monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',\r
- 'Lug','Ago','Set','Ott','Nov','Dic'],\r
- dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],\r
- dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],\r
- dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['it']);\r
-});\r
-/* Japanese initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Kentaro SATO (kentaro@ranvis.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['ja'] = {\r
- closeText: '閉じる',\r
- prevText: '<前',\r
- nextText: '次>',\r
- currentText: '今日',\r
- monthNames: ['1月','2月','3月','4月','5月','6月',\r
- '7月','8月','9月','10月','11月','12月'],\r
- monthNamesShort: ['1月','2月','3月','4月','5月','6月',\r
- '7月','8月','9月','10月','11月','12月'],\r
- dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],\r
- dayNamesShort: ['日','月','火','水','木','金','土'],\r
- dayNamesMin: ['日','月','火','水','木','金','土'],\r
- dateFormat: 'yy/mm/dd', firstDay: 0,\r
- isRTL: false,\r
- showMonthAfterYear: true};\r
- $.datepicker.setDefaults($.datepicker.regional['ja']);\r
-});/* Korean initialisation for the jQuery calendar extension. */\r
-/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['ko'] = {\r
- closeText: '닫기',\r
- prevText: '이전달',\r
- nextText: '다음달',\r
- currentText: '오늘',\r
- monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
- '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
- monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
- '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
- dayNames: ['일','월','화','수','목','금','토'],\r
- dayNamesShort: ['일','월','화','수','목','금','토'],\r
- dayNamesMin: ['일','월','화','수','목','금','토'],\r
- dateFormat: 'yy-mm-dd', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['ko']);\r
-});/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* @author Arturas Paleicikas <arturas@avalon.lt> */\r
-jQuery(function($){\r
- $.datepicker.regional['lt'] = {\r
- closeText: 'Uždaryti',\r
- prevText: '<Atgal',\r
- nextText: 'Pirmyn>',\r
- currentText: 'Šiandien',\r
- monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',\r
- 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],\r
- monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',\r
- 'Lie','Rugp','Rugs','Spa','Lap','Gru'],\r
- dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],\r
- dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],\r
- dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],\r
- dateFormat: 'yy-mm-dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['lt']);\r
-});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */\r
-jQuery(function($){\r
- $.datepicker.regional['lv'] = {\r
- closeText: 'Aizvērt',\r
- prevText: 'Iepr',\r
- nextText: 'Nāka',\r
- currentText: 'Šodien',\r
- monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',\r
- 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',\r
- 'Jūl','Aug','Sep','Okt','Nov','Dec'],\r
- dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],\r
- dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],\r
- dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],\r
- dateFormat: 'dd-mm-yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['lv']);\r
-});/* Malaysian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */\r
-jQuery(function($){\r
- $.datepicker.regional['ms'] = {\r
- closeText: 'Tutup',\r
- prevText: '<Sebelum',\r
- nextText: 'Selepas>',\r
- currentText: 'hari ini',\r
- monthNames: ['Januari','Februari','Mac','April','Mei','Jun',\r
- 'Julai','Ogos','September','Oktober','November','Disember'],\r
- monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',\r
- 'Jul','Ogo','Sep','Okt','Nov','Dis'],\r
- dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],\r
- dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],\r
- dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['ms']);\r
-});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Mathias Bynens <http://mathiasbynens.be/> */\r
-jQuery(function($){\r
- $.datepicker.regional.nl = {\r
- closeText: 'Sluiten',\r
- prevText: '←',\r
- nextText: '→',\r
- currentText: 'Vandaag',\r
- monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',\r
- 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],\r
- monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',\r
- 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],\r
- dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],\r
- dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],\r
- dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional.nl);\r
-});/* Norwegian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['no'] = {\r
- closeText: 'Lukk',\r
- prevText: '«Forrige',\r
- nextText: 'Neste»',\r
- currentText: 'I dag',\r
- monthNames: ['Januar','Februar','Mars','April','Mai','Juni',\r
- 'Juli','August','September','Oktober','November','Desember'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',\r
- 'Jul','Aug','Sep','Okt','Nov','Des'],\r
- dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
- dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
- dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
- dateFormat: 'yy-mm-dd', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['no']);\r
-});\r
-/* Polish initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['pl'] = {\r
- closeText: 'Zamknij',\r
- prevText: '<Poprzedni',\r
- nextText: 'Następny>',\r
- currentText: 'Dziś',\r
- monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',\r
- 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],\r
- monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',\r
- 'Lip','Sie','Wrz','Pa','Lis','Gru'],\r
- dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],\r
- dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],\r
- dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],\r
- dateFormat: 'yy-mm-dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['pl']);\r
-});\r
-/* Brazilian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['pt-BR'] = {\r
- closeText: 'Fechar',\r
- prevText: '<Anterior',\r
- nextText: 'Próximo>',\r
- currentText: 'Hoje',\r
- monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',\r
- 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],\r
- monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',\r
- 'Jul','Ago','Set','Out','Nov','Dez'],\r
- dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],\r
- dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
- dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['pt-BR']);\r
-});/* Romanian initialisation for the jQuery UI date picker plugin.\r
- *\r
- * Written by Edmond L. (ll_edmond@walla.com)\r
- * and Ionut G. Stan (ionut.g.stan@gmail.com)\r
- */\r
-jQuery(function($){\r
- $.datepicker.regional['ro'] = {\r
- closeText: 'Închide',\r
- prevText: '« Luna precedentă',\r
- nextText: 'Luna următoare »',\r
- currentText: 'Azi',\r
- monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',\r
- 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],\r
- monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',\r
- 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],\r
- dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],\r
- dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],\r
- dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],\r
- dateFormat: 'dd MM yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['ro']);\r
-});\r
-/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Andrew Stromnov (stromnov@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['ru'] = {\r
- closeText: 'Закрыть',\r
- prevText: '<Пред',\r
- nextText: 'След>',\r
- currentText: 'Сегодня',\r
- monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',\r
- 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],\r
- monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',\r
- 'Июл','Авг','Сен','Окт','Ноя','Дек'],\r
- dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],\r
- dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],\r
- dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['ru']);\r
-});/* Slovak initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Vojtech Rinik (vojto@hmm.sk). */\r
-jQuery(function($){\r
- $.datepicker.regional['sk'] = {\r
- closeText: 'Zavrieť',\r
- prevText: '<Predchádzajúci',\r
- nextText: 'Nasledujúci>',\r
- currentText: 'Dnes',\r
- monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',\r
- 'Júl','August','September','Október','November','December'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',\r
- 'Júl','Aug','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],\r
- dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],\r
- dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],\r
- dateFormat: 'dd.mm.yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sk']);\r
-});\r
-/* Slovenian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Jaka Jancar (jaka@kubje.org). */\r
-/* c = č, s = š z = ž C = Č S = Š Z = Ž */\r
-jQuery(function($){\r
- $.datepicker.regional['sl'] = {\r
- closeText: 'Zapri',\r
- prevText: '<Prejšnji',\r
- nextText: 'Naslednji>',\r
- currentText: 'Trenutni',\r
- monthNames: ['Januar','Februar','Marec','April','Maj','Junij',\r
- 'Julij','Avgust','September','Oktober','November','December'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],\r
- dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],\r
- dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sl']);\r
-});\r
-/* Albanian initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Flakron Bytyqi (flakron@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['sq'] = {\r
- closeText: 'mbylle',\r
- prevText: '<mbrapa',\r
- nextText: 'Përpara>',\r
- currentText: 'sot',\r
- monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',\r
- 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],\r
- monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',\r
- 'Kor','Gus','Sht','Tet','Nën','Dhj'],\r
- dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],\r
- dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
- dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sq']);\r
-});\r
-/* Serbian i18n for the jQuery UI date picker plugin. */\r
-/* Written by Dejan Dimić. */\r
-jQuery(function($){\r
- $.datepicker.regional['sr-SR'] = {\r
- closeText: 'Zatvori',\r
- prevText: '<',\r
- nextText: '>',\r
- currentText: 'Danas',\r
- monthNames: ['Januar','Februar','Mart','April','Maj','Jun',\r
- 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],\r
- dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],\r
- dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sr-SR']);\r
-});
-/* Serbian i18n for the jQuery UI date picker plugin. */\r
-/* Written by Dejan Dimić. */\r
-jQuery(function($){\r
- $.datepicker.regional['sr'] = {\r
- closeText: 'Затвори',\r
- prevText: '<',\r
- nextText: '>',\r
- currentText: 'Данас',\r
- monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',\r
- 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],\r
- monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',\r
- 'Јул','Авг','Сеп','Окт','Нов','Дец'],\r
- dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],\r
- dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],\r
- dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sr']);\r
-});
-/* Swedish initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Anders Ekdahl ( anders@nomadiz.se). */\r
-jQuery(function($){\r
- $.datepicker.regional['sv'] = {\r
- closeText: 'Stäng',\r
- prevText: '«Förra',\r
- nextText: 'Nästa»',\r
- currentText: 'Idag',\r
- monthNames: ['Januari','Februari','Mars','April','Maj','Juni',\r
- 'Juli','Augusti','September','Oktober','November','December'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
- dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],\r
- dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],\r
- dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],\r
- dateFormat: 'yy-mm-dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sv']);\r
-});\r
-/* Thai initialisation for the jQuery UI date picker plugin. */\r
-/* Written by pipo (pipo@sixhead.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['th'] = {\r
- closeText: 'ปิด',\r
- prevText: '« ย้อน',\r
- nextText: 'ถัดไป »',\r
- currentText: 'วันนี้',\r
- monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',\r
- 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],\r
- monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',\r
- 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],\r
- dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],\r
- dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
- dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
- dateFormat: 'dd/mm/yy', firstDay: 0,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['th']);\r
-});/* Turkish initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Izzet Emre Erkan (kara@karalamalar.net). */\r
-jQuery(function($){\r
- $.datepicker.regional['tr'] = {\r
- closeText: 'kapat',\r
- prevText: '<geri',\r
- nextText: 'ileri>',\r
- currentText: 'bugün',\r
- monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',\r
- 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],\r
- monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',\r
- 'Tem','Ağu','Eyl','Eki','Kas','Ara'],\r
- dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],\r
- dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
- dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
- dateFormat: 'dd.mm.yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['tr']);\r
-});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['uk'] = {\r
- clearText: 'Очистити', clearStatus: '',\r
- closeText: 'Закрити', closeStatus: '',\r
- prevText: '<', prevStatus: '',\r
- prevBigText: '<<', prevBigStatus: '',\r
- nextText: '>', nextStatus: '',\r
- nextBigText: '>>', nextBigStatus: '',\r
- currentText: 'Сьогодні', currentStatus: '',\r
- monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',\r
- 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],\r
- monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',\r
- 'Лип','Сер','Вер','Жов','Лис','Гру'],\r
- monthStatus: '', yearStatus: '',\r
- weekHeader: 'Не', weekStatus: '',\r
- dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],\r
- dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],\r
- dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],\r
- dayStatus: 'DD', dateStatus: 'D, M d',\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- initStatus: '', isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['uk']);\r
-});/* Chinese initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Cloudream (cloudream@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['zh-CN'] = {\r
- closeText: '关闭',\r
- prevText: '<上月',\r
- nextText: '下月>',\r
- currentText: '今天',\r
- monthNames: ['一月','二月','三月','四月','五月','六月',\r
- '七月','八月','九月','十月','十一月','十二月'],\r
- monthNamesShort: ['一','二','三','四','五','六',\r
- '七','八','九','十','十一','十二'],\r
- dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
- dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
- dayNamesMin: ['日','一','二','三','四','五','六'],\r
- dateFormat: 'yy-mm-dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['zh-CN']);\r
-});\r
-/* Chinese initialisation for the jQuery UI date picker plugin. */\r
-/* Written by Ressol (ressol@gmail.com). */\r
-jQuery(function($){\r
- $.datepicker.regional['zh-TW'] = {\r
- closeText: '關閉',\r
- prevText: '<上月',\r
- nextText: '下月>',\r
- currentText: '今天',\r
- monthNames: ['一月','二月','三月','四月','五月','六月',\r
- '七月','八月','九月','十月','十一月','十二月'],\r
- monthNamesShort: ['一','二','三','四','五','六',\r
- '七','八','九','十','十一','十二'],\r
- dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
- dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
- dayNamesMin: ['日','一','二','三','四','五','六'],\r
- dateFormat: 'yy/mm/dd', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['zh-TW']);\r
-});\r
+++ /dev/null
-/* Arabic Translation for jQuery UI date picker plugin. */
-/* Khaled Al Horani -- koko.dw@gmail.com */
-/* خالد الحوراني -- koko.dw@gmail.com */
-/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
-jQuery(function($){
- $.datepicker.regional['ar'] = {
- closeText: 'إغلاق',
- prevText: '<السابق',
- nextText: 'التالي>',
- currentText: 'اليوم',
- monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
- 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
- monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
- dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
- dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
- dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: true};
- $.datepicker.setDefaults($.datepicker.regional['ar']);
-});
\ No newline at end of file
+++ /dev/null
-/* Bulgarian initialisation for the jQuery UI date picker plugin. */
-/* Written by Stoyan Kyosev (http://svest.org). */
-jQuery(function($){
- $.datepicker.regional['bg'] = {
- closeText: 'затвори',
- prevText: '<назад',
- nextText: 'напред>',
- nextBigText: '>>',
- currentText: 'днес',
- monthNames: ['Януари','Февруари','Март','Април','Май','Юни',
- 'Юли','Август','Септември','Октомври','Ноември','Декември'],
- monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',
- 'Юли','Авг','Сеп','Окт','Нов','Дек'],
- dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],
- dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],
- dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['bg']);
-});
+++ /dev/null
-/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */
-/* Writers: (joan.leon@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['ca'] = {
- closeText: 'Tancar',
- prevText: '<Ant',
- nextText: 'Seg>',
- currentText: 'Avui',
- monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',
- 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
- monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
- 'Jul','Ago','Set','Oct','Nov','Des'],
- dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
- dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
- dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
- dateFormat: 'mm/dd/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['ca']);
-});
\ No newline at end of file
+++ /dev/null
-/* Czech initialisation for the jQuery UI date picker plugin. */
-/* Written by Tomas Muller (tomas@tomas-muller.net). */
-jQuery(function($){
- $.datepicker.regional['cs'] = {
- closeText: 'Zavřít',
- prevText: '<Dříve',
- nextText: 'Později>',
- currentText: 'Nyní',
- monthNames: ['leden','únor','březen','duben','květen','červen',
- 'červenec','srpen','září','říjen','listopad','prosinec'],
- monthNamesShort: ['led','úno','bře','dub','kvě','čer',
- 'čvc','srp','zář','říj','lis','pro'],
- dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],
- dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],
- dayNamesMin: ['ne','po','út','st','čt','pá','so'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['cs']);
-});
+++ /dev/null
-/* Danish initialisation for the jQuery UI date picker plugin. */
-/* Written by Jan Christensen ( deletestuff@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['da'] = {
- closeText: 'Luk',
- prevText: '<Forrige',
- nextText: 'Næste>',
- currentText: 'Idag',
- monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
- 'Juli','August','September','Oktober','November','December'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
- 'Jul','Aug','Sep','Okt','Nov','Dec'],
- dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
- dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
- dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
- dateFormat: 'dd-mm-yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['da']);
-});
+++ /dev/null
-/* German initialisation for the jQuery UI date picker plugin. */
-/* Written by Milian Wolff (mail@milianw.de). */
-jQuery(function($){
- $.datepicker.regional['de'] = {
- closeText: 'schließen',
- prevText: '<zurück',
- nextText: 'Vor>',
- currentText: 'heute',
- monthNames: ['Januar','Februar','März','April','Mai','Juni',
- 'Juli','August','September','Oktober','November','Dezember'],
- monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
- 'Jul','Aug','Sep','Okt','Nov','Dez'],
- dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
- dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
- dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['de']);
-});
+++ /dev/null
-/* Greek (el) initialisation for the jQuery UI date picker plugin. */
-/* Written by Alex Cicovic (http://www.alexcicovic.com) */
-jQuery(function($){
- $.datepicker.regional['el'] = {
- closeText: 'Κλείσιμο',
- prevText: 'Προηγούμενος',
- nextText: 'Επόμενος',
- currentText: 'Τρέχων Μήνας',
- monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',
- 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],
- monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',
- 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],
- dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],
- dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],
- dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],
- dateFormat: 'dd/mm/yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['el']);
-});
\ No newline at end of file
+++ /dev/null
-/* Esperanto initialisation for the jQuery UI date picker plugin. */
-/* Written by Olivier M. (olivierweb@ifrance.com). */
-jQuery(function($){
- $.datepicker.regional['eo'] = {
- closeText: 'Fermi',
- prevText: '<Anta',
- nextText: 'Sekv>',
- currentText: 'Nuna',
- monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
- 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
- 'Jul','Aŭg','Sep','Okt','Nov','Dec'],
- dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
- dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],
- dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['eo']);
-});
+++ /dev/null
-/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */
-/* Traducido por Vester (xvester@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['es'] = {
- closeText: 'Cerrar',
- prevText: '<Ant',
- nextText: 'Sig>',
- currentText: 'Hoy',
- monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
- 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
- monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
- 'Jul','Ago','Sep','Oct','Nov','Dic'],
- dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],
- dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],
- dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['es']);
-});
\ No newline at end of file
+++ /dev/null
-/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
-/* Javad Mowlanezhad -- jmowla@gmail.com */
-/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
-jQuery(function($) {
- $.datepicker.regional['fa'] = {
- closeText: 'بستن',
- prevText: '<قبلي',
- nextText: 'بعدي>',
- currentText: 'امروز',
- monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
- 'مهر','آبان','آذر','دي','بهمن','اسفند'],
- monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
- dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
- dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
- dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
- dateFormat: 'yy/mm/dd', firstDay: 6,
- isRTL: true};
- $.datepicker.setDefaults($.datepicker.regional['fa']);
-});
\ No newline at end of file
+++ /dev/null
-/* Finnish initialisation for the jQuery UI date picker plugin. */
-/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['fi'] = {
- closeText: 'Sulje',
- prevText: '«Edellinen',
- nextText: 'Seuraava»',
- currentText: 'Tänään',
- monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',
- 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
- monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',
- 'Heinä','Elo','Syys','Loka','Marras','Joulu'],
- dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
- dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
- dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['fi']);
-});
+++ /dev/null
-/* French initialisation for the jQuery UI date picker plugin. */
-/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */
-jQuery(function($){
- $.datepicker.regional['fr'] = {
- closeText: 'Fermer',
- prevText: '<Préc',
- nextText: 'Suiv>',
- currentText: 'Courant',
- monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
- 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
- monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
- 'Jul','Aoû','Sep','Oct','Nov','Déc'],
- dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
- dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
- dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
- dateFormat: 'dd/mm/yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['fr']);
-});
\ No newline at end of file
+++ /dev/null
-/* Hebrew initialisation for the UI Datepicker extension. */
-/* Written by Amir Hardon (ahardon at gmail dot com). */
-jQuery(function($){
- $.datepicker.regional['he'] = {
- closeText: 'סגור',
- prevText: '<הקודם',
- nextText: 'הבא>',
- currentText: 'היום',
- monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',
- 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],
- monthNamesShort: ['1','2','3','4','5','6',
- '7','8','9','10','11','12'],
- dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
- dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
- dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: true};
- $.datepicker.setDefaults($.datepicker.regional['he']);
-});
+++ /dev/null
-/* Croatian i18n for the jQuery UI date picker plugin. */
-/* Written by Vjekoslav Nesek. */
-jQuery(function($){
- $.datepicker.regional['hr'] = {
- closeText: 'Zatvori',
- prevText: '<',
- nextText: '>',
- currentText: 'Danas',
- monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',
- 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
- monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
- 'Srp','Kol','Ruj','Lis','Stu','Pro'],
- dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
- dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
- dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
- dateFormat: 'dd.mm.yy.', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['hr']);
-});
\ No newline at end of file
+++ /dev/null
-/* Hungarian initialisation for the jQuery UI date picker plugin. */
-/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */
-jQuery(function($){
- $.datepicker.regional['hu'] = {
- closeText: 'bezárás',
- prevText: '« vissza',
- nextText: 'előre »',
- currentText: 'ma',
- monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',
- 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
- monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',
- 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
- dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
- dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
- dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
- dateFormat: 'yy-mm-dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['hu']);
-});
+++ /dev/null
-/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
-jQuery(function($){
- $.datepicker.regional['hy'] = {
- closeText: 'Փակել',
- prevText: '<Նախ.',
- nextText: 'Հաջ.>',
- currentText: 'Այսօր',
- monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',
- 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],
- monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',
- 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],
- dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],
- dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
- dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['hy']);
-});
\ No newline at end of file
+++ /dev/null
-/* Indonesian initialisation for the jQuery UI date picker plugin. */
-/* Written by Deden Fathurahman (dedenf@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['id'] = {
- closeText: 'Tutup',
- prevText: '<mundur',
- nextText: 'maju>',
- currentText: 'hari ini',
- monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
- 'Juli','Agustus','September','Oktober','Nopember','Desember'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
- 'Jul','Agus','Sep','Okt','Nop','Des'],
- dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
- dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
- dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['id']);
-});
\ No newline at end of file
+++ /dev/null
-/* Icelandic initialisation for the jQuery UI date picker plugin. */
-/* Written by Haukur H. Thorsson (haukur@eskill.is). */
-jQuery(function($){
- $.datepicker.regional['is'] = {
- closeText: 'Loka',
- prevText: '< Fyrri',
- nextText: 'Næsti >',
- currentText: 'Í dag',
- monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',
- 'Júlí','Ágúst','September','Október','Nóvember','Desember'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',
- 'Júl','Ágú','Sep','Okt','Nóv','Des'],
- dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],
- dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],
- dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['is']);
-});
\ No newline at end of file
+++ /dev/null
-/* Italian initialisation for the jQuery UI date picker plugin. */
-/* Written by Apaella (apaella@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['it'] = {
- closeText: 'Chiudi',
- prevText: '<Prec',
- nextText: 'Succ>',
- currentText: 'Oggi',
- monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
- 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
- monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
- 'Lug','Ago','Set','Ott','Nov','Dic'],
- dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],
- dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
- dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],
- dateFormat: 'dd/mm/yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['it']);
-});
+++ /dev/null
-/* Japanese initialisation for the jQuery UI date picker plugin. */
-/* Written by Kentaro SATO (kentaro@ranvis.com). */
-jQuery(function($){
- $.datepicker.regional['ja'] = {
- closeText: '閉じる',
- prevText: '<前',
- nextText: '次>',
- currentText: '今日',
- monthNames: ['1月','2月','3月','4月','5月','6月',
- '7月','8月','9月','10月','11月','12月'],
- monthNamesShort: ['1月','2月','3月','4月','5月','6月',
- '7月','8月','9月','10月','11月','12月'],
- dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],
- dayNamesShort: ['日','月','火','水','木','金','土'],
- dayNamesMin: ['日','月','火','水','木','金','土'],
- dateFormat: 'yy/mm/dd', firstDay: 0,
- isRTL: false,
- showMonthAfterYear: true};
- $.datepicker.setDefaults($.datepicker.regional['ja']);
-});
\ No newline at end of file
+++ /dev/null
-/* Korean initialisation for the jQuery calendar extension. */
-/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['ko'] = {
- closeText: '닫기',
- prevText: '이전달',
- nextText: '다음달',
- currentText: '오늘',
- monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
- '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
- monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
- '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
- dayNames: ['일','월','화','수','목','금','토'],
- dayNamesShort: ['일','월','화','수','목','금','토'],
- dayNamesMin: ['일','월','화','수','목','금','토'],
- dateFormat: 'yy-mm-dd', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['ko']);
-});
\ No newline at end of file
+++ /dev/null
-/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* @author Arturas Paleicikas <arturas@avalon.lt> */
-jQuery(function($){
- $.datepicker.regional['lt'] = {
- closeText: 'Uždaryti',
- prevText: '<Atgal',
- nextText: 'Pirmyn>',
- currentText: 'Šiandien',
- monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
- 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
- monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
- 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
- dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],
- dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
- dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],
- dateFormat: 'yy-mm-dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['lt']);
-});
\ No newline at end of file
+++ /dev/null
-/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
-jQuery(function($){
- $.datepicker.regional['lv'] = {
- closeText: 'Aizvērt',
- prevText: 'Iepr',
- nextText: 'Nāka',
- currentText: 'Šodien',
- monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',
- 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',
- 'Jūl','Aug','Sep','Okt','Nov','Dec'],
- dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
- dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
- dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
- dateFormat: 'dd-mm-yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['lv']);
-});
\ No newline at end of file
+++ /dev/null
-/* Malaysian initialisation for the jQuery UI date picker plugin. */
-/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
-jQuery(function($){
- $.datepicker.regional['ms'] = {
- closeText: 'Tutup',
- prevText: '<Sebelum',
- nextText: 'Selepas>',
- currentText: 'hari ini',
- monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
- 'Julai','Ogos','September','Oktober','November','Disember'],
- monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
- 'Jul','Ogo','Sep','Okt','Nov','Dis'],
- dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
- dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
- dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['ms']);
-});
\ No newline at end of file
+++ /dev/null
-/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Mathias Bynens <http://mathiasbynens.be/> */
-jQuery(function($){
- $.datepicker.regional.nl = {
- closeText: 'Sluiten',
- prevText: '←',
- nextText: '→',
- currentText: 'Vandaag',
- monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
- 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
- monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
- 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
- dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
- dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
- dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
- dateFormat: 'dd/mm/yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional.nl);
-});
\ No newline at end of file
+++ /dev/null
-/* Norwegian initialisation for the jQuery UI date picker plugin. */
-/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['no'] = {
- closeText: 'Lukk',
- prevText: '«Forrige',
- nextText: 'Neste»',
- currentText: 'I dag',
- monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
- 'Juli','August','September','Oktober','November','Desember'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
- 'Jul','Aug','Sep','Okt','Nov','Des'],
- dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
- dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
- dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
- dateFormat: 'yy-mm-dd', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['no']);
-});
+++ /dev/null
-/* Polish initialisation for the jQuery UI date picker plugin. */
-/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['pl'] = {
- closeText: 'Zamknij',
- prevText: '<Poprzedni',
- nextText: 'Następny>',
- currentText: 'Dziś',
- monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
- 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
- monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
- 'Lip','Sie','Wrz','Pa','Lis','Gru'],
- dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
- dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],
- dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],
- dateFormat: 'yy-mm-dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['pl']);
-});
+++ /dev/null
-/* Brazilian initialisation for the jQuery UI date picker plugin. */
-/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['pt-BR'] = {
- closeText: 'Fechar',
- prevText: '<Anterior',
- nextText: 'Próximo>',
- currentText: 'Hoje',
- monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',
- 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
- monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
- 'Jul','Ago','Set','Out','Nov','Dez'],
- dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
- dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
- dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
-});
\ No newline at end of file
+++ /dev/null
-/* Romanian initialisation for the jQuery UI date picker plugin.
- *
- * Written by Edmond L. (ll_edmond@walla.com)
- * and Ionut G. Stan (ionut.g.stan@gmail.com)
- */
-jQuery(function($){
- $.datepicker.regional['ro'] = {
- closeText: 'Închide',
- prevText: '« Luna precedentă',
- nextText: 'Luna următoare »',
- currentText: 'Azi',
- monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
- 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
- monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
- 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
- dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
- dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
- dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
- dateFormat: 'dd MM yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['ro']);
-});
+++ /dev/null
-/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Andrew Stromnov (stromnov@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['ru'] = {
- closeText: 'Закрыть',
- prevText: '<Пред',
- nextText: 'След>',
- currentText: 'Сегодня',
- monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',
- 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],
- monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',
- 'Июл','Авг','Сен','Окт','Ноя','Дек'],
- dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],
- dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],
- dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['ru']);
-});
\ No newline at end of file
+++ /dev/null
-/* Slovak initialisation for the jQuery UI date picker plugin. */
-/* Written by Vojtech Rinik (vojto@hmm.sk). */
-jQuery(function($){
- $.datepicker.regional['sk'] = {
- closeText: 'Zavrieť',
- prevText: '<Predchádzajúci',
- nextText: 'Nasledujúci>',
- currentText: 'Dnes',
- monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
- 'Júl','August','September','Október','November','December'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
- 'Júl','Aug','Sep','Okt','Nov','Dec'],
- dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],
- dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],
- dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],
- dateFormat: 'dd.mm.yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['sk']);
-});
+++ /dev/null
-/* Slovenian initialisation for the jQuery UI date picker plugin. */
-/* Written by Jaka Jancar (jaka@kubje.org). */
-/* c = č, s = š z = ž C = Č S = Š Z = Ž */
-jQuery(function($){
- $.datepicker.regional['sl'] = {
- closeText: 'Zapri',
- prevText: '<Prejšnji',
- nextText: 'Naslednji>',
- currentText: 'Trenutni',
- monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
- 'Julij','Avgust','September','Oktober','November','December'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
- 'Jul','Avg','Sep','Okt','Nov','Dec'],
- dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],
- dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],
- dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['sl']);
-});
+++ /dev/null
-/* Albanian initialisation for the jQuery UI date picker plugin. */
-/* Written by Flakron Bytyqi (flakron@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['sq'] = {
- closeText: 'mbylle',
- prevText: '<mbrapa',
- nextText: 'Përpara>',
- currentText: 'sot',
- monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
- 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
- monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
- 'Kor','Gus','Sht','Tet','Nën','Dhj'],
- dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
- dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
- dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['sq']);
-});
+++ /dev/null
-/* Serbian i18n for the jQuery UI date picker plugin. */\r
-/* Written by Dejan Dimić. */\r
-jQuery(function($){\r
- $.datepicker.regional['sr-SR'] = {\r
- closeText: 'Zatvori',\r
- prevText: '<',\r
- nextText: '>',\r
- currentText: 'Danas',\r
- monthNames: ['Januar','Februar','Mart','April','Maj','Jun',\r
- 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],\r
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
- 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
- dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],\r
- dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],\r
- dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sr-SR']);\r
-});
+++ /dev/null
-/* Serbian i18n for the jQuery UI date picker plugin. */\r
-/* Written by Dejan Dimić. */\r
-jQuery(function($){\r
- $.datepicker.regional['sr'] = {\r
- closeText: 'Затвори',\r
- prevText: '<',\r
- nextText: '>',\r
- currentText: 'Данас',\r
- monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',\r
- 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],\r
- monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',\r
- 'Јул','Авг','Сеп','Окт','Нов','Дец'],\r
- dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],\r
- dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],\r
- dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],\r
- dateFormat: 'dd/mm/yy', firstDay: 1,\r
- isRTL: false};\r
- $.datepicker.setDefaults($.datepicker.regional['sr']);\r
-});
+++ /dev/null
-/* Swedish initialisation for the jQuery UI date picker plugin. */
-/* Written by Anders Ekdahl ( anders@nomadiz.se). */
-jQuery(function($){
- $.datepicker.regional['sv'] = {
- closeText: 'Stäng',
- prevText: '«Förra',
- nextText: 'Nästa»',
- currentText: 'Idag',
- monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
- 'Juli','Augusti','September','Oktober','November','December'],
- monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
- 'Jul','Aug','Sep','Okt','Nov','Dec'],
- dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
- dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
- dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
- dateFormat: 'yy-mm-dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['sv']);
-});
+++ /dev/null
-/* Thai initialisation for the jQuery UI date picker plugin. */
-/* Written by pipo (pipo@sixhead.com). */
-jQuery(function($){
- $.datepicker.regional['th'] = {
- closeText: 'ปิด',
- prevText: '« ย้อน',
- nextText: 'ถัดไป »',
- currentText: 'วันนี้',
- monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
- 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],
- monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
- 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],
- dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],
- dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
- dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
- dateFormat: 'dd/mm/yy', firstDay: 0,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['th']);
-});
\ No newline at end of file
+++ /dev/null
-/* Turkish initialisation for the jQuery UI date picker plugin. */
-/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
-jQuery(function($){
- $.datepicker.regional['tr'] = {
- closeText: 'kapat',
- prevText: '<geri',
- nextText: 'ileri>',
- currentText: 'bugün',
- monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
- 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
- monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',
- 'Tem','Ağu','Eyl','Eki','Kas','Ara'],
- dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
- dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
- dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
- dateFormat: 'dd.mm.yy', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['tr']);
-});
\ No newline at end of file
+++ /dev/null
-/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['uk'] = {
- clearText: 'Очистити', clearStatus: '',
- closeText: 'Закрити', closeStatus: '',
- prevText: '<', prevStatus: '',
- prevBigText: '<<', prevBigStatus: '',
- nextText: '>', nextStatus: '',
- nextBigText: '>>', nextBigStatus: '',
- currentText: 'Сьогодні', currentStatus: '',
- monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
- 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],
- monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
- 'Лип','Сер','Вер','Жов','Лис','Гру'],
- monthStatus: '', yearStatus: '',
- weekHeader: 'Не', weekStatus: '',
- dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],
- dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],
- dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],
- dayStatus: 'DD', dateStatus: 'D, M d',
- dateFormat: 'dd/mm/yy', firstDay: 1,
- initStatus: '', isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['uk']);
-});
\ No newline at end of file
+++ /dev/null
-/* Chinese initialisation for the jQuery UI date picker plugin. */
-/* Written by Cloudream (cloudream@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['zh-CN'] = {
- closeText: '关闭',
- prevText: '<上月',
- nextText: '下月>',
- currentText: '今天',
- monthNames: ['一月','二月','三月','四月','五月','六月',
- '七月','八月','九月','十月','十一月','十二月'],
- monthNamesShort: ['一','二','三','四','五','六',
- '七','八','九','十','十一','十二'],
- dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
- dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
- dayNamesMin: ['日','一','二','三','四','五','六'],
- dateFormat: 'yy-mm-dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
-});
+++ /dev/null
-/* Chinese initialisation for the jQuery UI date picker plugin. */
-/* Written by Ressol (ressol@gmail.com). */
-jQuery(function($){
- $.datepicker.regional['zh-TW'] = {
- closeText: '關閉',
- prevText: '<上月',
- nextText: '下月>',
- currentText: '今天',
- monthNames: ['一月','二月','三月','四月','五月','六月',
- '七月','八月','九月','十月','十一月','十二月'],
- monthNamesShort: ['一','二','三','四','五','六',
- '七','八','九','十','十一','十二'],
- dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
- dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
- dayNamesMin: ['日','一','二','三','四','五','六'],
- dateFormat: 'yy/mm/dd', firstDay: 1,
- isRTL: false};
- $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
-});
+++ /dev/null
-/*
- * jQuery UI 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI
- */
-;jQuery.ui || (function($) {
-
-var _remove = $.fn.remove,
- isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
-
-//Helper functions and ui object
-$.ui = {
- version: "1.7.1",
-
- // $.ui.plugin is deprecated. Use the proxy pattern instead.
- plugin: {
- add: function(module, option, set) {
- var proto = $.ui[module].prototype;
- for(var i in set) {
- proto.plugins[i] = proto.plugins[i] || [];
- proto.plugins[i].push([option, set[i]]);
- }
- },
- call: function(instance, name, args) {
- var set = instance.plugins[name];
- if(!set || !instance.element[0].parentNode) { return; }
-
- for (var i = 0; i < set.length; i++) {
- if (instance.options[set[i][0]]) {
- set[i][1].apply(instance.element, args);
- }
- }
- }
- },
-
- contains: function(a, b) {
- return document.compareDocumentPosition
- ? a.compareDocumentPosition(b) & 16
- : a !== b && a.contains(b);
- },
-
- hasScroll: function(el, a) {
-
- //If overflow is hidden, the element might have extra content, but the user wants to hide it
- if ($(el).css('overflow') == 'hidden') { return false; }
-
- var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
- has = false;
-
- if (el[scroll] > 0) { return true; }
-
- // TODO: determine which cases actually cause this to happen
- // if the element doesn't have the scroll set, see if it's possible to
- // set the scroll
- el[scroll] = 1;
- has = (el[scroll] > 0);
- el[scroll] = 0;
- return has;
- },
-
- isOverAxis: function(x, reference, size) {
- //Determines when x coordinate is over "b" element axis
- return (x > reference) && (x < (reference + size));
- },
-
- isOver: function(y, x, top, left, height, width) {
- //Determines when x, y coordinates is over "b" element
- return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
- },
-
- keyCode: {
- BACKSPACE: 8,
- CAPS_LOCK: 20,
- COMMA: 188,
- CONTROL: 17,
- DELETE: 46,
- DOWN: 40,
- END: 35,
- ENTER: 13,
- ESCAPE: 27,
- HOME: 36,
- INSERT: 45,
- LEFT: 37,
- NUMPAD_ADD: 107,
- NUMPAD_DECIMAL: 110,
- NUMPAD_DIVIDE: 111,
- NUMPAD_ENTER: 108,
- NUMPAD_MULTIPLY: 106,
- NUMPAD_SUBTRACT: 109,
- PAGE_DOWN: 34,
- PAGE_UP: 33,
- PERIOD: 190,
- RIGHT: 39,
- SHIFT: 16,
- SPACE: 32,
- TAB: 9,
- UP: 38
- }
-};
-
-// WAI-ARIA normalization
-if (isFF2) {
- var attr = $.attr,
- removeAttr = $.fn.removeAttr,
- ariaNS = "http://www.w3.org/2005/07/aaa",
- ariaState = /^aria-/,
- ariaRole = /^wairole:/;
-
- $.attr = function(elem, name, value) {
- var set = value !== undefined;
-
- return (name == 'role'
- ? (set
- ? attr.call(this, elem, name, "wairole:" + value)
- : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
- : (ariaState.test(name)
- ? (set
- ? elem.setAttributeNS(ariaNS,
- name.replace(ariaState, "aaa:"), value)
- : attr.call(this, elem, name.replace(ariaState, "aaa:")))
- : attr.apply(this, arguments)));
- };
-
- $.fn.removeAttr = function(name) {
- return (ariaState.test(name)
- ? this.each(function() {
- this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
- }) : removeAttr.call(this, name));
- };
-}
-
-//jQuery plugins
-$.fn.extend({
- remove: function() {
- // Safari has a native remove event which actually removes DOM elements,
- // so we have to use triggerHandler instead of trigger (#3037).
- $("*", this).add(this).each(function() {
- $(this).triggerHandler("remove");
- });
- return _remove.apply(this, arguments );
- },
-
- enableSelection: function() {
- return this
- .attr('unselectable', 'off')
- .css('MozUserSelect', '')
- .unbind('selectstart.ui');
- },
-
- disableSelection: function() {
- return this
- .attr('unselectable', 'on')
- .css('MozUserSelect', 'none')
- .bind('selectstart.ui', function() { return false; });
- },
-
- scrollParent: function() {
- var scrollParent;
- if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
- scrollParent = this.parents().filter(function() {
- return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- } else {
- scrollParent = this.parents().filter(function() {
- return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- }
-
- return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
- }
-});
-
-
-//Additional selectors
-$.extend($.expr[':'], {
- data: function(elem, i, match) {
- return !!$.data(elem, match[3]);
- },
-
- focusable: function(element) {
- var nodeName = element.nodeName.toLowerCase(),
- tabIndex = $.attr(element, 'tabindex');
- return (/input|select|textarea|button|object/.test(nodeName)
- ? !element.disabled
- : 'a' == nodeName || 'area' == nodeName
- ? element.href || !isNaN(tabIndex)
- : !isNaN(tabIndex))
- // the element and all of its ancestors must be visible
- // the browser may report that the area is hidden
- && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
- },
-
- tabbable: function(element) {
- var tabIndex = $.attr(element, 'tabindex');
- return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
- }
-});
-
-
-// $.widget is a factory to create jQuery plugins
-// taking some boilerplate code out of the plugin code
-function getter(namespace, plugin, method, args) {
- function getMethods(type) {
- var methods = $[namespace][plugin][type] || [];
- return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
- }
-
- var methods = getMethods('getter');
- if (args.length == 1 && typeof args[0] == 'string') {
- methods = methods.concat(getMethods('getterSetter'));
- }
- return ($.inArray(method, methods) != -1);
-}
-
-$.widget = function(name, prototype) {
- var namespace = name.split(".")[0];
- name = name.split(".")[1];
-
- // create plugin method
- $.fn[name] = function(options) {
- var isMethodCall = (typeof options == 'string'),
- args = Array.prototype.slice.call(arguments, 1);
-
- // prevent calls to internal methods
- if (isMethodCall && options.substring(0, 1) == '_') {
- return this;
- }
-
- // handle getter methods
- if (isMethodCall && getter(namespace, name, options, args)) {
- var instance = $.data(this[0], name);
- return (instance ? instance[options].apply(instance, args)
- : undefined);
- }
-
- // handle initialization and non-getter methods
- return this.each(function() {
- var instance = $.data(this, name);
-
- // constructor
- (!instance && !isMethodCall &&
- $.data(this, name, new $[namespace][name](this, options))._init());
-
- // method call
- (instance && isMethodCall && $.isFunction(instance[options]) &&
- instance[options].apply(instance, args));
- });
- };
-
- // create widget constructor
- $[namespace] = $[namespace] || {};
- $[namespace][name] = function(element, options) {
- var self = this;
-
- this.namespace = namespace;
- this.widgetName = name;
- this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
- this.widgetBaseClass = namespace + '-' + name;
-
- this.options = $.extend({},
- $.widget.defaults,
- $[namespace][name].defaults,
- $.metadata && $.metadata.get(element)[name],
- options);
-
- this.element = $(element)
- .bind('setData.' + name, function(event, key, value) {
- if (event.target == element) {
- return self._setData(key, value);
- }
- })
- .bind('getData.' + name, function(event, key) {
- if (event.target == element) {
- return self._getData(key);
- }
- })
- .bind('remove', function() {
- return self.destroy();
- });
- };
-
- // add widget prototype
- $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
-
- // TODO: merge getter and getterSetter properties from widget prototype
- // and plugin prototype
- $[namespace][name].getterSetter = 'option';
-};
-
-$.widget.prototype = {
- _init: function() {},
- destroy: function() {
- this.element.removeData(this.widgetName)
- .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
- .removeAttr('aria-disabled');
- },
-
- option: function(key, value) {
- var options = key,
- self = this;
-
- if (typeof key == "string") {
- if (value === undefined) {
- return this._getData(key);
- }
- options = {};
- options[key] = value;
- }
-
- $.each(options, function(key, value) {
- self._setData(key, value);
- });
- },
- _getData: function(key) {
- return this.options[key];
- },
- _setData: function(key, value) {
- this.options[key] = value;
-
- if (key == 'disabled') {
- this.element
- [value ? 'addClass' : 'removeClass'](
- this.widgetBaseClass + '-disabled' + ' ' +
- this.namespace + '-state-disabled')
- .attr("aria-disabled", value);
- }
- },
-
- enable: function() {
- this._setData('disabled', false);
- },
- disable: function() {
- this._setData('disabled', true);
- },
-
- _trigger: function(type, event, data) {
- var callback = this.options[type],
- eventName = (type == this.widgetEventPrefix
- ? type : this.widgetEventPrefix + type);
-
- event = $.Event(event);
- event.type = eventName;
-
- // copy original event properties over to the new event
- // this would happen if we could call $.event.fix instead of $.Event
- // but we don't have a way to force an event to be fixed multiple times
- if (event.originalEvent) {
- for (var i = $.event.props.length, prop; i;) {
- prop = $.event.props[--i];
- event[prop] = event.originalEvent[prop];
- }
- }
-
- this.element.trigger(event, data);
-
- return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
- || event.isDefaultPrevented());
- }
-};
-
-$.widget.defaults = {
- disabled: false
-};
-
-
-/** Mouse Interaction Plugin **/
-
-$.ui.mouse = {
- _mouseInit: function() {
- var self = this;
-
- this.element
- .bind('mousedown.'+this.widgetName, function(event) {
- return self._mouseDown(event);
- })
- .bind('click.'+this.widgetName, function(event) {
- if(self._preventClickEvent) {
- self._preventClickEvent = false;
- event.stopImmediatePropagation();
- return false;
- }
- });
-
- // Prevent text selection in IE
- if ($.browser.msie) {
- this._mouseUnselectable = this.element.attr('unselectable');
- this.element.attr('unselectable', 'on');
- }
-
- this.started = false;
- },
-
- // TODO: make sure destroying one instance of mouse doesn't mess with
- // other instances of mouse
- _mouseDestroy: function() {
- this.element.unbind('.'+this.widgetName);
-
- // Restore text selection in IE
- ($.browser.msie
- && this.element.attr('unselectable', this._mouseUnselectable));
- },
-
- _mouseDown: function(event) {
- // don't let more than one widget handle mouseStart
- // TODO: figure out why we have to use originalEvent
- event.originalEvent = event.originalEvent || {};
- if (event.originalEvent.mouseHandled) { return; }
-
- // we may have missed mouseup (out of window)
- (this._mouseStarted && this._mouseUp(event));
-
- this._mouseDownEvent = event;
-
- var self = this,
- btnIsLeft = (event.which == 1),
- elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
- if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
- return true;
- }
-
- this.mouseDelayMet = !this.options.delay;
- if (!this.mouseDelayMet) {
- this._mouseDelayTimer = setTimeout(function() {
- self.mouseDelayMet = true;
- }, this.options.delay);
- }
-
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted = (this._mouseStart(event) !== false);
- if (!this._mouseStarted) {
- event.preventDefault();
- return true;
- }
- }
-
- // these delegates are required to keep context
- this._mouseMoveDelegate = function(event) {
- return self._mouseMove(event);
- };
- this._mouseUpDelegate = function(event) {
- return self._mouseUp(event);
- };
- $(document)
- .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
- // preventDefault() is used to prevent the selection of text here -
- // however, in Safari, this causes select boxes not to be selectable
- // anymore, so this fix is needed
- ($.browser.safari || event.preventDefault());
-
- event.originalEvent.mouseHandled = true;
- return true;
- },
-
- _mouseMove: function(event) {
- // IE mouseup check - mouseup happened when mouse was out of window
- if ($.browser.msie && !event.button) {
- return this._mouseUp(event);
- }
-
- if (this._mouseStarted) {
- this._mouseDrag(event);
- return event.preventDefault();
- }
-
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted =
- (this._mouseStart(this._mouseDownEvent, event) !== false);
- (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
- }
-
- return !this._mouseStarted;
- },
-
- _mouseUp: function(event) {
- $(document)
- .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
- if (this._mouseStarted) {
- this._mouseStarted = false;
- this._preventClickEvent = (event.target == this._mouseDownEvent.target);
- this._mouseStop(event);
- }
-
- return false;
- },
-
- _mouseDistanceMet: function(event) {
- return (Math.max(
- Math.abs(this._mouseDownEvent.pageX - event.pageX),
- Math.abs(this._mouseDownEvent.pageY - event.pageY)
- ) >= this.options.distance
- );
- },
-
- _mouseDelayMet: function(event) {
- return this.mouseDelayMet;
- },
-
- // These are placeholder methods, to be overriden by extending plugin
- _mouseStart: function(event) {},
- _mouseDrag: function(event) {},
- _mouseStop: function(event) {},
- _mouseCapture: function(event) { return true; }
-};
-
-$.ui.mouse.defaults = {
- cancel: null,
- distance: 1,
- delay: 0
-};
-
-})(jQuery);
-/*
- * jQuery UI Draggable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
- this.element[0].style.position = 'relative';
-
- (this.options.addClasses && this.element.addClass("ui-draggable"));
- (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
-
- this._mouseInit();
-
- },
-
- destroy: function() {
- if(!this.element.data('draggable')) return;
- this.element
- .removeData("draggable")
- .unbind(".draggable")
- .removeClass("ui-draggable"
- + " ui-draggable-dragging"
- + " ui-draggable-disabled");
- this._mouseDestroy();
- },
-
- _mouseCapture: function(event) {
-
- var o = this.options;
-
- if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
- return false;
-
- //Quit if we're not on a valid handle
- this.handle = this._getHandle(event);
- if (!this.handle)
- return false;
-
- return true;
-
- },
-
- _mouseStart: function(event) {
-
- var o = this.options;
-
- //Create and append the visible helper
- this.helper = this._createHelper(event);
-
- //Cache the helper size
- this._cacheHelperProportions();
-
- //If ddmanager is used for droppables, set the global draggable
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
-
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
-
- //Cache the margins of the original element
- this._cacheMargins();
-
- //Store the helper's css position
- this.cssPosition = this.helper.css("position");
- this.scrollParent = this.helper.scrollParent();
-
- //The element's absolute position on the page minus margins
- this.offset = this.element.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
-
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
-
- //Generate the original position
- this.originalPosition = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
-
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
-
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
-
- //Call plugins and callbacks
- this._trigger("start", event);
-
- //Recache the helper size
- this._cacheHelperProportions();
-
- //Prepare the droppable offsets
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
-
- this.helper.addClass("ui-draggable-dragging");
- this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
- return true;
- },
-
- _mouseDrag: function(event, noPropagation) {
-
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
-
- //Call plugins and callbacks and use the resulting position if something is returned
- if (!noPropagation) {
- var ui = this._uiHash();
- this._trigger('drag', event, ui);
- this.position = ui.position;
- }
-
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
- return false;
- },
-
- _mouseStop: function(event) {
-
- //If we are using droppables, inform the manager about the drop
- var dropped = false;
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- dropped = $.ui.ddmanager.drop(this, event);
-
- //if a drop comes from outside (a sortable)
- if(this.dropped) {
- dropped = this.dropped;
- this.dropped = false;
- }
-
- if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
- var self = this;
- $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
- self._trigger("stop", event);
- self._clear();
- });
- } else {
- this._trigger("stop", event);
- this._clear();
- }
-
- return false;
- },
-
- _getHandle: function(event) {
-
- var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
- $(this.options.handle, this.element)
- .find("*")
- .andSelf()
- .each(function() {
- if(this == event.target) handle = true;
- });
-
- return handle;
-
- },
-
- _createHelper: function(event) {
-
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
-
- if(!helper.parents('body').length)
- helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
-
- if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
- helper.css("position", "absolute");
-
- return helper;
-
- },
-
- _adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
- },
-
- _getParentOffset: function() {
-
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
-
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
-
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
-
- return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
-
- },
-
- _getRelativeOffset: function() {
-
- if(this.cssPosition == "relative") {
- var p = this.element.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
- }
-
- },
-
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.element.css("marginLeft"),10) || 0),
- top: (parseInt(this.element.css("marginTop"),10) || 0)
- };
- },
-
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
- },
-
- _setContainment: function() {
-
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- 0 - this.offset.relative.left - this.offset.parent.left,
- 0 - this.offset.relative.top - this.offset.parent.top,
- $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
-
- if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
- var ce = $(o.containment)[0]; if(!ce) return;
- var co = $(o.containment).offset();
- var over = ($(ce).css("overflow") != 'hidden');
-
- this.containment = [
- co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
- co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
- co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
- co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
- ];
- } else if(o.containment.constructor == Array) {
- this.containment = o.containment;
- }
-
- },
-
- _convertPositionTo: function(d, pos) {
-
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
-
- },
-
- _generatePosition: function(event) {
-
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
- }
-
- var pageX = event.pageX;
- var pageY = event.pageY;
-
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
-
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
- if(this.containment) {
- if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
- }
-
- if(o.grid) {
- var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
- pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
- var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
- pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
- }
-
- }
-
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
-
- },
-
- _clear: function() {
- this.helper.removeClass("ui-draggable-dragging");
- if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
- //if($.ui.ddmanager) $.ui.ddmanager.current = null;
- this.helper = null;
- this.cancelHelperRemoval = false;
- },
-
- // From now on bulk stuff - mainly helpers
-
- _trigger: function(type, event, ui) {
- ui = ui || this._uiHash();
- $.ui.plugin.call(this, type, [event, ui]);
- if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
- return $.widget.prototype._trigger.call(this, type, event, ui);
- },
-
- plugins: {},
-
- _uiHash: function(event) {
- return {
- helper: this.helper,
- position: this.position,
- absolutePosition: this.positionAbs, //deprecated
- offset: this.positionAbs
- };
- }
-
-}));
-
-$.extend($.ui.draggable, {
- version: "1.7.1",
- eventPrefix: "drag",
- defaults: {
- addClasses: true,
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectToSortable: false,
- containment: false,
- cursor: "auto",
- cursorAt: false,
- delay: 0,
- distance: 1,
- grid: false,
- handle: false,
- helper: "original",
- iframeFix: false,
- opacity: false,
- refreshPositions: false,
- revert: false,
- revertDuration: 500,
- scope: "default",
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- snap: false,
- snapMode: "both",
- snapTolerance: 20,
- stack: false,
- zIndex: false
- }
-});
-
-$.ui.plugin.add("draggable", "connectToSortable", {
- start: function(event, ui) {
-
- var inst = $(this).data("draggable"), o = inst.options,
- uiSortable = $.extend({}, ui, { item: inst.element });
- inst.sortables = [];
- $(o.connectToSortable).each(function() {
- var sortable = $.data(this, 'sortable');
- if (sortable && !sortable.options.disabled) {
- inst.sortables.push({
- instance: sortable,
- shouldRevert: sortable.options.revert
- });
- sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
- sortable._trigger("activate", event, uiSortable);
- }
- });
-
- },
- stop: function(event, ui) {
-
- //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
- var inst = $(this).data("draggable"),
- uiSortable = $.extend({}, ui, { item: inst.element });
-
- $.each(inst.sortables, function() {
- if(this.instance.isOver) {
-
- this.instance.isOver = 0;
-
- inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
- this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
-
- //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
- if(this.shouldRevert) this.instance.options.revert = true;
-
- //Trigger the stop of the sortable
- this.instance._mouseStop(event);
-
- this.instance.options.helper = this.instance.options._helper;
-
- //If the helper has been the original item, restore properties in the sortable
- if(inst.options.helper == 'original')
- this.instance.currentItem.css({ top: 'auto', left: 'auto' });
-
- } else {
- this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
- this.instance._trigger("deactivate", event, uiSortable);
- }
-
- });
-
- },
- drag: function(event, ui) {
-
- var inst = $(this).data("draggable"), self = this;
-
- var checkPos = function(o) {
- var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
- var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
- var itemHeight = o.height, itemWidth = o.width;
- var itemTop = o.top, itemLeft = o.left;
-
- return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
- };
-
- $.each(inst.sortables, function(i) {
-
- //Copy over some variables to allow calling the sortable's native _intersectsWith
- this.instance.positionAbs = inst.positionAbs;
- this.instance.helperProportions = inst.helperProportions;
- this.instance.offset.click = inst.offset.click;
-
- if(this.instance._intersectsWith(this.instance.containerCache)) {
-
- //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
- if(!this.instance.isOver) {
-
- this.instance.isOver = 1;
- //Now we fake the start of dragging for the sortable instance,
- //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
- //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
- this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
- this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
- this.instance.options.helper = function() { return ui.helper[0]; };
-
- event.target = this.instance.currentItem[0];
- this.instance._mouseCapture(event, true);
- this.instance._mouseStart(event, true, true);
-
- //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
- this.instance.offset.click.top = inst.offset.click.top;
- this.instance.offset.click.left = inst.offset.click.left;
- this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
- this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
-
- inst._trigger("toSortable", event);
- inst.dropped = this.instance.element; //draggable revert needs that
- //hack so receive/update callbacks work (mostly)
- inst.currentItem = inst.element;
- this.instance.fromOutside = inst;
-
- }
-
- //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
- if(this.instance.currentItem) this.instance._mouseDrag(event);
-
- } else {
-
- //If it doesn't intersect with the sortable, and it intersected before,
- //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
- if(this.instance.isOver) {
-
- this.instance.isOver = 0;
- this.instance.cancelHelperRemoval = true;
-
- //Prevent reverting on this forced stop
- this.instance.options.revert = false;
-
- // The out event needs to be triggered independently
- this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-
- this.instance._mouseStop(event, true);
- this.instance.options.helper = this.instance.options._helper;
-
- //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
- this.instance.currentItem.remove();
- if(this.instance.placeholder) this.instance.placeholder.remove();
-
- inst._trigger("fromSortable", event);
- inst.dropped = false; //draggable revert needs that
- }
-
- };
-
- });
-
- }
-});
-
-$.ui.plugin.add("draggable", "cursor", {
- start: function(event, ui) {
- var t = $('body'), o = $(this).data('draggable').options;
- if (t.css("cursor")) o._cursor = t.css("cursor");
- t.css("cursor", o.cursor);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if (o._cursor) $('body').css("cursor", o._cursor);
- }
-});
-
-$.ui.plugin.add("draggable", "iframeFix", {
- start: function(event, ui) {
- var o = $(this).data('draggable').options;
- $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
- $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
- .css({
- width: this.offsetWidth+"px", height: this.offsetHeight+"px",
- position: "absolute", opacity: "0.001", zIndex: 1000
- })
- .css($(this).offset())
- .appendTo("body");
- });
- },
- stop: function(event, ui) {
- $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
- }
-});
-
-$.ui.plugin.add("draggable", "opacity", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data('draggable').options;
- if(t.css("opacity")) o._opacity = t.css("opacity");
- t.css('opacity', o.opacity);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if(o._opacity) $(ui.helper).css('opacity', o._opacity);
- }
-});
-
-$.ui.plugin.add("draggable", "scroll", {
- start: function(event, ui) {
- var i = $(this).data("draggable");
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
- },
- drag: function(event, ui) {
-
- var i = $(this).data("draggable"), o = i.options, scrolled = false;
-
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
-
- if(!o.axis || o.axis != 'x') {
- if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
- }
-
- if(!o.axis || o.axis != 'y') {
- if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
- }
-
- } else {
-
- if(!o.axis || o.axis != 'x') {
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
- }
-
- if(!o.axis || o.axis != 'y') {
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
- }
-
- }
-
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(i, event);
-
- }
-});
-
-$.ui.plugin.add("draggable", "snap", {
- start: function(event, ui) {
-
- var i = $(this).data("draggable"), o = i.options;
- i.snapElements = [];
-
- $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
- var $t = $(this); var $o = $t.offset();
- if(this != i.element[0]) i.snapElements.push({
- item: this,
- width: $t.outerWidth(), height: $t.outerHeight(),
- top: $o.top, left: $o.left
- });
- });
-
- },
- drag: function(event, ui) {
-
- var inst = $(this).data("draggable"), o = inst.options;
- var d = o.snapTolerance;
-
- var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
- y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
-
- for (var i = inst.snapElements.length - 1; i >= 0; i--){
-
- var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
- t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
-
- //Yes, I know, this is insane ;)
- if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
- if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = false;
- continue;
- }
-
- if(o.snapMode != 'inner') {
- var ts = Math.abs(t - y2) <= d;
- var bs = Math.abs(b - y1) <= d;
- var ls = Math.abs(l - x2) <= d;
- var rs = Math.abs(r - x1) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
- }
-
- var first = (ts || bs || ls || rs);
-
- if(o.snapMode != 'outer') {
- var ts = Math.abs(t - y1) <= d;
- var bs = Math.abs(b - y2) <= d;
- var ls = Math.abs(l - x1) <= d;
- var rs = Math.abs(r - x2) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
- }
-
- if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
- (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
-
- };
-
- }
-});
-
-$.ui.plugin.add("draggable", "stack", {
- start: function(event, ui) {
-
- var o = $(this).data("draggable").options;
-
- var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
- return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
- });
-
- $(group).each(function(i) {
- this.style.zIndex = o.stack.min + i;
- });
-
- this[0].style.zIndex = o.stack.min + group.length;
-
- }
-});
-
-$.ui.plugin.add("draggable", "zIndex", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data("draggable").options;
- if(t.css("zIndex")) o._zIndex = t.css("zIndex");
- t.css('zIndex', o.zIndex);
- },
- stop: function(event, ui) {
- var o = $(this).data("draggable").options;
- if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Droppable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- * ui.core.js
- * ui.draggable.js
- */
-(function($) {
-
-$.widget("ui.droppable", {
-
- _init: function() {
-
- var o = this.options, accept = o.accept;
- this.isover = 0; this.isout = 1;
-
- this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
- return d.is(accept);
- };
-
- //Store the droppable's proportions
- this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
-
- // Add the reference and positions to the manager
- $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
- $.ui.ddmanager.droppables[this.options.scope].push(this);
-
- (this.options.addClasses && this.element.addClass("ui-droppable"));
-
- },
-
- destroy: function() {
- var drop = $.ui.ddmanager.droppables[this.options.scope];
- for ( var i = 0; i < drop.length; i++ )
- if ( drop[i] == this )
- drop.splice(i, 1);
-
- this.element
- .removeClass("ui-droppable ui-droppable-disabled")
- .removeData("droppable")
- .unbind(".droppable");
- },
-
- _setData: function(key, value) {
-
- if(key == 'accept') {
- this.options.accept = value && $.isFunction(value) ? value : function(d) {
- return d.is(value);
- };
- } else {
- $.widget.prototype._setData.apply(this, arguments);
- }
-
- },
-
- _activate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.addClass(this.options.activeClass);
- (draggable && this._trigger('activate', event, this.ui(draggable)));
- },
-
- _deactivate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- (draggable && this._trigger('deactivate', event, this.ui(draggable)));
- },
-
- _over: function(event) {
-
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
- this._trigger('over', event, this.ui(draggable));
- }
-
- },
-
- _out: function(event) {
-
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('out', event, this.ui(draggable));
- }
-
- },
-
- _drop: function(event,custom) {
-
- var draggable = custom || $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
-
- var childrenIntersection = false;
- this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
- var inst = $.data(this, 'droppable');
- if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
- childrenIntersection = true; return false;
- }
- });
- if(childrenIntersection) return false;
-
- if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('drop', event, this.ui(draggable));
- return this.element;
- }
-
- return false;
-
- },
-
- ui: function(c) {
- return {
- draggable: (c.currentItem || c.element),
- helper: c.helper,
- position: c.position,
- absolutePosition: c.positionAbs, //deprecated
- offset: c.positionAbs
- };
- }
-
-});
-
-$.extend($.ui.droppable, {
- version: "1.7.1",
- eventPrefix: 'drop',
- defaults: {
- accept: '*',
- activeClass: false,
- addClasses: true,
- greedy: false,
- hoverClass: false,
- scope: 'default',
- tolerance: 'intersect'
- }
-});
-
-$.ui.intersect = function(draggable, droppable, toleranceMode) {
-
- if (!droppable.offset) return false;
-
- var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
- y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
- var l = droppable.offset.left, r = l + droppable.proportions.width,
- t = droppable.offset.top, b = t + droppable.proportions.height;
-
- switch (toleranceMode) {
- case 'fit':
- return (l < x1 && x2 < r
- && t < y1 && y2 < b);
- break;
- case 'intersect':
- return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
- && x2 - (draggable.helperProportions.width / 2) < r // Left Half
- && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
- && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
- break;
- case 'pointer':
- var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
- draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
- isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
- return isOver;
- break;
- case 'touch':
- return (
- (y1 >= t && y1 <= b) || // Top edge touching
- (y2 >= t && y2 <= b) || // Bottom edge touching
- (y1 < t && y2 > b) // Surrounded vertically
- ) && (
- (x1 >= l && x1 <= r) || // Left edge touching
- (x2 >= l && x2 <= r) || // Right edge touching
- (x1 < l && x2 > r) // Surrounded horizontally
- );
- break;
- default:
- return false;
- break;
- }
-
-};
-
-/*
- This manager tracks offsets of draggables and droppables
-*/
-$.ui.ddmanager = {
- current: null,
- droppables: { 'default': [] },
- prepareOffsets: function(t, event) {
-
- var m = $.ui.ddmanager.droppables[t.options.scope];
- var type = event ? event.type : null; // workaround for #2317
- var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
-
- droppablesLoop: for (var i = 0; i < m.length; i++) {
-
- if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
- for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
- m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
-
- m[i].offset = m[i].element.offset();
- m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
-
- if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
-
- }
-
- },
- drop: function(draggable, event) {
-
- var dropped = false;
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
-
- if(!this.options) return;
- if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
- dropped = this._drop.call(this, event);
-
- if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- this.isout = 1; this.isover = 0;
- this._deactivate.call(this, event);
- }
-
- });
- return dropped;
-
- },
- drag: function(draggable, event) {
-
- //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
- if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
-
- //Run through all droppables and check their positions based on specific tolerance options
-
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
-
- if(this.options.disabled || this.greedyChild || !this.visible) return;
- var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
-
- var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
- if(!c) return;
-
- var parentInstance;
- if (this.options.greedy) {
- var parent = this.element.parents(':data(droppable):eq(0)');
- if (parent.length) {
- parentInstance = $.data(parent[0], 'droppable');
- parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
- }
- }
-
- // we just moved into a greedy child
- if (parentInstance && c == 'isover') {
- parentInstance['isover'] = 0;
- parentInstance['isout'] = 1;
- parentInstance._out.call(parentInstance, event);
- }
-
- this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
- this[c == "isover" ? "_over" : "_out"].call(this, event);
-
- // we just moved out of a greedy child
- if (parentInstance && c == 'isout') {
- parentInstance['isout'] = 0;
- parentInstance['isover'] = 1;
- parentInstance._over.call(parentInstance, event);
- }
- });
-
- }
-};
-
-})(jQuery);
-/*
- * jQuery UI Resizable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- var self = this, o = this.options;
- this.element.addClass("ui-resizable");
-
- $.extend(this, {
- _aspectRatio: !!(o.aspectRatio),
- aspectRatio: o.aspectRatio,
- originalElement: this.element,
- _proportionallyResizeElements: [],
- _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
- });
-
- //Wrap the element if it cannot hold child nodes
- if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
-
- //Opera fix for relative positioning
- if (/relative/.test(this.element.css('position')) && $.browser.opera)
- this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
-
- //Create a wrapper element and set the wrapper to the new current internal element
- this.element.wrap(
- $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
- position: this.element.css('position'),
- width: this.element.outerWidth(),
- height: this.element.outerHeight(),
- top: this.element.css('top'),
- left: this.element.css('left')
- })
- );
-
- //Overwrite the original this.element
- this.element = this.element.parent().data(
- "resizable", this.element.data('resizable')
- );
-
- this.elementIsWrapper = true;
-
- //Move margins to the wrapper
- this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
- this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
-
- //Prevent Safari textarea resize
- this.originalResizeStyle = this.originalElement.css('resize');
- this.originalElement.css('resize', 'none');
-
- //Push the actual element to our proportionallyResize internal array
- this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
-
- // avoid IE jump (hard set the margin)
- this.originalElement.css({ margin: this.originalElement.css('margin') });
-
- // fix handlers offset
- this._proportionallyResize();
-
- }
-
- this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
- if(this.handles.constructor == String) {
-
- if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
- var n = this.handles.split(","); this.handles = {};
-
- for(var i = 0; i < n.length; i++) {
-
- var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
- var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
-
- // increase zIndex of sw, se, ne, nw axis
- //TODO : this modifies original option
- if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
-
- //TODO : What's going on here?
- if ('se' == handle) {
- axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
- };
-
- //Insert into internal handles object and append to element
- this.handles[handle] = '.ui-resizable-'+handle;
- this.element.append(axis);
- }
-
- }
-
- this._renderAxis = function(target) {
-
- target = target || this.element;
-
- for(var i in this.handles) {
-
- if(this.handles[i].constructor == String)
- this.handles[i] = $(this.handles[i], this.element).show();
-
- //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
- if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
-
- var axis = $(this.handles[i], this.element), padWrapper = 0;
-
- //Checking the correct pad and border
- padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
-
- //The padding type i have to apply...
- var padPos = [ 'padding',
- /ne|nw|n/.test(i) ? 'Top' :
- /se|sw|s/.test(i) ? 'Bottom' :
- /^e$/.test(i) ? 'Right' : 'Left' ].join("");
-
- target.css(padPos, padWrapper);
-
- this._proportionallyResize();
-
- }
-
- //TODO: What's that good for? There's not anything to be executed left
- if(!$(this.handles[i]).length)
- continue;
-
- }
- };
-
- //TODO: make renderAxis a prototype function
- this._renderAxis(this.element);
-
- this._handles = $('.ui-resizable-handle', this.element)
- .disableSelection();
-
- //Matching axis name
- this._handles.mouseover(function() {
- if (!self.resizing) {
- if (this.className)
- var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
- //Axis, default = se
- self.axis = axis && axis[1] ? axis[1] : 'se';
- }
- });
-
- //If we want to auto hide the elements
- if (o.autoHide) {
- this._handles.hide();
- $(this.element)
- .addClass("ui-resizable-autohide")
- .hover(function() {
- $(this).removeClass("ui-resizable-autohide");
- self._handles.show();
- },
- function(){
- if (!self.resizing) {
- $(this).addClass("ui-resizable-autohide");
- self._handles.hide();
- }
- });
- }
-
- //Initialize the mouse interaction
- this._mouseInit();
-
- },
-
- destroy: function() {
-
- this._mouseDestroy();
-
- var _destroy = function(exp) {
- $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
- .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
- };
-
- //TODO: Unwrap at same DOM position
- if (this.elementIsWrapper) {
- _destroy(this.element);
- var wrapper = this.element;
- wrapper.parent().append(
- this.originalElement.css({
- position: wrapper.css('position'),
- width: wrapper.outerWidth(),
- height: wrapper.outerHeight(),
- top: wrapper.css('top'),
- left: wrapper.css('left')
- })
- ).end().remove();
- }
-
- this.originalElement.css('resize', this.originalResizeStyle);
- _destroy(this.originalElement);
-
- },
-
- _mouseCapture: function(event) {
-
- var handle = false;
- for(var i in this.handles) {
- if($(this.handles[i])[0] == event.target) handle = true;
- }
-
- return this.options.disabled || !!handle;
-
- },
-
- _mouseStart: function(event) {
-
- var o = this.options, iniPos = this.element.position(), el = this.element;
-
- this.resizing = true;
- this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
-
- // bugfix for http://dev.jquery.com/ticket/1749
- if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
- el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
- }
-
- //Opera fixing relative position
- if ($.browser.opera && (/relative/).test(el.css('position')))
- el.css({ position: 'relative', top: 'auto', left: 'auto' });
-
- this._renderProxy();
-
- var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
-
- if (o.containment) {
- curleft += $(o.containment).scrollLeft() || 0;
- curtop += $(o.containment).scrollTop() || 0;
- }
-
- //Store needed variables
- this.offset = this.helper.offset();
- this.position = { left: curleft, top: curtop };
- this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalPosition = { left: curleft, top: curtop };
- this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
- this.originalMousePosition = { left: event.pageX, top: event.pageY };
-
- //Aspect Ratio
- this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
-
- var cursor = $('.ui-resizable-' + this.axis).css('cursor');
- $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
-
- el.addClass("ui-resizable-resizing");
- this._propagate("start", event);
- return true;
- },
-
- _mouseDrag: function(event) {
-
- //Increase performance, avoid regex
- var el = this.helper, o = this.options, props = {},
- self = this, smp = this.originalMousePosition, a = this.axis;
-
- var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
- var trigger = this._change[a];
- if (!trigger) return false;
-
- // Calculate the attrs that will be change
- var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
-
- if (this._aspectRatio || event.shiftKey)
- data = this._updateRatio(data, event);
-
- data = this._respectSize(data, event);
-
- // plugins callbacks need to be called first
- this._propagate("resize", event);
-
- el.css({
- top: this.position.top + "px", left: this.position.left + "px",
- width: this.size.width + "px", height: this.size.height + "px"
- });
-
- if (!this._helper && this._proportionallyResizeElements.length)
- this._proportionallyResize();
-
- this._updateCache(data);
-
- // calling the user callback at the end
- this._trigger('resize', event, this.ui());
-
- return false;
- },
-
- _mouseStop: function(event) {
-
- this.resizing = false;
- var o = this.options, self = this;
-
- if(this._helper) {
- var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
-
- var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
- if (!o.animate)
- this.element.css($.extend(s, { top: top, left: left }));
-
- self.helper.height(self.size.height);
- self.helper.width(self.size.width);
-
- if (this._helper && !o.animate) this._proportionallyResize();
- }
-
- $('body').css('cursor', 'auto');
-
- this.element.removeClass("ui-resizable-resizing");
-
- this._propagate("stop", event);
-
- if (this._helper) this.helper.remove();
- return false;
-
- },
-
- _updateCache: function(data) {
- var o = this.options;
- this.offset = this.helper.offset();
- if (isNumber(data.left)) this.position.left = data.left;
- if (isNumber(data.top)) this.position.top = data.top;
- if (isNumber(data.height)) this.size.height = data.height;
- if (isNumber(data.width)) this.size.width = data.width;
- },
-
- _updateRatio: function(data, event) {
-
- var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
-
- if (data.height) data.width = (csize.height * this.aspectRatio);
- else if (data.width) data.height = (csize.width / this.aspectRatio);
-
- if (a == 'sw') {
- data.left = cpos.left + (csize.width - data.width);
- data.top = null;
- }
- if (a == 'nw') {
- data.top = cpos.top + (csize.height - data.height);
- data.left = cpos.left + (csize.width - data.width);
- }
-
- return data;
- },
-
- _respectSize: function(data, event) {
-
- var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
- ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
- isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
-
- if (isminw) data.width = o.minWidth;
- if (isminh) data.height = o.minHeight;
- if (ismaxw) data.width = o.maxWidth;
- if (ismaxh) data.height = o.maxHeight;
-
- var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
- var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
-
- if (isminw && cw) data.left = dw - o.minWidth;
- if (ismaxw && cw) data.left = dw - o.maxWidth;
- if (isminh && ch) data.top = dh - o.minHeight;
- if (ismaxh && ch) data.top = dh - o.maxHeight;
-
- // fixing jump error on top/left - bug #2330
- var isNotwh = !data.width && !data.height;
- if (isNotwh && !data.left && data.top) data.top = null;
- else if (isNotwh && !data.top && data.left) data.left = null;
-
- return data;
- },
-
- _proportionallyResize: function() {
-
- var o = this.options;
- if (!this._proportionallyResizeElements.length) return;
- var element = this.helper || this.element;
-
- for (var i=0; i < this._proportionallyResizeElements.length; i++) {
-
- var prel = this._proportionallyResizeElements[i];
-
- if (!this.borderDif) {
- var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
- p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
-
- this.borderDif = $.map(b, function(v, i) {
- var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
- return border + padding;
- });
- }
-
- if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
- continue;
-
- prel.css({
- height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
- width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
- });
-
- };
-
- },
-
- _renderProxy: function() {
-
- var el = this.element, o = this.options;
- this.elementOffset = el.offset();
-
- if(this._helper) {
-
- this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
-
- // fix ie6 offset TODO: This seems broken
- var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
- pxyoffset = ( ie6 ? 2 : -1 );
-
- this.helper.addClass(this._helper).css({
- width: this.element.outerWidth() + pxyoffset,
- height: this.element.outerHeight() + pxyoffset,
- position: 'absolute',
- left: this.elementOffset.left - ie6offset +'px',
- top: this.elementOffset.top - ie6offset +'px',
- zIndex: ++o.zIndex //TODO: Don't modify option
- });
-
- this.helper
- .appendTo("body")
- .disableSelection();
-
- } else {
- this.helper = this.element;
- }
-
- },
-
- _change: {
- e: function(event, dx, dy) {
- return { width: this.originalSize.width + dx };
- },
- w: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { left: sp.left + dx, width: cs.width - dx };
- },
- n: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { top: sp.top + dy, height: cs.height - dy };
- },
- s: function(event, dx, dy) {
- return { height: this.originalSize.height + dy };
- },
- se: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- sw: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- },
- ne: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- nw: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- }
- },
-
- _propagate: function(n, event) {
- $.ui.plugin.call(this, n, [event, this.ui()]);
- (n != "resize" && this._trigger(n, event, this.ui()));
- },
-
- plugins: {},
-
- ui: function() {
- return {
- originalElement: this.originalElement,
- element: this.element,
- helper: this.helper,
- position: this.position,
- size: this.size,
- originalSize: this.originalSize,
- originalPosition: this.originalPosition
- };
- }
-
-}));
-
-$.extend($.ui.resizable, {
- version: "1.7.1",
- eventPrefix: "resize",
- defaults: {
- alsoResize: false,
- animate: false,
- animateDuration: "slow",
- animateEasing: "swing",
- aspectRatio: false,
- autoHide: false,
- cancel: ":input,option",
- containment: false,
- delay: 0,
- distance: 1,
- ghost: false,
- grid: false,
- handles: "e,s,se",
- helper: false,
- maxHeight: null,
- maxWidth: null,
- minHeight: 10,
- minWidth: 10,
- zIndex: 1000
- }
-});
-
-/*
- * Resizable Extensions
- */
-
-$.ui.plugin.add("resizable", "alsoResize", {
-
- start: function(event, ui) {
-
- var self = $(this).data("resizable"), o = self.options;
-
- _store = function(exp) {
- $(exp).each(function() {
- $(this).data("resizable-alsoresize", {
- width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
- left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
- });
- });
- };
-
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
- if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
- else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
- }else{
- _store(o.alsoResize);
- }
- },
-
- resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
-
- var delta = {
- height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
- top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
- },
-
- _alsoResize = function(exp, c) {
- $(exp).each(function() {
- var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
-
- $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
- var sum = (start[prop]||0) + (delta[prop]||0);
- if (sum && sum >= 0)
- style[prop] = sum || null;
- });
-
- //Opera fixing relative position
- if (/relative/.test(el.css('position')) && $.browser.opera) {
- self._revertToRelativePosition = true;
- el.css({ position: 'absolute', top: 'auto', left: 'auto' });
- }
-
- el.css(style);
- });
- };
-
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
- $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
- }else{
- _alsoResize(o.alsoResize);
- }
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable");
-
- //Opera fixing relative position
- if (self._revertToRelativePosition && $.browser.opera) {
- self._revertToRelativePosition = false;
- el.css({ position: 'relative' });
- }
-
- $(this).removeData("resizable-alsoresize-start");
- }
-});
-
-$.ui.plugin.add("resizable", "animate", {
-
- stop: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options;
-
- var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
-
- var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
- self.element.animate(
- $.extend(style, top && left ? { top: top, left: left } : {}), {
- duration: o.animateDuration,
- easing: o.animateEasing,
- step: function() {
-
- var data = {
- width: parseInt(self.element.css('width'), 10),
- height: parseInt(self.element.css('height'), 10),
- top: parseInt(self.element.css('top'), 10),
- left: parseInt(self.element.css('left'), 10)
- };
-
- if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
-
- // propagating resize, and updating values for each animation step
- self._updateCache(data);
- self._propagate("resize", event);
-
- }
- }
- );
- }
-
-});
-
-$.ui.plugin.add("resizable", "containment", {
-
- start: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, el = self.element;
- var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
- if (!ce) return;
-
- self.containerElement = $(ce);
-
- if (/document/.test(oc) || oc == document) {
- self.containerOffset = { left: 0, top: 0 };
- self.containerPosition = { left: 0, top: 0 };
-
- self.parentData = {
- element: $(document), left: 0, top: 0,
- width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
- };
- }
-
- // i'm a node, so compute top, left, right, bottom
- else {
- var element = $(ce), p = [];
- $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
-
- self.containerOffset = element.offset();
- self.containerPosition = element.position();
- self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
-
- var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
- width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
-
- self.parentData = {
- element: ce, left: co.left, top: co.top, width: width, height: height
- };
- }
- },
-
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options,
- ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
- pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
-
- if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
-
- if (cp.left < (self._helper ? co.left : 0)) {
- self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
- if (pRatio) self.size.height = self.size.width / o.aspectRatio;
- self.position.left = o.helper ? co.left : 0;
- }
-
- if (cp.top < (self._helper ? co.top : 0)) {
- self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
- if (pRatio) self.size.width = self.size.height * o.aspectRatio;
- self.position.top = self._helper ? co.top : 0;
- }
-
- self.offset.left = self.parentData.left+self.position.left;
- self.offset.top = self.parentData.top+self.position.top;
-
- var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
- hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
-
- var isParent = self.containerElement.get(0) == self.element.parent().get(0),
- isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
-
- if(isParent && isOffsetRelative) woset -= self.parentData.left;
-
- if (woset + self.size.width >= self.parentData.width) {
- self.size.width = self.parentData.width - woset;
- if (pRatio) self.size.height = self.size.width / self.aspectRatio;
- }
-
- if (hoset + self.size.height >= self.parentData.height) {
- self.size.height = self.parentData.height - hoset;
- if (pRatio) self.size.width = self.size.height * self.aspectRatio;
- }
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, cp = self.position,
- co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
-
- var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
-
- if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
- if (self._helper && !o.animate && (/static/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
- }
-});
-
-$.ui.plugin.add("resizable", "ghost", {
-
- start: function(event, ui) {
-
- var self = $(this).data("resizable"), o = self.options, cs = self.size;
-
- self.ghost = self.originalElement.clone();
- self.ghost
- .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
- .addClass('ui-resizable-ghost')
- .addClass(typeof o.ghost == 'string' ? o.ghost : '');
-
- self.ghost.appendTo(self.helper);
-
- },
-
- resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
- }
-
-});
-
-$.ui.plugin.add("resizable", "grid", {
-
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
- o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
- var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
-
- if (/^(se|s|e)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- }
- else if (/^(ne)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- }
- else if (/^(sw)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.left = op.left - ox;
- }
- else {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- self.position.left = op.left - ox;
- }
- }
-
-});
-
-var num = function(v) {
- return parseInt(v, 10) || 0;
-};
-
-var isNumber = function(value) {
- return !isNaN(parseInt(value, 10));
-};
-
-})(jQuery);
-/*
- * jQuery UI Selectable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
- var self = this;
-
- this.element.addClass("ui-selectable");
-
- this.dragged = false;
-
- // cache selectee children based on filter
- var selectees;
- this.refresh = function() {
- selectees = $(self.options.filter, self.element[0]);
- selectees.each(function() {
- var $this = $(this);
- var pos = $this.offset();
- $.data(this, "selectable-item", {
- element: this,
- $element: $this,
- left: pos.left,
- top: pos.top,
- right: pos.left + $this.outerWidth(),
- bottom: pos.top + $this.outerHeight(),
- startselected: false,
- selected: $this.hasClass('ui-selected'),
- selecting: $this.hasClass('ui-selecting'),
- unselecting: $this.hasClass('ui-unselecting')
- });
- });
- };
- this.refresh();
-
- this.selectees = selectees.addClass("ui-selectee");
-
- this._mouseInit();
-
- this.helper = $(document.createElement('div'))
- .css({border:'1px dotted black'})
- .addClass("ui-selectable-helper");
- },
-
- destroy: function() {
- this.element
- .removeClass("ui-selectable ui-selectable-disabled")
- .removeData("selectable")
- .unbind(".selectable");
- this._mouseDestroy();
- },
-
- _mouseStart: function(event) {
- var self = this;
-
- this.opos = [event.pageX, event.pageY];
-
- if (this.options.disabled)
- return;
-
- var options = this.options;
-
- this.selectees = $(options.filter, this.element[0]);
-
- this._trigger("start", event);
-
- $(options.appendTo).append(this.helper);
- // position helper (lasso)
- this.helper.css({
- "z-index": 100,
- "position": "absolute",
- "left": event.clientX,
- "top": event.clientY,
- "width": 0,
- "height": 0
- });
-
- if (options.autoRefresh) {
- this.refresh();
- }
-
- this.selectees.filter('.ui-selected').each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.startselected = true;
- if (!event.metaKey) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- });
-
- $(event.target).parents().andSelf().each(function() {
- var selectee = $.data(this, "selectable-item");
- if (selectee) {
- selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
- selectee.unselecting = false;
- selectee.selecting = true;
- selectee.selected = true;
- // selectable SELECTING callback
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- return false;
- }
- });
-
- },
-
- _mouseDrag: function(event) {
- var self = this;
- this.dragged = true;
-
- if (this.options.disabled)
- return;
-
- var options = this.options;
-
- var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
- if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
- if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
- this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
-
- this.selectees.each(function() {
- var selectee = $.data(this, "selectable-item");
- //prevent helper from being selected if appendTo: selectable
- if (!selectee || selectee.element == self.element[0])
- return;
- var hit = false;
- if (options.tolerance == 'touch') {
- hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
- } else if (options.tolerance == 'fit') {
- hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
- }
-
- if (hit) {
- // SELECT
- if (selectee.selected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- }
- if (selectee.unselecting) {
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- }
- if (!selectee.selecting) {
- selectee.$element.addClass('ui-selecting');
- selectee.selecting = true;
- // selectable SELECTING callback
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- }
- } else {
- // UNSELECT
- if (selectee.selecting) {
- if (event.metaKey && selectee.startselected) {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- selectee.$element.addClass('ui-selected');
- selectee.selected = true;
- } else {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- if (selectee.startselected) {
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- }
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- if (selectee.selected) {
- if (!event.metaKey && !selectee.startselected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
-
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- }
- });
-
- return false;
- },
-
- _mouseStop: function(event) {
- var self = this;
-
- this.dragged = false;
-
- var options = this.options;
-
- $('.ui-unselecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- selectee.startselected = false;
- self._trigger("unselected", event, {
- unselected: selectee.element
- });
- });
- $('.ui-selecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
- selectee.selecting = false;
- selectee.selected = true;
- selectee.startselected = true;
- self._trigger("selected", event, {
- selected: selectee.element
- });
- });
- this._trigger("stop", event);
-
- this.helper.remove();
-
- return false;
- }
-
-}));
-
-$.extend($.ui.selectable, {
- version: "1.7.1",
- defaults: {
- appendTo: 'body',
- autoRefresh: true,
- cancel: ":input,option",
- delay: 0,
- distance: 0,
- filter: '*',
- tolerance: 'touch'
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Sortable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
- _init: function() {
-
- var o = this.options;
- this.containerCache = {};
- this.element.addClass("ui-sortable");
-
- //Get the items
- this.refresh();
-
- //Let's determine if the items are floating
- this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
-
- //Let's determine the parent's offset
- this.offset = this.element.offset();
-
- //Initialize mouse events for interaction
- this._mouseInit();
-
- },
-
- destroy: function() {
- this.element
- .removeClass("ui-sortable ui-sortable-disabled")
- .removeData("sortable")
- .unbind(".sortable");
- this._mouseDestroy();
-
- for ( var i = this.items.length - 1; i >= 0; i-- )
- this.items[i].item.removeData("sortable-item");
- },
-
- _mouseCapture: function(event, overrideHandle) {
-
- if (this.reverting) {
- return false;
- }
-
- if(this.options.disabled || this.options.type == 'static') return false;
-
- //We have to refresh the items data once first
- this._refreshItems(event);
-
- //Find out if the clicked node (or one of its parents) is a actual item in this.items
- var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
- if($.data(this, 'sortable-item') == self) {
- currentItem = $(this);
- return false;
- }
- });
- if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
-
- if(!currentItem) return false;
- if(this.options.handle && !overrideHandle) {
- var validHandle = false;
-
- $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
- if(!validHandle) return false;
- }
-
- this.currentItem = currentItem;
- this._removeCurrentsFromItems();
- return true;
-
- },
-
- _mouseStart: function(event, overrideHandle, noActivation) {
-
- var o = this.options, self = this;
- this.currentContainer = this;
-
- //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
- this.refreshPositions();
-
- //Create and append the visible helper
- this.helper = this._createHelper(event);
-
- //Cache the helper size
- this._cacheHelperProportions();
-
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
-
- //Cache the margins of the original element
- this._cacheMargins();
-
- //Get the next scrolling parent
- this.scrollParent = this.helper.scrollParent();
-
- //The element's absolute position on the page minus margins
- this.offset = this.currentItem.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
-
- // Only after we got the offset, we can change the helper's position to absolute
- // TODO: Still need to figure out a way to make relative sorting possible
- this.helper.css("position", "absolute");
- this.cssPosition = this.helper.css("position");
-
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
-
- //Generate the original position
- this.originalPosition = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
-
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
-
- //Cache the former DOM position
- this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
-
- //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
- if(this.helper[0] != this.currentItem[0]) {
- this.currentItem.hide();
- }
-
- //Create the placeholder
- this._createPlaceholder();
-
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
-
- if(o.cursor) { // cursor option
- if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
- $('body').css("cursor", o.cursor);
- }
-
- if(o.opacity) { // opacity option
- if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
- this.helper.css("opacity", o.opacity);
- }
-
- if(o.zIndex) { // zIndex option
- if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
- this.helper.css("zIndex", o.zIndex);
- }
-
- //Prepare scrolling
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
- this.overflowOffset = this.scrollParent.offset();
-
- //Call callbacks
- this._trigger("start", event, this._uiHash());
-
- //Recache the helper size
- if(!this._preserveHelperProportions)
- this._cacheHelperProportions();
-
-
- //Post 'activate' events to possible containers
- if(!noActivation) {
- for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
- }
-
- //Prepare possible droppables
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
-
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
-
- this.dragging = true;
-
- this.helper.addClass("ui-sortable-helper");
- this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
- return true;
-
- },
-
- _mouseDrag: function(event) {
-
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
-
- if (!this.lastPositionAbs) {
- this.lastPositionAbs = this.positionAbs;
- }
-
- //Do scrolling
- if(this.options.scroll) {
- var o = this.options, scrolled = false;
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
-
- if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
-
- if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
-
- } else {
-
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
-
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
-
- }
-
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
- }
-
- //Regenerate the absolute position used for position checks
- this.positionAbs = this._convertPositionTo("absolute");
-
- //Set the helper position
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
-
- //Rearrange
- for (var i = this.items.length - 1; i >= 0; i--) {
-
- //Cache variables and intersection, continue if no intersection
- var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
- if (!intersection) continue;
-
- if(itemElement != this.currentItem[0] //cannot intersect with itself
- && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
- && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
- && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
- ) {
-
- this.direction = intersection == 1 ? "down" : "up";
-
- if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
- this._rearrange(event, item);
- } else {
- break;
- }
-
- this._trigger("change", event, this._uiHash());
- break;
- }
- }
-
- //Post events to containers
- this._contactContainers(event);
-
- //Interconnect with droppables
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
- //Call callbacks
- this._trigger('sort', event, this._uiHash());
-
- this.lastPositionAbs = this.positionAbs;
- return false;
-
- },
-
- _mouseStop: function(event, noPropagation) {
-
- if(!event) return;
-
- //If we are using droppables, inform the manager about the drop
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- $.ui.ddmanager.drop(this, event);
-
- if(this.options.revert) {
- var self = this;
- var cur = self.placeholder.offset();
-
- self.reverting = true;
-
- $(this.helper).animate({
- left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
- top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
- }, parseInt(this.options.revert, 10) || 500, function() {
- self._clear(event);
- });
- } else {
- this._clear(event, noPropagation);
- }
-
- return false;
-
- },
-
- cancel: function() {
-
- var self = this;
-
- if(this.dragging) {
-
- this._mouseUp();
-
- if(this.options.helper == "original")
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- else
- this.currentItem.show();
-
- //Post deactivating events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- this.containers[i]._trigger("deactivate", null, self._uiHash(this));
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", null, self._uiHash(this));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- }
-
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
- if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
-
- $.extend(this, {
- helper: null,
- dragging: false,
- reverting: false,
- _noFinalSort: null
- });
-
- if(this.domPosition.prev) {
- $(this.domPosition.prev).after(this.currentItem);
- } else {
- $(this.domPosition.parent).prepend(this.currentItem);
- }
-
- return true;
-
- },
-
- serialize: function(o) {
-
- var items = this._getItemsAsjQuery(o && o.connected);
- var str = []; o = o || {};
-
- $(items).each(function() {
- var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
- if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
- });
-
- return str.join('&');
-
- },
-
- toArray: function(o) {
-
- var items = this._getItemsAsjQuery(o && o.connected);
- var ret = []; o = o || {};
-
- items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
- return ret;
-
- },
-
- /* Be careful with the following core functions */
- _intersectsWith: function(item) {
-
- var x1 = this.positionAbs.left,
- x2 = x1 + this.helperProportions.width,
- y1 = this.positionAbs.top,
- y2 = y1 + this.helperProportions.height;
-
- var l = item.left,
- r = l + item.width,
- t = item.top,
- b = t + item.height;
-
- var dyClick = this.offset.click.top,
- dxClick = this.offset.click.left;
-
- var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
-
- if( this.options.tolerance == "pointer"
- || this.options.forcePointerForContainers
- || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
- ) {
- return isOverElement;
- } else {
-
- return (l < x1 + (this.helperProportions.width / 2) // Right Half
- && x2 - (this.helperProportions.width / 2) < r // Left Half
- && t < y1 + (this.helperProportions.height / 2) // Bottom Half
- && y2 - (this.helperProportions.height / 2) < b ); // Top Half
-
- }
- },
-
- _intersectsWithPointer: function(item) {
-
- var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
- isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
- isOverElement = isOverElementHeight && isOverElementWidth,
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
-
- if (!isOverElement)
- return false;
-
- return this.floating ?
- ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
- : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
-
- },
-
- _intersectsWithSides: function(item) {
-
- var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
- isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
-
- if (this.floating && horizontalDirection) {
- return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
- } else {
- return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
- }
-
- },
-
- _getDragVerticalDirection: function() {
- var delta = this.positionAbs.top - this.lastPositionAbs.top;
- return delta != 0 && (delta > 0 ? "down" : "up");
- },
-
- _getDragHorizontalDirection: function() {
- var delta = this.positionAbs.left - this.lastPositionAbs.left;
- return delta != 0 && (delta > 0 ? "right" : "left");
- },
-
- refresh: function(event) {
- this._refreshItems(event);
- this.refreshPositions();
- },
-
- _connectWith: function() {
- var options = this.options;
- return options.connectWith.constructor == String
- ? [options.connectWith]
- : options.connectWith;
- },
-
- _getItemsAsjQuery: function(connected) {
-
- var self = this;
- var items = [];
- var queries = [];
- var connectWith = this._connectWith();
-
- if(connectWith && connected) {
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
- }
- };
- };
- }
-
- queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);
-
- for (var i = queries.length - 1; i >= 0; i--){
- queries[i][0].each(function() {
- items.push(this);
- });
- };
-
- return $(items);
-
- },
-
- _removeCurrentsFromItems: function() {
-
- var list = this.currentItem.find(":data(sortable-item)");
-
- for (var i=0; i < this.items.length; i++) {
-
- for (var j=0; j < list.length; j++) {
- if(list[j] == this.items[i].item[0])
- this.items.splice(i,1);
- };
-
- };
-
- },
-
- _refreshItems: function(event) {
-
- this.items = [];
- this.containers = [this];
- var items = this.items;
- var self = this;
- var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
- var connectWith = this._connectWith();
-
- if(connectWith) {
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
- this.containers.push(inst);
- }
- };
- };
- }
-
- for (var i = queries.length - 1; i >= 0; i--) {
- var targetData = queries[i][1];
- var _queries = queries[i][0];
-
- for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
- var item = $(_queries[j]);
-
- item.data('sortable-item', targetData); // Data for target checking (mouse manager)
-
- items.push({
- item: item,
- instance: targetData,
- width: 0, height: 0,
- left: 0, top: 0
- });
- };
- };
-
- },
-
- refreshPositions: function(fast) {
-
- //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
- if(this.offsetParent && this.helper) {
- this.offset.parent = this._getParentOffset();
- }
-
- for (var i = this.items.length - 1; i >= 0; i--){
- var item = this.items[i];
-
- //We ignore calculating positions of all connected containers when we're not over them
- if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
- continue;
-
- var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
-
- if (!fast) {
- item.width = t.outerWidth();
- item.height = t.outerHeight();
- }
-
- var p = t.offset();
- item.left = p.left;
- item.top = p.top;
- };
-
- if(this.options.custom && this.options.custom.refreshContainers) {
- this.options.custom.refreshContainers.call(this);
- } else {
- for (var i = this.containers.length - 1; i >= 0; i--){
- var p = this.containers[i].element.offset();
- this.containers[i].containerCache.left = p.left;
- this.containers[i].containerCache.top = p.top;
- this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
- this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
- };
- }
-
- },
-
- _createPlaceholder: function(that) {
-
- var self = that || this, o = self.options;
-
- if(!o.placeholder || o.placeholder.constructor == String) {
- var className = o.placeholder;
- o.placeholder = {
- element: function() {
-
- var el = $(document.createElement(self.currentItem[0].nodeName))
- .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
- .removeClass("ui-sortable-helper")[0];
-
- if(!className)
- el.style.visibility = "hidden";
-
- return el;
- },
- update: function(container, p) {
-
- // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
- // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
- if(className && !o.forcePlaceholderSize) return;
-
- //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
- if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
- if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
- }
- };
- }
-
- //Create the placeholder
- self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
-
- //Append it after the actual current item
- self.currentItem.after(self.placeholder);
-
- //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
- o.placeholder.update(self, self.placeholder);
-
- },
-
- _contactContainers: function(event) {
- for (var i = this.containers.length - 1; i >= 0; i--){
-
- if(this._intersectsWith(this.containers[i].containerCache)) {
- if(!this.containers[i].containerCache.over) {
-
- if(this.currentContainer != this.containers[i]) {
-
- //When entering a new container, we will find the item with the least distance and append our item near it
- var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
- for (var j = this.items.length - 1; j >= 0; j--) {
- if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
- var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
- if(Math.abs(cur - base) < dist) {
- dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
- }
- }
-
- if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
- continue;
-
- this.currentContainer = this.containers[i];
- itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
- this._trigger("change", event, this._uiHash());
- this.containers[i]._trigger("change", event, this._uiHash(this));
-
- //Update the placeholder
- this.options.placeholder.update(this.currentContainer, this.placeholder);
-
- }
-
- this.containers[i]._trigger("over", event, this._uiHash(this));
- this.containers[i].containerCache.over = 1;
- }
- } else {
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", event, this._uiHash(this));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- };
- },
-
- _createHelper: function(event) {
-
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
-
- if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
- $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
-
- if(helper[0] == this.currentItem[0])
- this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
-
- if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
- if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
-
- return helper;
-
- },
-
- _adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
- },
-
- _getParentOffset: function() {
-
-
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
-
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
-
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
-
- return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
-
- },
-
- _getRelativeOffset: function() {
-
- if(this.cssPosition == "relative") {
- var p = this.currentItem.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
- }
-
- },
-
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
- top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
- };
- },
-
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
- },
-
- _setContainment: function() {
-
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- 0 - this.offset.relative.left - this.offset.parent.left,
- 0 - this.offset.relative.top - this.offset.parent.top,
- $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
-
- if(!(/^(document|window|parent)$/).test(o.containment)) {
- var ce = $(o.containment)[0];
- var co = $(o.containment).offset();
- var over = ($(ce).css("overflow") != 'hidden');
-
- this.containment = [
- co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
- co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
- co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
- co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
- ];
- }
-
- },
-
- _convertPositionTo: function(d, pos) {
-
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
-
- },
-
- _generatePosition: function(event) {
-
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
- }
-
- var pageX = event.pageX;
- var pageY = event.pageY;
-
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
-
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
- if(this.containment) {
- if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
- }
-
- if(o.grid) {
- var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
- pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
- var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
- pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
- }
-
- }
-
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
-
- },
-
- _rearrange: function(event, i, a, hardRefresh) {
-
- a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
-
- //Various things done here to improve the performance:
- // 1. we create a setTimeout, that calls refreshPositions
- // 2. on the instance, we have a counter variable, that get's higher after every append
- // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
- // 4. this lets only the last addition to the timeout stack through
- this.counter = this.counter ? ++this.counter : 1;
- var self = this, counter = this.counter;
-
- window.setTimeout(function() {
- if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
- },0);
-
- },
-
- _clear: function(event, noPropagation) {
-
- this.reverting = false;
- // We delay all events that have to be triggered to after the point where the placeholder has been removed and
- // everything else normalized again
- var delayedTriggers = [], self = this;
-
- // We first have to update the dom position of the actual currentItem
- // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
- if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
- this._noFinalSort = null;
-
- if(this.helper[0] == this.currentItem[0]) {
- for(var i in this._storedCSS) {
- if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
- }
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- } else {
- this.currentItem.show();
- }
-
- if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
- if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
- if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
- if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
- for (var i = this.containers.length - 1; i >= 0; i--){
- if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- }
- };
- };
-
- //Post events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- if(this.containers[i].containerCache.over) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- //Do what was originally in plugins
- if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
- if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
- if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
-
- this.dragging = false;
- if(this.cancelHelperRemoval) {
- if(!noPropagation) {
- this._trigger("beforeStop", event, this._uiHash());
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
- return false;
- }
-
- if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
-
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-
- if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
-
- if(!noPropagation) {
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
-
- this.fromOutside = false;
- return true;
-
- },
-
- _trigger: function() {
- if ($.widget.prototype._trigger.apply(this, arguments) === false) {
- this.cancel();
- }
- },
-
- _uiHash: function(inst) {
- var self = inst || this;
- return {
- helper: self.helper,
- placeholder: self.placeholder || $([]),
- position: self.position,
- absolutePosition: self.positionAbs, //deprecated
- offset: self.positionAbs,
- item: self.currentItem,
- sender: inst ? inst.element : null
- };
- }
-
-}));
-
-$.extend($.ui.sortable, {
- getter: "serialize toArray",
- version: "1.7.1",
- eventPrefix: "sort",
- defaults: {
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectWith: false,
- containment: false,
- cursor: 'auto',
- cursorAt: false,
- delay: 0,
- distance: 1,
- dropOnEmpty: true,
- forcePlaceholderSize: false,
- forceHelperSize: false,
- grid: false,
- handle: false,
- helper: "original",
- items: '> *',
- opacity: false,
- placeholder: false,
- revert: false,
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- scope: "default",
- tolerance: "intersect",
- zIndex: 1000
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Accordion 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.accordion", {
-
- _init: function() {
-
- var o = this.options, self = this;
- this.running = 0;
-
- // if the user set the alwaysOpen option on init
- // then we need to set the collapsible option
- // if they set both on init, collapsible will take priority
- if (o.collapsible == $.ui.accordion.defaults.collapsible &&
- o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
- o.collapsible = !o.alwaysOpen;
- }
-
- if ( o.navigation ) {
- var current = this.element.find("a").filter(o.navigationFilter);
- if ( current.length ) {
- if ( current.filter(o.header).length ) {
- this.active = current;
- } else {
- this.active = current.parent().parent().prev();
- current.addClass("ui-accordion-content-active");
- }
- }
- }
-
- this.element.addClass("ui-accordion ui-widget ui-helper-reset");
-
- // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
- if (this.element[0].nodeName == "UL") {
- this.element.children("li").addClass("ui-accordion-li-fix");
- }
-
- this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
- .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
- .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
- .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
- .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
-
- this.headers
- .next()
- .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
-
- this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
- this.active.next().addClass('ui-accordion-content-active');
-
- //Append icon elements
- $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
- this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
-
- // IE7-/Win - Extra vertical space in lists fixed
- if ($.browser.msie) {
- this.element.find('a').css('zoom', '1');
- }
-
- this.resize();
-
- //ARIA
- this.element.attr('role','tablist');
-
- this.headers
- .attr('role','tab')
- .bind('keydown', function(event) { return self._keydown(event); })
- .next()
- .attr('role','tabpanel');
-
- this.headers
- .not(this.active || "")
- .attr('aria-expanded','false')
- .attr("tabIndex", "-1")
- .next()
- .hide();
-
- // make sure at least one header is in the tab order
- if (!this.active.length) {
- this.headers.eq(0).attr('tabIndex','0');
- } else {
- this.active
- .attr('aria-expanded','true')
- .attr('tabIndex', '0');
- }
-
- // only need links in taborder for Safari
- if (!$.browser.safari)
- this.headers.find('a').attr('tabIndex','-1');
-
- if (o.event) {
- this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
- }
-
- },
-
- destroy: function() {
- var o = this.options;
-
- this.element
- .removeClass("ui-accordion ui-widget ui-helper-reset")
- .removeAttr("role")
- .unbind('.accordion')
- .removeData('accordion');
-
- this.headers
- .unbind(".accordion")
- .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
- .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
-
- this.headers.find("a").removeAttr("tabindex");
- this.headers.children(".ui-icon").remove();
- var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
- if (o.autoHeight || o.fillHeight) {
- contents.css("height", "");
- }
- },
-
- _setData: function(key, value) {
- if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
- $.widget.prototype._setData.apply(this, arguments);
- },
-
- _keydown: function(event) {
-
- var o = this.options, keyCode = $.ui.keyCode;
-
- if (o.disabled || event.altKey || event.ctrlKey)
- return;
-
- var length = this.headers.length;
- var currentIndex = this.headers.index(event.target);
- var toFocus = false;
-
- switch(event.keyCode) {
- case keyCode.RIGHT:
- case keyCode.DOWN:
- toFocus = this.headers[(currentIndex + 1) % length];
- break;
- case keyCode.LEFT:
- case keyCode.UP:
- toFocus = this.headers[(currentIndex - 1 + length) % length];
- break;
- case keyCode.SPACE:
- case keyCode.ENTER:
- return this._clickHandler({ target: event.target }, event.target);
- }
-
- if (toFocus) {
- $(event.target).attr('tabIndex','-1');
- $(toFocus).attr('tabIndex','0');
- toFocus.focus();
- return false;
- }
-
- return true;
-
- },
-
- resize: function() {
-
- var o = this.options, maxHeight;
-
- if (o.fillSpace) {
-
- if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
- maxHeight = this.element.parent().height();
- if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
-
- this.headers.each(function() {
- maxHeight -= $(this).outerHeight();
- });
-
- var maxPadding = 0;
- this.headers.next().each(function() {
- maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
- }).height(Math.max(0, maxHeight - maxPadding))
- .css('overflow', 'auto');
-
- } else if ( o.autoHeight ) {
- maxHeight = 0;
- this.headers.next().each(function() {
- maxHeight = Math.max(maxHeight, $(this).outerHeight());
- }).height(maxHeight);
- }
-
- },
-
- activate: function(index) {
- // call clickHandler with custom event
- var active = this._findActive(index)[0];
- this._clickHandler({ target: active }, active);
- },
-
- _findActive: function(selector) {
- return selector
- ? typeof selector == "number"
- ? this.headers.filter(":eq(" + selector + ")")
- : this.headers.not(this.headers.not(selector))
- : selector === false
- ? $([])
- : this.headers.filter(":eq(0)");
- },
-
- _clickHandler: function(event, target) {
-
- var o = this.options;
- if (o.disabled) return false;
-
- // called only when using activate(false) to close all parts programmatically
- if (!event.target && o.collapsible) {
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- var toHide = this.active.next(),
- data = {
- options: o,
- newHeader: $([]),
- oldHeader: o.active,
- newContent: $([]),
- oldContent: toHide
- },
- toShow = (this.active = $([]));
- this._toggle(toShow, toHide, data);
- return false;
- }
-
- // get the click target
- var clicked = $(event.currentTarget || target);
- var clickedIsActive = clicked[0] == this.active[0];
-
- // if animations are still active, or the active header is the target, ignore click
- if (this.running || (!o.collapsible && clickedIsActive)) {
- return false;
- }
-
- // switch classes
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- if (!clickedIsActive) {
- clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
- .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
- clicked.next().addClass('ui-accordion-content-active');
- }
-
- // find elements to show and hide
- var toShow = clicked.next(),
- toHide = this.active.next(),
- data = {
- options: o,
- newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
- oldHeader: this.active,
- newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
- oldContent: toHide.find('> *')
- },
- down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
-
- this.active = clickedIsActive ? $([]) : clicked;
- this._toggle(toShow, toHide, data, clickedIsActive, down);
-
- return false;
-
- },
-
- _toggle: function(toShow, toHide, data, clickedIsActive, down) {
-
- var o = this.options, self = this;
-
- this.toShow = toShow;
- this.toHide = toHide;
- this.data = data;
-
- var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
-
- // trigger changestart event
- this._trigger("changestart", null, this.data);
-
- // count elements to animate
- this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
-
- if (o.animated) {
-
- var animOptions = {};
-
- if ( o.collapsible && clickedIsActive ) {
- animOptions = {
- toShow: $([]),
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
- } else {
- animOptions = {
- toShow: toShow,
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
- }
-
- if (!o.proxied) {
- o.proxied = o.animated;
- }
-
- if (!o.proxiedDuration) {
- o.proxiedDuration = o.duration;
- }
-
- o.animated = $.isFunction(o.proxied) ?
- o.proxied(animOptions) : o.proxied;
-
- o.duration = $.isFunction(o.proxiedDuration) ?
- o.proxiedDuration(animOptions) : o.proxiedDuration;
-
- var animations = $.ui.accordion.animations,
- duration = o.duration,
- easing = o.animated;
-
- if (!animations[easing]) {
- animations[easing] = function(options) {
- this.slide(options, {
- easing: easing,
- duration: duration || 700
- });
- };
- }
-
- animations[easing](animOptions);
-
- } else {
-
- if (o.collapsible && clickedIsActive) {
- toShow.toggle();
- } else {
- toHide.hide();
- toShow.show();
- }
-
- complete(true);
-
- }
-
- toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
- toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
-
- },
-
- _completed: function(cancel) {
-
- var o = this.options;
-
- this.running = cancel ? 0 : --this.running;
- if (this.running) return;
-
- if (o.clearStyle) {
- this.toShow.add(this.toHide).css({
- height: "",
- overflow: ""
- });
- }
-
- this._trigger('change', null, this.data);
- }
-
-});
-
-
-$.extend($.ui.accordion, {
- version: "1.7.1",
- defaults: {
- active: null,
- alwaysOpen: true, //deprecated, use collapsible
- animated: 'slide',
- autoHeight: true,
- clearStyle: false,
- collapsible: false,
- event: "click",
- fillSpace: false,
- header: "> li > :first-child,> :not(li):even",
- icons: {
- header: "ui-icon-triangle-1-e",
- headerSelected: "ui-icon-triangle-1-s"
- },
- navigation: false,
- navigationFilter: function() {
- return this.href.toLowerCase() == location.href.toLowerCase();
- }
- },
- animations: {
- slide: function(options, additions) {
- options = $.extend({
- easing: "swing",
- duration: 300
- }, options, additions);
- if ( !options.toHide.size() ) {
- options.toShow.animate({height: "show"}, options);
- return;
- }
- if ( !options.toShow.size() ) {
- options.toHide.animate({height: "hide"}, options);
- return;
- }
- var overflow = options.toShow.css('overflow'),
- percentDone,
- showProps = {},
- hideProps = {},
- fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
- originalWidth;
- // fix width before calculating height of hidden element
- var s = options.toShow;
- originalWidth = s[0].style.width;
- s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
-
- $.each(fxAttrs, function(i, prop) {
- hideProps[prop] = 'hide';
-
- var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
- showProps[prop] = {
- value: parts[1],
- unit: parts[2] || 'px'
- };
- });
- options.toShow.css({ height: 0, overflow: 'hidden' }).show();
- options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
- step: function(now, settings) {
- // only calculate the percent when animating height
- // IE gets very inconsistent results when animating elements
- // with small values, which is common for padding
- if (settings.prop == 'height') {
- percentDone = (settings.now - settings.start) / (settings.end - settings.start);
- }
-
- options.toShow[0].style[settings.prop] =
- (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
- },
- duration: options.duration,
- easing: options.easing,
- complete: function() {
- if ( !options.autoHeight ) {
- options.toShow.css("height", "");
- }
- options.toShow.css("width", originalWidth);
- options.toShow.css({overflow: overflow});
- options.complete();
- }
- });
- },
- bounceslide: function(options) {
- this.slide(options, {
- easing: options.down ? "easeOutBounce" : "swing",
- duration: options.down ? 1000 : 200
- });
- },
- easeslide: function(options) {
- this.slide(options, {
- easing: "easeinout",
- duration: 700
- });
- }
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Dialog 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- * ui.core.js
- * ui.draggable.js
- * ui.resizable.js
- */
-(function($) {
-
-var setDataSwitch = {
- dragStart: "start.draggable",
- drag: "drag.draggable",
- dragStop: "stop.draggable",
- maxHeight: "maxHeight.resizable",
- minHeight: "minHeight.resizable",
- maxWidth: "maxWidth.resizable",
- minWidth: "minWidth.resizable",
- resizeStart: "start.resizable",
- resize: "drag.resizable",
- resizeStop: "stop.resizable"
- },
-
- uiDialogClasses =
- 'ui-dialog ' +
- 'ui-widget ' +
- 'ui-widget-content ' +
- 'ui-corner-all ';
-
-$.widget("ui.dialog", {
-
- _init: function() {
- this.originalTitle = this.element.attr('title');
-
- var self = this,
- options = this.options,
-
- title = options.title || this.originalTitle || ' ',
- titleId = $.ui.dialog.getTitleId(this.element),
-
- uiDialog = (this.uiDialog = $('<div/>'))
- .appendTo(document.body)
- .hide()
- .addClass(uiDialogClasses + options.dialogClass)
- .css({
- position: 'absolute',
- overflow: 'hidden',
- zIndex: options.zIndex
- })
- // setting tabIndex makes the div focusable
- // setting outline to 0 prevents a border on focus in Mozilla
- .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
- (options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
- })
- .attr({
- role: 'dialog',
- 'aria-labelledby': titleId
- })
- .mousedown(function(event) {
- self.moveToTop(false, event);
- }),
-
- uiDialogContent = this.element
- .show()
- .removeAttr('title')
- .addClass(
- 'ui-dialog-content ' +
- 'ui-widget-content')
- .appendTo(uiDialog),
-
- uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
- .addClass(
- 'ui-dialog-titlebar ' +
- 'ui-widget-header ' +
- 'ui-corner-all ' +
- 'ui-helper-clearfix'
- )
- .prependTo(uiDialog),
-
- uiDialogTitlebarClose = $('<a href="#"/>')
- .addClass(
- 'ui-dialog-titlebar-close ' +
- 'ui-corner-all'
- )
- .attr('role', 'button')
- .hover(
- function() {
- uiDialogTitlebarClose.addClass('ui-state-hover');
- },
- function() {
- uiDialogTitlebarClose.removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- uiDialogTitlebarClose.addClass('ui-state-focus');
- })
- .blur(function() {
- uiDialogTitlebarClose.removeClass('ui-state-focus');
- })
- .mousedown(function(ev) {
- ev.stopPropagation();
- })
- .click(function(event) {
- self.close(event);
- return false;
- })
- .appendTo(uiDialogTitlebar),
-
- uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
- .addClass(
- 'ui-icon ' +
- 'ui-icon-closethick'
- )
- .text(options.closeText)
- .appendTo(uiDialogTitlebarClose),
-
- uiDialogTitle = $('<span/>')
- .addClass('ui-dialog-title')
- .attr('id', titleId)
- .html(title)
- .prependTo(uiDialogTitlebar);
-
- uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
-
- (options.draggable && $.fn.draggable && this._makeDraggable());
- (options.resizable && $.fn.resizable && this._makeResizable());
-
- this._createButtons(options.buttons);
- this._isOpen = false;
-
- (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
- (options.autoOpen && this.open());
-
- },
-
- destroy: function() {
- (this.overlay && this.overlay.destroy());
- this.uiDialog.hide();
- this.element
- .unbind('.dialog')
- .removeData('dialog')
- .removeClass('ui-dialog-content ui-widget-content')
- .hide().appendTo('body');
- this.uiDialog.remove();
-
- (this.originalTitle && this.element.attr('title', this.originalTitle));
- },
-
- close: function(event) {
- var self = this;
-
- if (false === self._trigger('beforeclose', event)) {
- return;
- }
-
- (self.overlay && self.overlay.destroy());
- self.uiDialog.unbind('keypress.ui-dialog');
-
- (self.options.hide
- ? self.uiDialog.hide(self.options.hide, function() {
- self._trigger('close', event);
- })
- : self.uiDialog.hide() && self._trigger('close', event));
-
- $.ui.dialog.overlay.resize();
-
- self._isOpen = false;
- },
-
- isOpen: function() {
- return this._isOpen;
- },
-
- // the force parameter allows us to move modal dialogs to their correct
- // position on open
- moveToTop: function(force, event) {
-
- if ((this.options.modal && !force)
- || (!this.options.stack && !this.options.modal)) {
- return this._trigger('focus', event);
- }
-
- if (this.options.zIndex > $.ui.dialog.maxZ) {
- $.ui.dialog.maxZ = this.options.zIndex;
- }
- (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
-
- //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
- // http://ui.jquery.com/bugs/ticket/3193
- var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
- this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
- this.element.attr(saveScroll);
- this._trigger('focus', event);
- },
-
- open: function() {
- if (this._isOpen) { return; }
-
- var options = this.options,
- uiDialog = this.uiDialog;
-
- this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
- (uiDialog.next().length && uiDialog.appendTo('body'));
- this._size();
- this._position(options.position);
- uiDialog.show(options.show);
- this.moveToTop(true);
-
- // prevent tabbing out of modal dialogs
- (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
- if (event.keyCode != $.ui.keyCode.TAB) {
- return;
- }
-
- var tabbables = $(':tabbable', this),
- first = tabbables.filter(':first')[0],
- last = tabbables.filter(':last')[0];
-
- if (event.target == last && !event.shiftKey) {
- setTimeout(function() {
- first.focus();
- }, 1);
- } else if (event.target == first && event.shiftKey) {
- setTimeout(function() {
- last.focus();
- }, 1);
- }
- }));
-
- // set focus to the first tabbable element in the content area or the first button
- // if there are no tabbable elements, set focus on the dialog itself
- $([])
- .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
- .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
- .add(uiDialog)
- .filter(':first')
- .focus();
-
- this._trigger('open');
- this._isOpen = true;
- },
-
- _createButtons: function(buttons) {
- var self = this,
- hasButtons = false,
- uiDialogButtonPane = $('<div></div>')
- .addClass(
- 'ui-dialog-buttonpane ' +
- 'ui-widget-content ' +
- 'ui-helper-clearfix'
- );
-
- // if we already have a button pane, remove it
- this.uiDialog.find('.ui-dialog-buttonpane').remove();
-
- (typeof buttons == 'object' && buttons !== null &&
- $.each(buttons, function() { return !(hasButtons = true); }));
- if (hasButtons) {
- $.each(buttons, function(name, fn) {
- $('<button type="button"></button>')
- .addClass(
- 'ui-state-default ' +
- 'ui-corner-all'
- )
- .text(name)
- .click(function() { fn.apply(self.element[0], arguments); })
- .hover(
- function() {
- $(this).addClass('ui-state-hover');
- },
- function() {
- $(this).removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- $(this).addClass('ui-state-focus');
- })
- .blur(function() {
- $(this).removeClass('ui-state-focus');
- })
- .appendTo(uiDialogButtonPane);
- });
- uiDialogButtonPane.appendTo(this.uiDialog);
- }
- },
-
- _makeDraggable: function() {
- var self = this,
- options = this.options,
- heightBeforeDrag;
-
- this.uiDialog.draggable({
- cancel: '.ui-dialog-content',
- handle: '.ui-dialog-titlebar',
- containment: 'document',
- start: function() {
- heightBeforeDrag = options.height;
- $(this).height($(this).height()).addClass("ui-dialog-dragging");
- (options.dragStart && options.dragStart.apply(self.element[0], arguments));
- },
- drag: function() {
- (options.drag && options.drag.apply(self.element[0], arguments));
- },
- stop: function() {
- $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
- (options.dragStop && options.dragStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
- }
- });
- },
-
- _makeResizable: function(handles) {
- handles = (handles === undefined ? this.options.resizable : handles);
- var self = this,
- options = this.options,
- resizeHandles = typeof handles == 'string'
- ? handles
- : 'n,e,s,w,se,sw,ne,nw';
-
- this.uiDialog.resizable({
- cancel: '.ui-dialog-content',
- alsoResize: this.element,
- maxWidth: options.maxWidth,
- maxHeight: options.maxHeight,
- minWidth: options.minWidth,
- minHeight: options.minHeight,
- start: function() {
- $(this).addClass("ui-dialog-resizing");
- (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
- },
- resize: function() {
- (options.resize && options.resize.apply(self.element[0], arguments));
- },
- handles: resizeHandles,
- stop: function() {
- $(this).removeClass("ui-dialog-resizing");
- options.height = $(this).height();
- options.width = $(this).width();
- (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
- }
- })
- .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
- },
-
- _position: function(pos) {
- var wnd = $(window), doc = $(document),
- pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
- minTop = pTop;
-
- if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
- pos = [
- pos == 'right' || pos == 'left' ? pos : 'center',
- pos == 'top' || pos == 'bottom' ? pos : 'middle'
- ];
- }
- if (pos.constructor != Array) {
- pos = ['center', 'middle'];
- }
- if (pos[0].constructor == Number) {
- pLeft += pos[0];
- } else {
- switch (pos[0]) {
- case 'left':
- pLeft += 0;
- break;
- case 'right':
- pLeft += wnd.width() - this.uiDialog.outerWidth();
- break;
- default:
- case 'center':
- pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
- }
- }
- if (pos[1].constructor == Number) {
- pTop += pos[1];
- } else {
- switch (pos[1]) {
- case 'top':
- pTop += 0;
- break;
- case 'bottom':
- pTop += wnd.height() - this.uiDialog.outerHeight();
- break;
- default:
- case 'middle':
- pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
- }
- }
-
- // prevent the dialog from being too high (make sure the titlebar
- // is accessible)
- pTop = Math.max(pTop, minTop);
- this.uiDialog.css({top: pTop, left: pLeft});
- },
-
- _setData: function(key, value){
- (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
- switch (key) {
- case "buttons":
- this._createButtons(value);
- break;
- case "closeText":
- this.uiDialogTitlebarCloseText.text(value);
- break;
- case "dialogClass":
- this.uiDialog
- .removeClass(this.options.dialogClass)
- .addClass(uiDialogClasses + value);
- break;
- case "draggable":
- (value
- ? this._makeDraggable()
- : this.uiDialog.draggable('destroy'));
- break;
- case "height":
- this.uiDialog.height(value);
- break;
- case "position":
- this._position(value);
- break;
- case "resizable":
- var uiDialog = this.uiDialog,
- isResizable = this.uiDialog.is(':data(resizable)');
-
- // currently resizable, becoming non-resizable
- (isResizable && !value && uiDialog.resizable('destroy'));
-
- // currently resizable, changing handles
- (isResizable && typeof value == 'string' &&
- uiDialog.resizable('option', 'handles', value));
-
- // currently non-resizable, becoming resizable
- (isResizable || this._makeResizable(value));
- break;
- case "title":
- $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
- break;
- case "width":
- this.uiDialog.width(value);
- break;
- }
-
- $.widget.prototype._setData.apply(this, arguments);
- },
-
- _size: function() {
- /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
- * divs will both have width and height set, so we need to reset them
- */
- var options = this.options;
-
- // reset content sizing
- this.element.css({
- height: 0,
- minHeight: 0,
- width: 'auto'
- });
-
- // reset wrapper sizing
- // determine the height of all the non-content elements
- var nonContentHeight = this.uiDialog.css({
- height: 'auto',
- width: options.width
- })
- .height();
-
- this.element
- .css({
- minHeight: Math.max(options.minHeight - nonContentHeight, 0),
- height: options.height == 'auto'
- ? 'auto'
- : Math.max(options.height - nonContentHeight, 0)
- });
- }
-});
-
-$.extend($.ui.dialog, {
- version: "1.7.1",
- defaults: {
- autoOpen: true,
- bgiframe: false,
- buttons: {},
- closeOnEscape: true,
- closeText: 'close',
- dialogClass: '',
- draggable: true,
- hide: null,
- height: 'auto',
- maxHeight: false,
- maxWidth: false,
- minHeight: 150,
- minWidth: 150,
- modal: false,
- position: 'center',
- resizable: true,
- show: null,
- stack: true,
- title: '',
- width: 300,
- zIndex: 1000
- },
-
- getter: 'isOpen',
-
- uuid: 0,
- maxZ: 0,
-
- getTitleId: function($el) {
- return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
- },
-
- overlay: function(dialog) {
- this.$el = $.ui.dialog.overlay.create(dialog);
- }
-});
-
-$.extend($.ui.dialog.overlay, {
- instances: [],
- maxZ: 0,
- events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
- function(event) { return event + '.dialog-overlay'; }).join(' '),
- create: function(dialog) {
- if (this.instances.length === 0) {
- // prevent use of anchors and inputs
- // we use a setTimeout in case the overlay is created from an
- // event that we're going to be cancelling (see #2804)
- setTimeout(function() {
- $(document).bind($.ui.dialog.overlay.events, function(event) {
- var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
- return (dialogZ > $.ui.dialog.overlay.maxZ);
- });
- }, 1);
-
- // allow closing by pressing the escape key
- $(document).bind('keydown.dialog-overlay', function(event) {
- (dialog.options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
- });
-
- // handle window resize
- $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
- }
-
- var $el = $('<div></div>').appendTo(document.body)
- .addClass('ui-widget-overlay').css({
- width: this.width(),
- height: this.height()
- });
-
- (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
-
- this.instances.push($el);
- return $el;
- },
-
- destroy: function($el) {
- this.instances.splice($.inArray(this.instances, $el), 1);
-
- if (this.instances.length === 0) {
- $([document, window]).unbind('.dialog-overlay');
- }
-
- $el.remove();
- },
-
- height: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollHeight = Math.max(
- document.documentElement.scrollHeight,
- document.body.scrollHeight
- );
- var offsetHeight = Math.max(
- document.documentElement.offsetHeight,
- document.body.offsetHeight
- );
-
- if (scrollHeight < offsetHeight) {
- return $(window).height() + 'px';
- } else {
- return scrollHeight + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).height() + 'px';
- }
- },
-
- width: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollWidth = Math.max(
- document.documentElement.scrollWidth,
- document.body.scrollWidth
- );
- var offsetWidth = Math.max(
- document.documentElement.offsetWidth,
- document.body.offsetWidth
- );
-
- if (scrollWidth < offsetWidth) {
- return $(window).width() + 'px';
- } else {
- return scrollWidth + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).width() + 'px';
- }
- },
-
- resize: function() {
- /* If the dialog is draggable and the user drags it past the
- * right edge of the window, the document becomes wider so we
- * need to stretch the overlay. If the user then drags the
- * dialog back to the left, the document will become narrower,
- * so we need to shrink the overlay to the appropriate size.
- * This is handled by shrinking the overlay before setting it
- * to the full document size.
- */
- var $overlays = $([]);
- $.each($.ui.dialog.overlay.instances, function() {
- $overlays = $overlays.add(this);
- });
-
- $overlays.css({
- width: 0,
- height: 0
- }).css({
- width: $.ui.dialog.overlay.width(),
- height: $.ui.dialog.overlay.height()
- });
- }
-});
-
-$.extend($.ui.dialog.overlay.prototype, {
- destroy: function() {
- $.ui.dialog.overlay.destroy(this.$el);
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Slider 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- * ui.core.js
- */
-
-(function($) {
-
-$.widget("ui.slider", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- var self = this, o = this.options;
- this._keySliding = false;
- this._handleIndex = null;
- this._detectOrientation();
- this._mouseInit();
-
- this.element
- .addClass("ui-slider"
- + " ui-slider-" + this.orientation
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all");
-
- this.range = $([]);
-
- if (o.range) {
-
- if (o.range === true) {
- this.range = $('<div></div>');
- if (!o.values) o.values = [this._valueMin(), this._valueMin()];
- if (o.values.length && o.values.length != 2) {
- o.values = [o.values[0], o.values[0]];
- }
- } else {
- this.range = $('<div></div>');
- }
-
- this.range
- .appendTo(this.element)
- .addClass("ui-slider-range");
-
- if (o.range == "min" || o.range == "max") {
- this.range.addClass("ui-slider-range-" + o.range);
- }
-
- // note: this isn't the most fittingly semantic framework class for this element,
- // but worked best visually with a variety of themes
- this.range.addClass("ui-widget-header");
-
- }
-
- if ($(".ui-slider-handle", this.element).length == 0)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
-
- if (o.values && o.values.length) {
- while ($(".ui-slider-handle", this.element).length < o.values.length)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
- }
-
- this.handles = $(".ui-slider-handle", this.element)
- .addClass("ui-state-default"
- + " ui-corner-all");
-
- this.handle = this.handles.eq(0);
-
- this.handles.add(this.range).filter("a")
- .click(function(event) { event.preventDefault(); })
- .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); })
- .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); })
- .blur(function() { $(this).removeClass('ui-state-focus'); });
-
- this.handles.each(function(i) {
- $(this).data("index.ui-slider-handle", i);
- });
-
- this.handles.keydown(function(event) {
-
- var ret = true;
-
- var index = $(this).data("index.ui-slider-handle");
-
- if (self.options.disabled)
- return;
-
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- case $.ui.keyCode.END:
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- ret = false;
- if (!self._keySliding) {
- self._keySliding = true;
- $(this).addClass("ui-state-active");
- self._start(event, index);
- }
- break;
- }
-
- var curVal, newVal, step = self._step();
- if (self.options.values && self.options.values.length) {
- curVal = newVal = self.values(index);
- } else {
- curVal = newVal = self.value();
- }
-
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- newVal = self._valueMin();
- break;
- case $.ui.keyCode.END:
- newVal = self._valueMax();
- break;
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- if(curVal == self._valueMax()) return;
- newVal = curVal + step;
- break;
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- if(curVal == self._valueMin()) return;
- newVal = curVal - step;
- break;
- }
-
- self._slide(event, index, newVal);
-
- return ret;
-
- }).keyup(function(event) {
-
- var index = $(this).data("index.ui-slider-handle");
-
- if (self._keySliding) {
- self._stop(event, index);
- self._change(event, index);
- self._keySliding = false;
- $(this).removeClass("ui-state-active");
- }
-
- });
-
- this._refreshValue();
-
- },
-
- destroy: function() {
-
- this.handles.remove();
- this.range.remove();
-
- this.element
- .removeClass("ui-slider"
- + " ui-slider-horizontal"
- + " ui-slider-vertical"
- + " ui-slider-disabled"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeData("slider")
- .unbind(".slider");
-
- this._mouseDestroy();
-
- },
-
- _mouseCapture: function(event) {
-
- var o = this.options;
-
- if (o.disabled)
- return false;
-
- this.elementSize = {
- width: this.element.outerWidth(),
- height: this.element.outerHeight()
- };
- this.elementOffset = this.element.offset();
-
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
-
- var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
- var self = this, index;
- this.handles.each(function(i) {
- var thisDistance = Math.abs(normValue - self.values(i));
- if (distance > thisDistance) {
- distance = thisDistance;
- closestHandle = $(this);
- index = i;
- }
- });
-
- // workaround for bug #3736 (if both handles of a range are at 0,
- // the first is always used as the one with least distance,
- // and moving it is obviously prevented by preventing negative ranges)
- if(o.range == true && this.values(1) == o.min) {
- closestHandle = $(this.handles[++index]);
- }
-
- this._start(event, index);
-
- self._handleIndex = index;
-
- closestHandle
- .addClass("ui-state-active")
- .focus();
-
- var offset = closestHandle.offset();
- var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
- this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
- left: event.pageX - offset.left - (closestHandle.width() / 2),
- top: event.pageY - offset.top
- - (closestHandle.height() / 2)
- - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
- - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
- + (parseInt(closestHandle.css('marginTop'),10) || 0)
- };
-
- normValue = this._normValueFromMouse(position);
- this._slide(event, index, normValue);
- return true;
-
- },
-
- _mouseStart: function(event) {
- return true;
- },
-
- _mouseDrag: function(event) {
-
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
-
- this._slide(event, this._handleIndex, normValue);
-
- return false;
-
- },
-
- _mouseStop: function(event) {
-
- this.handles.removeClass("ui-state-active");
- this._stop(event, this._handleIndex);
- this._change(event, this._handleIndex);
- this._handleIndex = null;
- this._clickOffset = null;
-
- return false;
-
- },
-
- _detectOrientation: function() {
- this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
- },
-
- _normValueFromMouse: function(position) {
-
- var pixelTotal, pixelMouse;
- if ('horizontal' == this.orientation) {
- pixelTotal = this.elementSize.width;
- pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
- } else {
- pixelTotal = this.elementSize.height;
- pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
- }
-
- var percentMouse = (pixelMouse / pixelTotal);
- if (percentMouse > 1) percentMouse = 1;
- if (percentMouse < 0) percentMouse = 0;
- if ('vertical' == this.orientation)
- percentMouse = 1 - percentMouse;
-
- var valueTotal = this._valueMax() - this._valueMin(),
- valueMouse = percentMouse * valueTotal,
- valueMouseModStep = valueMouse % this.options.step,
- normValue = this._valueMin() + valueMouse - valueMouseModStep;
-
- if (valueMouseModStep > (this.options.step / 2))
- normValue += this.options.step;
-
- // Since JavaScript has problems with large floats, round
- // the final value to 5 digits after the decimal point (see #4124)
- return parseFloat(normValue.toFixed(5));
-
- },
-
- _start: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("start", event, uiHash);
- },
-
- _slide: function(event, index, newVal) {
-
- var handle = this.handles[index];
-
- if (this.options.values && this.options.values.length) {
-
- var otherVal = this.values(index ? 0 : 1);
-
- if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal))
- newVal = otherVal;
-
- if (newVal != this.values(index)) {
- var newValues = this.values();
- newValues[index] = newVal;
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal,
- values: newValues
- });
- var otherVal = this.values(index ? 0 : 1);
- if (allowed !== false) {
- this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
- }
- }
-
- } else {
-
- if (newVal != this.value()) {
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal
- });
- if (allowed !== false) {
- this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
- }
-
- }
-
- }
-
- },
-
- _stop: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("stop", event, uiHash);
- },
-
- _change: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("change", event, uiHash);
- },
-
- value: function(newValue) {
-
- if (arguments.length) {
- this._setData("value", newValue);
- this._change(null, 0);
- }
-
- return this._value();
-
- },
-
- values: function(index, newValue, animated, noPropagation) {
-
- if (arguments.length > 1) {
- this.options.values[index] = newValue;
- this._refreshValue(animated);
- if(!noPropagation) this._change(null, index);
- }
-
- if (arguments.length) {
- if (this.options.values && this.options.values.length) {
- return this._values(index);
- } else {
- return this.value();
- }
- } else {
- return this._values();
- }
-
- },
-
- _setData: function(key, value, animated) {
-
- $.widget.prototype._setData.apply(this, arguments);
-
- switch (key) {
- case 'orientation':
-
- this._detectOrientation();
-
- this.element
- .removeClass("ui-slider-horizontal ui-slider-vertical")
- .addClass("ui-slider-" + this.orientation);
- this._refreshValue(animated);
- break;
- case 'value':
- this._refreshValue(animated);
- break;
- }
-
- },
-
- _step: function() {
- var step = this.options.step;
- return step;
- },
-
- _value: function() {
-
- var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
-
- },
-
- _values: function(index) {
-
- if (arguments.length) {
- var val = this.options.values[index];
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
- } else {
- return this.options.values;
- }
-
- },
-
- _valueMin: function() {
- var valueMin = this.options.min;
- return valueMin;
- },
-
- _valueMax: function() {
- var valueMax = this.options.max;
- return valueMax;
- },
-
- _refreshValue: function(animate) {
-
- var oRange = this.options.range, o = this.options, self = this;
-
- if (this.options.values && this.options.values.length) {
- var vp0, vp1;
- this.handles.each(function(i, j) {
- var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
- if (self.options.range === true) {
- if (self.orientation == 'horizontal') {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- } else {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- }
- }
- lastValPercent = valPercent;
- });
- } else {
- var value = this.value(),
- valueMin = this._valueMin(),
- valueMax = this._valueMax(),
- valPercent = valueMax != valueMin
- ? (value - valueMin) / (valueMax - valueMin) * 100
- : 0;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
-
- (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
- (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
- }
-
- }
-
-}));
-
-$.extend($.ui.slider, {
- getter: "value values",
- version: "1.7.1",
- eventPrefix: "slide",
- defaults: {
- animate: false,
- delay: 0,
- distance: 0,
- max: 100,
- min: 0,
- orientation: 'horizontal',
- range: false,
- step: 1,
- value: 0,
- values: null
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Tabs 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.tabs", {
-
- _init: function() {
- if (this.options.deselectable !== undefined) {
- this.options.collapsible = this.options.deselectable;
- }
- this._tabify(true);
- },
-
- _setData: function(key, value) {
- if (key == 'selected') {
- if (this.options.collapsible && value == this.options.selected) {
- return;
- }
- this.select(value);
- }
- else {
- this.options[key] = value;
- if (key == 'deselectable') {
- this.options.collapsible = value;
- }
- this._tabify();
- }
- },
-
- _tabId: function(a) {
- return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
- this.options.idPrefix + $.data(a);
- },
-
- _sanitizeSelector: function(hash) {
- return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
- },
-
- _cookie: function() {
- var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
- return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
- },
-
- _ui: function(tab, panel) {
- return {
- tab: tab,
- panel: panel,
- index: this.anchors.index(tab)
- };
- },
-
- _cleanup: function() {
- // restore all former loading tabs labels
- this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
- .find('span:data(label.tabs)')
- .each(function() {
- var el = $(this);
- el.html(el.data('label.tabs')).removeData('label.tabs');
- });
- },
-
- _tabify: function(init) {
-
- this.list = this.element.children('ul:first');
- this.lis = $('li:has(a[href])', this.list);
- this.anchors = this.lis.map(function() { return $('a', this)[0]; });
- this.panels = $([]);
-
- var self = this, o = this.options;
-
- var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
- this.anchors.each(function(i, a) {
- var href = $(a).attr('href');
-
- // For dynamically created HTML that contains a hash as href IE < 8 expands
- // such href to the full page url with hash and then misinterprets tab as ajax.
- // Same consideration applies for an added tab with a fragment identifier
- // since a[href=#fragment-identifier] does unexpectedly not match.
- // Thus normalize href attribute...
- var hrefBase = href.split('#')[0], baseEl;
- if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
- (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
- href = a.hash;
- a.href = href;
- }
-
- // inline tab
- if (fragmentId.test(href)) {
- self.panels = self.panels.add(self._sanitizeSelector(href));
- }
-
- // remote tab
- else if (href != '#') { // prevent loading the page itself if href is just "#"
- $.data(a, 'href.tabs', href); // required for restore on destroy
-
- // TODO until #3808 is fixed strip fragment identifier from url
- // (IE fails to load from such url)
- $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
-
- var id = self._tabId(a);
- a.href = '#' + id;
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
- .insertAfter(self.panels[i - 1] || self.list);
- $panel.data('destroy.tabs', true);
- }
- self.panels = self.panels.add($panel);
- }
-
- // invalid tab href
- else {
- o.disabled.push(i);
- }
- });
-
- // initialization from scratch
- if (init) {
-
- // attach necessary classes for styling
- this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
- this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
- this.lis.addClass('ui-state-default ui-corner-top');
- this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
-
- // Selected tab
- // use "selected" option or try to retrieve:
- // 1. from fragment identifier in url
- // 2. from cookie
- // 3. from selected class attribute on <li>
- if (o.selected === undefined) {
- if (location.hash) {
- this.anchors.each(function(i, a) {
- if (a.hash == location.hash) {
- o.selected = i;
- return false; // break
- }
- });
- }
- if (typeof o.selected != 'number' && o.cookie) {
- o.selected = parseInt(self._cookie(), 10);
- }
- if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
- o.selected = o.selected || 0;
- }
- else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
- o.selected = -1;
- }
-
- // sanity check - default to first tab...
- o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
-
- // Take disabling tabs via class attribute from HTML
- // into account and update option properly.
- // A selected tab cannot become disabled.
- o.disabled = $.unique(o.disabled.concat(
- $.map(this.lis.filter('.ui-state-disabled'),
- function(n, i) { return self.lis.index(n); } )
- )).sort();
-
- if ($.inArray(o.selected, o.disabled) != -1) {
- o.disabled.splice($.inArray(o.selected, o.disabled), 1);
- }
-
- // highlight selected tab
- this.panels.addClass('ui-tabs-hide');
- this.lis.removeClass('ui-tabs-selected ui-state-active');
- if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
- this.panels.eq(o.selected).removeClass('ui-tabs-hide');
- this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
-
- // seems to be expected behavior that the show callback is fired
- self.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
- });
-
- this.load(o.selected);
- }
-
- // clean up to avoid memory leaks in certain versions of IE 6
- $(window).bind('unload', function() {
- self.lis.add(self.anchors).unbind('.tabs');
- self.lis = self.anchors = self.panels = null;
- });
-
- }
- // update selected after add/remove
- else {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
-
- // update collapsible
- this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
-
- // set or update cookie after init and add/remove respectively
- if (o.cookie) {
- this._cookie(o.selected, o.cookie);
- }
-
- // disable tabs
- for (var i = 0, li; (li = this.lis[i]); i++) {
- $(li)[$.inArray(i, o.disabled) != -1 &&
- !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
- }
-
- // reset cache if switching from cached to not cached
- if (o.cache === false) {
- this.anchors.removeData('cache.tabs');
- }
-
- // remove all handlers before, tabify may run on existing tabs after add or option change
- this.lis.add(this.anchors).unbind('.tabs');
-
- if (o.event != 'mouseover') {
- var addState = function(state, el) {
- if (el.is(':not(.ui-state-disabled)')) {
- el.addClass('ui-state-' + state);
- }
- };
- var removeState = function(state, el) {
- el.removeClass('ui-state-' + state);
- };
- this.lis.bind('mouseover.tabs', function() {
- addState('hover', $(this));
- });
- this.lis.bind('mouseout.tabs', function() {
- removeState('hover', $(this));
- });
- this.anchors.bind('focus.tabs', function() {
- addState('focus', $(this).closest('li'));
- });
- this.anchors.bind('blur.tabs', function() {
- removeState('focus', $(this).closest('li'));
- });
- }
-
- // set up animations
- var hideFx, showFx;
- if (o.fx) {
- if ($.isArray(o.fx)) {
- hideFx = o.fx[0];
- showFx = o.fx[1];
- }
- else {
- hideFx = showFx = o.fx;
- }
- }
-
- // Reset certain styles left over from animation
- // and prevent IE's ClearType bug...
- function resetStyle($el, fx) {
- $el.css({ display: '' });
- if ($.browser.msie && fx.opacity) {
- $el[0].style.removeAttribute('filter');
- }
- }
-
- // Show a tab...
- var showTab = showFx ?
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
- .animate(showFx, showFx.duration || 'normal', function() {
- resetStyle($show, showFx);
- self._trigger('show', null, self._ui(clicked, $show[0]));
- });
- } :
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.removeClass('ui-tabs-hide');
- self._trigger('show', null, self._ui(clicked, $show[0]));
- };
-
- // Hide a tab, $show is optional...
- var hideTab = hideFx ?
- function(clicked, $hide) {
- $hide.animate(hideFx, hideFx.duration || 'normal', function() {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- resetStyle($hide, hideFx);
- self.element.dequeue("tabs");
- });
- } :
- function(clicked, $hide, $show) {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- self.element.dequeue("tabs");
- };
-
- // attach tab event handler, unbind to avoid duplicates from former tabifying...
- this.anchors.bind(o.event + '.tabs', function() {
- var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
- $show = $(self._sanitizeSelector(this.hash));
-
- // If tab is already selected and not collapsible or tab disabled or
- // or is already loading or click callback returns false stop here.
- // Check if click handler returns false last so that it is not executed
- // for a disabled or loading tab!
- if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
- $li.hasClass('ui-state-disabled') ||
- $li.hasClass('ui-state-processing') ||
- self._trigger('select', null, self._ui(this, $show[0])) === false) {
- this.blur();
- return false;
- }
-
- o.selected = self.anchors.index(this);
-
- self.abort();
-
- // if tab may be closed
- if (o.collapsible) {
- if ($li.hasClass('ui-tabs-selected')) {
- o.selected = -1;
-
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- }).dequeue("tabs");
-
- this.blur();
- return false;
- }
- else if (!$hide.length) {
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
-
- self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
-
- this.blur();
- return false;
- }
- }
-
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- // show new tab
- if ($show.length) {
- if ($hide.length) {
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- });
- }
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
-
- self.load(self.anchors.index(this));
- }
- else {
- throw 'jQuery UI Tabs: Mismatching fragment identifier.';
- }
-
- // Prevent IE from keeping other link focussed when using the back button
- // and remove dotted border from clicked link. This is controlled via CSS
- // in modern browsers; blur() removes focus from address bar in Firefox
- // which can become a usability and annoying problem with tabs('rotate').
- if ($.browser.msie) {
- this.blur();
- }
-
- });
-
- // disable click in any case
- this.anchors.bind('click.tabs', function(){return false;});
-
- },
-
- destroy: function() {
- var o = this.options;
-
- this.abort();
-
- this.element.unbind('.tabs')
- .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
- .removeData('tabs');
-
- this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
-
- this.anchors.each(function() {
- var href = $.data(this, 'href.tabs');
- if (href) {
- this.href = href;
- }
- var $this = $(this).unbind('.tabs');
- $.each(['href', 'load', 'cache'], function(i, prefix) {
- $this.removeData(prefix + '.tabs');
- });
- });
-
- this.lis.unbind('.tabs').add(this.panels).each(function() {
- if ($.data(this, 'destroy.tabs')) {
- $(this).remove();
- }
- else {
- $(this).removeClass([
- 'ui-state-default',
- 'ui-corner-top',
- 'ui-tabs-selected',
- 'ui-state-active',
- 'ui-state-hover',
- 'ui-state-focus',
- 'ui-state-disabled',
- 'ui-tabs-panel',
- 'ui-widget-content',
- 'ui-corner-bottom',
- 'ui-tabs-hide'
- ].join(' '));
- }
- });
-
- if (o.cookie) {
- this._cookie(null, o.cookie);
- }
- },
-
- add: function(url, label, index) {
- if (index === undefined) {
- index = this.anchors.length; // append by default
- }
-
- var self = this, o = this.options,
- $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
- id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
-
- $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
-
- // try to find an existing element before creating a new one
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
- }
- $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
-
- if (index >= this.lis.length) {
- $li.appendTo(this.list);
- $panel.appendTo(this.list[0].parentNode);
- }
- else {
- $li.insertBefore(this.lis[index]);
- $panel.insertBefore(this.panels[index]);
- }
-
- o.disabled = $.map(o.disabled,
- function(n, i) { return n >= index ? ++n : n; });
-
- this._tabify();
-
- if (this.anchors.length == 1) { // after tabify
- $li.addClass('ui-tabs-selected ui-state-active');
- $panel.removeClass('ui-tabs-hide');
- this.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
- });
-
- this.load(0);
- }
-
- // callback
- this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
- },
-
- remove: function(index) {
- var o = this.options, $li = this.lis.eq(index).remove(),
- $panel = this.panels.eq(index).remove();
-
- // If selected tab was removed focus tab to the right or
- // in case the last tab was removed the tab to the left.
- if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
- this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
- }
-
- o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
- function(n, i) { return n >= index ? --n : n; });
-
- this._tabify();
-
- // callback
- this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
- },
-
- enable: function(index) {
- var o = this.options;
- if ($.inArray(index, o.disabled) == -1) {
- return;
- }
-
- this.lis.eq(index).removeClass('ui-state-disabled');
- o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
-
- // callback
- this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
- },
-
- disable: function(index) {
- var self = this, o = this.options;
- if (index != o.selected) { // cannot disable already selected tab
- this.lis.eq(index).addClass('ui-state-disabled');
-
- o.disabled.push(index);
- o.disabled.sort();
-
- // callback
- this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
- }
- },
-
- select: function(index) {
- if (typeof index == 'string') {
- index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
- }
- else if (index === null) { // usage of null is deprecated, TODO remove in next release
- index = -1;
- }
- if (index == -1 && this.options.collapsible) {
- index = this.options.selected;
- }
-
- this.anchors.eq(index).trigger(this.options.event + '.tabs');
- },
-
- load: function(index) {
- var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
-
- this.abort();
-
- // not remote or from cache
- if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
- this.element.dequeue("tabs");
- return;
- }
-
- // load remote from here on
- this.lis.eq(index).addClass('ui-state-processing');
-
- if (o.spinner) {
- var span = $('span', a);
- span.data('label.tabs', span.html()).html(o.spinner);
- }
-
- this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
- url: url,
- success: function(r, s) {
- $(self._sanitizeSelector(a.hash)).html(r);
-
- // take care of tab labels
- self._cleanup();
-
- if (o.cache) {
- $.data(a, 'cache.tabs', true); // if loaded once do not load them again
- }
-
- // callbacks
- self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
- try {
- o.ajaxOptions.success(r, s);
- }
- catch (e) {}
-
- // last, so that load event is fired before show...
- self.element.dequeue("tabs");
- }
- }));
- },
-
- abort: function() {
- // stop possibly running animations
- this.element.queue([]);
- this.panels.stop(false, true);
-
- // terminate pending requests from other tabs
- if (this.xhr) {
- this.xhr.abort();
- delete this.xhr;
- }
-
- // take care of tab labels
- this._cleanup();
-
- },
-
- url: function(index, url) {
- this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
- },
-
- length: function() {
- return this.anchors.length;
- }
-
-});
-
-$.extend($.ui.tabs, {
- version: '1.7.1',
- getter: 'length',
- defaults: {
- ajaxOptions: null,
- cache: false,
- cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
- collapsible: false,
- disabled: [],
- event: 'click',
- fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
- idPrefix: 'ui-tabs-',
- panelTemplate: '<div></div>',
- spinner: '<em>Loading…</em>',
- tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
- }
-});
-
-/*
- * Tabs Extensions
- */
-
-/*
- * Rotate
- */
-$.extend($.ui.tabs.prototype, {
- rotation: null,
- rotate: function(ms, continuing) {
-
- var self = this, o = this.options;
-
- var rotate = self._rotate || (self._rotate = function(e) {
- clearTimeout(self.rotation);
- self.rotation = setTimeout(function() {
- var t = o.selected;
- self.select( ++t < self.anchors.length ? t : 0 );
- }, ms);
-
- if (e) {
- e.stopPropagation();
- }
- });
-
- var stop = self._unrotate || (self._unrotate = !continuing ?
- function(e) {
- if (e.clientX) { // in case of a true click
- self.rotate(null);
- }
- } :
- function(e) {
- t = o.selected;
- rotate();
- });
-
- // start rotation
- if (ms) {
- this.element.bind('tabsshow', rotate);
- this.anchors.bind(o.event + '.tabs', stop);
- rotate();
- }
- // stop rotation
- else {
- clearTimeout(self.rotation);
- this.element.unbind('tabsshow', rotate);
- this.anchors.unbind(o.event + '.tabs', stop);
- delete this._rotate;
- delete this._unrotate;
- }
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Datepicker 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- * ui.core.js
- */
-
-(function($) { // hide the namespace
-
-$.extend($.ui, { datepicker: { version: "1.7.1" } });
-
-var PROP_NAME = 'datepicker';
-
-/* Date picker manager.
- Use the singleton instance of this class, $.datepicker, to interact with the date picker.
- Settings for (groups of) date pickers are maintained in an instance object,
- allowing multiple different settings on the same page. */
-
-function Datepicker() {
- this.debug = false; // Change this to true to start debugging
- this._curInst = null; // The current instance in use
- this._keyEvent = false; // If the last event was a key event
- this._disabledInputs = []; // List of date picker inputs that have been disabled
- this._datepickerShowing = false; // True if the popup picker is showing , false if not
- this._inDialog = false; // True if showing within a "dialog", false if not
- this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
- this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
- this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
- this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
- this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
- this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
- this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
- this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
- this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
- this.regional = []; // Available regional settings, indexed by language code
- this.regional[''] = { // Default regional settings
- closeText: 'Done', // Display text for close link
- prevText: 'Prev', // Display text for previous month link
- nextText: 'Next', // Display text for next month link
- currentText: 'Today', // Display text for current month link
- monthNames: ['January','February','March','April','May','June',
- 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
- monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
- dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
- dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
- dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
- dateFormat: 'mm/dd/yy', // See format options on parseDate
- firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
- isRTL: false // True if right-to-left language, false if left-to-right
- };
- this._defaults = { // Global defaults for all the date picker instances
- showOn: 'focus', // 'focus' for popup on focus,
- // 'button' for trigger button, or 'both' for either
- showAnim: 'show', // Name of jQuery animation for popup
- showOptions: {}, // Options for enhanced animations
- defaultDate: null, // Used when field is blank: actual date,
- // +/-number for offset from today, null for today
- appendText: '', // Display text following the input box, e.g. showing the format
- buttonText: '...', // Text for trigger button
- buttonImage: '', // URL for trigger button image
- buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
- hideIfNoPrevNext: false, // True to hide next/previous month links
- // if not applicable, false to just disable them
- navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
- gotoCurrent: false, // True if today link goes back to current selection instead
- changeMonth: false, // True if month can be selected directly, false if only prev/next
- changeYear: false, // True if year can be selected directly, false if only prev/next
- showMonthAfterYear: false, // True if the year select precedes month, false for month then year
- yearRange: '-10:+10', // Range of years to display in drop-down,
- // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
- showOtherMonths: false, // True to show dates in other months, false to leave blank
- calculateWeek: this.iso8601Week, // How to calculate the week of the year,
- // takes a Date and returns the number of the week for it
- shortYearCutoff: '+10', // Short year values < this are in the current century,
- // > this are in the previous century,
- // string value starting with '+' for current year + value
- minDate: null, // The earliest selectable date, or null for no limit
- maxDate: null, // The latest selectable date, or null for no limit
- duration: 'normal', // Duration of display/closure
- beforeShowDay: null, // Function that takes a date and returns an array with
- // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
- // [2] = cell title (optional), e.g. $.datepicker.noWeekends
- beforeShow: null, // Function that takes an input field and
- // returns a set of custom settings for the date picker
- onSelect: null, // Define a callback function when a date is selected
- onChangeMonthYear: null, // Define a callback function when the month or year is changed
- onClose: null, // Define a callback function when the datepicker is closed
- numberOfMonths: 1, // Number of months to show at a time
- showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
- stepMonths: 1, // Number of months to step back/forward
- stepBigMonths: 12, // Number of months to step back/forward for the big links
- altField: '', // Selector for an alternate field to store selected dates into
- altFormat: '', // The date format to use for the alternate field
- constrainInput: true, // The input is constrained by the current date format
- showButtonPanel: false // True to show button panel, false to not show it
- };
- $.extend(this._defaults, this.regional['']);
- this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
-}
-
-$.extend(Datepicker.prototype, {
- /* Class name added to elements to indicate already configured with a date picker. */
- markerClassName: 'hasDatepicker',
-
- /* Debug logging (if enabled). */
- log: function () {
- if (this.debug)
- console.log.apply('', arguments);
- },
-
- /* Override the default settings for all instances of the date picker.
- @param settings object - the new settings to use as defaults (anonymous object)
- @return the manager object */
- setDefaults: function(settings) {
- extendRemove(this._defaults, settings || {});
- return this;
- },
-
- /* Attach the date picker to a jQuery selection.
- @param target element - the target input field or division or span
- @param settings object - the new settings to use for this date picker instance (anonymous) */
- _attachDatepicker: function(target, settings) {
- // check for settings on the control itself - in namespace 'date:'
- var inlineSettings = null;
- for (var attrName in this._defaults) {
- var attrValue = target.getAttribute('date:' + attrName);
- if (attrValue) {
- inlineSettings = inlineSettings || {};
- try {
- inlineSettings[attrName] = eval(attrValue);
- } catch (err) {
- inlineSettings[attrName] = attrValue;
- }
- }
- }
- var nodeName = target.nodeName.toLowerCase();
- var inline = (nodeName == 'div' || nodeName == 'span');
- if (!target.id)
- target.id = 'dp' + (++this.uuid);
- var inst = this._newInst($(target), inline);
- inst.settings = $.extend({}, settings || {}, inlineSettings || {});
- if (nodeName == 'input') {
- this._connectDatepicker(target, inst);
- } else if (inline) {
- this._inlineDatepicker(target, inst);
- }
- },
-
- /* Create a new instance object. */
- _newInst: function(target, inline) {
- var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
- return {id: id, input: target, // associated target
- selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
- drawMonth: 0, drawYear: 0, // month being drawn
- inline: inline, // is datepicker inline or not
- dpDiv: (!inline ? this.dpDiv : // presentation div
- $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
- },
-
- /* Attach the date picker to an input field. */
- _connectDatepicker: function(target, inst) {
- var input = $(target);
- inst.trigger = $([]);
- if (input.hasClass(this.markerClassName))
- return;
- var appendText = this._get(inst, 'appendText');
- var isRTL = this._get(inst, 'isRTL');
- if (appendText)
- input[isRTL ? 'before' : 'after']('<span class="' + this._appendClass + '">' + appendText + '</span>');
- var showOn = this._get(inst, 'showOn');
- if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
- input.focus(this._showDatepicker);
- if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
- var buttonText = this._get(inst, 'buttonText');
- var buttonImage = this._get(inst, 'buttonImage');
- inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
- $('<img/>').addClass(this._triggerClass).
- attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
- $('<button type="button"></button>').addClass(this._triggerClass).
- html(buttonImage == '' ? buttonText : $('<img/>').attr(
- { src:buttonImage, alt:buttonText, title:buttonText })));
- input[isRTL ? 'before' : 'after'](inst.trigger);
- inst.trigger.click(function() {
- if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
- $.datepicker._hideDatepicker();
- else
- $.datepicker._showDatepicker(target);
- return false;
- });
- }
- input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
- bind("setData.datepicker", function(event, key, value) {
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key) {
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- },
-
- /* Attach an inline date picker to a div. */
- _inlineDatepicker: function(target, inst) {
- var divSpan = $(target);
- if (divSpan.hasClass(this.markerClassName))
- return;
- divSpan.addClass(this.markerClassName).append(inst.dpDiv).
- bind("setData.datepicker", function(event, key, value){
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key){
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- this._setDate(inst, this._getDefaultDate(inst));
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- },
-
- /* Pop-up the date picker in a "dialog" box.
- @param input element - ignored
- @param dateText string - the initial date to display (in the current format)
- @param onSelect function - the function(dateText) to call when a date is selected
- @param settings object - update the dialog date picker instance's settings (anonymous object)
- @param pos int[2] - coordinates for the dialog's position within the screen or
- event - with x/y coordinates or
- leave empty for default (screen centre)
- @return the manager object */
- _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
- var inst = this._dialogInst; // internal instance
- if (!inst) {
- var id = 'dp' + (++this.uuid);
- this._dialogInput = $('<input type="text" id="' + id +
- '" size="1" style="position: absolute; top: -100px;"/>');
- this._dialogInput.keydown(this._doKeyDown);
- $('body').append(this._dialogInput);
- inst = this._dialogInst = this._newInst(this._dialogInput, false);
- inst.settings = {};
- $.data(this._dialogInput[0], PROP_NAME, inst);
- }
- extendRemove(inst.settings, settings || {});
- this._dialogInput.val(dateText);
-
- this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
- if (!this._pos) {
- var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
- var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
- var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
- var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
- this._pos = // should use actual width/height below
- [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
- }
-
- // move input on screen for focus, but hidden behind dialog
- this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
- inst.settings.onSelect = onSelect;
- this._inDialog = true;
- this.dpDiv.addClass(this._dialogClass);
- this._showDatepicker(this._dialogInput[0]);
- if ($.blockUI)
- $.blockUI(this.dpDiv);
- $.data(this._dialogInput[0], PROP_NAME, inst);
- return this;
- },
-
- /* Detach a datepicker from its control.
- @param target element - the target input field or division or span */
- _destroyDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- $.removeData(target, PROP_NAME);
- if (nodeName == 'input') {
- inst.trigger.remove();
- $target.siblings('.' + this._appendClass).remove().end().
- removeClass(this.markerClassName).
- unbind('focus', this._showDatepicker).
- unbind('keydown', this._doKeyDown).
- unbind('keypress', this._doKeyPress);
- } else if (nodeName == 'div' || nodeName == 'span')
- $target.removeClass(this.markerClassName).empty();
- },
-
- /* Enable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _enableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = false;
- inst.trigger.filter("button").
- each(function() { this.disabled = false; }).end().
- filter("img").
- css({opacity: '1.0', cursor: ''});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().removeClass('ui-state-disabled');
- }
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- },
-
- /* Disable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _disableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = true;
- inst.trigger.filter("button").
- each(function() { this.disabled = true; }).end().
- filter("img").
- css({opacity: '0.5', cursor: 'default'});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().addClass('ui-state-disabled');
- }
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- this._disabledInputs[this._disabledInputs.length] = target;
- },
-
- /* Is the first field in a jQuery collection disabled as a datepicker?
- @param target element - the target input field or division or span
- @return boolean - true if disabled, false if enabled */
- _isDisabledDatepicker: function(target) {
- if (!target) {
- return false;
- }
- for (var i = 0; i < this._disabledInputs.length; i++) {
- if (this._disabledInputs[i] == target)
- return true;
- }
- return false;
- },
-
- /* Retrieve the instance data for the target control.
- @param target element - the target input field or division or span
- @return object - the associated instance data
- @throws error if a jQuery problem getting data */
- _getInst: function(target) {
- try {
- return $.data(target, PROP_NAME);
- }
- catch (err) {
- throw 'Missing instance data for this datepicker';
- }
- },
-
- /* Update the settings for a date picker attached to an input field or division.
- @param target element - the target input field or division or span
- @param name object - the new settings to update or
- string - the name of the setting to change or
- @param value any - the new value for the setting (omit if above is an object) */
- _optionDatepicker: function(target, name, value) {
- var settings = name || {};
- if (typeof name == 'string') {
- settings = {};
- settings[name] = value;
- }
- var inst = this._getInst(target);
- if (inst) {
- if (this._curInst == inst) {
- this._hideDatepicker(null);
- }
- extendRemove(inst.settings, settings);
- var date = new Date();
- extendRemove(inst, {rangeStart: null, // start of range
- endDay: null, endMonth: null, endYear: null, // end of range
- selectedDay: date.getDate(), selectedMonth: date.getMonth(),
- selectedYear: date.getFullYear(), // starting point
- currentDay: date.getDate(), currentMonth: date.getMonth(),
- currentYear: date.getFullYear(), // current selection
- drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn
- this._updateDatepicker(inst);
- }
- },
-
- // change method deprecated
- _changeDatepicker: function(target, name, value) {
- this._optionDatepicker(target, name, value);
- },
-
- /* Redraw the date picker attached to an input field or division.
- @param target element - the target input field or division or span */
- _refreshDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst) {
- this._updateDatepicker(inst);
- }
- },
-
- /* Set the dates for a jQuery selection.
- @param target element - the target input field or division or span
- @param date Date - the new date
- @param endDate Date - the new end date for a range (optional) */
- _setDateDatepicker: function(target, date, endDate) {
- var inst = this._getInst(target);
- if (inst) {
- this._setDate(inst, date, endDate);
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- }
- },
-
- /* Get the date(s) for the first entry in a jQuery selection.
- @param target element - the target input field or division or span
- @return Date - the current date or
- Date[2] - the current dates for a range */
- _getDateDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst && !inst.inline)
- this._setDateFromField(inst);
- return (inst ? this._getDate(inst) : null);
- },
-
- /* Handle keystrokes. */
- _doKeyDown: function(event) {
- var inst = $.datepicker._getInst(event.target);
- var handled = true;
- var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
- inst._keyEvent = true;
- if ($.datepicker._datepickerShowing)
- switch (event.keyCode) {
- case 9: $.datepicker._hideDatepicker(null, '');
- break; // hide on tab out
- case 13: var sel = $('td.' + $.datepicker._dayOverClass +
- ', td.' + $.datepicker._currentClass, inst.dpDiv);
- if (sel[0])
- $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
- else
- $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- return false; // don't submit the form
- break; // select the value on enter
- case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- break; // hide on escape
- case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // previous month/year on page up/+ ctrl
- case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // next month/year on page down/+ ctrl
- case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // clear on ctrl or command +end
- case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // current on ctrl or command +home
- case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // -1 day on ctrl or command +left
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +left on Mac
- break;
- case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // -1 week on ctrl or command +up
- case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // +1 day on ctrl or command +right
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +right
- break;
- case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // +1 week on ctrl or command +down
- default: handled = false;
- }
- else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
- $.datepicker._showDatepicker(this);
- else {
- handled = false;
- }
- if (handled) {
- event.preventDefault();
- event.stopPropagation();
- }
- },
-
- /* Filter entered characters - based on date format. */
- _doKeyPress: function(event) {
- var inst = $.datepicker._getInst(event.target);
- if ($.datepicker._get(inst, 'constrainInput')) {
- var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
- var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
- return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
- }
- },
-
- /* Pop-up the date picker for a given input field.
- @param input element - the input field attached to the date picker or
- event - if triggered by focus */
- _showDatepicker: function(input) {
- input = input.target || input;
- if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
- input = $('input', input.parentNode)[0];
- if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
- return;
- var inst = $.datepicker._getInst(input);
- var beforeShow = $.datepicker._get(inst, 'beforeShow');
- extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
- $.datepicker._hideDatepicker(null, '');
- $.datepicker._lastInput = input;
- $.datepicker._setDateFromField(inst);
- if ($.datepicker._inDialog) // hide cursor
- input.value = '';
- if (!$.datepicker._pos) { // position below input
- $.datepicker._pos = $.datepicker._findPos(input);
- $.datepicker._pos[1] += input.offsetHeight; // add the height
- }
- var isFixed = false;
- $(input).parents().each(function() {
- isFixed |= $(this).css('position') == 'fixed';
- return !isFixed;
- });
- if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
- $.datepicker._pos[0] -= document.documentElement.scrollLeft;
- $.datepicker._pos[1] -= document.documentElement.scrollTop;
- }
- var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
- $.datepicker._pos = null;
- inst.rangeStart = null;
- // determine sizing offscreen
- inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
- $.datepicker._updateDatepicker(inst);
- // fix width for dynamic number of date pickers
- // and adjust position before showing
- offset = $.datepicker._checkOffset(inst, offset, isFixed);
- inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
- 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
- left: offset.left + 'px', top: offset.top + 'px'});
- if (!inst.inline) {
- var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
- var duration = $.datepicker._get(inst, 'duration');
- var postProcess = function() {
- $.datepicker._datepickerShowing = true;
- if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
- $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4});
- };
- if ($.effects && $.effects[showAnim])
- inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
- else
- inst.dpDiv[showAnim](duration, postProcess);
- if (duration == '')
- postProcess();
- if (inst.input[0].type != 'hidden')
- inst.input[0].focus();
- $.datepicker._curInst = inst;
- }
- },
-
- /* Generate the date picker content. */
- _updateDatepicker: function(inst) {
- var dims = {width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4};
- var self = this;
- inst.dpDiv.empty().append(this._generateHTML(inst))
- .find('iframe.ui-datepicker-cover').
- css({width: dims.width, height: dims.height})
- .end()
- .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
- .bind('mouseout', function(){
- $(this).removeClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
- })
- .bind('mouseover', function(){
- if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
- $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
- $(this).addClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
- }
- })
- .end()
- .find('.' + this._dayOverClass + ' a')
- .trigger('mouseover')
- .end();
- var numMonths = this._getNumberOfMonths(inst);
- var cols = numMonths[1];
- var width = 17;
- if (cols > 1) {
- inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
- } else {
- inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
- }
- inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
- 'Class']('ui-datepicker-multi');
- inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
- 'Class']('ui-datepicker-rtl');
- if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
- $(inst.input[0]).focus();
- },
-
- /* Check positioning to remain on screen. */
- _checkOffset: function(inst, offset, isFixed) {
- var dpWidth = inst.dpDiv.outerWidth();
- var dpHeight = inst.dpDiv.outerHeight();
- var inputWidth = inst.input ? inst.input.outerWidth() : 0;
- var inputHeight = inst.input ? inst.input.outerHeight() : 0;
- var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
- var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
-
- offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
- offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
- offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
-
- // now check if datepicker is showing outside window viewport - move to a better place if so.
- offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
- offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
-
- return offset;
- },
-
- /* Find an object's position on the screen. */
- _findPos: function(obj) {
- while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
- obj = obj.nextSibling;
- }
- var position = $(obj).offset();
- return [position.left, position.top];
- },
-
- /* Hide the date picker from view.
- @param input element - the input field attached to the date picker
- @param duration string - the duration over which to close the date picker */
- _hideDatepicker: function(input, duration) {
- var inst = this._curInst;
- if (!inst || (input && inst != $.data(input, PROP_NAME)))
- return;
- if (inst.stayOpen)
- this._selectDate('#' + inst.id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- inst.stayOpen = false;
- if (this._datepickerShowing) {
- duration = (duration != null ? duration : this._get(inst, 'duration'));
- var showAnim = this._get(inst, 'showAnim');
- var postProcess = function() {
- $.datepicker._tidyDialog(inst);
- };
- if (duration != '' && $.effects && $.effects[showAnim])
- inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
- duration, postProcess);
- else
- inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
- (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
- if (duration == '')
- this._tidyDialog(inst);
- var onClose = this._get(inst, 'onClose');
- if (onClose)
- onClose.apply((inst.input ? inst.input[0] : null),
- [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
- this._datepickerShowing = false;
- this._lastInput = null;
- if (this._inDialog) {
- this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
- if ($.blockUI) {
- $.unblockUI();
- $('body').append(this.dpDiv);
- }
- }
- this._inDialog = false;
- }
- this._curInst = null;
- },
-
- /* Tidy up after a dialog display. */
- _tidyDialog: function(inst) {
- inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
- },
-
- /* Close date picker if clicked elsewhere. */
- _checkExternalClick: function(event) {
- if (!$.datepicker._curInst)
- return;
- var $target = $(event.target);
- if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
- !$target.hasClass($.datepicker.markerClassName) &&
- !$target.hasClass($.datepicker._triggerClass) &&
- $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
- $.datepicker._hideDatepicker(null, '');
- },
-
- /* Adjust one of the date sub-fields. */
- _adjustDate: function(id, offset, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._isDisabledDatepicker(target[0])) {
- return;
- }
- this._adjustInstDate(inst, offset +
- (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
- period);
- this._updateDatepicker(inst);
- },
-
- /* Action for current link. */
- _gotoToday: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
- inst.selectedDay = inst.currentDay;
- inst.drawMonth = inst.selectedMonth = inst.currentMonth;
- inst.drawYear = inst.selectedYear = inst.currentYear;
- }
- else {
- var date = new Date();
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- }
- this._notifyChange(inst);
- this._adjustDate(target);
- },
-
- /* Action for selecting a new month/year. */
- _selectMonthYear: function(id, select, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst._selectingMonthYear = false;
- inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
- inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
- parseInt(select.options[select.selectedIndex].value,10);
- this._notifyChange(inst);
- this._adjustDate(target);
- },
-
- /* Restore input focus after not changing month/year. */
- _clickMonthYear: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (inst.input && inst._selectingMonthYear && !$.browser.msie)
- inst.input[0].focus();
- inst._selectingMonthYear = !inst._selectingMonthYear;
- },
-
- /* Action for selecting a day. */
- _selectDay: function(id, month, year, td) {
- var target = $(id);
- if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
- return;
- }
- var inst = this._getInst(target[0]);
- inst.selectedDay = inst.currentDay = $('a', td).html();
- inst.selectedMonth = inst.currentMonth = month;
- inst.selectedYear = inst.currentYear = year;
- if (inst.stayOpen) {
- inst.endDay = inst.endMonth = inst.endYear = null;
- }
- this._selectDate(id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- if (inst.stayOpen) {
- inst.rangeStart = this._daylightSavingAdjust(
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
- this._updateDatepicker(inst);
- }
- },
-
- /* Erase the input field and hide the date picker. */
- _clearDate: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst.stayOpen = false;
- inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
- this._selectDate(target, '');
- },
-
- /* Update the input field with the selected date. */
- _selectDate: function(id, dateStr) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
- if (inst.input)
- inst.input.val(dateStr);
- this._updateAlternate(inst);
- var onSelect = this._get(inst, 'onSelect');
- if (onSelect)
- onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
- else if (inst.input)
- inst.input.trigger('change'); // fire the change event
- if (inst.inline)
- this._updateDatepicker(inst);
- else if (!inst.stayOpen) {
- this._hideDatepicker(null, this._get(inst, 'duration'));
- this._lastInput = inst.input[0];
- if (typeof(inst.input[0]) != 'object')
- inst.input[0].focus(); // restore focus
- this._lastInput = null;
- }
- },
-
- /* Update any alternate field to synchronise with the main field. */
- _updateAlternate: function(inst) {
- var altField = this._get(inst, 'altField');
- if (altField) { // update alternate field too
- var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
- var date = this._getDate(inst);
- dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
- $(altField).each(function() { $(this).val(dateStr); });
- }
- },
-
- /* Set as beforeShowDay function to prevent selection of weekends.
- @param date Date - the date to customise
- @return [boolean, string] - is this date selectable?, what is its CSS class? */
- noWeekends: function(date) {
- var day = date.getDay();
- return [(day > 0 && day < 6), ''];
- },
-
- /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
- @param date Date - the date to get the week for
- @return number - the number of the week within the year that contains this date */
- iso8601Week: function(date) {
- var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
- var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
- var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
- firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
- if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
- checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
- return $.datepicker.iso8601Week(checkDate);
- } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
- firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
- if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
- return 1;
- }
- }
- return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
- },
-
- /* Parse a string value into a date object.
- See formatDate below for the possible formats.
-
- @param format string - the expected format of the date
- @param value string - the date in the above format
- @param settings Object - attributes include:
- shortYearCutoff number - the cutoff year for determining the century (optional)
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return Date - the extracted date value or null if value is blank */
- parseDate: function (format, value, settings) {
- if (format == null || value == null)
- throw 'Invalid arguments';
- value = (typeof value == 'object' ? value.toString() : value + '');
- if (value == '')
- return null;
- var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- var year = -1;
- var month = -1;
- var day = -1;
- var doy = -1;
- var literal = false;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Extract a number from the string value
- var getNumber = function(match) {
- lookAhead(match);
- var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
- var size = origSize;
- var num = 0;
- while (size > 0 && iValue < value.length &&
- value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
- num = num * 10 + parseInt(value.charAt(iValue++),10);
- size--;
- }
- if (size == origSize)
- throw 'Missing number at position ' + iValue;
- return num;
- };
- // Extract a name from the string value and convert to an index
- var getName = function(match, shortNames, longNames) {
- var names = (lookAhead(match) ? longNames : shortNames);
- var size = 0;
- for (var j = 0; j < names.length; j++)
- size = Math.max(size, names[j].length);
- var name = '';
- var iInit = iValue;
- while (size > 0 && iValue < value.length) {
- name += value.charAt(iValue++);
- for (var i = 0; i < names.length; i++)
- if (name == names[i])
- return i + 1;
- size--;
- }
- throw 'Unknown name at position ' + iInit;
- };
- // Confirm that a literal character matches the string value
- var checkLiteral = function() {
- if (value.charAt(iValue) != format.charAt(iFormat))
- throw 'Unexpected literal at position ' + iValue;
- iValue++;
- };
- var iValue = 0;
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- checkLiteral();
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- day = getNumber('d');
- break;
- case 'D':
- getName('D', dayNamesShort, dayNames);
- break;
- case 'o':
- doy = getNumber('o');
- break;
- case 'm':
- month = getNumber('m');
- break;
- case 'M':
- month = getName('M', monthNamesShort, monthNames);
- break;
- case 'y':
- year = getNumber('y');
- break;
- case '@':
- var date = new Date(getNumber('@'));
- year = date.getFullYear();
- month = date.getMonth() + 1;
- day = date.getDate();
- break;
- case "'":
- if (lookAhead("'"))
- checkLiteral();
- else
- literal = true;
- break;
- default:
- checkLiteral();
- }
- }
- if (year == -1)
- year = new Date().getFullYear();
- else if (year < 100)
- year += new Date().getFullYear() - new Date().getFullYear() % 100 +
- (year <= shortYearCutoff ? 0 : -100);
- if (doy > -1) {
- month = 1;
- day = doy;
- do {
- var dim = this._getDaysInMonth(year, month - 1);
- if (day <= dim)
- break;
- month++;
- day -= dim;
- } while (true);
- }
- var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
- if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
- throw 'Invalid date'; // E.g. 31/02/*
- return date;
- },
-
- /* Standard date formats. */
- ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
- COOKIE: 'D, dd M yy',
- ISO_8601: 'yy-mm-dd',
- RFC_822: 'D, d M y',
- RFC_850: 'DD, dd-M-y',
- RFC_1036: 'D, d M y',
- RFC_1123: 'D, d M yy',
- RFC_2822: 'D, d M yy',
- RSS: 'D, d M y', // RFC 822
- TIMESTAMP: '@',
- W3C: 'yy-mm-dd', // ISO 8601
-
- /* Format a date object into a string value.
- The format can be combinations of the following:
- d - day of month (no leading zero)
- dd - day of month (two digit)
- o - day of year (no leading zeros)
- oo - day of year (three digit)
- D - day name short
- DD - day name long
- m - month of year (no leading zero)
- mm - month of year (two digit)
- M - month name short
- MM - month name long
- y - year (two digit)
- yy - year (four digit)
- @ - Unix timestamp (ms since 01/01/1970)
- '...' - literal text
- '' - single quote
-
- @param format string - the desired format of the date
- @param date Date - the date value to format
- @param settings Object - attributes include:
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return string - the date in the above format */
- formatDate: function (format, date, settings) {
- if (!date)
- return '';
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Format a number, with leading zero if necessary
- var formatNumber = function(match, value, len) {
- var num = '' + value;
- if (lookAhead(match))
- while (num.length < len)
- num = '0' + num;
- return num;
- };
- // Format a name, short or long as requested
- var formatName = function(match, value, shortNames, longNames) {
- return (lookAhead(match) ? longNames[value] : shortNames[value]);
- };
- var output = '';
- var literal = false;
- if (date)
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- output += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- output += formatNumber('d', date.getDate(), 2);
- break;
- case 'D':
- output += formatName('D', date.getDay(), dayNamesShort, dayNames);
- break;
- case 'o':
- var doy = date.getDate();
- for (var m = date.getMonth() - 1; m >= 0; m--)
- doy += this._getDaysInMonth(date.getFullYear(), m);
- output += formatNumber('o', doy, 3);
- break;
- case 'm':
- output += formatNumber('m', date.getMonth() + 1, 2);
- break;
- case 'M':
- output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
- break;
- case 'y':
- output += (lookAhead('y') ? date.getFullYear() :
- (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
- break;
- case '@':
- output += date.getTime();
- break;
- case "'":
- if (lookAhead("'"))
- output += "'";
- else
- literal = true;
- break;
- default:
- output += format.charAt(iFormat);
- }
- }
- return output;
- },
-
- /* Extract all possible characters from the date format. */
- _possibleChars: function (format) {
- var chars = '';
- var literal = false;
- for (var iFormat = 0; iFormat < format.length; iFormat++)
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- chars += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd': case 'm': case 'y': case '@':
- chars += '0123456789';
- break;
- case 'D': case 'M':
- return null; // Accept anything
- case "'":
- if (lookAhead("'"))
- chars += "'";
- else
- literal = true;
- break;
- default:
- chars += format.charAt(iFormat);
- }
- return chars;
- },
-
- /* Get a setting value, defaulting if necessary. */
- _get: function(inst, name) {
- return inst.settings[name] !== undefined ?
- inst.settings[name] : this._defaults[name];
- },
-
- /* Parse existing date and initialise date picker. */
- _setDateFromField: function(inst) {
- var dateFormat = this._get(inst, 'dateFormat');
- var dates = inst.input ? inst.input.val() : null;
- inst.endDay = inst.endMonth = inst.endYear = null;
- var date = defaultDate = this._getDefaultDate(inst);
- var settings = this._getFormatConfig(inst);
- try {
- date = this.parseDate(dateFormat, dates, settings) || defaultDate;
- } catch (event) {
- this.log(event);
- date = defaultDate;
- }
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- inst.currentDay = (dates ? date.getDate() : 0);
- inst.currentMonth = (dates ? date.getMonth() : 0);
- inst.currentYear = (dates ? date.getFullYear() : 0);
- this._adjustInstDate(inst);
- },
-
- /* Retrieve the default date shown on opening. */
- _getDefaultDate: function(inst) {
- var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- return date;
- },
-
- /* A date may be specified as an exact value or a relative one. */
- _determineDate: function(date, defaultDate) {
- var offsetNumeric = function(offset) {
- var date = new Date();
- date.setDate(date.getDate() + offset);
- return date;
- };
- var offsetString = function(offset, getDaysInMonth) {
- var date = new Date();
- var year = date.getFullYear();
- var month = date.getMonth();
- var day = date.getDate();
- var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
- var matches = pattern.exec(offset);
- while (matches) {
- switch (matches[2] || 'd') {
- case 'd' : case 'D' :
- day += parseInt(matches[1],10); break;
- case 'w' : case 'W' :
- day += parseInt(matches[1],10) * 7; break;
- case 'm' : case 'M' :
- month += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- case 'y': case 'Y' :
- year += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- }
- matches = pattern.exec(offset);
- }
- return new Date(year, month, day);
- };
- date = (date == null ? defaultDate :
- (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
- (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
- date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
- if (date) {
- date.setHours(0);
- date.setMinutes(0);
- date.setSeconds(0);
- date.setMilliseconds(0);
- }
- return this._daylightSavingAdjust(date);
- },
-
- /* Handle switch to/from daylight saving.
- Hours may be non-zero on daylight saving cut-over:
- > 12 when midnight changeover, but then cannot generate
- midnight datetime, so jump to 1AM, otherwise reset.
- @param date (Date) the date to check
- @return (Date) the corrected date */
- _daylightSavingAdjust: function(date) {
- if (!date) return null;
- date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
- return date;
- },
-
- /* Set the date(s) directly. */
- _setDate: function(inst, date, endDate) {
- var clear = !(date);
- var origMonth = inst.selectedMonth;
- var origYear = inst.selectedYear;
- date = this._determineDate(date, new Date());
- inst.selectedDay = inst.currentDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
- if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
- this._notifyChange(inst);
- this._adjustInstDate(inst);
- if (inst.input) {
- inst.input.val(clear ? '' : this._formatDate(inst));
- }
- },
-
- /* Retrieve the date(s) directly. */
- _getDate: function(inst) {
- var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
- this._daylightSavingAdjust(new Date(
- inst.currentYear, inst.currentMonth, inst.currentDay)));
- return startDate;
- },
-
- /* Generate the HTML for the current state of the date picker. */
- _generateHTML: function(inst) {
- var today = new Date();
- today = this._daylightSavingAdjust(
- new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
- var isRTL = this._get(inst, 'isRTL');
- var showButtonPanel = this._get(inst, 'showButtonPanel');
- var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
- var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
- var numMonths = this._getNumberOfMonths(inst);
- var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
- var stepMonths = this._get(inst, 'stepMonths');
- var stepBigMonths = this._get(inst, 'stepBigMonths');
- var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
- var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- var drawMonth = inst.drawMonth - showCurrentAtPos;
- var drawYear = inst.drawYear;
- if (drawMonth < 0) {
- drawMonth += 12;
- drawYear--;
- }
- if (maxDate) {
- var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
- maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
- maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
- while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
- drawMonth--;
- if (drawMonth < 0) {
- drawMonth = 11;
- drawYear--;
- }
- }
- }
- inst.drawMonth = drawMonth;
- inst.drawYear = drawYear;
- var prevText = this._get(inst, 'prevText');
- prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
- this._getFormatConfig(inst)));
- var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
- ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
- var nextText = this._get(inst, 'nextText');
- nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
- this._getFormatConfig(inst)));
- var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
- ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
- var currentText = this._get(inst, 'currentText');
- var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
- currentText = (!navigationAsDateFormat ? currentText :
- this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
- var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
- var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
- (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
- '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
- var firstDay = parseInt(this._get(inst, 'firstDay'),10);
- firstDay = (isNaN(firstDay) ? 0 : firstDay);
- var dayNames = this._get(inst, 'dayNames');
- var dayNamesShort = this._get(inst, 'dayNamesShort');
- var dayNamesMin = this._get(inst, 'dayNamesMin');
- var monthNames = this._get(inst, 'monthNames');
- var monthNamesShort = this._get(inst, 'monthNamesShort');
- var beforeShowDay = this._get(inst, 'beforeShowDay');
- var showOtherMonths = this._get(inst, 'showOtherMonths');
- var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
- var endDate = inst.endDay ? this._daylightSavingAdjust(
- new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
- var defaultDate = this._getDefaultDate(inst);
- var html = '';
- for (var row = 0; row < numMonths[0]; row++) {
- var group = '';
- for (var col = 0; col < numMonths[1]; col++) {
- var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
- var cornerClass = ' ui-corner-all';
- var calender = '';
- if (isMultiMonth) {
- calender += '<div class="ui-datepicker-group ui-datepicker-group-';
- switch (col) {
- case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
- case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
- default: calender += 'middle'; cornerClass = ''; break;
- }
- calender += '">';
- }
- calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
- (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
- (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
- this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
- '</div><table class="ui-datepicker-calendar"><thead>' +
- '<tr>';
- var thead = '';
- for (var dow = 0; dow < 7; dow++) { // days of the week
- var day = (dow + firstDay) % 7;
- thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
- '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
- }
- calender += thead + '</tr></thead><tbody>';
- var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
- if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
- inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
- var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
- var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
- var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
- for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
- calender += '<tr>';
- var tbody = '';
- for (var dow = 0; dow < 7; dow++) { // create date picker days
- var daySettings = (beforeShowDay ?
- beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
- var otherMonth = (printDate.getMonth() != drawMonth);
- var unselectable = otherMonth || !daySettings[0] ||
- (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
- tbody += '<td class="' +
- ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
- (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
- ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
- (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
- // or defaultDate is current printedDate and defaultDate is selectedDate
- ' ' + this._dayOverClass : '') + // highlight selected day
- (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
- (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ' + this._currentClass : '') + // highlight selected day
- (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
- ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
- (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
- inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
- (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
- (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
- (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ui-state-active' : '') + // highlight selected day
- '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
- printDate.setDate(printDate.getDate() + 1);
- printDate = this._daylightSavingAdjust(printDate);
- }
- calender += tbody + '</tr>';
- }
- drawMonth++;
- if (drawMonth > 11) {
- drawMonth = 0;
- drawYear++;
- }
- calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
- ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
- group += calender;
- }
- html += group;
- }
- html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
- '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
- inst._keyEvent = false;
- return html;
- },
-
- /* Generate the month and year header. */
- _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, secondary, monthNames, monthNamesShort) {
- minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
- var changeMonth = this._get(inst, 'changeMonth');
- var changeYear = this._get(inst, 'changeYear');
- var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
- var html = '<div class="ui-datepicker-title">';
- var monthHtml = '';
- // month selection
- if (secondary || !changeMonth)
- monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
- else {
- var inMinYear = (minDate && minDate.getFullYear() == drawYear);
- var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
- monthHtml += '<select class="ui-datepicker-month" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (var month = 0; month < 12; month++) {
- if ((!inMinYear || month >= minDate.getMonth()) &&
- (!inMaxYear || month <= maxDate.getMonth()))
- monthHtml += '<option value="' + month + '"' +
- (month == drawMonth ? ' selected="selected"' : '') +
- '>' + monthNamesShort[month] + '</option>';
- }
- monthHtml += '</select>';
- }
- if (!showMonthAfterYear)
- html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
- // year selection
- if (secondary || !changeYear)
- html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
- else {
- // determine range of years to display
- var years = this._get(inst, 'yearRange').split(':');
- var year = 0;
- var endYear = 0;
- if (years.length != 2) {
- year = drawYear - 10;
- endYear = drawYear + 10;
- } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
- year = drawYear + parseInt(years[0], 10);
- endYear = drawYear + parseInt(years[1], 10);
- } else {
- year = parseInt(years[0], 10);
- endYear = parseInt(years[1], 10);
- }
- year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
- endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
- html += '<select class="ui-datepicker-year" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (; year <= endYear; year++) {
- html += '<option value="' + year + '"' +
- (year == drawYear ? ' selected="selected"' : '') +
- '>' + year + '</option>';
- }
- html += '</select>';
- }
- if (showMonthAfterYear)
- html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
- html += '</div>'; // Close datepicker_header
- return html;
- },
-
- /* Adjust one of the date sub-fields. */
- _adjustInstDate: function(inst, offset, period) {
- var year = inst.drawYear + (period == 'Y' ? offset : 0);
- var month = inst.drawMonth + (period == 'M' ? offset : 0);
- var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
- (period == 'D' ? offset : 0);
- var date = this._daylightSavingAdjust(new Date(year, month, day));
- // ensure it is within the bounds set
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- if (period == 'M' || period == 'Y')
- this._notifyChange(inst);
- },
-
- /* Notify change of month/year. */
- _notifyChange: function(inst) {
- var onChange = this._get(inst, 'onChangeMonthYear');
- if (onChange)
- onChange.apply((inst.input ? inst.input[0] : null),
- [inst.selectedYear, inst.selectedMonth + 1, inst]);
- },
-
- /* Determine the number of months to show. */
- _getNumberOfMonths: function(inst) {
- var numMonths = this._get(inst, 'numberOfMonths');
- return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
- },
-
- /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
- _getMinMaxDate: function(inst, minMax, checkRange) {
- var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
- return (!checkRange || !inst.rangeStart ? date :
- (!date || inst.rangeStart > date ? inst.rangeStart : date));
- },
-
- /* Find the number of days in a given month. */
- _getDaysInMonth: function(year, month) {
- return 32 - new Date(year, month, 32).getDate();
- },
-
- /* Find the day of the week of the first of a month. */
- _getFirstDayOfMonth: function(year, month) {
- return new Date(year, month, 1).getDay();
- },
-
- /* Determines if we should allow a "next/prev" month display change. */
- _canAdjustMonth: function(inst, offset, curYear, curMonth) {
- var numMonths = this._getNumberOfMonths(inst);
- var date = this._daylightSavingAdjust(new Date(
- curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
- if (offset < 0)
- date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
- return this._isInRange(inst, date);
- },
-
- /* Is the given date in the accepted range? */
- _isInRange: function(inst, date) {
- // during range selection, use minimum of selected date and range start
- var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
- new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
- newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
- var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
- },
-
- /* Provide the configuration settings for formatting/parsing. */
- _getFormatConfig: function(inst) {
- var shortYearCutoff = this._get(inst, 'shortYearCutoff');
- shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
- new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
- return {shortYearCutoff: shortYearCutoff,
- dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
- monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
- },
-
- /* Format the given date for display. */
- _formatDate: function(inst, day, month, year) {
- if (!day) {
- inst.currentDay = inst.selectedDay;
- inst.currentMonth = inst.selectedMonth;
- inst.currentYear = inst.selectedYear;
- }
- var date = (day ? (typeof day == 'object' ? day :
- this._daylightSavingAdjust(new Date(year, month, day))) :
- this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
- }
-});
-
-/* jQuery extend now ignores nulls! */
-function extendRemove(target, props) {
- $.extend(target, props);
- for (var name in props)
- if (props[name] == null || props[name] == undefined)
- target[name] = props[name];
- return target;
-};
-
-/* Determine whether an object is an array. */
-function isArray(a) {
- return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
- (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
-
-/* Invoke the datepicker functionality.
- @param options string - a command, optionally followed by additional parameters or
- Object - settings for attaching new datepicker functionality
- @return jQuery object */
-$.fn.datepicker = function(options){
-
- /* Initialise the date picker. */
- if (!$.datepicker.initialized) {
- $(document).mousedown($.datepicker._checkExternalClick).
- find('body').append($.datepicker.dpDiv);
- $.datepicker.initialized = true;
- }
-
- var otherArgs = Array.prototype.slice.call(arguments, 1);
- if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- return this.each(function() {
- typeof options == 'string' ?
- $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this].concat(otherArgs)) :
- $.datepicker._attachDatepicker(this, options);
- });
-};
-
-$.datepicker = new Datepicker(); // singleton instance
-$.datepicker.initialized = false;
-$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "1.7.1";
-
-// Workaround for #4055
-// Add another global to avoid noConflict issues with inline event handlers
-window.DP_jQuery = $;
-
-})(jQuery);
-/*
- * jQuery UI Progressbar 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.progressbar", {
-
- _init: function() {
-
- this.element
- .addClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .attr({
- role: "progressbar",
- "aria-valuemin": this._valueMin(),
- "aria-valuemax": this._valueMax(),
- "aria-valuenow": this._value()
- });
-
- this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
-
- this._refreshValue();
-
- },
-
- destroy: function() {
-
- this.element
- .removeClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeAttr("role")
- .removeAttr("aria-valuemin")
- .removeAttr("aria-valuemax")
- .removeAttr("aria-valuenow")
- .removeData("progressbar")
- .unbind(".progressbar");
-
- this.valueDiv.remove();
-
- $.widget.prototype.destroy.apply(this, arguments);
-
- },
-
- value: function(newValue) {
- arguments.length && this._setData("value", newValue);
- return this._value();
- },
-
- _setData: function(key, value) {
-
- switch (key) {
- case 'value':
- this.options.value = value;
- this._refreshValue();
- this._trigger('change', null, {});
- break;
- }
-
- $.widget.prototype._setData.apply(this, arguments);
-
- },
-
- _value: function() {
-
- var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
-
- },
-
- _valueMin: function() {
- var valueMin = 0;
- return valueMin;
- },
-
- _valueMax: function() {
- var valueMax = 100;
- return valueMax;
- },
-
- _refreshValue: function() {
- var value = this.value();
- this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
- this.valueDiv.width(value + '%');
- this.element.attr("aria-valuenow", value);
- }
-
-});
-
-$.extend($.ui.progressbar, {
- version: "1.7.1",
- defaults: {
- value: 0
- }
-});
-
-})(jQuery);
-/*
- * jQuery UI Effects 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/
- */
-;jQuery.effects || (function($) {
-
-$.effects = {
- version: "1.7.1",
-
- // Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
- }
- },
-
- // Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
- }
- },
-
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
- return mode;
- },
-
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
- var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
- };
- return {x: x, y: y};
- },
-
- // Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
-
- //if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent();
-
- //Cache width,height and float properties of the element, and create a wrapper around it
- var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
- element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
- var wrapper = element.parent();
-
- //Transfer the positioning of the element to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative'} );
- } else {
- var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
- var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
- wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
- element.css({position: 'relative', top: 0, left: 0 });
- }
-
- wrapper.css(props);
- return wrapper;
- },
-
- removeWrapper: function(element) {
- if (element.parent().is('.ui-effects-wrapper'))
- return element.parent().replaceWith(element);
- return element;
- },
-
- setTransition: function(element, list, factor, value) {
- value = value || {};
- $.each(list, function(i, x){
- unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
- });
- return value;
- },
-
- //Base function to animate from one class to another in a seamless transition
- animateClass: function(value, duration, easing, callback) {
-
- var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
- var ea = (typeof easing == "string" ? easing : null);
-
- return this.each(function() {
-
- var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
- if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
- if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
-
- //Let's get a style offset
- var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
- var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
- if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
-
- // The main function to form the object for animation
- for(var n in newStyle) {
- if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
- && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
- && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
- && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
- && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
- ) offset[n] = newStyle[n];
- }
-
- that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
- // Change style attribute back to original. For stupid IE, we need to clear the damn object.
- if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
- if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
- if(cb) cb.apply(this, arguments);
- });
-
- });
- }
-};
-
-
-function _normalizeArguments(a, m) {
-
- var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
- var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
- speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
- var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
-
- return [a[0], o, speed, callback];
-
-}
-
-//Extend the methods of jQuery
-$.fn.extend({
-
- //Save old methods
- _show: $.fn.show,
- _hide: $.fn.hide,
- __toggle: $.fn.toggle,
- _addClass: $.fn.addClass,
- _removeClass: $.fn.removeClass,
- _toggleClass: $.fn.toggleClass,
-
- // New effect methods
- effect: function(fx, options, speed, callback) {
- return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
- },
-
- show: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._show.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
- }
- },
-
- hide: function() {
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
- return this._hide.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
- }
- },
-
- toggle: function(){
- if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
- return this.__toggle.apply(this, arguments);
- else {
- return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
- }
- },
-
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
- },
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
- },
- toggleClass: function(classNames,speed,easing,callback) {
- return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
- },
- morph: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
- },
- switchClass: function() {
- return this.morph.apply(this, arguments);
- },
-
- // helper functions
- cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
- });
- return val;
- }
-});
-
-/*
- * jQuery Color Animations
- * Copyright 2007 John Resig
- * Released under the MIT and GPL licenses.
- */
-
-// We override the animation for all of these color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
- $.fx.step[attr] = function(fx) {
- if ( fx.state == 0 ) {
- fx.start = getColor( fx.elem, attr );
- fx.end = getRGB( fx.end );
- }
-
- fx.elem.style[attr] = "rgb(" + [
- Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
- Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
- ].join(",") + ")";
- };
-});
-
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
-
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
-
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
-
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
-
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
-
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
-
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
-
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
-
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
-}
-
-function getColor(elem, attr) {
- var color;
-
- do {
- color = $.curCSS(elem, attr);
-
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
-
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
-
- return getRGB(color);
-};
-
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
-};
-
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
-
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
- },
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
- },
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
- },
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
- },
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
- },
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
- },
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
- },
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- },
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
- },
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
- },
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
- },
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
- },
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
- },
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
- },
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
- } else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
- }
- },
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
- }
-});
-
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
-
-})(jQuery);
-/*
- * jQuery UI Effects Blind 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.blind = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'vertical') ? 'height' : 'width';
- var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
- if(mode == 'show') wrapper.css(ref, 0); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = mode == 'show' ? distance : 0;
-
- // Animate
- wrapper.animate(animation, o.duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Bounce 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.bounce = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'up'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 5; // Default # of times
- var speed = o.duration || 250; // Default speed per bounce
- if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- if (mode == 'hide') distance = distance / (times * 2);
- if (mode != 'hide') times--;
-
- // Animate
- if (mode == 'show') { // Show Bounce
- var animation = {opacity: 1};
- animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation, speed / 2, o.options.easing);
- distance = distance / 2;
- times--;
- };
- for (var i = 0; i < times; i++) { // Bounces
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
- distance = (mode == 'hide') ? distance * 2 : distance / 2;
- };
- if (mode == 'hide') { // Last Bounce
- var animation = {opacity: 0};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- el.animate(animation, speed / 2, o.options.easing, function(){
- el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Clip 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.clip = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','height','width'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var animate = el[0].tagName == 'IMG' ? wrapper : el;
- var ref = {
- size: (direction == 'vertical') ? 'height' : 'width',
- position: (direction == 'vertical') ? 'top' : 'left'
- };
- var distance = (direction == 'vertical') ? animate.height() : animate.width();
- if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
-
- // Animation
- var animation = {};
- animation[ref.size] = mode == 'show' ? distance : 0;
- animation[ref.position] = mode == 'show' ? 0 : distance / 2;
-
- // Animate
- animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Drop 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.drop = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','opacity'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {opacity: mode == 'show' ? 1 : 0};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Explode 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.explode = function(o) {
-
- return this.queue(function() {
-
- var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-
- o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
- var el = $(this).show().css('visibility', 'hidden');
- var offset = el.offset();
-
- //Substract the margins - not fixing the problem yet.
- offset.top -= parseInt(el.css("marginTop"),10) || 0;
- offset.left -= parseInt(el.css("marginLeft"),10) || 0;
-
- var width = el.outerWidth(true);
- var height = el.outerHeight(true);
-
- for(var i=0;i<rows;i++) { // =
- for(var j=0;j<cells;j++) { // ||
- el
- .clone()
- .appendTo('body')
- .wrap('<div></div>')
- .css({
- position: 'absolute',
- visibility: 'visible',
- left: -j*(width/cells),
- top: -i*(height/rows)
- })
- .parent()
- .addClass('ui-effects-explode')
- .css({
- position: 'absolute',
- overflow: 'hidden',
- width: width/cells,
- height: height/rows,
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
- opacity: o.options.mode == 'show' ? 0 : 1
- }).animate({
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
- opacity: o.options.mode == 'show' ? 1 : 0
- }, o.duration || 500);
- }
- }
-
- // Set a timeout, to call the callback approx. when the other animations have finished
- setTimeout(function() {
-
- o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
- if(o.callback) o.callback.apply(el[0]); // Callback
- el.dequeue();
-
- $('div.ui-effects-explode').remove();
-
- }, o.duration || 500);
-
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Fold 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Fold
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.fold = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var size = o.options.size || 15; // Default fold size
- var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var widthFirst = ((mode == 'show') != horizFirst);
- var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
- var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
- var percent = /([0-9]+)%/.exec(size);
- if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
- if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
-
- // Animation
- var animation1 = {}, animation2 = {};
- animation1[ref[0]] = mode == 'show' ? distance[0] : size;
- animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
-
- // Animate
- wrapper.animate(animation1, duration, o.options.easing)
- .animate(animation2, duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Highlight 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.highlight = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var color = o.options.color || "#ffff99"; // Default highlight color
- var oldColor = el.css("backgroundColor");
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
-
- // Animation
- var animation = {backgroundColor: oldColor };
- if (mode == "hide") animation['opacity'] = 0;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == "hide") el.hide();
- $.effects.restore(el, props);
- if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
- if(o.callback) o.callback.apply(this, arguments);
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Pulsate 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.pulsate = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var times = o.options.times || 5; // Default # of times
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- if (mode == 'hide') times--;
- if (el.is(':hidden')) { // Show fadeIn
- el.css('opacity', 0);
- el.show(); // Show
- el.animate({opacity: 1}, duration, o.options.easing);
- times = times-2;
- }
-
- // Animate
- for (var i = 0; i < times; i++) { // Pulsate
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
- };
- if (mode == 'hide') { // Last Pulse
- el.animate({opacity: 0}, duration, o.options.easing, function(){
- el.hide(); // Hide
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Scale 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.puff = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
- options.fade = true; // It's not a puff if it doesn't fade! :)
- var original = {height: el.height(), width: el.width()}; // Save original
-
- // Adjust
- var factor = percent / 100;
- el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
-
- // Animation
- options.from = el.from;
- options.percent = (mode == 'hide') ? percent : 100;
- options.mode = mode;
-
- // Animate
- el.effect('scale', options, o.duration, o.callback);
- el.dequeue();
- });
-
-};
-
-$.effects.scale = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
- var direction = o.options.direction || 'both'; // Set default axis
- var origin = o.options.origin; // The origin of the scaling
- if (mode != 'effect') { // Set default origin and restore for show/hide
- options.origin = origin || ['middle','center'];
- options.restore = true;
- }
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
-
- // Adjust
- var factor = { // Set scaling factor
- y: direction != 'horizontal' ? (percent / 100) : 1,
- x: direction != 'vertical' ? (percent / 100) : 1
- };
- el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
-
- if (o.options.fade) { // Fade option to support puff
- if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
- if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
- };
-
- // Animation
- options.from = el.from; options.to = el.to; options.mode = mode;
-
- // Animate
- el.effect('size', options, o.duration, o.callback);
- el.dequeue();
- });
-
-};
-
-$.effects.size = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
- var props1 = ['position','top','left','overflow','opacity']; // Always restore
- var props2 = ['width','height','overflow']; // Copy for children
- var cProps = ['fontSize'];
- var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
- var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var restore = o.options.restore || false; // Default restore
- var scale = o.options.scale || 'both'; // Default scale mode
- var origin = o.options.origin; // The origin of the sizing
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || original; // Default from state
- el.to = o.options.to || original; // Default to state
- // Adjust
- if (origin) { // Calculate baseline shifts
- var baseline = $.effects.getBaseline(origin, original);
- el.from.top = (original.height - el.from.height) * baseline.y;
- el.from.left = (original.width - el.from.width) * baseline.x;
- el.to.top = (original.height - el.to.height) * baseline.y;
- el.to.left = (original.width - el.to.width) * baseline.x;
- };
- var factor = { // Set scaling factor
- from: {y: el.from.height / original.height, x: el.from.width / original.width},
- to: {y: el.to.height / original.height, x: el.to.width / original.width}
- };
- if (scale == 'box' || scale == 'both') { // Scale the css box
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(vProps);
- el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- props = props.concat(hProps);
- el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
- el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
- };
- };
- if (scale == 'content' || scale == 'both') { // Scale the content
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(cProps);
- el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
- };
- };
- $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- el.css('overflow','hidden').css(el.from); // Shift
-
- // Animate
- if (scale == 'content' || scale == 'both') { // Scale the children
- vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
- hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
- props2 = props.concat(vProps).concat(hProps); // Concat
- el.find("*[width]").each(function(){
- child = $(this);
- if (restore) $.effects.save(child, props2);
- var c_original = {height: child.height(), width: child.width()}; // Save original
- child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
- child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
- child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
- child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
- };
- child.css(child.from); // Shift children
- child.animate(child.to, o.duration, o.options.easing, function(){
- if (restore) $.effects.restore(child, props2); // Restore children
- }); // Animate children
- });
- };
-
- // Animate
- el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Shake 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.shake = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'left'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 3; // Default # of times
- var speed = o.duration || o.options.duration || 140; // Default speed per shake
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-
- // Animation
- var animation = {}, animation1 = {}, animation2 = {};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
- animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
-
- // Animate
- el.animate(animation, speed, o.options.easing);
- for (var i = 1; i < times; i++) { // Shakes
- el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
- };
- el.animate(animation1, speed, o.options.easing).
- animate(animation, speed / 2, o.options.easing, function(){ // Last shake
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Slide 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.slide = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','left'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
- if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Transfer 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- * effects.core.js
- */
-(function($) {
-
-$.effects.transfer = function(o) {
- return this.queue(function() {
- var elem = $(this),
- target = $(o.options.to),
- endPosition = target.offset(),
- animation = {
- top: endPosition.top,
- left: endPosition.left,
- height: target.innerHeight(),
- width: target.innerWidth()
- },
- startPosition = elem.offset(),
- transfer = $('<div class="ui-effects-transfer"></div>')
- .appendTo(document.body)
- .addClass(o.options.className)
- .css({
- top: startPosition.top,
- left: startPosition.left,
- height: elem.innerHeight(),
- width: elem.innerWidth(),
- position: 'absolute'
- })
- .animate(animation, o.duration, o.options.easing, function() {
- transfer.remove();
- (o.callback && o.callback.apply(elem[0], arguments));
- elem.dequeue();
- });
- });
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Accordion 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.accordion", {
-
- _init: function() {
-
- var o = this.options, self = this;
- this.running = 0;
-
- // if the user set the alwaysOpen option on init
- // then we need to set the collapsible option
- // if they set both on init, collapsible will take priority
- if (o.collapsible == $.ui.accordion.defaults.collapsible &&
- o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
- o.collapsible = !o.alwaysOpen;
- }
-
- if ( o.navigation ) {
- var current = this.element.find("a").filter(o.navigationFilter);
- if ( current.length ) {
- if ( current.filter(o.header).length ) {
- this.active = current;
- } else {
- this.active = current.parent().parent().prev();
- current.addClass("ui-accordion-content-active");
- }
- }
- }
-
- this.element.addClass("ui-accordion ui-widget ui-helper-reset");
-
- // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
- if (this.element[0].nodeName == "UL") {
- this.element.children("li").addClass("ui-accordion-li-fix");
- }
-
- this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
- .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
- .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
- .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
- .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
-
- this.headers
- .next()
- .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
-
- this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
- this.active.next().addClass('ui-accordion-content-active');
-
- //Append icon elements
- $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
- this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
-
- // IE7-/Win - Extra vertical space in lists fixed
- if ($.browser.msie) {
- this.element.find('a').css('zoom', '1');
- }
-
- this.resize();
-
- //ARIA
- this.element.attr('role','tablist');
-
- this.headers
- .attr('role','tab')
- .bind('keydown', function(event) { return self._keydown(event); })
- .next()
- .attr('role','tabpanel');
-
- this.headers
- .not(this.active || "")
- .attr('aria-expanded','false')
- .attr("tabIndex", "-1")
- .next()
- .hide();
-
- // make sure at least one header is in the tab order
- if (!this.active.length) {
- this.headers.eq(0).attr('tabIndex','0');
- } else {
- this.active
- .attr('aria-expanded','true')
- .attr('tabIndex', '0');
- }
-
- // only need links in taborder for Safari
- if (!$.browser.safari)
- this.headers.find('a').attr('tabIndex','-1');
-
- if (o.event) {
- this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
- }
-
- },
-
- destroy: function() {
- var o = this.options;
-
- this.element
- .removeClass("ui-accordion ui-widget ui-helper-reset")
- .removeAttr("role")
- .unbind('.accordion')
- .removeData('accordion');
-
- this.headers
- .unbind(".accordion")
- .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
- .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
-
- this.headers.find("a").removeAttr("tabindex");
- this.headers.children(".ui-icon").remove();
- var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
- if (o.autoHeight || o.fillHeight) {
- contents.css("height", "");
- }
- },
-
- _setData: function(key, value) {
- if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
- $.widget.prototype._setData.apply(this, arguments);
- },
-
- _keydown: function(event) {
-
- var o = this.options, keyCode = $.ui.keyCode;
-
- if (o.disabled || event.altKey || event.ctrlKey)
- return;
-
- var length = this.headers.length;
- var currentIndex = this.headers.index(event.target);
- var toFocus = false;
-
- switch(event.keyCode) {
- case keyCode.RIGHT:
- case keyCode.DOWN:
- toFocus = this.headers[(currentIndex + 1) % length];
- break;
- case keyCode.LEFT:
- case keyCode.UP:
- toFocus = this.headers[(currentIndex - 1 + length) % length];
- break;
- case keyCode.SPACE:
- case keyCode.ENTER:
- return this._clickHandler({ target: event.target }, event.target);
- }
-
- if (toFocus) {
- $(event.target).attr('tabIndex','-1');
- $(toFocus).attr('tabIndex','0');
- toFocus.focus();
- return false;
- }
-
- return true;
-
- },
-
- resize: function() {
-
- var o = this.options, maxHeight;
-
- if (o.fillSpace) {
-
- if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
- maxHeight = this.element.parent().height();
- if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
-
- this.headers.each(function() {
- maxHeight -= $(this).outerHeight();
- });
-
- var maxPadding = 0;
- this.headers.next().each(function() {
- maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
- }).height(Math.max(0, maxHeight - maxPadding))
- .css('overflow', 'auto');
-
- } else if ( o.autoHeight ) {
- maxHeight = 0;
- this.headers.next().each(function() {
- maxHeight = Math.max(maxHeight, $(this).outerHeight());
- }).height(maxHeight);
- }
-
- },
-
- activate: function(index) {
- // call clickHandler with custom event
- var active = this._findActive(index)[0];
- this._clickHandler({ target: active }, active);
- },
-
- _findActive: function(selector) {
- return selector
- ? typeof selector == "number"
- ? this.headers.filter(":eq(" + selector + ")")
- : this.headers.not(this.headers.not(selector))
- : selector === false
- ? $([])
- : this.headers.filter(":eq(0)");
- },
-
- _clickHandler: function(event, target) {
-
- var o = this.options;
- if (o.disabled) return false;
-
- // called only when using activate(false) to close all parts programmatically
- if (!event.target && o.collapsible) {
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- var toHide = this.active.next(),
- data = {
- options: o,
- newHeader: $([]),
- oldHeader: o.active,
- newContent: $([]),
- oldContent: toHide
- },
- toShow = (this.active = $([]));
- this._toggle(toShow, toHide, data);
- return false;
- }
-
- // get the click target
- var clicked = $(event.currentTarget || target);
- var clickedIsActive = clicked[0] == this.active[0];
-
- // if animations are still active, or the active header is the target, ignore click
- if (this.running || (!o.collapsible && clickedIsActive)) {
- return false;
- }
-
- // switch classes
- this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
- .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
- this.active.next().addClass('ui-accordion-content-active');
- if (!clickedIsActive) {
- clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
- .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
- clicked.next().addClass('ui-accordion-content-active');
- }
-
- // find elements to show and hide
- var toShow = clicked.next(),
- toHide = this.active.next(),
- data = {
- options: o,
- newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
- oldHeader: this.active,
- newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
- oldContent: toHide.find('> *')
- },
- down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
-
- this.active = clickedIsActive ? $([]) : clicked;
- this._toggle(toShow, toHide, data, clickedIsActive, down);
-
- return false;
-
- },
-
- _toggle: function(toShow, toHide, data, clickedIsActive, down) {
-
- var o = this.options, self = this;
-
- this.toShow = toShow;
- this.toHide = toHide;
- this.data = data;
-
- var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
-
- // trigger changestart event
- this._trigger("changestart", null, this.data);
-
- // count elements to animate
- this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
-
- if (o.animated) {
-
- var animOptions = {};
-
- if ( o.collapsible && clickedIsActive ) {
- animOptions = {
- toShow: $([]),
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
- } else {
- animOptions = {
- toShow: toShow,
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: o.autoHeight || o.fillSpace
- };
- }
-
- if (!o.proxied) {
- o.proxied = o.animated;
- }
-
- if (!o.proxiedDuration) {
- o.proxiedDuration = o.duration;
- }
-
- o.animated = $.isFunction(o.proxied) ?
- o.proxied(animOptions) : o.proxied;
-
- o.duration = $.isFunction(o.proxiedDuration) ?
- o.proxiedDuration(animOptions) : o.proxiedDuration;
-
- var animations = $.ui.accordion.animations,
- duration = o.duration,
- easing = o.animated;
-
- if (!animations[easing]) {
- animations[easing] = function(options) {
- this.slide(options, {
- easing: easing,
- duration: duration || 700
- });
- };
- }
-
- animations[easing](animOptions);
-
- } else {
-
- if (o.collapsible && clickedIsActive) {
- toShow.toggle();
- } else {
- toHide.hide();
- toShow.show();
- }
-
- complete(true);
-
- }
-
- toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
- toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
-
- },
-
- _completed: function(cancel) {
-
- var o = this.options;
-
- this.running = cancel ? 0 : --this.running;
- if (this.running) return;
-
- if (o.clearStyle) {
- this.toShow.add(this.toHide).css({
- height: "",
- overflow: ""
- });
- }
-
- this._trigger('change', null, this.data);
- }
-
-});
-
-
-$.extend($.ui.accordion, {
- version: "1.7.1",
- defaults: {
- active: null,
- alwaysOpen: true, //deprecated, use collapsible
- animated: 'slide',
- autoHeight: true,
- clearStyle: false,
- collapsible: false,
- event: "click",
- fillSpace: false,
- header: "> li > :first-child,> :not(li):even",
- icons: {
- header: "ui-icon-triangle-1-e",
- headerSelected: "ui-icon-triangle-1-s"
- },
- navigation: false,
- navigationFilter: function() {
- return this.href.toLowerCase() == location.href.toLowerCase();
- }
- },
- animations: {
- slide: function(options, additions) {
- options = $.extend({
- easing: "swing",
- duration: 300
- }, options, additions);
- if ( !options.toHide.size() ) {
- options.toShow.animate({height: "show"}, options);
- return;
- }
- if ( !options.toShow.size() ) {
- options.toHide.animate({height: "hide"}, options);
- return;
- }
- var overflow = options.toShow.css('overflow'),
- percentDone,
- showProps = {},
- hideProps = {},
- fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
- originalWidth;
- // fix width before calculating height of hidden element
- var s = options.toShow;
- originalWidth = s[0].style.width;
- s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
-
- $.each(fxAttrs, function(i, prop) {
- hideProps[prop] = 'hide';
-
- var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
- showProps[prop] = {
- value: parts[1],
- unit: parts[2] || 'px'
- };
- });
- options.toShow.css({ height: 0, overflow: 'hidden' }).show();
- options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
- step: function(now, settings) {
- // only calculate the percent when animating height
- // IE gets very inconsistent results when animating elements
- // with small values, which is common for padding
- if (settings.prop == 'height') {
- percentDone = (settings.now - settings.start) / (settings.end - settings.start);
- }
-
- options.toShow[0].style[settings.prop] =
- (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
- },
- duration: options.duration,
- easing: options.easing,
- complete: function() {
- if ( !options.autoHeight ) {
- options.toShow.css("height", "");
- }
- options.toShow.css("width", originalWidth);
- options.toShow.css({overflow: overflow});
- options.complete();
- }
- });
- },
- bounceslide: function(options) {
- this.slide(options, {
- easing: options.down ? "easeOutBounce" : "swing",
- duration: options.down ? 1000 : 200
- });
- },
- easeslide: function(options) {
- this.slide(options, {
- easing: "easeinout",
- duration: 700
- });
- }
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI
- */
-;jQuery.ui || (function($) {
-
-var _remove = $.fn.remove,
- isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
-
-//Helper functions and ui object
-$.ui = {
- version: "1.7.1",
-
- // $.ui.plugin is deprecated. Use the proxy pattern instead.
- plugin: {
- add: function(module, option, set) {
- var proto = $.ui[module].prototype;
- for(var i in set) {
- proto.plugins[i] = proto.plugins[i] || [];
- proto.plugins[i].push([option, set[i]]);
- }
- },
- call: function(instance, name, args) {
- var set = instance.plugins[name];
- if(!set || !instance.element[0].parentNode) { return; }
-
- for (var i = 0; i < set.length; i++) {
- if (instance.options[set[i][0]]) {
- set[i][1].apply(instance.element, args);
- }
- }
- }
- },
-
- contains: function(a, b) {
- return document.compareDocumentPosition
- ? a.compareDocumentPosition(b) & 16
- : a !== b && a.contains(b);
- },
-
- hasScroll: function(el, a) {
-
- //If overflow is hidden, the element might have extra content, but the user wants to hide it
- if ($(el).css('overflow') == 'hidden') { return false; }
-
- var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
- has = false;
-
- if (el[scroll] > 0) { return true; }
-
- // TODO: determine which cases actually cause this to happen
- // if the element doesn't have the scroll set, see if it's possible to
- // set the scroll
- el[scroll] = 1;
- has = (el[scroll] > 0);
- el[scroll] = 0;
- return has;
- },
-
- isOverAxis: function(x, reference, size) {
- //Determines when x coordinate is over "b" element axis
- return (x > reference) && (x < (reference + size));
- },
-
- isOver: function(y, x, top, left, height, width) {
- //Determines when x, y coordinates is over "b" element
- return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
- },
-
- keyCode: {
- BACKSPACE: 8,
- CAPS_LOCK: 20,
- COMMA: 188,
- CONTROL: 17,
- DELETE: 46,
- DOWN: 40,
- END: 35,
- ENTER: 13,
- ESCAPE: 27,
- HOME: 36,
- INSERT: 45,
- LEFT: 37,
- NUMPAD_ADD: 107,
- NUMPAD_DECIMAL: 110,
- NUMPAD_DIVIDE: 111,
- NUMPAD_ENTER: 108,
- NUMPAD_MULTIPLY: 106,
- NUMPAD_SUBTRACT: 109,
- PAGE_DOWN: 34,
- PAGE_UP: 33,
- PERIOD: 190,
- RIGHT: 39,
- SHIFT: 16,
- SPACE: 32,
- TAB: 9,
- UP: 38
- }
-};
-
-// WAI-ARIA normalization
-if (isFF2) {
- var attr = $.attr,
- removeAttr = $.fn.removeAttr,
- ariaNS = "http://www.w3.org/2005/07/aaa",
- ariaState = /^aria-/,
- ariaRole = /^wairole:/;
-
- $.attr = function(elem, name, value) {
- var set = value !== undefined;
-
- return (name == 'role'
- ? (set
- ? attr.call(this, elem, name, "wairole:" + value)
- : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
- : (ariaState.test(name)
- ? (set
- ? elem.setAttributeNS(ariaNS,
- name.replace(ariaState, "aaa:"), value)
- : attr.call(this, elem, name.replace(ariaState, "aaa:")))
- : attr.apply(this, arguments)));
- };
-
- $.fn.removeAttr = function(name) {
- return (ariaState.test(name)
- ? this.each(function() {
- this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
- }) : removeAttr.call(this, name));
- };
-}
-
-//jQuery plugins
-$.fn.extend({
- remove: function() {
- // Safari has a native remove event which actually removes DOM elements,
- // so we have to use triggerHandler instead of trigger (#3037).
- $("*", this).add(this).each(function() {
- $(this).triggerHandler("remove");
- });
- return _remove.apply(this, arguments );
- },
-
- enableSelection: function() {
- return this
- .attr('unselectable', 'off')
- .css('MozUserSelect', '')
- .unbind('selectstart.ui');
- },
-
- disableSelection: function() {
- return this
- .attr('unselectable', 'on')
- .css('MozUserSelect', 'none')
- .bind('selectstart.ui', function() { return false; });
- },
-
- scrollParent: function() {
- var scrollParent;
- if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
- scrollParent = this.parents().filter(function() {
- return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- } else {
- scrollParent = this.parents().filter(function() {
- return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
- }).eq(0);
- }
-
- return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
- }
-});
-
-
-//Additional selectors
-$.extend($.expr[':'], {
- data: function(elem, i, match) {
- return !!$.data(elem, match[3]);
- },
-
- focusable: function(element) {
- var nodeName = element.nodeName.toLowerCase(),
- tabIndex = $.attr(element, 'tabindex');
- return (/input|select|textarea|button|object/.test(nodeName)
- ? !element.disabled
- : 'a' == nodeName || 'area' == nodeName
- ? element.href || !isNaN(tabIndex)
- : !isNaN(tabIndex))
- // the element and all of its ancestors must be visible
- // the browser may report that the area is hidden
- && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
- },
-
- tabbable: function(element) {
- var tabIndex = $.attr(element, 'tabindex');
- return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
- }
-});
-
-
-// $.widget is a factory to create jQuery plugins
-// taking some boilerplate code out of the plugin code
-function getter(namespace, plugin, method, args) {
- function getMethods(type) {
- var methods = $[namespace][plugin][type] || [];
- return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
- }
-
- var methods = getMethods('getter');
- if (args.length == 1 && typeof args[0] == 'string') {
- methods = methods.concat(getMethods('getterSetter'));
- }
- return ($.inArray(method, methods) != -1);
-}
-
-$.widget = function(name, prototype) {
- var namespace = name.split(".")[0];
- name = name.split(".")[1];
-
- // create plugin method
- $.fn[name] = function(options) {
- var isMethodCall = (typeof options == 'string'),
- args = Array.prototype.slice.call(arguments, 1);
-
- // prevent calls to internal methods
- if (isMethodCall && options.substring(0, 1) == '_') {
- return this;
- }
-
- // handle getter methods
- if (isMethodCall && getter(namespace, name, options, args)) {
- var instance = $.data(this[0], name);
- return (instance ? instance[options].apply(instance, args)
- : undefined);
- }
-
- // handle initialization and non-getter methods
- return this.each(function() {
- var instance = $.data(this, name);
-
- // constructor
- (!instance && !isMethodCall &&
- $.data(this, name, new $[namespace][name](this, options))._init());
-
- // method call
- (instance && isMethodCall && $.isFunction(instance[options]) &&
- instance[options].apply(instance, args));
- });
- };
-
- // create widget constructor
- $[namespace] = $[namespace] || {};
- $[namespace][name] = function(element, options) {
- var self = this;
-
- this.namespace = namespace;
- this.widgetName = name;
- this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
- this.widgetBaseClass = namespace + '-' + name;
-
- this.options = $.extend({},
- $.widget.defaults,
- $[namespace][name].defaults,
- $.metadata && $.metadata.get(element)[name],
- options);
-
- this.element = $(element)
- .bind('setData.' + name, function(event, key, value) {
- if (event.target == element) {
- return self._setData(key, value);
- }
- })
- .bind('getData.' + name, function(event, key) {
- if (event.target == element) {
- return self._getData(key);
- }
- })
- .bind('remove', function() {
- return self.destroy();
- });
- };
-
- // add widget prototype
- $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
-
- // TODO: merge getter and getterSetter properties from widget prototype
- // and plugin prototype
- $[namespace][name].getterSetter = 'option';
-};
-
-$.widget.prototype = {
- _init: function() {},
- destroy: function() {
- this.element.removeData(this.widgetName)
- .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
- .removeAttr('aria-disabled');
- },
-
- option: function(key, value) {
- var options = key,
- self = this;
-
- if (typeof key == "string") {
- if (value === undefined) {
- return this._getData(key);
- }
- options = {};
- options[key] = value;
- }
-
- $.each(options, function(key, value) {
- self._setData(key, value);
- });
- },
- _getData: function(key) {
- return this.options[key];
- },
- _setData: function(key, value) {
- this.options[key] = value;
-
- if (key == 'disabled') {
- this.element
- [value ? 'addClass' : 'removeClass'](
- this.widgetBaseClass + '-disabled' + ' ' +
- this.namespace + '-state-disabled')
- .attr("aria-disabled", value);
- }
- },
-
- enable: function() {
- this._setData('disabled', false);
- },
- disable: function() {
- this._setData('disabled', true);
- },
-
- _trigger: function(type, event, data) {
- var callback = this.options[type],
- eventName = (type == this.widgetEventPrefix
- ? type : this.widgetEventPrefix + type);
-
- event = $.Event(event);
- event.type = eventName;
-
- // copy original event properties over to the new event
- // this would happen if we could call $.event.fix instead of $.Event
- // but we don't have a way to force an event to be fixed multiple times
- if (event.originalEvent) {
- for (var i = $.event.props.length, prop; i;) {
- prop = $.event.props[--i];
- event[prop] = event.originalEvent[prop];
- }
- }
-
- this.element.trigger(event, data);
-
- return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
- || event.isDefaultPrevented());
- }
-};
-
-$.widget.defaults = {
- disabled: false
-};
-
-
-/** Mouse Interaction Plugin **/
-
-$.ui.mouse = {
- _mouseInit: function() {
- var self = this;
-
- this.element
- .bind('mousedown.'+this.widgetName, function(event) {
- return self._mouseDown(event);
- })
- .bind('click.'+this.widgetName, function(event) {
- if(self._preventClickEvent) {
- self._preventClickEvent = false;
- event.stopImmediatePropagation();
- return false;
- }
- });
-
- // Prevent text selection in IE
- if ($.browser.msie) {
- this._mouseUnselectable = this.element.attr('unselectable');
- this.element.attr('unselectable', 'on');
- }
-
- this.started = false;
- },
-
- // TODO: make sure destroying one instance of mouse doesn't mess with
- // other instances of mouse
- _mouseDestroy: function() {
- this.element.unbind('.'+this.widgetName);
-
- // Restore text selection in IE
- ($.browser.msie
- && this.element.attr('unselectable', this._mouseUnselectable));
- },
-
- _mouseDown: function(event) {
- // don't let more than one widget handle mouseStart
- // TODO: figure out why we have to use originalEvent
- event.originalEvent = event.originalEvent || {};
- if (event.originalEvent.mouseHandled) { return; }
-
- // we may have missed mouseup (out of window)
- (this._mouseStarted && this._mouseUp(event));
-
- this._mouseDownEvent = event;
-
- var self = this,
- btnIsLeft = (event.which == 1),
- elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
- if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
- return true;
- }
-
- this.mouseDelayMet = !this.options.delay;
- if (!this.mouseDelayMet) {
- this._mouseDelayTimer = setTimeout(function() {
- self.mouseDelayMet = true;
- }, this.options.delay);
- }
-
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted = (this._mouseStart(event) !== false);
- if (!this._mouseStarted) {
- event.preventDefault();
- return true;
- }
- }
-
- // these delegates are required to keep context
- this._mouseMoveDelegate = function(event) {
- return self._mouseMove(event);
- };
- this._mouseUpDelegate = function(event) {
- return self._mouseUp(event);
- };
- $(document)
- .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
- // preventDefault() is used to prevent the selection of text here -
- // however, in Safari, this causes select boxes not to be selectable
- // anymore, so this fix is needed
- ($.browser.safari || event.preventDefault());
-
- event.originalEvent.mouseHandled = true;
- return true;
- },
-
- _mouseMove: function(event) {
- // IE mouseup check - mouseup happened when mouse was out of window
- if ($.browser.msie && !event.button) {
- return this._mouseUp(event);
- }
-
- if (this._mouseStarted) {
- this._mouseDrag(event);
- return event.preventDefault();
- }
-
- if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
- this._mouseStarted =
- (this._mouseStart(this._mouseDownEvent, event) !== false);
- (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
- }
-
- return !this._mouseStarted;
- },
-
- _mouseUp: function(event) {
- $(document)
- .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
- .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
- if (this._mouseStarted) {
- this._mouseStarted = false;
- this._preventClickEvent = (event.target == this._mouseDownEvent.target);
- this._mouseStop(event);
- }
-
- return false;
- },
-
- _mouseDistanceMet: function(event) {
- return (Math.max(
- Math.abs(this._mouseDownEvent.pageX - event.pageX),
- Math.abs(this._mouseDownEvent.pageY - event.pageY)
- ) >= this.options.distance
- );
- },
-
- _mouseDelayMet: function(event) {
- return this.mouseDelayMet;
- },
-
- // These are placeholder methods, to be overriden by extending plugin
- _mouseStart: function(event) {},
- _mouseDrag: function(event) {},
- _mouseStop: function(event) {},
- _mouseCapture: function(event) { return true; }
-};
-
-$.ui.mouse.defaults = {
- cancel: null,
- distance: 1,
- delay: 0
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Datepicker 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- * ui.core.js
- */
-
-(function($) { // hide the namespace
-
-$.extend($.ui, { datepicker: { version: "1.7.1" } });
-
-var PROP_NAME = 'datepicker';
-
-/* Date picker manager.
- Use the singleton instance of this class, $.datepicker, to interact with the date picker.
- Settings for (groups of) date pickers are maintained in an instance object,
- allowing multiple different settings on the same page. */
-
-function Datepicker() {
- this.debug = false; // Change this to true to start debugging
- this._curInst = null; // The current instance in use
- this._keyEvent = false; // If the last event was a key event
- this._disabledInputs = []; // List of date picker inputs that have been disabled
- this._datepickerShowing = false; // True if the popup picker is showing , false if not
- this._inDialog = false; // True if showing within a "dialog", false if not
- this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
- this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
- this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
- this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
- this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
- this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
- this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
- this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
- this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
- this.regional = []; // Available regional settings, indexed by language code
- this.regional[''] = { // Default regional settings
- closeText: 'Done', // Display text for close link
- prevText: 'Prev', // Display text for previous month link
- nextText: 'Next', // Display text for next month link
- currentText: 'Today', // Display text for current month link
- monthNames: ['January','February','March','April','May','June',
- 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
- monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
- dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
- dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
- dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
- dateFormat: 'mm/dd/yy', // See format options on parseDate
- firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
- isRTL: false // True if right-to-left language, false if left-to-right
- };
- this._defaults = { // Global defaults for all the date picker instances
- showOn: 'focus', // 'focus' for popup on focus,
- // 'button' for trigger button, or 'both' for either
- showAnim: 'show', // Name of jQuery animation for popup
- showOptions: {}, // Options for enhanced animations
- defaultDate: null, // Used when field is blank: actual date,
- // +/-number for offset from today, null for today
- appendText: '', // Display text following the input box, e.g. showing the format
- buttonText: '...', // Text for trigger button
- buttonImage: '', // URL for trigger button image
- buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
- hideIfNoPrevNext: false, // True to hide next/previous month links
- // if not applicable, false to just disable them
- navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
- gotoCurrent: false, // True if today link goes back to current selection instead
- changeMonth: false, // True if month can be selected directly, false if only prev/next
- changeYear: false, // True if year can be selected directly, false if only prev/next
- showMonthAfterYear: false, // True if the year select precedes month, false for month then year
- yearRange: '-10:+10', // Range of years to display in drop-down,
- // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
- showOtherMonths: false, // True to show dates in other months, false to leave blank
- calculateWeek: this.iso8601Week, // How to calculate the week of the year,
- // takes a Date and returns the number of the week for it
- shortYearCutoff: '+10', // Short year values < this are in the current century,
- // > this are in the previous century,
- // string value starting with '+' for current year + value
- minDate: null, // The earliest selectable date, or null for no limit
- maxDate: null, // The latest selectable date, or null for no limit
- duration: 'normal', // Duration of display/closure
- beforeShowDay: null, // Function that takes a date and returns an array with
- // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
- // [2] = cell title (optional), e.g. $.datepicker.noWeekends
- beforeShow: null, // Function that takes an input field and
- // returns a set of custom settings for the date picker
- onSelect: null, // Define a callback function when a date is selected
- onChangeMonthYear: null, // Define a callback function when the month or year is changed
- onClose: null, // Define a callback function when the datepicker is closed
- numberOfMonths: 1, // Number of months to show at a time
- showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
- stepMonths: 1, // Number of months to step back/forward
- stepBigMonths: 12, // Number of months to step back/forward for the big links
- altField: '', // Selector for an alternate field to store selected dates into
- altFormat: '', // The date format to use for the alternate field
- constrainInput: true, // The input is constrained by the current date format
- showButtonPanel: false // True to show button panel, false to not show it
- };
- $.extend(this._defaults, this.regional['']);
- this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
-}
-
-$.extend(Datepicker.prototype, {
- /* Class name added to elements to indicate already configured with a date picker. */
- markerClassName: 'hasDatepicker',
-
- /* Debug logging (if enabled). */
- log: function () {
- if (this.debug)
- console.log.apply('', arguments);
- },
-
- /* Override the default settings for all instances of the date picker.
- @param settings object - the new settings to use as defaults (anonymous object)
- @return the manager object */
- setDefaults: function(settings) {
- extendRemove(this._defaults, settings || {});
- return this;
- },
-
- /* Attach the date picker to a jQuery selection.
- @param target element - the target input field or division or span
- @param settings object - the new settings to use for this date picker instance (anonymous) */
- _attachDatepicker: function(target, settings) {
- // check for settings on the control itself - in namespace 'date:'
- var inlineSettings = null;
- for (var attrName in this._defaults) {
- var attrValue = target.getAttribute('date:' + attrName);
- if (attrValue) {
- inlineSettings = inlineSettings || {};
- try {
- inlineSettings[attrName] = eval(attrValue);
- } catch (err) {
- inlineSettings[attrName] = attrValue;
- }
- }
- }
- var nodeName = target.nodeName.toLowerCase();
- var inline = (nodeName == 'div' || nodeName == 'span');
- if (!target.id)
- target.id = 'dp' + (++this.uuid);
- var inst = this._newInst($(target), inline);
- inst.settings = $.extend({}, settings || {}, inlineSettings || {});
- if (nodeName == 'input') {
- this._connectDatepicker(target, inst);
- } else if (inline) {
- this._inlineDatepicker(target, inst);
- }
- },
-
- /* Create a new instance object. */
- _newInst: function(target, inline) {
- var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
- return {id: id, input: target, // associated target
- selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
- drawMonth: 0, drawYear: 0, // month being drawn
- inline: inline, // is datepicker inline or not
- dpDiv: (!inline ? this.dpDiv : // presentation div
- $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
- },
-
- /* Attach the date picker to an input field. */
- _connectDatepicker: function(target, inst) {
- var input = $(target);
- inst.trigger = $([]);
- if (input.hasClass(this.markerClassName))
- return;
- var appendText = this._get(inst, 'appendText');
- var isRTL = this._get(inst, 'isRTL');
- if (appendText)
- input[isRTL ? 'before' : 'after']('<span class="' + this._appendClass + '">' + appendText + '</span>');
- var showOn = this._get(inst, 'showOn');
- if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
- input.focus(this._showDatepicker);
- if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
- var buttonText = this._get(inst, 'buttonText');
- var buttonImage = this._get(inst, 'buttonImage');
- inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
- $('<img/>').addClass(this._triggerClass).
- attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
- $('<button type="button"></button>').addClass(this._triggerClass).
- html(buttonImage == '' ? buttonText : $('<img/>').attr(
- { src:buttonImage, alt:buttonText, title:buttonText })));
- input[isRTL ? 'before' : 'after'](inst.trigger);
- inst.trigger.click(function() {
- if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
- $.datepicker._hideDatepicker();
- else
- $.datepicker._showDatepicker(target);
- return false;
- });
- }
- input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
- bind("setData.datepicker", function(event, key, value) {
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key) {
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- },
-
- /* Attach an inline date picker to a div. */
- _inlineDatepicker: function(target, inst) {
- var divSpan = $(target);
- if (divSpan.hasClass(this.markerClassName))
- return;
- divSpan.addClass(this.markerClassName).append(inst.dpDiv).
- bind("setData.datepicker", function(event, key, value){
- inst.settings[key] = value;
- }).bind("getData.datepicker", function(event, key){
- return this._get(inst, key);
- });
- $.data(target, PROP_NAME, inst);
- this._setDate(inst, this._getDefaultDate(inst));
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- },
-
- /* Pop-up the date picker in a "dialog" box.
- @param input element - ignored
- @param dateText string - the initial date to display (in the current format)
- @param onSelect function - the function(dateText) to call when a date is selected
- @param settings object - update the dialog date picker instance's settings (anonymous object)
- @param pos int[2] - coordinates for the dialog's position within the screen or
- event - with x/y coordinates or
- leave empty for default (screen centre)
- @return the manager object */
- _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
- var inst = this._dialogInst; // internal instance
- if (!inst) {
- var id = 'dp' + (++this.uuid);
- this._dialogInput = $('<input type="text" id="' + id +
- '" size="1" style="position: absolute; top: -100px;"/>');
- this._dialogInput.keydown(this._doKeyDown);
- $('body').append(this._dialogInput);
- inst = this._dialogInst = this._newInst(this._dialogInput, false);
- inst.settings = {};
- $.data(this._dialogInput[0], PROP_NAME, inst);
- }
- extendRemove(inst.settings, settings || {});
- this._dialogInput.val(dateText);
-
- this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
- if (!this._pos) {
- var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
- var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
- var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
- var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
- this._pos = // should use actual width/height below
- [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
- }
-
- // move input on screen for focus, but hidden behind dialog
- this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
- inst.settings.onSelect = onSelect;
- this._inDialog = true;
- this.dpDiv.addClass(this._dialogClass);
- this._showDatepicker(this._dialogInput[0]);
- if ($.blockUI)
- $.blockUI(this.dpDiv);
- $.data(this._dialogInput[0], PROP_NAME, inst);
- return this;
- },
-
- /* Detach a datepicker from its control.
- @param target element - the target input field or division or span */
- _destroyDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- $.removeData(target, PROP_NAME);
- if (nodeName == 'input') {
- inst.trigger.remove();
- $target.siblings('.' + this._appendClass).remove().end().
- removeClass(this.markerClassName).
- unbind('focus', this._showDatepicker).
- unbind('keydown', this._doKeyDown).
- unbind('keypress', this._doKeyPress);
- } else if (nodeName == 'div' || nodeName == 'span')
- $target.removeClass(this.markerClassName).empty();
- },
-
- /* Enable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _enableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = false;
- inst.trigger.filter("button").
- each(function() { this.disabled = false; }).end().
- filter("img").
- css({opacity: '1.0', cursor: ''});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().removeClass('ui-state-disabled');
- }
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- },
-
- /* Disable the date picker to a jQuery selection.
- @param target element - the target input field or division or span */
- _disableDatepicker: function(target) {
- var $target = $(target);
- var inst = $.data(target, PROP_NAME);
- if (!$target.hasClass(this.markerClassName)) {
- return;
- }
- var nodeName = target.nodeName.toLowerCase();
- if (nodeName == 'input') {
- target.disabled = true;
- inst.trigger.filter("button").
- each(function() { this.disabled = true; }).end().
- filter("img").
- css({opacity: '0.5', cursor: 'default'});
- }
- else if (nodeName == 'div' || nodeName == 'span') {
- var inline = $target.children('.' + this._inlineClass);
- inline.children().addClass('ui-state-disabled');
- }
- this._disabledInputs = $.map(this._disabledInputs,
- function(value) { return (value == target ? null : value); }); // delete entry
- this._disabledInputs[this._disabledInputs.length] = target;
- },
-
- /* Is the first field in a jQuery collection disabled as a datepicker?
- @param target element - the target input field or division or span
- @return boolean - true if disabled, false if enabled */
- _isDisabledDatepicker: function(target) {
- if (!target) {
- return false;
- }
- for (var i = 0; i < this._disabledInputs.length; i++) {
- if (this._disabledInputs[i] == target)
- return true;
- }
- return false;
- },
-
- /* Retrieve the instance data for the target control.
- @param target element - the target input field or division or span
- @return object - the associated instance data
- @throws error if a jQuery problem getting data */
- _getInst: function(target) {
- try {
- return $.data(target, PROP_NAME);
- }
- catch (err) {
- throw 'Missing instance data for this datepicker';
- }
- },
-
- /* Update the settings for a date picker attached to an input field or division.
- @param target element - the target input field or division or span
- @param name object - the new settings to update or
- string - the name of the setting to change or
- @param value any - the new value for the setting (omit if above is an object) */
- _optionDatepicker: function(target, name, value) {
- var settings = name || {};
- if (typeof name == 'string') {
- settings = {};
- settings[name] = value;
- }
- var inst = this._getInst(target);
- if (inst) {
- if (this._curInst == inst) {
- this._hideDatepicker(null);
- }
- extendRemove(inst.settings, settings);
- var date = new Date();
- extendRemove(inst, {rangeStart: null, // start of range
- endDay: null, endMonth: null, endYear: null, // end of range
- selectedDay: date.getDate(), selectedMonth: date.getMonth(),
- selectedYear: date.getFullYear(), // starting point
- currentDay: date.getDate(), currentMonth: date.getMonth(),
- currentYear: date.getFullYear(), // current selection
- drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn
- this._updateDatepicker(inst);
- }
- },
-
- // change method deprecated
- _changeDatepicker: function(target, name, value) {
- this._optionDatepicker(target, name, value);
- },
-
- /* Redraw the date picker attached to an input field or division.
- @param target element - the target input field or division or span */
- _refreshDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst) {
- this._updateDatepicker(inst);
- }
- },
-
- /* Set the dates for a jQuery selection.
- @param target element - the target input field or division or span
- @param date Date - the new date
- @param endDate Date - the new end date for a range (optional) */
- _setDateDatepicker: function(target, date, endDate) {
- var inst = this._getInst(target);
- if (inst) {
- this._setDate(inst, date, endDate);
- this._updateDatepicker(inst);
- this._updateAlternate(inst);
- }
- },
-
- /* Get the date(s) for the first entry in a jQuery selection.
- @param target element - the target input field or division or span
- @return Date - the current date or
- Date[2] - the current dates for a range */
- _getDateDatepicker: function(target) {
- var inst = this._getInst(target);
- if (inst && !inst.inline)
- this._setDateFromField(inst);
- return (inst ? this._getDate(inst) : null);
- },
-
- /* Handle keystrokes. */
- _doKeyDown: function(event) {
- var inst = $.datepicker._getInst(event.target);
- var handled = true;
- var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
- inst._keyEvent = true;
- if ($.datepicker._datepickerShowing)
- switch (event.keyCode) {
- case 9: $.datepicker._hideDatepicker(null, '');
- break; // hide on tab out
- case 13: var sel = $('td.' + $.datepicker._dayOverClass +
- ', td.' + $.datepicker._currentClass, inst.dpDiv);
- if (sel[0])
- $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
- else
- $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- return false; // don't submit the form
- break; // select the value on enter
- case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
- break; // hide on escape
- case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // previous month/year on page up/+ ctrl
- case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- break; // next month/year on page down/+ ctrl
- case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // clear on ctrl or command +end
- case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
- handled = event.ctrlKey || event.metaKey;
- break; // current on ctrl or command +home
- case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // -1 day on ctrl or command +left
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- -$.datepicker._get(inst, 'stepBigMonths') :
- -$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +left on Mac
- break;
- case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // -1 week on ctrl or command +up
- case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
- handled = event.ctrlKey || event.metaKey;
- // +1 day on ctrl or command +right
- if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
- +$.datepicker._get(inst, 'stepBigMonths') :
- +$.datepicker._get(inst, 'stepMonths')), 'M');
- // next month/year on alt +right
- break;
- case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
- handled = event.ctrlKey || event.metaKey;
- break; // +1 week on ctrl or command +down
- default: handled = false;
- }
- else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
- $.datepicker._showDatepicker(this);
- else {
- handled = false;
- }
- if (handled) {
- event.preventDefault();
- event.stopPropagation();
- }
- },
-
- /* Filter entered characters - based on date format. */
- _doKeyPress: function(event) {
- var inst = $.datepicker._getInst(event.target);
- if ($.datepicker._get(inst, 'constrainInput')) {
- var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
- var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
- return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
- }
- },
-
- /* Pop-up the date picker for a given input field.
- @param input element - the input field attached to the date picker or
- event - if triggered by focus */
- _showDatepicker: function(input) {
- input = input.target || input;
- if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
- input = $('input', input.parentNode)[0];
- if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
- return;
- var inst = $.datepicker._getInst(input);
- var beforeShow = $.datepicker._get(inst, 'beforeShow');
- extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
- $.datepicker._hideDatepicker(null, '');
- $.datepicker._lastInput = input;
- $.datepicker._setDateFromField(inst);
- if ($.datepicker._inDialog) // hide cursor
- input.value = '';
- if (!$.datepicker._pos) { // position below input
- $.datepicker._pos = $.datepicker._findPos(input);
- $.datepicker._pos[1] += input.offsetHeight; // add the height
- }
- var isFixed = false;
- $(input).parents().each(function() {
- isFixed |= $(this).css('position') == 'fixed';
- return !isFixed;
- });
- if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
- $.datepicker._pos[0] -= document.documentElement.scrollLeft;
- $.datepicker._pos[1] -= document.documentElement.scrollTop;
- }
- var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
- $.datepicker._pos = null;
- inst.rangeStart = null;
- // determine sizing offscreen
- inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
- $.datepicker._updateDatepicker(inst);
- // fix width for dynamic number of date pickers
- // and adjust position before showing
- offset = $.datepicker._checkOffset(inst, offset, isFixed);
- inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
- 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
- left: offset.left + 'px', top: offset.top + 'px'});
- if (!inst.inline) {
- var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
- var duration = $.datepicker._get(inst, 'duration');
- var postProcess = function() {
- $.datepicker._datepickerShowing = true;
- if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
- $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4});
- };
- if ($.effects && $.effects[showAnim])
- inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
- else
- inst.dpDiv[showAnim](duration, postProcess);
- if (duration == '')
- postProcess();
- if (inst.input[0].type != 'hidden')
- inst.input[0].focus();
- $.datepicker._curInst = inst;
- }
- },
-
- /* Generate the date picker content. */
- _updateDatepicker: function(inst) {
- var dims = {width: inst.dpDiv.width() + 4,
- height: inst.dpDiv.height() + 4};
- var self = this;
- inst.dpDiv.empty().append(this._generateHTML(inst))
- .find('iframe.ui-datepicker-cover').
- css({width: dims.width, height: dims.height})
- .end()
- .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
- .bind('mouseout', function(){
- $(this).removeClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
- })
- .bind('mouseover', function(){
- if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
- $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
- $(this).addClass('ui-state-hover');
- if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
- if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
- }
- })
- .end()
- .find('.' + this._dayOverClass + ' a')
- .trigger('mouseover')
- .end();
- var numMonths = this._getNumberOfMonths(inst);
- var cols = numMonths[1];
- var width = 17;
- if (cols > 1) {
- inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
- } else {
- inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
- }
- inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
- 'Class']('ui-datepicker-multi');
- inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
- 'Class']('ui-datepicker-rtl');
- if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
- $(inst.input[0]).focus();
- },
-
- /* Check positioning to remain on screen. */
- _checkOffset: function(inst, offset, isFixed) {
- var dpWidth = inst.dpDiv.outerWidth();
- var dpHeight = inst.dpDiv.outerHeight();
- var inputWidth = inst.input ? inst.input.outerWidth() : 0;
- var inputHeight = inst.input ? inst.input.outerHeight() : 0;
- var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
- var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
-
- offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
- offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
- offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
-
- // now check if datepicker is showing outside window viewport - move to a better place if so.
- offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
- offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
-
- return offset;
- },
-
- /* Find an object's position on the screen. */
- _findPos: function(obj) {
- while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
- obj = obj.nextSibling;
- }
- var position = $(obj).offset();
- return [position.left, position.top];
- },
-
- /* Hide the date picker from view.
- @param input element - the input field attached to the date picker
- @param duration string - the duration over which to close the date picker */
- _hideDatepicker: function(input, duration) {
- var inst = this._curInst;
- if (!inst || (input && inst != $.data(input, PROP_NAME)))
- return;
- if (inst.stayOpen)
- this._selectDate('#' + inst.id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- inst.stayOpen = false;
- if (this._datepickerShowing) {
- duration = (duration != null ? duration : this._get(inst, 'duration'));
- var showAnim = this._get(inst, 'showAnim');
- var postProcess = function() {
- $.datepicker._tidyDialog(inst);
- };
- if (duration != '' && $.effects && $.effects[showAnim])
- inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
- duration, postProcess);
- else
- inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
- (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
- if (duration == '')
- this._tidyDialog(inst);
- var onClose = this._get(inst, 'onClose');
- if (onClose)
- onClose.apply((inst.input ? inst.input[0] : null),
- [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
- this._datepickerShowing = false;
- this._lastInput = null;
- if (this._inDialog) {
- this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
- if ($.blockUI) {
- $.unblockUI();
- $('body').append(this.dpDiv);
- }
- }
- this._inDialog = false;
- }
- this._curInst = null;
- },
-
- /* Tidy up after a dialog display. */
- _tidyDialog: function(inst) {
- inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
- },
-
- /* Close date picker if clicked elsewhere. */
- _checkExternalClick: function(event) {
- if (!$.datepicker._curInst)
- return;
- var $target = $(event.target);
- if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
- !$target.hasClass($.datepicker.markerClassName) &&
- !$target.hasClass($.datepicker._triggerClass) &&
- $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
- $.datepicker._hideDatepicker(null, '');
- },
-
- /* Adjust one of the date sub-fields. */
- _adjustDate: function(id, offset, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._isDisabledDatepicker(target[0])) {
- return;
- }
- this._adjustInstDate(inst, offset +
- (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
- period);
- this._updateDatepicker(inst);
- },
-
- /* Action for current link. */
- _gotoToday: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
- inst.selectedDay = inst.currentDay;
- inst.drawMonth = inst.selectedMonth = inst.currentMonth;
- inst.drawYear = inst.selectedYear = inst.currentYear;
- }
- else {
- var date = new Date();
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- }
- this._notifyChange(inst);
- this._adjustDate(target);
- },
-
- /* Action for selecting a new month/year. */
- _selectMonthYear: function(id, select, period) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst._selectingMonthYear = false;
- inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
- inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
- parseInt(select.options[select.selectedIndex].value,10);
- this._notifyChange(inst);
- this._adjustDate(target);
- },
-
- /* Restore input focus after not changing month/year. */
- _clickMonthYear: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- if (inst.input && inst._selectingMonthYear && !$.browser.msie)
- inst.input[0].focus();
- inst._selectingMonthYear = !inst._selectingMonthYear;
- },
-
- /* Action for selecting a day. */
- _selectDay: function(id, month, year, td) {
- var target = $(id);
- if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
- return;
- }
- var inst = this._getInst(target[0]);
- inst.selectedDay = inst.currentDay = $('a', td).html();
- inst.selectedMonth = inst.currentMonth = month;
- inst.selectedYear = inst.currentYear = year;
- if (inst.stayOpen) {
- inst.endDay = inst.endMonth = inst.endYear = null;
- }
- this._selectDate(id, this._formatDate(inst,
- inst.currentDay, inst.currentMonth, inst.currentYear));
- if (inst.stayOpen) {
- inst.rangeStart = this._daylightSavingAdjust(
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
- this._updateDatepicker(inst);
- }
- },
-
- /* Erase the input field and hide the date picker. */
- _clearDate: function(id) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- inst.stayOpen = false;
- inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
- this._selectDate(target, '');
- },
-
- /* Update the input field with the selected date. */
- _selectDate: function(id, dateStr) {
- var target = $(id);
- var inst = this._getInst(target[0]);
- dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
- if (inst.input)
- inst.input.val(dateStr);
- this._updateAlternate(inst);
- var onSelect = this._get(inst, 'onSelect');
- if (onSelect)
- onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
- else if (inst.input)
- inst.input.trigger('change'); // fire the change event
- if (inst.inline)
- this._updateDatepicker(inst);
- else if (!inst.stayOpen) {
- this._hideDatepicker(null, this._get(inst, 'duration'));
- this._lastInput = inst.input[0];
- if (typeof(inst.input[0]) != 'object')
- inst.input[0].focus(); // restore focus
- this._lastInput = null;
- }
- },
-
- /* Update any alternate field to synchronise with the main field. */
- _updateAlternate: function(inst) {
- var altField = this._get(inst, 'altField');
- if (altField) { // update alternate field too
- var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
- var date = this._getDate(inst);
- dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
- $(altField).each(function() { $(this).val(dateStr); });
- }
- },
-
- /* Set as beforeShowDay function to prevent selection of weekends.
- @param date Date - the date to customise
- @return [boolean, string] - is this date selectable?, what is its CSS class? */
- noWeekends: function(date) {
- var day = date.getDay();
- return [(day > 0 && day < 6), ''];
- },
-
- /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
- @param date Date - the date to get the week for
- @return number - the number of the week within the year that contains this date */
- iso8601Week: function(date) {
- var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
- var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
- var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
- firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
- if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
- checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
- return $.datepicker.iso8601Week(checkDate);
- } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
- firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
- if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
- return 1;
- }
- }
- return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
- },
-
- /* Parse a string value into a date object.
- See formatDate below for the possible formats.
-
- @param format string - the expected format of the date
- @param value string - the date in the above format
- @param settings Object - attributes include:
- shortYearCutoff number - the cutoff year for determining the century (optional)
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return Date - the extracted date value or null if value is blank */
- parseDate: function (format, value, settings) {
- if (format == null || value == null)
- throw 'Invalid arguments';
- value = (typeof value == 'object' ? value.toString() : value + '');
- if (value == '')
- return null;
- var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- var year = -1;
- var month = -1;
- var day = -1;
- var doy = -1;
- var literal = false;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Extract a number from the string value
- var getNumber = function(match) {
- lookAhead(match);
- var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
- var size = origSize;
- var num = 0;
- while (size > 0 && iValue < value.length &&
- value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
- num = num * 10 + parseInt(value.charAt(iValue++),10);
- size--;
- }
- if (size == origSize)
- throw 'Missing number at position ' + iValue;
- return num;
- };
- // Extract a name from the string value and convert to an index
- var getName = function(match, shortNames, longNames) {
- var names = (lookAhead(match) ? longNames : shortNames);
- var size = 0;
- for (var j = 0; j < names.length; j++)
- size = Math.max(size, names[j].length);
- var name = '';
- var iInit = iValue;
- while (size > 0 && iValue < value.length) {
- name += value.charAt(iValue++);
- for (var i = 0; i < names.length; i++)
- if (name == names[i])
- return i + 1;
- size--;
- }
- throw 'Unknown name at position ' + iInit;
- };
- // Confirm that a literal character matches the string value
- var checkLiteral = function() {
- if (value.charAt(iValue) != format.charAt(iFormat))
- throw 'Unexpected literal at position ' + iValue;
- iValue++;
- };
- var iValue = 0;
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- checkLiteral();
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- day = getNumber('d');
- break;
- case 'D':
- getName('D', dayNamesShort, dayNames);
- break;
- case 'o':
- doy = getNumber('o');
- break;
- case 'm':
- month = getNumber('m');
- break;
- case 'M':
- month = getName('M', monthNamesShort, monthNames);
- break;
- case 'y':
- year = getNumber('y');
- break;
- case '@':
- var date = new Date(getNumber('@'));
- year = date.getFullYear();
- month = date.getMonth() + 1;
- day = date.getDate();
- break;
- case "'":
- if (lookAhead("'"))
- checkLiteral();
- else
- literal = true;
- break;
- default:
- checkLiteral();
- }
- }
- if (year == -1)
- year = new Date().getFullYear();
- else if (year < 100)
- year += new Date().getFullYear() - new Date().getFullYear() % 100 +
- (year <= shortYearCutoff ? 0 : -100);
- if (doy > -1) {
- month = 1;
- day = doy;
- do {
- var dim = this._getDaysInMonth(year, month - 1);
- if (day <= dim)
- break;
- month++;
- day -= dim;
- } while (true);
- }
- var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
- if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
- throw 'Invalid date'; // E.g. 31/02/*
- return date;
- },
-
- /* Standard date formats. */
- ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
- COOKIE: 'D, dd M yy',
- ISO_8601: 'yy-mm-dd',
- RFC_822: 'D, d M y',
- RFC_850: 'DD, dd-M-y',
- RFC_1036: 'D, d M y',
- RFC_1123: 'D, d M yy',
- RFC_2822: 'D, d M yy',
- RSS: 'D, d M y', // RFC 822
- TIMESTAMP: '@',
- W3C: 'yy-mm-dd', // ISO 8601
-
- /* Format a date object into a string value.
- The format can be combinations of the following:
- d - day of month (no leading zero)
- dd - day of month (two digit)
- o - day of year (no leading zeros)
- oo - day of year (three digit)
- D - day name short
- DD - day name long
- m - month of year (no leading zero)
- mm - month of year (two digit)
- M - month name short
- MM - month name long
- y - year (two digit)
- yy - year (four digit)
- @ - Unix timestamp (ms since 01/01/1970)
- '...' - literal text
- '' - single quote
-
- @param format string - the desired format of the date
- @param date Date - the date value to format
- @param settings Object - attributes include:
- dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
- dayNames string[7] - names of the days from Sunday (optional)
- monthNamesShort string[12] - abbreviated names of the months (optional)
- monthNames string[12] - names of the months (optional)
- @return string - the date in the above format */
- formatDate: function (format, date, settings) {
- if (!date)
- return '';
- var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
- var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
- var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
- var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
- // Check whether a format character is doubled
- var lookAhead = function(match) {
- var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
- if (matches)
- iFormat++;
- return matches;
- };
- // Format a number, with leading zero if necessary
- var formatNumber = function(match, value, len) {
- var num = '' + value;
- if (lookAhead(match))
- while (num.length < len)
- num = '0' + num;
- return num;
- };
- // Format a name, short or long as requested
- var formatName = function(match, value, shortNames, longNames) {
- return (lookAhead(match) ? longNames[value] : shortNames[value]);
- };
- var output = '';
- var literal = false;
- if (date)
- for (var iFormat = 0; iFormat < format.length; iFormat++) {
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- output += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd':
- output += formatNumber('d', date.getDate(), 2);
- break;
- case 'D':
- output += formatName('D', date.getDay(), dayNamesShort, dayNames);
- break;
- case 'o':
- var doy = date.getDate();
- for (var m = date.getMonth() - 1; m >= 0; m--)
- doy += this._getDaysInMonth(date.getFullYear(), m);
- output += formatNumber('o', doy, 3);
- break;
- case 'm':
- output += formatNumber('m', date.getMonth() + 1, 2);
- break;
- case 'M':
- output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
- break;
- case 'y':
- output += (lookAhead('y') ? date.getFullYear() :
- (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
- break;
- case '@':
- output += date.getTime();
- break;
- case "'":
- if (lookAhead("'"))
- output += "'";
- else
- literal = true;
- break;
- default:
- output += format.charAt(iFormat);
- }
- }
- return output;
- },
-
- /* Extract all possible characters from the date format. */
- _possibleChars: function (format) {
- var chars = '';
- var literal = false;
- for (var iFormat = 0; iFormat < format.length; iFormat++)
- if (literal)
- if (format.charAt(iFormat) == "'" && !lookAhead("'"))
- literal = false;
- else
- chars += format.charAt(iFormat);
- else
- switch (format.charAt(iFormat)) {
- case 'd': case 'm': case 'y': case '@':
- chars += '0123456789';
- break;
- case 'D': case 'M':
- return null; // Accept anything
- case "'":
- if (lookAhead("'"))
- chars += "'";
- else
- literal = true;
- break;
- default:
- chars += format.charAt(iFormat);
- }
- return chars;
- },
-
- /* Get a setting value, defaulting if necessary. */
- _get: function(inst, name) {
- return inst.settings[name] !== undefined ?
- inst.settings[name] : this._defaults[name];
- },
-
- /* Parse existing date and initialise date picker. */
- _setDateFromField: function(inst) {
- var dateFormat = this._get(inst, 'dateFormat');
- var dates = inst.input ? inst.input.val() : null;
- inst.endDay = inst.endMonth = inst.endYear = null;
- var date = defaultDate = this._getDefaultDate(inst);
- var settings = this._getFormatConfig(inst);
- try {
- date = this.parseDate(dateFormat, dates, settings) || defaultDate;
- } catch (event) {
- this.log(event);
- date = defaultDate;
- }
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- inst.currentDay = (dates ? date.getDate() : 0);
- inst.currentMonth = (dates ? date.getMonth() : 0);
- inst.currentYear = (dates ? date.getFullYear() : 0);
- this._adjustInstDate(inst);
- },
-
- /* Retrieve the default date shown on opening. */
- _getDefaultDate: function(inst) {
- var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- return date;
- },
-
- /* A date may be specified as an exact value or a relative one. */
- _determineDate: function(date, defaultDate) {
- var offsetNumeric = function(offset) {
- var date = new Date();
- date.setDate(date.getDate() + offset);
- return date;
- };
- var offsetString = function(offset, getDaysInMonth) {
- var date = new Date();
- var year = date.getFullYear();
- var month = date.getMonth();
- var day = date.getDate();
- var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
- var matches = pattern.exec(offset);
- while (matches) {
- switch (matches[2] || 'd') {
- case 'd' : case 'D' :
- day += parseInt(matches[1],10); break;
- case 'w' : case 'W' :
- day += parseInt(matches[1],10) * 7; break;
- case 'm' : case 'M' :
- month += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- case 'y': case 'Y' :
- year += parseInt(matches[1],10);
- day = Math.min(day, getDaysInMonth(year, month));
- break;
- }
- matches = pattern.exec(offset);
- }
- return new Date(year, month, day);
- };
- date = (date == null ? defaultDate :
- (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
- (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
- date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
- if (date) {
- date.setHours(0);
- date.setMinutes(0);
- date.setSeconds(0);
- date.setMilliseconds(0);
- }
- return this._daylightSavingAdjust(date);
- },
-
- /* Handle switch to/from daylight saving.
- Hours may be non-zero on daylight saving cut-over:
- > 12 when midnight changeover, but then cannot generate
- midnight datetime, so jump to 1AM, otherwise reset.
- @param date (Date) the date to check
- @return (Date) the corrected date */
- _daylightSavingAdjust: function(date) {
- if (!date) return null;
- date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
- return date;
- },
-
- /* Set the date(s) directly. */
- _setDate: function(inst, date, endDate) {
- var clear = !(date);
- var origMonth = inst.selectedMonth;
- var origYear = inst.selectedYear;
- date = this._determineDate(date, new Date());
- inst.selectedDay = inst.currentDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
- if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
- this._notifyChange(inst);
- this._adjustInstDate(inst);
- if (inst.input) {
- inst.input.val(clear ? '' : this._formatDate(inst));
- }
- },
-
- /* Retrieve the date(s) directly. */
- _getDate: function(inst) {
- var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
- this._daylightSavingAdjust(new Date(
- inst.currentYear, inst.currentMonth, inst.currentDay)));
- return startDate;
- },
-
- /* Generate the HTML for the current state of the date picker. */
- _generateHTML: function(inst) {
- var today = new Date();
- today = this._daylightSavingAdjust(
- new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
- var isRTL = this._get(inst, 'isRTL');
- var showButtonPanel = this._get(inst, 'showButtonPanel');
- var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
- var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
- var numMonths = this._getNumberOfMonths(inst);
- var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
- var stepMonths = this._get(inst, 'stepMonths');
- var stepBigMonths = this._get(inst, 'stepBigMonths');
- var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
- var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
- new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- var drawMonth = inst.drawMonth - showCurrentAtPos;
- var drawYear = inst.drawYear;
- if (drawMonth < 0) {
- drawMonth += 12;
- drawYear--;
- }
- if (maxDate) {
- var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
- maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
- maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
- while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
- drawMonth--;
- if (drawMonth < 0) {
- drawMonth = 11;
- drawYear--;
- }
- }
- }
- inst.drawMonth = drawMonth;
- inst.drawYear = drawYear;
- var prevText = this._get(inst, 'prevText');
- prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
- this._getFormatConfig(inst)));
- var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
- ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
- var nextText = this._get(inst, 'nextText');
- nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
- this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
- this._getFormatConfig(inst)));
- var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
- ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
- (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
- var currentText = this._get(inst, 'currentText');
- var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
- currentText = (!navigationAsDateFormat ? currentText :
- this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
- var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
- var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
- (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
- '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
- var firstDay = parseInt(this._get(inst, 'firstDay'),10);
- firstDay = (isNaN(firstDay) ? 0 : firstDay);
- var dayNames = this._get(inst, 'dayNames');
- var dayNamesShort = this._get(inst, 'dayNamesShort');
- var dayNamesMin = this._get(inst, 'dayNamesMin');
- var monthNames = this._get(inst, 'monthNames');
- var monthNamesShort = this._get(inst, 'monthNamesShort');
- var beforeShowDay = this._get(inst, 'beforeShowDay');
- var showOtherMonths = this._get(inst, 'showOtherMonths');
- var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
- var endDate = inst.endDay ? this._daylightSavingAdjust(
- new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
- var defaultDate = this._getDefaultDate(inst);
- var html = '';
- for (var row = 0; row < numMonths[0]; row++) {
- var group = '';
- for (var col = 0; col < numMonths[1]; col++) {
- var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
- var cornerClass = ' ui-corner-all';
- var calender = '';
- if (isMultiMonth) {
- calender += '<div class="ui-datepicker-group ui-datepicker-group-';
- switch (col) {
- case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
- case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
- default: calender += 'middle'; cornerClass = ''; break;
- }
- calender += '">';
- }
- calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
- (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
- (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
- this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
- '</div><table class="ui-datepicker-calendar"><thead>' +
- '<tr>';
- var thead = '';
- for (var dow = 0; dow < 7; dow++) { // days of the week
- var day = (dow + firstDay) % 7;
- thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
- '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
- }
- calender += thead + '</tr></thead><tbody>';
- var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
- if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
- inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
- var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
- var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
- var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
- for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
- calender += '<tr>';
- var tbody = '';
- for (var dow = 0; dow < 7; dow++) { // create date picker days
- var daySettings = (beforeShowDay ?
- beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
- var otherMonth = (printDate.getMonth() != drawMonth);
- var unselectable = otherMonth || !daySettings[0] ||
- (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
- tbody += '<td class="' +
- ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
- (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
- ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
- (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
- // or defaultDate is current printedDate and defaultDate is selectedDate
- ' ' + this._dayOverClass : '') + // highlight selected day
- (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
- (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ' + this._currentClass : '') + // highlight selected day
- (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
- ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
- (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
- inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
- (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
- (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
- (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
- (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
- ' ui-state-active' : '') + // highlight selected day
- '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
- printDate.setDate(printDate.getDate() + 1);
- printDate = this._daylightSavingAdjust(printDate);
- }
- calender += tbody + '</tr>';
- }
- drawMonth++;
- if (drawMonth > 11) {
- drawMonth = 0;
- drawYear++;
- }
- calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
- ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
- group += calender;
- }
- html += group;
- }
- html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
- '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
- inst._keyEvent = false;
- return html;
- },
-
- /* Generate the month and year header. */
- _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
- selectedDate, secondary, monthNames, monthNamesShort) {
- minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
- var changeMonth = this._get(inst, 'changeMonth');
- var changeYear = this._get(inst, 'changeYear');
- var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
- var html = '<div class="ui-datepicker-title">';
- var monthHtml = '';
- // month selection
- if (secondary || !changeMonth)
- monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
- else {
- var inMinYear = (minDate && minDate.getFullYear() == drawYear);
- var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
- monthHtml += '<select class="ui-datepicker-month" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (var month = 0; month < 12; month++) {
- if ((!inMinYear || month >= minDate.getMonth()) &&
- (!inMaxYear || month <= maxDate.getMonth()))
- monthHtml += '<option value="' + month + '"' +
- (month == drawMonth ? ' selected="selected"' : '') +
- '>' + monthNamesShort[month] + '</option>';
- }
- monthHtml += '</select>';
- }
- if (!showMonthAfterYear)
- html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
- // year selection
- if (secondary || !changeYear)
- html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
- else {
- // determine range of years to display
- var years = this._get(inst, 'yearRange').split(':');
- var year = 0;
- var endYear = 0;
- if (years.length != 2) {
- year = drawYear - 10;
- endYear = drawYear + 10;
- } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
- year = drawYear + parseInt(years[0], 10);
- endYear = drawYear + parseInt(years[1], 10);
- } else {
- year = parseInt(years[0], 10);
- endYear = parseInt(years[1], 10);
- }
- year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
- endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
- html += '<select class="ui-datepicker-year" ' +
- 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
- 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
- '>';
- for (; year <= endYear; year++) {
- html += '<option value="' + year + '"' +
- (year == drawYear ? ' selected="selected"' : '') +
- '>' + year + '</option>';
- }
- html += '</select>';
- }
- if (showMonthAfterYear)
- html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
- html += '</div>'; // Close datepicker_header
- return html;
- },
-
- /* Adjust one of the date sub-fields. */
- _adjustInstDate: function(inst, offset, period) {
- var year = inst.drawYear + (period == 'Y' ? offset : 0);
- var month = inst.drawMonth + (period == 'M' ? offset : 0);
- var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
- (period == 'D' ? offset : 0);
- var date = this._daylightSavingAdjust(new Date(year, month, day));
- // ensure it is within the bounds set
- var minDate = this._getMinMaxDate(inst, 'min', true);
- var maxDate = this._getMinMaxDate(inst, 'max');
- date = (minDate && date < minDate ? minDate : date);
- date = (maxDate && date > maxDate ? maxDate : date);
- inst.selectedDay = date.getDate();
- inst.drawMonth = inst.selectedMonth = date.getMonth();
- inst.drawYear = inst.selectedYear = date.getFullYear();
- if (period == 'M' || period == 'Y')
- this._notifyChange(inst);
- },
-
- /* Notify change of month/year. */
- _notifyChange: function(inst) {
- var onChange = this._get(inst, 'onChangeMonthYear');
- if (onChange)
- onChange.apply((inst.input ? inst.input[0] : null),
- [inst.selectedYear, inst.selectedMonth + 1, inst]);
- },
-
- /* Determine the number of months to show. */
- _getNumberOfMonths: function(inst) {
- var numMonths = this._get(inst, 'numberOfMonths');
- return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
- },
-
- /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
- _getMinMaxDate: function(inst, minMax, checkRange) {
- var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
- return (!checkRange || !inst.rangeStart ? date :
- (!date || inst.rangeStart > date ? inst.rangeStart : date));
- },
-
- /* Find the number of days in a given month. */
- _getDaysInMonth: function(year, month) {
- return 32 - new Date(year, month, 32).getDate();
- },
-
- /* Find the day of the week of the first of a month. */
- _getFirstDayOfMonth: function(year, month) {
- return new Date(year, month, 1).getDay();
- },
-
- /* Determines if we should allow a "next/prev" month display change. */
- _canAdjustMonth: function(inst, offset, curYear, curMonth) {
- var numMonths = this._getNumberOfMonths(inst);
- var date = this._daylightSavingAdjust(new Date(
- curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
- if (offset < 0)
- date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
- return this._isInRange(inst, date);
- },
-
- /* Is the given date in the accepted range? */
- _isInRange: function(inst, date) {
- // during range selection, use minimum of selected date and range start
- var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
- new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
- newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
- var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
- var maxDate = this._getMinMaxDate(inst, 'max');
- return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
- },
-
- /* Provide the configuration settings for formatting/parsing. */
- _getFormatConfig: function(inst) {
- var shortYearCutoff = this._get(inst, 'shortYearCutoff');
- shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
- new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
- return {shortYearCutoff: shortYearCutoff,
- dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
- monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
- },
-
- /* Format the given date for display. */
- _formatDate: function(inst, day, month, year) {
- if (!day) {
- inst.currentDay = inst.selectedDay;
- inst.currentMonth = inst.selectedMonth;
- inst.currentYear = inst.selectedYear;
- }
- var date = (day ? (typeof day == 'object' ? day :
- this._daylightSavingAdjust(new Date(year, month, day))) :
- this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
- return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
- }
-});
-
-/* jQuery extend now ignores nulls! */
-function extendRemove(target, props) {
- $.extend(target, props);
- for (var name in props)
- if (props[name] == null || props[name] == undefined)
- target[name] = props[name];
- return target;
-};
-
-/* Determine whether an object is an array. */
-function isArray(a) {
- return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
- (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
-
-/* Invoke the datepicker functionality.
- @param options string - a command, optionally followed by additional parameters or
- Object - settings for attaching new datepicker functionality
- @return jQuery object */
-$.fn.datepicker = function(options){
-
- /* Initialise the date picker. */
- if (!$.datepicker.initialized) {
- $(document).mousedown($.datepicker._checkExternalClick).
- find('body').append($.datepicker.dpDiv);
- $.datepicker.initialized = true;
- }
-
- var otherArgs = Array.prototype.slice.call(arguments, 1);
- if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
- return $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this[0]].concat(otherArgs));
- return this.each(function() {
- typeof options == 'string' ?
- $.datepicker['_' + options + 'Datepicker'].
- apply($.datepicker, [this].concat(otherArgs)) :
- $.datepicker._attachDatepicker(this, options);
- });
-};
-
-$.datepicker = new Datepicker(); // singleton instance
-$.datepicker.initialized = false;
-$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "1.7.1";
-
-// Workaround for #4055
-// Add another global to avoid noConflict issues with inline event handlers
-window.DP_jQuery = $;
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Dialog 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- * ui.core.js
- * ui.draggable.js
- * ui.resizable.js
- */
-(function($) {
-
-var setDataSwitch = {
- dragStart : "start.draggable",
- drag : "drag.draggable",
- dragStop : "stop.draggable",
- maxHeight : "maxHeight.resizable",
- minHeight : "minHeight.resizable",
- maxWidth : "maxWidth.resizable",
- minWidth : "minWidth.resizable",
- resizeStart : "start.resizable",
- resize : "drag.resizable",
- resizeStop : "stop.resizable"
- },
-
- uiDialogClasses =
- 'ui-dialog ' +
- 'ui-widget ' +
- 'ui-widget-content ' +
- 'ui-corner-all ';
-
-$.widget("ui.dialog", {
-
- _init: function() {
- this.originalTitle = this.element.attr('title');
-
- var self = this,
- options = this.options,
-
- title = options.title || this.originalTitle || ' ',
- titleId = $.ui.dialog.getTitleId(this.element),
-
- uiDialog = (this.uiDialog = $('<div/>'))
- .appendTo(document.body)
- .hide()
- .addClass(uiDialogClasses + options.dialogClass)
- .css({
- position: 'absolute',
- overflow: 'hidden',
- zIndex: options.zIndex
- })
- // setting tabIndex makes the div focusable
- // setting outline to 0 prevents a border on focus in Mozilla
- .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
- (options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
- })
- .attr({
- role: 'dialog',
- 'aria-labelledby': titleId
- })
- .mousedown(function(event) {
- self.moveToTop(false, event);
- }),
-
- uiDialogContent = this.element
- .show()
- .removeAttr('title')
- .addClass(
- 'ui-dialog-content ' +
- 'ui-widget-content')
- .appendTo(uiDialog),
-
- uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
- .addClass(
- 'ui-dialog-titlebar ' +
- 'ui-widget-header ' +
- 'ui-corner-all ' +
- 'ui-helper-clearfix'
- )
- .prependTo(uiDialog),
-
- uiDialogTitlebarClose = $('<a href="#"/>')
- .addClass(
- 'ui-dialog-titlebar-close ' +
- 'ui-corner-all'
- )
- .attr('role', 'button')
- .hover(
- function() {
- uiDialogTitlebarClose.addClass('ui-state-hover');
- },
- function() {
- uiDialogTitlebarClose.removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- uiDialogTitlebarClose.addClass('ui-state-focus');
- })
- .blur(function() {
- uiDialogTitlebarClose.removeClass('ui-state-focus');
- })
- .mousedown(function(ev) {
- ev.stopPropagation();
- })
- .click(function(event) {
- self.close(event);
- return false;
- })
- .appendTo(uiDialogTitlebar),
-
- uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
- .addClass(
- 'ui-icon ' +
- 'ui-icon-closethick'
- )
- .text(options.closeText)
- .appendTo(uiDialogTitlebarClose),
-
- uiDialogTitle = $('<span/>')
- .addClass('ui-dialog-title')
- .attr('id', titleId)
- .html(title)
- .prependTo(uiDialogTitlebar);
-
- uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
-
- (options.draggable && $.fn.draggable && this._makeDraggable());
- (options.resizable && $.fn.resizable && this._makeResizable());
-
- this._createButtons(options.buttons);
- this._isOpen = false;
-
- (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
- (options.autoOpen && this.open());
-
- },
-
- destroy: function() {
- (this.overlay && this.overlay.destroy());
- this.uiDialog.hide();
- this.element
- .unbind('.dialog')
- .removeData('dialog')
- .removeClass('ui-dialog-content ui-widget-content')
- .hide().appendTo('body');
- this.uiDialog.remove();
-
- (this.originalTitle && this.element.attr('title', this.originalTitle));
- },
-
- close: function(event) {
- var self = this;
-
- if (false === self._trigger('beforeclose', event)) {
- return;
- }
-
- (self.overlay && self.overlay.destroy());
- self.uiDialog.unbind('keypress.ui-dialog');
-
- (self.options.hide
- ? self.uiDialog.hide(self.options.hide, function() {
- self._trigger('close', event);
- })
- : self.uiDialog.hide() && self._trigger('close', event));
-
- $.ui.dialog.overlay.resize();
-
- self._isOpen = false;
- },
-
- isOpen: function() {
- return this._isOpen;
- },
-
- // the force parameter allows us to move modal dialogs to their correct
- // position on open
- moveToTop: function(force, event) {
-
- if ((this.options.modal && !force)
- || (!this.options.stack && !this.options.modal)) {
- return this._trigger('focus', event);
- }
-
- if (this.options.zIndex > $.ui.dialog.maxZ) {
- $.ui.dialog.maxZ = this.options.zIndex;
- }
- (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
-
- //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
- // http://ui.jquery.com/bugs/ticket/3193
- var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
- this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
- this.element.attr(saveScroll);
- this._trigger('focus', event);
- },
-
- open: function() {
- if (this._isOpen) { return; }
-
- var options = this.options,
- uiDialog = this.uiDialog;
-
- this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
- (uiDialog.next().length && uiDialog.appendTo('body'));
- this._size();
- this._position(options.position);
- uiDialog.show(options.show);
- this.moveToTop(true);
-
- // prevent tabbing out of modal dialogs
- (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
- if (event.keyCode != $.ui.keyCode.TAB) {
- return;
- }
-
- var tabbables = $(':tabbable', this),
- first = tabbables.filter(':first')[0],
- last = tabbables.filter(':last')[0];
-
- if (event.target == last && !event.shiftKey) {
- setTimeout(function() {
- first.focus();
- }, 1);
- } else if (event.target == first && event.shiftKey) {
- setTimeout(function() {
- last.focus();
- }, 1);
- }
- }));
-
- // set focus to the first tabbable element in the content area or the first button
- // if there are no tabbable elements, set focus on the dialog itself
- $([])
- .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
- .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
- .add(uiDialog)
- .filter(':first')
- .focus();
-
- this._trigger('open');
- this._isOpen = true;
- },
-
- _createButtons: function(buttons) {
- var self = this,
- hasButtons = false,
- uiDialogButtonPane = $('<div></div>')
- .addClass(
- 'ui-dialog-buttonpane ' +
- 'ui-widget-content ' +
- 'ui-helper-clearfix'
- );
-
- // if we already have a button pane, remove it
- this.uiDialog.find('.ui-dialog-buttonpane').remove();
-
- (typeof buttons == 'object' && buttons !== null &&
- $.each(buttons, function() { return !(hasButtons = true); }));
- if (hasButtons) {
- $.each(buttons, function(name, fn) {
- $('<button type="button"></button>')
- .addClass(
- 'ui-state-default ' +
- 'ui-corner-all'
- )
- .text(name)
- .click(function() { fn.apply(self.element[0], arguments); })
- .hover(
- function() {
- $(this).addClass('ui-state-hover');
- },
- function() {
- $(this).removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- $(this).addClass('ui-state-focus');
- })
- .blur(function() {
- $(this).removeClass('ui-state-focus');
- })
- .appendTo(uiDialogButtonPane);
- });
- uiDialogButtonPane.appendTo(this.uiDialog);
- }
- },
-
- _makeDraggable: function() {
- var self = this,
- options = this.options,
- heightBeforeDrag;
-
- this.uiDialog.draggable({
- cancel: '.ui-dialog-content',
- handle: '.ui-dialog-titlebar',
- containment: 'document',
- start: function() {
- heightBeforeDrag = options.height;
- $(this).height($(this).height()).addClass("ui-dialog-dragging");
- (options.dragStart && options.dragStart.apply(self.element[0], arguments));
- },
- drag: function() {
- (options.drag && options.drag.apply(self.element[0], arguments));
- },
- stop: function() {
- $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
- (options.dragStop && options.dragStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
- }
- });
- },
-
- _makeResizable: function(handles) {
- handles = (handles === undefined ? this.options.resizable : handles);
- var self = this,
- options = this.options,
- resizeHandles = typeof handles == 'string'
- ? handles
- : 'n,e,s,w,se,sw,ne,nw';
-
- this.uiDialog.resizable({
- cancel: '.ui-dialog-content',
- alsoResize: this.element,
- maxWidth: options.maxWidth,
- maxHeight: options.maxHeight,
- minWidth: options.minWidth,
- minHeight: options.minHeight,
- start: function() {
- $(this).addClass("ui-dialog-resizing");
- (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
- },
- resize: function() {
- (options.resize && options.resize.apply(self.element[0], arguments));
- },
- handles: resizeHandles,
- stop: function() {
- $(this).removeClass("ui-dialog-resizing");
- options.height = $(this).height();
- options.width = $(this).width();
- (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
- $.ui.dialog.overlay.resize();
- }
- })
- .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
- },
-
- _position: function(pos) {
- var wnd = $(window), doc = $(document),
- pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
- minTop = pTop;
-
- if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
- pos = [
- pos == 'right' || pos == 'left' ? pos : 'center',
- pos == 'top' || pos == 'bottom' ? pos : 'middle'
- ];
- }
- if (pos.constructor != Array) {
- pos = ['center', 'middle'];
- }
- if (pos[0].constructor == Number) {
- pLeft += pos[0];
- } else {
- switch (pos[0]) {
- case 'left':
- pLeft += 0;
- break;
- case 'right':
- pLeft += wnd.width() - this.uiDialog.outerWidth();
- break;
- default:
- case 'center':
- pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
- }
- }
- if (pos[1].constructor == Number) {
- pTop += pos[1];
- } else {
- switch (pos[1]) {
- case 'top':
- pTop += 0;
- break;
- case 'bottom':
- pTop += wnd.height() - this.uiDialog.outerHeight();
- break;
- default:
- case 'middle':
- pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
- }
- }
-
- // prevent the dialog from being too high (make sure the titlebar
- // is accessible)
- pTop = Math.max(pTop, minTop);
- this.uiDialog.css({top: pTop, left: pLeft});
- },
-
- _setData: function(key, value){
- (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
- switch (key) {
- case "buttons":
- this._createButtons(value);
- break;
- case "closeText":
- this.uiDialogTitlebarCloseText.text(value);
- break;
- case "dialogClass":
- this.uiDialog
- .removeClass(this.options.dialogClass)
- .addClass(uiDialogClasses + value);
- break;
- case "draggable":
- (value
- ? this._makeDraggable()
- : this.uiDialog.draggable('destroy'));
- break;
- case "height":
- this.uiDialog.height(value);
- break;
- case "position":
- this._position(value);
- break;
- case "resizable":
- var uiDialog = this.uiDialog,
- isResizable = this.uiDialog.is(':data(resizable)');
-
- // currently resizable, becoming non-resizable
- (isResizable && !value && uiDialog.resizable('destroy'));
-
- // currently resizable, changing handles
- (isResizable && typeof value == 'string' &&
- uiDialog.resizable('option', 'handles', value));
-
- // currently non-resizable, becoming resizable
- (isResizable || this._makeResizable(value));
- break;
- case "title":
- $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
- break;
- case "width":
- this.uiDialog.width(value);
- break;
- }
-
- $.widget.prototype._setData.apply(this, arguments);
- },
-
- _size: function() {
- /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
- * divs will both have width and height set, so we need to reset them
- */
- var options = this.options;
-
- // reset content sizing
- this.element.css({
- height: 0,
- minHeight: 0,
- width: 'auto'
- });
-
- // reset wrapper sizing
- // determine the height of all the non-content elements
- var nonContentHeight = this.uiDialog.css({
- height: 'auto',
- width: options.width
- })
- .height();
-
- this.element
- .css({
- minHeight: Math.max(options.minHeight - nonContentHeight, 0),
- height: options.height == 'auto'
- ? 'auto'
- : Math.max(options.height - nonContentHeight, 0)
- });
- }
-});
-
-$.extend($.ui.dialog, {
- version: "1.7.1",
- defaults: {
- autoOpen: true,
- bgiframe: false,
- buttons: {},
- closeOnEscape: true,
- closeText: 'close',
- dialogClass: '',
- draggable: true,
- hide: null,
- height: 'auto',
- maxHeight: false,
- maxWidth: false,
- minHeight: 150,
- minWidth: 150,
- modal: false,
- position: 'center',
- resizable: true,
- show: null,
- stack: true,
- title: '',
- width: 300,
- zIndex: 1000
- },
-
- getter: 'isOpen',
-
- uuid: 0,
- maxZ: 0,
-
- getTitleId: function($el) {
- return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
- },
-
- overlay: function(dialog) {
- this.$el = $.ui.dialog.overlay.create(dialog);
- }
-});
-
-$.extend($.ui.dialog.overlay, {
- instances: [],
- maxZ: 0,
- events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
- function(event) { return event + '.dialog-overlay'; }).join(' '),
- create: function(dialog) {
- if (this.instances.length === 0) {
- // prevent use of anchors and inputs
- // we use a setTimeout in case the overlay is created from an
- // event that we're going to be cancelling (see #2804)
- setTimeout(function() {
- $(document).bind($.ui.dialog.overlay.events, function(event) {
- var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
- return (dialogZ > $.ui.dialog.overlay.maxZ);
- });
- }, 1);
-
- // allow closing by pressing the escape key
- $(document).bind('keydown.dialog-overlay', function(event) {
- (dialog.options.closeOnEscape && event.keyCode
- && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
- });
-
- // handle window resize
- $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
- }
-
- var $el = $('<div></div>').appendTo(document.body)
- .addClass('ui-widget-overlay').css({
- width: this.width(),
- height: this.height()
- });
-
- (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
-
- this.instances.push($el);
- return $el;
- },
-
- destroy: function($el) {
- this.instances.splice($.inArray(this.instances, $el), 1);
-
- if (this.instances.length === 0) {
- $([document, window]).unbind('.dialog-overlay');
- }
-
- $el.remove();
- },
-
- height: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollHeight = Math.max(
- document.documentElement.scrollHeight,
- document.body.scrollHeight
- );
- var offsetHeight = Math.max(
- document.documentElement.offsetHeight,
- document.body.offsetHeight
- );
-
- if (scrollHeight < offsetHeight) {
- return $(window).height() + 'px';
- } else {
- return scrollHeight + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).height() + 'px';
- }
- },
-
- width: function() {
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
- var scrollWidth = Math.max(
- document.documentElement.scrollWidth,
- document.body.scrollWidth
- );
- var offsetWidth = Math.max(
- document.documentElement.offsetWidth,
- document.body.offsetWidth
- );
-
- if (scrollWidth < offsetWidth) {
- return $(window).width() + 'px';
- } else {
- return scrollWidth + 'px';
- }
- // handle "good" browsers
- } else {
- return $(document).width() + 'px';
- }
- },
-
- resize: function() {
- /* If the dialog is draggable and the user drags it past the
- * right edge of the window, the document becomes wider so we
- * need to stretch the overlay. If the user then drags the
- * dialog back to the left, the document will become narrower,
- * so we need to shrink the overlay to the appropriate size.
- * This is handled by shrinking the overlay before setting it
- * to the full document size.
- */
- var $overlays = $([]);
- $.each($.ui.dialog.overlay.instances, function() {
- $overlays = $overlays.add(this);
- });
-
- $overlays.css({
- width: 0,
- height: 0
- }).css({
- width: $.ui.dialog.overlay.width(),
- height: $.ui.dialog.overlay.height()
- });
- }
-});
-
-$.extend($.ui.dialog.overlay.prototype, {
- destroy: function() {
- $.ui.dialog.overlay.destroy(this.$el);
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Draggable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
- this.element[0].style.position = 'relative';
-
- (this.options.addClasses && this.element.addClass("ui-draggable"));
- (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
-
- this._mouseInit();
-
- },
-
- destroy: function() {
- if(!this.element.data('draggable')) return;
- this.element
- .removeData("draggable")
- .unbind(".draggable")
- .removeClass("ui-draggable"
- + " ui-draggable-dragging"
- + " ui-draggable-disabled");
- this._mouseDestroy();
- },
-
- _mouseCapture: function(event) {
-
- var o = this.options;
-
- if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
- return false;
-
- //Quit if we're not on a valid handle
- this.handle = this._getHandle(event);
- if (!this.handle)
- return false;
-
- return true;
-
- },
-
- _mouseStart: function(event) {
-
- var o = this.options;
-
- //Create and append the visible helper
- this.helper = this._createHelper(event);
-
- //Cache the helper size
- this._cacheHelperProportions();
-
- //If ddmanager is used for droppables, set the global draggable
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
-
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
-
- //Cache the margins of the original element
- this._cacheMargins();
-
- //Store the helper's css position
- this.cssPosition = this.helper.css("position");
- this.scrollParent = this.helper.scrollParent();
-
- //The element's absolute position on the page minus margins
- this.offset = this.element.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
-
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
-
- //Generate the original position
- this.originalPosition = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
-
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
-
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
-
- //Call plugins and callbacks
- this._trigger("start", event);
-
- //Recache the helper size
- this._cacheHelperProportions();
-
- //Prepare the droppable offsets
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
-
- this.helper.addClass("ui-draggable-dragging");
- this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
- return true;
- },
-
- _mouseDrag: function(event, noPropagation) {
-
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
-
- //Call plugins and callbacks and use the resulting position if something is returned
- if (!noPropagation) {
- var ui = this._uiHash();
- this._trigger('drag', event, ui);
- this.position = ui.position;
- }
-
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
- return false;
- },
-
- _mouseStop: function(event) {
-
- //If we are using droppables, inform the manager about the drop
- var dropped = false;
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- dropped = $.ui.ddmanager.drop(this, event);
-
- //if a drop comes from outside (a sortable)
- if(this.dropped) {
- dropped = this.dropped;
- this.dropped = false;
- }
-
- if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
- var self = this;
- $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
- self._trigger("stop", event);
- self._clear();
- });
- } else {
- this._trigger("stop", event);
- this._clear();
- }
-
- return false;
- },
-
- _getHandle: function(event) {
-
- var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
- $(this.options.handle, this.element)
- .find("*")
- .andSelf()
- .each(function() {
- if(this == event.target) handle = true;
- });
-
- return handle;
-
- },
-
- _createHelper: function(event) {
-
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
-
- if(!helper.parents('body').length)
- helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
-
- if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
- helper.css("position", "absolute");
-
- return helper;
-
- },
-
- _adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
- },
-
- _getParentOffset: function() {
-
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
-
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
-
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
-
- return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
-
- },
-
- _getRelativeOffset: function() {
-
- if(this.cssPosition == "relative") {
- var p = this.element.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
- }
-
- },
-
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.element.css("marginLeft"),10) || 0),
- top: (parseInt(this.element.css("marginTop"),10) || 0)
- };
- },
-
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
- },
-
- _setContainment: function() {
-
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- 0 - this.offset.relative.left - this.offset.parent.left,
- 0 - this.offset.relative.top - this.offset.parent.top,
- $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
-
- if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
- var ce = $(o.containment)[0]; if(!ce) return;
- var co = $(o.containment).offset();
- var over = ($(ce).css("overflow") != 'hidden');
-
- this.containment = [
- co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
- co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
- co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
- co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
- ];
- } else if(o.containment.constructor == Array) {
- this.containment = o.containment;
- }
-
- },
-
- _convertPositionTo: function(d, pos) {
-
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
-
- },
-
- _generatePosition: function(event) {
-
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
- }
-
- var pageX = event.pageX;
- var pageY = event.pageY;
-
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
-
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
- if(this.containment) {
- if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
- }
-
- if(o.grid) {
- var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
- pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
- var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
- pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
- }
-
- }
-
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
-
- },
-
- _clear: function() {
- this.helper.removeClass("ui-draggable-dragging");
- if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
- //if($.ui.ddmanager) $.ui.ddmanager.current = null;
- this.helper = null;
- this.cancelHelperRemoval = false;
- },
-
- // From now on bulk stuff - mainly helpers
-
- _trigger: function(type, event, ui) {
- ui = ui || this._uiHash();
- $.ui.plugin.call(this, type, [event, ui]);
- if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
- return $.widget.prototype._trigger.call(this, type, event, ui);
- },
-
- plugins: {},
-
- _uiHash: function(event) {
- return {
- helper: this.helper,
- position: this.position,
- absolutePosition: this.positionAbs, //deprecated
- offset: this.positionAbs
- };
- }
-
-}));
-
-$.extend($.ui.draggable, {
- version: "1.7.1",
- eventPrefix: "drag",
- defaults: {
- addClasses: true,
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectToSortable: false,
- containment: false,
- cursor: "auto",
- cursorAt: false,
- delay: 0,
- distance: 1,
- grid: false,
- handle: false,
- helper: "original",
- iframeFix: false,
- opacity: false,
- refreshPositions: false,
- revert: false,
- revertDuration: 500,
- scope: "default",
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- snap: false,
- snapMode: "both",
- snapTolerance: 20,
- stack: false,
- zIndex: false
- }
-});
-
-$.ui.plugin.add("draggable", "connectToSortable", {
- start: function(event, ui) {
-
- var inst = $(this).data("draggable"), o = inst.options,
- uiSortable = $.extend({}, ui, { item: inst.element });
- inst.sortables = [];
- $(o.connectToSortable).each(function() {
- var sortable = $.data(this, 'sortable');
- if (sortable && !sortable.options.disabled) {
- inst.sortables.push({
- instance: sortable,
- shouldRevert: sortable.options.revert
- });
- sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
- sortable._trigger("activate", event, uiSortable);
- }
- });
-
- },
- stop: function(event, ui) {
-
- //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
- var inst = $(this).data("draggable"),
- uiSortable = $.extend({}, ui, { item: inst.element });
-
- $.each(inst.sortables, function() {
- if(this.instance.isOver) {
-
- this.instance.isOver = 0;
-
- inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
- this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
-
- //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
- if(this.shouldRevert) this.instance.options.revert = true;
-
- //Trigger the stop of the sortable
- this.instance._mouseStop(event);
-
- this.instance.options.helper = this.instance.options._helper;
-
- //If the helper has been the original item, restore properties in the sortable
- if(inst.options.helper == 'original')
- this.instance.currentItem.css({ top: 'auto', left: 'auto' });
-
- } else {
- this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
- this.instance._trigger("deactivate", event, uiSortable);
- }
-
- });
-
- },
- drag: function(event, ui) {
-
- var inst = $(this).data("draggable"), self = this;
-
- var checkPos = function(o) {
- var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
- var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
- var itemHeight = o.height, itemWidth = o.width;
- var itemTop = o.top, itemLeft = o.left;
-
- return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
- };
-
- $.each(inst.sortables, function(i) {
-
- //Copy over some variables to allow calling the sortable's native _intersectsWith
- this.instance.positionAbs = inst.positionAbs;
- this.instance.helperProportions = inst.helperProportions;
- this.instance.offset.click = inst.offset.click;
-
- if(this.instance._intersectsWith(this.instance.containerCache)) {
-
- //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
- if(!this.instance.isOver) {
-
- this.instance.isOver = 1;
- //Now we fake the start of dragging for the sortable instance,
- //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
- //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
- this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
- this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
- this.instance.options.helper = function() { return ui.helper[0]; };
-
- event.target = this.instance.currentItem[0];
- this.instance._mouseCapture(event, true);
- this.instance._mouseStart(event, true, true);
-
- //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
- this.instance.offset.click.top = inst.offset.click.top;
- this.instance.offset.click.left = inst.offset.click.left;
- this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
- this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
-
- inst._trigger("toSortable", event);
- inst.dropped = this.instance.element; //draggable revert needs that
- //hack so receive/update callbacks work (mostly)
- inst.currentItem = inst.element;
- this.instance.fromOutside = inst;
-
- }
-
- //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
- if(this.instance.currentItem) this.instance._mouseDrag(event);
-
- } else {
-
- //If it doesn't intersect with the sortable, and it intersected before,
- //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
- if(this.instance.isOver) {
-
- this.instance.isOver = 0;
- this.instance.cancelHelperRemoval = true;
-
- //Prevent reverting on this forced stop
- this.instance.options.revert = false;
-
- // The out event needs to be triggered independently
- this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-
- this.instance._mouseStop(event, true);
- this.instance.options.helper = this.instance.options._helper;
-
- //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
- this.instance.currentItem.remove();
- if(this.instance.placeholder) this.instance.placeholder.remove();
-
- inst._trigger("fromSortable", event);
- inst.dropped = false; //draggable revert needs that
- }
-
- };
-
- });
-
- }
-});
-
-$.ui.plugin.add("draggable", "cursor", {
- start: function(event, ui) {
- var t = $('body'), o = $(this).data('draggable').options;
- if (t.css("cursor")) o._cursor = t.css("cursor");
- t.css("cursor", o.cursor);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if (o._cursor) $('body').css("cursor", o._cursor);
- }
-});
-
-$.ui.plugin.add("draggable", "iframeFix", {
- start: function(event, ui) {
- var o = $(this).data('draggable').options;
- $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
- $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
- .css({
- width: this.offsetWidth+"px", height: this.offsetHeight+"px",
- position: "absolute", opacity: "0.001", zIndex: 1000
- })
- .css($(this).offset())
- .appendTo("body");
- });
- },
- stop: function(event, ui) {
- $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
- }
-});
-
-$.ui.plugin.add("draggable", "opacity", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data('draggable').options;
- if(t.css("opacity")) o._opacity = t.css("opacity");
- t.css('opacity', o.opacity);
- },
- stop: function(event, ui) {
- var o = $(this).data('draggable').options;
- if(o._opacity) $(ui.helper).css('opacity', o._opacity);
- }
-});
-
-$.ui.plugin.add("draggable", "scroll", {
- start: function(event, ui) {
- var i = $(this).data("draggable");
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
- },
- drag: function(event, ui) {
-
- var i = $(this).data("draggable"), o = i.options, scrolled = false;
-
- if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
-
- if(!o.axis || o.axis != 'x') {
- if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
- i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
- }
-
- if(!o.axis || o.axis != 'y') {
- if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
- i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
- }
-
- } else {
-
- if(!o.axis || o.axis != 'x') {
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
- }
-
- if(!o.axis || o.axis != 'y') {
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
- }
-
- }
-
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(i, event);
-
- }
-});
-
-$.ui.plugin.add("draggable", "snap", {
- start: function(event, ui) {
-
- var i = $(this).data("draggable"), o = i.options;
- i.snapElements = [];
-
- $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
- var $t = $(this); var $o = $t.offset();
- if(this != i.element[0]) i.snapElements.push({
- item: this,
- width: $t.outerWidth(), height: $t.outerHeight(),
- top: $o.top, left: $o.left
- });
- });
-
- },
- drag: function(event, ui) {
-
- var inst = $(this).data("draggable"), o = inst.options;
- var d = o.snapTolerance;
-
- var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
- y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
-
- for (var i = inst.snapElements.length - 1; i >= 0; i--){
-
- var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
- t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
-
- //Yes, I know, this is insane ;)
- if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
- if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = false;
- continue;
- }
-
- if(o.snapMode != 'inner') {
- var ts = Math.abs(t - y2) <= d;
- var bs = Math.abs(b - y1) <= d;
- var ls = Math.abs(l - x2) <= d;
- var rs = Math.abs(r - x1) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
- }
-
- var first = (ts || bs || ls || rs);
-
- if(o.snapMode != 'outer') {
- var ts = Math.abs(t - y1) <= d;
- var bs = Math.abs(b - y2) <= d;
- var ls = Math.abs(l - x1) <= d;
- var rs = Math.abs(r - x2) <= d;
- if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
- if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
- if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
- if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
- }
-
- if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
- (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
- inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
-
- };
-
- }
-});
-
-$.ui.plugin.add("draggable", "stack", {
- start: function(event, ui) {
-
- var o = $(this).data("draggable").options;
-
- var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
- return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
- });
-
- $(group).each(function(i) {
- this.style.zIndex = o.stack.min + i;
- });
-
- this[0].style.zIndex = o.stack.min + group.length;
-
- }
-});
-
-$.ui.plugin.add("draggable", "zIndex", {
- start: function(event, ui) {
- var t = $(ui.helper), o = $(this).data("draggable").options;
- if(t.css("zIndex")) o._zIndex = t.css("zIndex");
- t.css('zIndex', o.zIndex);
- },
- stop: function(event, ui) {
- var o = $(this).data("draggable").options;
- if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Droppable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- * ui.core.js
- * ui.draggable.js
- */
-(function($) {
-
-$.widget("ui.droppable", {
-
- _init: function() {
-
- var o = this.options, accept = o.accept;
- this.isover = 0; this.isout = 1;
-
- this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
- return d.is(accept);
- };
-
- //Store the droppable's proportions
- this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
-
- // Add the reference and positions to the manager
- $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
- $.ui.ddmanager.droppables[this.options.scope].push(this);
-
- (this.options.addClasses && this.element.addClass("ui-droppable"));
-
- },
-
- destroy: function() {
- var drop = $.ui.ddmanager.droppables[this.options.scope];
- for ( var i = 0; i < drop.length; i++ )
- if ( drop[i] == this )
- drop.splice(i, 1);
-
- this.element
- .removeClass("ui-droppable ui-droppable-disabled")
- .removeData("droppable")
- .unbind(".droppable");
- },
-
- _setData: function(key, value) {
-
- if(key == 'accept') {
- this.options.accept = value && $.isFunction(value) ? value : function(d) {
- return d.is(value);
- };
- } else {
- $.widget.prototype._setData.apply(this, arguments);
- }
-
- },
-
- _activate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.addClass(this.options.activeClass);
- (draggable && this._trigger('activate', event, this.ui(draggable)));
- },
-
- _deactivate: function(event) {
- var draggable = $.ui.ddmanager.current;
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- (draggable && this._trigger('deactivate', event, this.ui(draggable)));
- },
-
- _over: function(event) {
-
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
- this._trigger('over', event, this.ui(draggable));
- }
-
- },
-
- _out: function(event) {
-
- var draggable = $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
- if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('out', event, this.ui(draggable));
- }
-
- },
-
- _drop: function(event,custom) {
-
- var draggable = custom || $.ui.ddmanager.current;
- if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
-
- var childrenIntersection = false;
- this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
- var inst = $.data(this, 'droppable');
- if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
- childrenIntersection = true; return false;
- }
- });
- if(childrenIntersection) return false;
-
- if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
- if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
- this._trigger('drop', event, this.ui(draggable));
- return this.element;
- }
-
- return false;
-
- },
-
- ui: function(c) {
- return {
- draggable: (c.currentItem || c.element),
- helper: c.helper,
- position: c.position,
- absolutePosition: c.positionAbs, //deprecated
- offset: c.positionAbs
- };
- }
-
-});
-
-$.extend($.ui.droppable, {
- version: "1.7.1",
- eventPrefix: 'drop',
- defaults: {
- accept: '*',
- activeClass: false,
- addClasses: true,
- greedy: false,
- hoverClass: false,
- scope: 'default',
- tolerance: 'intersect'
- }
-});
-
-$.ui.intersect = function(draggable, droppable, toleranceMode) {
-
- if (!droppable.offset) return false;
-
- var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
- y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
- var l = droppable.offset.left, r = l + droppable.proportions.width,
- t = droppable.offset.top, b = t + droppable.proportions.height;
-
- switch (toleranceMode) {
- case 'fit':
- return (l < x1 && x2 < r
- && t < y1 && y2 < b);
- break;
- case 'intersect':
- return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
- && x2 - (draggable.helperProportions.width / 2) < r // Left Half
- && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
- && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
- break;
- case 'pointer':
- var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
- draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
- isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
- return isOver;
- break;
- case 'touch':
- return (
- (y1 >= t && y1 <= b) || // Top edge touching
- (y2 >= t && y2 <= b) || // Bottom edge touching
- (y1 < t && y2 > b) // Surrounded vertically
- ) && (
- (x1 >= l && x1 <= r) || // Left edge touching
- (x2 >= l && x2 <= r) || // Right edge touching
- (x1 < l && x2 > r) // Surrounded horizontally
- );
- break;
- default:
- return false;
- break;
- }
-
-};
-
-/*
- This manager tracks offsets of draggables and droppables
-*/
-$.ui.ddmanager = {
- current: null,
- droppables: { 'default': [] },
- prepareOffsets: function(t, event) {
-
- var m = $.ui.ddmanager.droppables[t.options.scope];
- var type = event ? event.type : null; // workaround for #2317
- var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
-
- droppablesLoop: for (var i = 0; i < m.length; i++) {
-
- if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
- for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
- m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
-
- m[i].offset = m[i].element.offset();
- m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
-
- if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
-
- }
-
- },
- drop: function(draggable, event) {
-
- var dropped = false;
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
-
- if(!this.options) return;
- if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
- dropped = this._drop.call(this, event);
-
- if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
- this.isout = 1; this.isover = 0;
- this._deactivate.call(this, event);
- }
-
- });
- return dropped;
-
- },
- drag: function(draggable, event) {
-
- //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
- if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
-
- //Run through all droppables and check their positions based on specific tolerance options
-
- $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
-
- if(this.options.disabled || this.greedyChild || !this.visible) return;
- var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
-
- var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
- if(!c) return;
-
- var parentInstance;
- if (this.options.greedy) {
- var parent = this.element.parents(':data(droppable):eq(0)');
- if (parent.length) {
- parentInstance = $.data(parent[0], 'droppable');
- parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
- }
- }
-
- // we just moved into a greedy child
- if (parentInstance && c == 'isover') {
- parentInstance['isover'] = 0;
- parentInstance['isout'] = 1;
- parentInstance._out.call(parentInstance, event);
- }
-
- this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
- this[c == "isover" ? "_over" : "_out"].call(this, event);
-
- // we just moved out of a greedy child
- if (parentInstance && c == 'isout') {
- parentInstance['isout'] = 0;
- parentInstance['isover'] = 1;
- parentInstance._over.call(parentInstance, event);
- }
- });
-
- }
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Progressbar 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.progressbar", {
-
- _init: function() {
-
- this.element
- .addClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .attr({
- role: "progressbar",
- "aria-valuemin": this._valueMin(),
- "aria-valuemax": this._valueMax(),
- "aria-valuenow": this._value()
- });
-
- this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
-
- this._refreshValue();
-
- },
-
- destroy: function() {
-
- this.element
- .removeClass("ui-progressbar"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeAttr("role")
- .removeAttr("aria-valuemin")
- .removeAttr("aria-valuemax")
- .removeAttr("aria-valuenow")
- .removeData("progressbar")
- .unbind(".progressbar");
-
- this.valueDiv.remove();
-
- $.widget.prototype.destroy.apply(this, arguments);
-
- },
-
- value: function(newValue) {
- arguments.length && this._setData("value", newValue);
- return this._value();
- },
-
- _setData: function(key, value) {
-
- switch (key) {
- case 'value':
- this.options.value = value;
- this._refreshValue();
- this._trigger('change', null, {});
- break;
- }
-
- $.widget.prototype._setData.apply(this, arguments);
-
- },
-
- _value: function() {
-
- var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
-
- },
-
- _valueMin: function() {
- var valueMin = 0;
- return valueMin;
- },
-
- _valueMax: function() {
- var valueMax = 100;
- return valueMax;
- },
-
- _refreshValue: function() {
- var value = this.value();
- this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
- this.valueDiv.width(value + '%');
- this.element.attr("aria-valuenow", value);
- }
-
-});
-
-$.extend($.ui.progressbar, {
- version: "1.7.1",
- defaults: {
- value: 0
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Resizable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- var self = this, o = this.options;
- this.element.addClass("ui-resizable");
-
- $.extend(this, {
- _aspectRatio: !!(o.aspectRatio),
- aspectRatio: o.aspectRatio,
- originalElement: this.element,
- _proportionallyResizeElements: [],
- _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
- });
-
- //Wrap the element if it cannot hold child nodes
- if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
-
- //Opera fix for relative positioning
- if (/relative/.test(this.element.css('position')) && $.browser.opera)
- this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
-
- //Create a wrapper element and set the wrapper to the new current internal element
- this.element.wrap(
- $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
- position: this.element.css('position'),
- width: this.element.outerWidth(),
- height: this.element.outerHeight(),
- top: this.element.css('top'),
- left: this.element.css('left')
- })
- );
-
- //Overwrite the original this.element
- this.element = this.element.parent().data(
- "resizable", this.element.data('resizable')
- );
-
- this.elementIsWrapper = true;
-
- //Move margins to the wrapper
- this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
- this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
-
- //Prevent Safari textarea resize
- this.originalResizeStyle = this.originalElement.css('resize');
- this.originalElement.css('resize', 'none');
-
- //Push the actual element to our proportionallyResize internal array
- this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
-
- // avoid IE jump (hard set the margin)
- this.originalElement.css({ margin: this.originalElement.css('margin') });
-
- // fix handlers offset
- this._proportionallyResize();
-
- }
-
- this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
- if(this.handles.constructor == String) {
-
- if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
- var n = this.handles.split(","); this.handles = {};
-
- for(var i = 0; i < n.length; i++) {
-
- var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
- var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
-
- // increase zIndex of sw, se, ne, nw axis
- //TODO : this modifies original option
- if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
-
- //TODO : What's going on here?
- if ('se' == handle) {
- axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
- };
-
- //Insert into internal handles object and append to element
- this.handles[handle] = '.ui-resizable-'+handle;
- this.element.append(axis);
- }
-
- }
-
- this._renderAxis = function(target) {
-
- target = target || this.element;
-
- for(var i in this.handles) {
-
- if(this.handles[i].constructor == String)
- this.handles[i] = $(this.handles[i], this.element).show();
-
- //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
- if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
-
- var axis = $(this.handles[i], this.element), padWrapper = 0;
-
- //Checking the correct pad and border
- padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
-
- //The padding type i have to apply...
- var padPos = [ 'padding',
- /ne|nw|n/.test(i) ? 'Top' :
- /se|sw|s/.test(i) ? 'Bottom' :
- /^e$/.test(i) ? 'Right' : 'Left' ].join("");
-
- target.css(padPos, padWrapper);
-
- this._proportionallyResize();
-
- }
-
- //TODO: What's that good for? There's not anything to be executed left
- if(!$(this.handles[i]).length)
- continue;
-
- }
- };
-
- //TODO: make renderAxis a prototype function
- this._renderAxis(this.element);
-
- this._handles = $('.ui-resizable-handle', this.element)
- .disableSelection();
-
- //Matching axis name
- this._handles.mouseover(function() {
- if (!self.resizing) {
- if (this.className)
- var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
- //Axis, default = se
- self.axis = axis && axis[1] ? axis[1] : 'se';
- }
- });
-
- //If we want to auto hide the elements
- if (o.autoHide) {
- this._handles.hide();
- $(this.element)
- .addClass("ui-resizable-autohide")
- .hover(function() {
- $(this).removeClass("ui-resizable-autohide");
- self._handles.show();
- },
- function(){
- if (!self.resizing) {
- $(this).addClass("ui-resizable-autohide");
- self._handles.hide();
- }
- });
- }
-
- //Initialize the mouse interaction
- this._mouseInit();
-
- },
-
- destroy: function() {
-
- this._mouseDestroy();
-
- var _destroy = function(exp) {
- $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
- .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
- };
-
- //TODO: Unwrap at same DOM position
- if (this.elementIsWrapper) {
- _destroy(this.element);
- var wrapper = this.element;
- wrapper.parent().append(
- this.originalElement.css({
- position: wrapper.css('position'),
- width: wrapper.outerWidth(),
- height: wrapper.outerHeight(),
- top: wrapper.css('top'),
- left: wrapper.css('left')
- })
- ).end().remove();
- }
-
- this.originalElement.css('resize', this.originalResizeStyle);
- _destroy(this.originalElement);
-
- },
-
- _mouseCapture: function(event) {
-
- var handle = false;
- for(var i in this.handles) {
- if($(this.handles[i])[0] == event.target) handle = true;
- }
-
- return this.options.disabled || !!handle;
-
- },
-
- _mouseStart: function(event) {
-
- var o = this.options, iniPos = this.element.position(), el = this.element;
-
- this.resizing = true;
- this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
-
- // bugfix for http://dev.jquery.com/ticket/1749
- if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
- el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
- }
-
- //Opera fixing relative position
- if ($.browser.opera && (/relative/).test(el.css('position')))
- el.css({ position: 'relative', top: 'auto', left: 'auto' });
-
- this._renderProxy();
-
- var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
-
- if (o.containment) {
- curleft += $(o.containment).scrollLeft() || 0;
- curtop += $(o.containment).scrollTop() || 0;
- }
-
- //Store needed variables
- this.offset = this.helper.offset();
- this.position = { left: curleft, top: curtop };
- this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
- this.originalPosition = { left: curleft, top: curtop };
- this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
- this.originalMousePosition = { left: event.pageX, top: event.pageY };
-
- //Aspect Ratio
- this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
-
- var cursor = $('.ui-resizable-' + this.axis).css('cursor');
- $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
-
- el.addClass("ui-resizable-resizing");
- this._propagate("start", event);
- return true;
- },
-
- _mouseDrag: function(event) {
-
- //Increase performance, avoid regex
- var el = this.helper, o = this.options, props = {},
- self = this, smp = this.originalMousePosition, a = this.axis;
-
- var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
- var trigger = this._change[a];
- if (!trigger) return false;
-
- // Calculate the attrs that will be change
- var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
-
- if (this._aspectRatio || event.shiftKey)
- data = this._updateRatio(data, event);
-
- data = this._respectSize(data, event);
-
- // plugins callbacks need to be called first
- this._propagate("resize", event);
-
- el.css({
- top: this.position.top + "px", left: this.position.left + "px",
- width: this.size.width + "px", height: this.size.height + "px"
- });
-
- if (!this._helper && this._proportionallyResizeElements.length)
- this._proportionallyResize();
-
- this._updateCache(data);
-
- // calling the user callback at the end
- this._trigger('resize', event, this.ui());
-
- return false;
- },
-
- _mouseStop: function(event) {
-
- this.resizing = false;
- var o = this.options, self = this;
-
- if(this._helper) {
- var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
-
- var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
- if (!o.animate)
- this.element.css($.extend(s, { top: top, left: left }));
-
- self.helper.height(self.size.height);
- self.helper.width(self.size.width);
-
- if (this._helper && !o.animate) this._proportionallyResize();
- }
-
- $('body').css('cursor', 'auto');
-
- this.element.removeClass("ui-resizable-resizing");
-
- this._propagate("stop", event);
-
- if (this._helper) this.helper.remove();
- return false;
-
- },
-
- _updateCache: function(data) {
- var o = this.options;
- this.offset = this.helper.offset();
- if (isNumber(data.left)) this.position.left = data.left;
- if (isNumber(data.top)) this.position.top = data.top;
- if (isNumber(data.height)) this.size.height = data.height;
- if (isNumber(data.width)) this.size.width = data.width;
- },
-
- _updateRatio: function(data, event) {
-
- var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
-
- if (data.height) data.width = (csize.height * this.aspectRatio);
- else if (data.width) data.height = (csize.width / this.aspectRatio);
-
- if (a == 'sw') {
- data.left = cpos.left + (csize.width - data.width);
- data.top = null;
- }
- if (a == 'nw') {
- data.top = cpos.top + (csize.height - data.height);
- data.left = cpos.left + (csize.width - data.width);
- }
-
- return data;
- },
-
- _respectSize: function(data, event) {
-
- var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
- ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
- isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
-
- if (isminw) data.width = o.minWidth;
- if (isminh) data.height = o.minHeight;
- if (ismaxw) data.width = o.maxWidth;
- if (ismaxh) data.height = o.maxHeight;
-
- var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
- var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
-
- if (isminw && cw) data.left = dw - o.minWidth;
- if (ismaxw && cw) data.left = dw - o.maxWidth;
- if (isminh && ch) data.top = dh - o.minHeight;
- if (ismaxh && ch) data.top = dh - o.maxHeight;
-
- // fixing jump error on top/left - bug #2330
- var isNotwh = !data.width && !data.height;
- if (isNotwh && !data.left && data.top) data.top = null;
- else if (isNotwh && !data.top && data.left) data.left = null;
-
- return data;
- },
-
- _proportionallyResize: function() {
-
- var o = this.options;
- if (!this._proportionallyResizeElements.length) return;
- var element = this.helper || this.element;
-
- for (var i=0; i < this._proportionallyResizeElements.length; i++) {
-
- var prel = this._proportionallyResizeElements[i];
-
- if (!this.borderDif) {
- var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
- p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
-
- this.borderDif = $.map(b, function(v, i) {
- var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
- return border + padding;
- });
- }
-
- if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
- continue;
-
- prel.css({
- height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
- width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
- });
-
- };
-
- },
-
- _renderProxy: function() {
-
- var el = this.element, o = this.options;
- this.elementOffset = el.offset();
-
- if(this._helper) {
-
- this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
-
- // fix ie6 offset TODO: This seems broken
- var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
- pxyoffset = ( ie6 ? 2 : -1 );
-
- this.helper.addClass(this._helper).css({
- width: this.element.outerWidth() + pxyoffset,
- height: this.element.outerHeight() + pxyoffset,
- position: 'absolute',
- left: this.elementOffset.left - ie6offset +'px',
- top: this.elementOffset.top - ie6offset +'px',
- zIndex: ++o.zIndex //TODO: Don't modify option
- });
-
- this.helper
- .appendTo("body")
- .disableSelection();
-
- } else {
- this.helper = this.element;
- }
-
- },
-
- _change: {
- e: function(event, dx, dy) {
- return { width: this.originalSize.width + dx };
- },
- w: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { left: sp.left + dx, width: cs.width - dx };
- },
- n: function(event, dx, dy) {
- var o = this.options, cs = this.originalSize, sp = this.originalPosition;
- return { top: sp.top + dy, height: cs.height - dy };
- },
- s: function(event, dx, dy) {
- return { height: this.originalSize.height + dy };
- },
- se: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- sw: function(event, dx, dy) {
- return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- },
- ne: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
- },
- nw: function(event, dx, dy) {
- return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
- }
- },
-
- _propagate: function(n, event) {
- $.ui.plugin.call(this, n, [event, this.ui()]);
- (n != "resize" && this._trigger(n, event, this.ui()));
- },
-
- plugins: {},
-
- ui: function() {
- return {
- originalElement: this.originalElement,
- element: this.element,
- helper: this.helper,
- position: this.position,
- size: this.size,
- originalSize: this.originalSize,
- originalPosition: this.originalPosition
- };
- }
-
-}));
-
-$.extend($.ui.resizable, {
- version: "1.7.1",
- eventPrefix: "resize",
- defaults: {
- alsoResize: false,
- animate: false,
- animateDuration: "slow",
- animateEasing: "swing",
- aspectRatio: false,
- autoHide: false,
- cancel: ":input,option",
- containment: false,
- delay: 0,
- distance: 1,
- ghost: false,
- grid: false,
- handles: "e,s,se",
- helper: false,
- maxHeight: null,
- maxWidth: null,
- minHeight: 10,
- minWidth: 10,
- zIndex: 1000
- }
-});
-
-/*
- * Resizable Extensions
- */
-
-$.ui.plugin.add("resizable", "alsoResize", {
-
- start: function(event, ui) {
-
- var self = $(this).data("resizable"), o = self.options;
-
- _store = function(exp) {
- $(exp).each(function() {
- $(this).data("resizable-alsoresize", {
- width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
- left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
- });
- });
- };
-
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
- if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
- else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
- }else{
- _store(o.alsoResize);
- }
- },
-
- resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
-
- var delta = {
- height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
- top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
- },
-
- _alsoResize = function(exp, c) {
- $(exp).each(function() {
- var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
-
- $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
- var sum = (start[prop]||0) + (delta[prop]||0);
- if (sum && sum >= 0)
- style[prop] = sum || null;
- });
-
- //Opera fixing relative position
- if (/relative/.test(el.css('position')) && $.browser.opera) {
- self._revertToRelativePosition = true;
- el.css({ position: 'absolute', top: 'auto', left: 'auto' });
- }
-
- el.css(style);
- });
- };
-
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
- $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
- }else{
- _alsoResize(o.alsoResize);
- }
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable");
-
- //Opera fixing relative position
- if (self._revertToRelativePosition && $.browser.opera) {
- self._revertToRelativePosition = false;
- el.css({ position: 'relative' });
- }
-
- $(this).removeData("resizable-alsoresize-start");
- }
-});
-
-$.ui.plugin.add("resizable", "animate", {
-
- stop: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options;
-
- var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
-
- var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
- self.element.animate(
- $.extend(style, top && left ? { top: top, left: left } : {}), {
- duration: o.animateDuration,
- easing: o.animateEasing,
- step: function() {
-
- var data = {
- width: parseInt(self.element.css('width'), 10),
- height: parseInt(self.element.css('height'), 10),
- top: parseInt(self.element.css('top'), 10),
- left: parseInt(self.element.css('left'), 10)
- };
-
- if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
-
- // propagating resize, and updating values for each animation step
- self._updateCache(data);
- self._propagate("resize", event);
-
- }
- }
- );
- }
-
-});
-
-$.ui.plugin.add("resizable", "containment", {
-
- start: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, el = self.element;
- var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
- if (!ce) return;
-
- self.containerElement = $(ce);
-
- if (/document/.test(oc) || oc == document) {
- self.containerOffset = { left: 0, top: 0 };
- self.containerPosition = { left: 0, top: 0 };
-
- self.parentData = {
- element: $(document), left: 0, top: 0,
- width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
- };
- }
-
- // i'm a node, so compute top, left, right, bottom
- else {
- var element = $(ce), p = [];
- $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
-
- self.containerOffset = element.offset();
- self.containerPosition = element.position();
- self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
-
- var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
- width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
-
- self.parentData = {
- element: ce, left: co.left, top: co.top, width: width, height: height
- };
- }
- },
-
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options,
- ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
- pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
-
- if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
-
- if (cp.left < (self._helper ? co.left : 0)) {
- self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
- if (pRatio) self.size.height = self.size.width / o.aspectRatio;
- self.position.left = o.helper ? co.left : 0;
- }
-
- if (cp.top < (self._helper ? co.top : 0)) {
- self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
- if (pRatio) self.size.width = self.size.height * o.aspectRatio;
- self.position.top = self._helper ? co.top : 0;
- }
-
- self.offset.left = self.parentData.left+self.position.left;
- self.offset.top = self.parentData.top+self.position.top;
-
- var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
- hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
-
- var isParent = self.containerElement.get(0) == self.element.parent().get(0),
- isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
-
- if(isParent && isOffsetRelative) woset -= self.parentData.left;
-
- if (woset + self.size.width >= self.parentData.width) {
- self.size.width = self.parentData.width - woset;
- if (pRatio) self.size.height = self.size.width / self.aspectRatio;
- }
-
- if (hoset + self.size.height >= self.parentData.height) {
- self.size.height = self.parentData.height - hoset;
- if (pRatio) self.size.width = self.size.height * self.aspectRatio;
- }
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, cp = self.position,
- co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
-
- var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
-
- if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
- if (self._helper && !o.animate && (/static/).test(ce.css('position')))
- $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
- }
-});
-
-$.ui.plugin.add("resizable", "ghost", {
-
- start: function(event, ui) {
-
- var self = $(this).data("resizable"), o = self.options, cs = self.size;
-
- self.ghost = self.originalElement.clone();
- self.ghost
- .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
- .addClass('ui-resizable-ghost')
- .addClass(typeof o.ghost == 'string' ? o.ghost : '');
-
- self.ghost.appendTo(self.helper);
-
- },
-
- resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
- },
-
- stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
- }
-
-});
-
-$.ui.plugin.add("resizable", "grid", {
-
- resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
- o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
- var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
-
- if (/^(se|s|e)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- }
- else if (/^(ne)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- }
- else if (/^(sw)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.left = op.left - ox;
- }
- else {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- self.position.left = op.left - ox;
- }
- }
-
-});
-
-var num = function(v) {
- return parseInt(v, 10) || 0;
-};
-
-var isNumber = function(value) {
- return !isNaN(parseInt(value, 10));
-};
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Selectable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
-
- _init: function() {
- var self = this;
-
- this.element.addClass("ui-selectable");
-
- this.dragged = false;
-
- // cache selectee children based on filter
- var selectees;
- this.refresh = function() {
- selectees = $(self.options.filter, self.element[0]);
- selectees.each(function() {
- var $this = $(this);
- var pos = $this.offset();
- $.data(this, "selectable-item", {
- element: this,
- $element: $this,
- left: pos.left,
- top: pos.top,
- right: pos.left + $this.outerWidth(),
- bottom: pos.top + $this.outerHeight(),
- startselected: false,
- selected: $this.hasClass('ui-selected'),
- selecting: $this.hasClass('ui-selecting'),
- unselecting: $this.hasClass('ui-unselecting')
- });
- });
- };
- this.refresh();
-
- this.selectees = selectees.addClass("ui-selectee");
-
- this._mouseInit();
-
- this.helper = $(document.createElement('div'))
- .css({border:'1px dotted black'})
- .addClass("ui-selectable-helper");
- },
-
- destroy: function() {
- this.element
- .removeClass("ui-selectable ui-selectable-disabled")
- .removeData("selectable")
- .unbind(".selectable");
- this._mouseDestroy();
- },
-
- _mouseStart: function(event) {
- var self = this;
-
- this.opos = [event.pageX, event.pageY];
-
- if (this.options.disabled)
- return;
-
- var options = this.options;
-
- this.selectees = $(options.filter, this.element[0]);
-
- this._trigger("start", event);
-
- $(options.appendTo).append(this.helper);
- // position helper (lasso)
- this.helper.css({
- "z-index": 100,
- "position": "absolute",
- "left": event.clientX,
- "top": event.clientY,
- "width": 0,
- "height": 0
- });
-
- if (options.autoRefresh) {
- this.refresh();
- }
-
- this.selectees.filter('.ui-selected').each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.startselected = true;
- if (!event.metaKey) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- });
-
- $(event.target).parents().andSelf().each(function() {
- var selectee = $.data(this, "selectable-item");
- if (selectee) {
- selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
- selectee.unselecting = false;
- selectee.selecting = true;
- selectee.selected = true;
- // selectable SELECTING callback
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- return false;
- }
- });
-
- },
-
- _mouseDrag: function(event) {
- var self = this;
- this.dragged = true;
-
- if (this.options.disabled)
- return;
-
- var options = this.options;
-
- var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
- if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
- if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
- this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
-
- this.selectees.each(function() {
- var selectee = $.data(this, "selectable-item");
- //prevent helper from being selected if appendTo: selectable
- if (!selectee || selectee.element == self.element[0])
- return;
- var hit = false;
- if (options.tolerance == 'touch') {
- hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
- } else if (options.tolerance == 'fit') {
- hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
- }
-
- if (hit) {
- // SELECT
- if (selectee.selected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
- }
- if (selectee.unselecting) {
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- }
- if (!selectee.selecting) {
- selectee.$element.addClass('ui-selecting');
- selectee.selecting = true;
- // selectable SELECTING callback
- self._trigger("selecting", event, {
- selecting: selectee.element
- });
- }
- } else {
- // UNSELECT
- if (selectee.selecting) {
- if (event.metaKey && selectee.startselected) {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- selectee.$element.addClass('ui-selected');
- selectee.selected = true;
- } else {
- selectee.$element.removeClass('ui-selecting');
- selectee.selecting = false;
- if (selectee.startselected) {
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- }
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- if (selectee.selected) {
- if (!event.metaKey && !selectee.startselected) {
- selectee.$element.removeClass('ui-selected');
- selectee.selected = false;
-
- selectee.$element.addClass('ui-unselecting');
- selectee.unselecting = true;
- // selectable UNSELECTING callback
- self._trigger("unselecting", event, {
- unselecting: selectee.element
- });
- }
- }
- }
- });
-
- return false;
- },
-
- _mouseStop: function(event) {
- var self = this;
-
- this.dragged = false;
-
- var options = this.options;
-
- $('.ui-unselecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-unselecting');
- selectee.unselecting = false;
- selectee.startselected = false;
- self._trigger("unselected", event, {
- unselected: selectee.element
- });
- });
- $('.ui-selecting', this.element[0]).each(function() {
- var selectee = $.data(this, "selectable-item");
- selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
- selectee.selecting = false;
- selectee.selected = true;
- selectee.startselected = true;
- self._trigger("selected", event, {
- selected: selectee.element
- });
- });
- this._trigger("stop", event);
-
- this.helper.remove();
-
- return false;
- }
-
-}));
-
-$.extend($.ui.selectable, {
- version: "1.7.1",
- defaults: {
- appendTo: 'body',
- autoRefresh: true,
- cancel: ":input,option",
- delay: 0,
- distance: 0,
- filter: '*',
- tolerance: 'touch'
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Slider 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- * ui.core.js
- */
-
-(function($) {
-
-$.widget("ui.slider", $.extend({}, $.ui.mouse, {
-
- _init: function() {
-
- var self = this, o = this.options;
- this._keySliding = false;
- this._handleIndex = null;
- this._detectOrientation();
- this._mouseInit();
-
- this.element
- .addClass("ui-slider"
- + " ui-slider-" + this.orientation
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all");
-
- this.range = $([]);
-
- if (o.range) {
-
- if (o.range === true) {
- this.range = $('<div></div>');
- if (!o.values) o.values = [this._valueMin(), this._valueMin()];
- if (o.values.length && o.values.length != 2) {
- o.values = [o.values[0], o.values[0]];
- }
- } else {
- this.range = $('<div></div>');
- }
-
- this.range
- .appendTo(this.element)
- .addClass("ui-slider-range");
-
- if (o.range == "min" || o.range == "max") {
- this.range.addClass("ui-slider-range-" + o.range);
- }
-
- // note: this isn't the most fittingly semantic framework class for this element,
- // but worked best visually with a variety of themes
- this.range.addClass("ui-widget-header");
-
- }
-
- if ($(".ui-slider-handle", this.element).length == 0)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
-
- if (o.values && o.values.length) {
- while ($(".ui-slider-handle", this.element).length < o.values.length)
- $('<a href="#"></a>')
- .appendTo(this.element)
- .addClass("ui-slider-handle");
- }
-
- this.handles = $(".ui-slider-handle", this.element)
- .addClass("ui-state-default"
- + " ui-corner-all");
-
- this.handle = this.handles.eq(0);
-
- this.handles.add(this.range).filter("a")
- .click(function(event) { event.preventDefault(); })
- .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); })
- .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); })
- .blur(function() { $(this).removeClass('ui-state-focus'); });
-
- this.handles.each(function(i) {
- $(this).data("index.ui-slider-handle", i);
- });
-
- this.handles.keydown(function(event) {
-
- var ret = true;
-
- var index = $(this).data("index.ui-slider-handle");
-
- if (self.options.disabled)
- return;
-
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- case $.ui.keyCode.END:
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- ret = false;
- if (!self._keySliding) {
- self._keySliding = true;
- $(this).addClass("ui-state-active");
- self._start(event, index);
- }
- break;
- }
-
- var curVal, newVal, step = self._step();
- if (self.options.values && self.options.values.length) {
- curVal = newVal = self.values(index);
- } else {
- curVal = newVal = self.value();
- }
-
- switch (event.keyCode) {
- case $.ui.keyCode.HOME:
- newVal = self._valueMin();
- break;
- case $.ui.keyCode.END:
- newVal = self._valueMax();
- break;
- case $.ui.keyCode.UP:
- case $.ui.keyCode.RIGHT:
- if(curVal == self._valueMax()) return;
- newVal = curVal + step;
- break;
- case $.ui.keyCode.DOWN:
- case $.ui.keyCode.LEFT:
- if(curVal == self._valueMin()) return;
- newVal = curVal - step;
- break;
- }
-
- self._slide(event, index, newVal);
-
- return ret;
-
- }).keyup(function(event) {
-
- var index = $(this).data("index.ui-slider-handle");
-
- if (self._keySliding) {
- self._stop(event, index);
- self._change(event, index);
- self._keySliding = false;
- $(this).removeClass("ui-state-active");
- }
-
- });
-
- this._refreshValue();
-
- },
-
- destroy: function() {
-
- this.handles.remove();
- this.range.remove();
-
- this.element
- .removeClass("ui-slider"
- + " ui-slider-horizontal"
- + " ui-slider-vertical"
- + " ui-slider-disabled"
- + " ui-widget"
- + " ui-widget-content"
- + " ui-corner-all")
- .removeData("slider")
- .unbind(".slider");
-
- this._mouseDestroy();
-
- },
-
- _mouseCapture: function(event) {
-
- var o = this.options;
-
- if (o.disabled)
- return false;
-
- this.elementSize = {
- width: this.element.outerWidth(),
- height: this.element.outerHeight()
- };
- this.elementOffset = this.element.offset();
-
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
-
- var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
- var self = this, index;
- this.handles.each(function(i) {
- var thisDistance = Math.abs(normValue - self.values(i));
- if (distance > thisDistance) {
- distance = thisDistance;
- closestHandle = $(this);
- index = i;
- }
- });
-
- // workaround for bug #3736 (if both handles of a range are at 0,
- // the first is always used as the one with least distance,
- // and moving it is obviously prevented by preventing negative ranges)
- if(o.range == true && this.values(1) == o.min) {
- closestHandle = $(this.handles[++index]);
- }
-
- this._start(event, index);
-
- self._handleIndex = index;
-
- closestHandle
- .addClass("ui-state-active")
- .focus();
-
- var offset = closestHandle.offset();
- var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
- this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
- left: event.pageX - offset.left - (closestHandle.width() / 2),
- top: event.pageY - offset.top
- - (closestHandle.height() / 2)
- - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
- - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
- + (parseInt(closestHandle.css('marginTop'),10) || 0)
- };
-
- normValue = this._normValueFromMouse(position);
- this._slide(event, index, normValue);
- return true;
-
- },
-
- _mouseStart: function(event) {
- return true;
- },
-
- _mouseDrag: function(event) {
-
- var position = { x: event.pageX, y: event.pageY };
- var normValue = this._normValueFromMouse(position);
-
- this._slide(event, this._handleIndex, normValue);
-
- return false;
-
- },
-
- _mouseStop: function(event) {
-
- this.handles.removeClass("ui-state-active");
- this._stop(event, this._handleIndex);
- this._change(event, this._handleIndex);
- this._handleIndex = null;
- this._clickOffset = null;
-
- return false;
-
- },
-
- _detectOrientation: function() {
- this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
- },
-
- _normValueFromMouse: function(position) {
-
- var pixelTotal, pixelMouse;
- if ('horizontal' == this.orientation) {
- pixelTotal = this.elementSize.width;
- pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
- } else {
- pixelTotal = this.elementSize.height;
- pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
- }
-
- var percentMouse = (pixelMouse / pixelTotal);
- if (percentMouse > 1) percentMouse = 1;
- if (percentMouse < 0) percentMouse = 0;
- if ('vertical' == this.orientation)
- percentMouse = 1 - percentMouse;
-
- var valueTotal = this._valueMax() - this._valueMin(),
- valueMouse = percentMouse * valueTotal,
- valueMouseModStep = valueMouse % this.options.step,
- normValue = this._valueMin() + valueMouse - valueMouseModStep;
-
- if (valueMouseModStep > (this.options.step / 2))
- normValue += this.options.step;
-
- // Since JavaScript has problems with large floats, round
- // the final value to 5 digits after the decimal point (see #4124)
- return parseFloat(normValue.toFixed(5));
-
- },
-
- _start: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("start", event, uiHash);
- },
-
- _slide: function(event, index, newVal) {
-
- var handle = this.handles[index];
-
- if (this.options.values && this.options.values.length) {
-
- var otherVal = this.values(index ? 0 : 1);
-
- if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal))
- newVal = otherVal;
-
- if (newVal != this.values(index)) {
- var newValues = this.values();
- newValues[index] = newVal;
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal,
- values: newValues
- });
- var otherVal = this.values(index ? 0 : 1);
- if (allowed !== false) {
- this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
- }
- }
-
- } else {
-
- if (newVal != this.value()) {
- // A slide can be canceled by returning false from the slide callback
- var allowed = this._trigger("slide", event, {
- handle: this.handles[index],
- value: newVal
- });
- if (allowed !== false) {
- this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
- }
-
- }
-
- }
-
- },
-
- _stop: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("stop", event, uiHash);
- },
-
- _change: function(event, index) {
- var uiHash = {
- handle: this.handles[index],
- value: this.value()
- };
- if (this.options.values && this.options.values.length) {
- uiHash.value = this.values(index)
- uiHash.values = this.values()
- }
- this._trigger("change", event, uiHash);
- },
-
- value: function(newValue) {
-
- if (arguments.length) {
- this._setData("value", newValue);
- this._change(null, 0);
- }
-
- return this._value();
-
- },
-
- values: function(index, newValue, animated, noPropagation) {
-
- if (arguments.length > 1) {
- this.options.values[index] = newValue;
- this._refreshValue(animated);
- if(!noPropagation) this._change(null, index);
- }
-
- if (arguments.length) {
- if (this.options.values && this.options.values.length) {
- return this._values(index);
- } else {
- return this.value();
- }
- } else {
- return this._values();
- }
-
- },
-
- _setData: function(key, value, animated) {
-
- $.widget.prototype._setData.apply(this, arguments);
-
- switch (key) {
- case 'orientation':
-
- this._detectOrientation();
-
- this.element
- .removeClass("ui-slider-horizontal ui-slider-vertical")
- .addClass("ui-slider-" + this.orientation);
- this._refreshValue(animated);
- break;
- case 'value':
- this._refreshValue(animated);
- break;
- }
-
- },
-
- _step: function() {
- var step = this.options.step;
- return step;
- },
-
- _value: function() {
-
- var val = this.options.value;
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
-
- },
-
- _values: function(index) {
-
- if (arguments.length) {
- var val = this.options.values[index];
- if (val < this._valueMin()) val = this._valueMin();
- if (val > this._valueMax()) val = this._valueMax();
-
- return val;
- } else {
- return this.options.values;
- }
-
- },
-
- _valueMin: function() {
- var valueMin = this.options.min;
- return valueMin;
- },
-
- _valueMax: function() {
- var valueMax = this.options.max;
- return valueMax;
- },
-
- _refreshValue: function(animate) {
-
- var oRange = this.options.range, o = this.options, self = this;
-
- if (this.options.values && this.options.values.length) {
- var vp0, vp1;
- this.handles.each(function(i, j) {
- var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
- if (self.options.range === true) {
- if (self.orientation == 'horizontal') {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- } else {
- (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
- (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
- }
- }
- lastValPercent = valPercent;
- });
- } else {
- var value = this.value(),
- valueMin = this._valueMin(),
- valueMax = this._valueMax(),
- valPercent = valueMax != valueMin
- ? (value - valueMin) / (valueMax - valueMin) * 100
- : 0;
- var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
- this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
-
- (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
- (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
- (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
- }
-
- }
-
-}));
-
-$.extend($.ui.slider, {
- getter: "value values",
- version: "1.7.1",
- eventPrefix: "slide",
- defaults: {
- animate: false,
- delay: 0,
- distance: 0,
- max: 100,
- min: 0,
- orientation: 'horizontal',
- range: false,
- step: 1,
- value: 0,
- values: null
- }
-});
-
-})(jQuery);
-
+++ /dev/null
-/*
- * jQuery UI Sortable 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
- _init: function() {
-
- var o = this.options;
- this.containerCache = {};
- this.element.addClass("ui-sortable");
-
- //Get the items
- this.refresh();
-
- //Let's determine if the items are floating
- this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
-
- //Let's determine the parent's offset
- this.offset = this.element.offset();
-
- //Initialize mouse events for interaction
- this._mouseInit();
-
- },
-
- destroy: function() {
- this.element
- .removeClass("ui-sortable ui-sortable-disabled")
- .removeData("sortable")
- .unbind(".sortable");
- this._mouseDestroy();
-
- for ( var i = this.items.length - 1; i >= 0; i-- )
- this.items[i].item.removeData("sortable-item");
- },
-
- _mouseCapture: function(event, overrideHandle) {
-
- if (this.reverting) {
- return false;
- }
-
- if(this.options.disabled || this.options.type == 'static') return false;
-
- //We have to refresh the items data once first
- this._refreshItems(event);
-
- //Find out if the clicked node (or one of its parents) is a actual item in this.items
- var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
- if($.data(this, 'sortable-item') == self) {
- currentItem = $(this);
- return false;
- }
- });
- if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
-
- if(!currentItem) return false;
- if(this.options.handle && !overrideHandle) {
- var validHandle = false;
-
- $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
- if(!validHandle) return false;
- }
-
- this.currentItem = currentItem;
- this._removeCurrentsFromItems();
- return true;
-
- },
-
- _mouseStart: function(event, overrideHandle, noActivation) {
-
- var o = this.options, self = this;
- this.currentContainer = this;
-
- //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
- this.refreshPositions();
-
- //Create and append the visible helper
- this.helper = this._createHelper(event);
-
- //Cache the helper size
- this._cacheHelperProportions();
-
- /*
- * - Position generation -
- * This block generates everything position related - it's the core of draggables.
- */
-
- //Cache the margins of the original element
- this._cacheMargins();
-
- //Get the next scrolling parent
- this.scrollParent = this.helper.scrollParent();
-
- //The element's absolute position on the page minus margins
- this.offset = this.currentItem.offset();
- this.offset = {
- top: this.offset.top - this.margins.top,
- left: this.offset.left - this.margins.left
- };
-
- // Only after we got the offset, we can change the helper's position to absolute
- // TODO: Still need to figure out a way to make relative sorting possible
- this.helper.css("position", "absolute");
- this.cssPosition = this.helper.css("position");
-
- $.extend(this.offset, {
- click: { //Where the click happened, relative to the element
- left: event.pageX - this.offset.left,
- top: event.pageY - this.offset.top
- },
- parent: this._getParentOffset(),
- relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
- });
-
- //Generate the original position
- this.originalPosition = this._generatePosition(event);
- this.originalPageX = event.pageX;
- this.originalPageY = event.pageY;
-
- //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
- if(o.cursorAt)
- this._adjustOffsetFromHelper(o.cursorAt);
-
- //Cache the former DOM position
- this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
-
- //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
- if(this.helper[0] != this.currentItem[0]) {
- this.currentItem.hide();
- }
-
- //Create the placeholder
- this._createPlaceholder();
-
- //Set a containment if given in the options
- if(o.containment)
- this._setContainment();
-
- if(o.cursor) { // cursor option
- if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
- $('body').css("cursor", o.cursor);
- }
-
- if(o.opacity) { // opacity option
- if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
- this.helper.css("opacity", o.opacity);
- }
-
- if(o.zIndex) { // zIndex option
- if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
- this.helper.css("zIndex", o.zIndex);
- }
-
- //Prepare scrolling
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
- this.overflowOffset = this.scrollParent.offset();
-
- //Call callbacks
- this._trigger("start", event, this._uiHash());
-
- //Recache the helper size
- if(!this._preserveHelperProportions)
- this._cacheHelperProportions();
-
-
- //Post 'activate' events to possible containers
- if(!noActivation) {
- for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
- }
-
- //Prepare possible droppables
- if($.ui.ddmanager)
- $.ui.ddmanager.current = this;
-
- if ($.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
-
- this.dragging = true;
-
- this.helper.addClass("ui-sortable-helper");
- this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
- return true;
-
- },
-
- _mouseDrag: function(event) {
-
- //Compute the helpers position
- this.position = this._generatePosition(event);
- this.positionAbs = this._convertPositionTo("absolute");
-
- if (!this.lastPositionAbs) {
- this.lastPositionAbs = this.positionAbs;
- }
-
- //Do scrolling
- if(this.options.scroll) {
- var o = this.options, scrolled = false;
- if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
-
- if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
- else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
- this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
-
- if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
- else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
- this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
-
- } else {
-
- if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
- else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
- scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
-
- if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
- else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
- scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
-
- }
-
- if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
- $.ui.ddmanager.prepareOffsets(this, event);
- }
-
- //Regenerate the absolute position used for position checks
- this.positionAbs = this._convertPositionTo("absolute");
-
- //Set the helper position
- if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
- if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
-
- //Rearrange
- for (var i = this.items.length - 1; i >= 0; i--) {
-
- //Cache variables and intersection, continue if no intersection
- var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
- if (!intersection) continue;
-
- if(itemElement != this.currentItem[0] //cannot intersect with itself
- && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
- && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
- && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
- ) {
-
- this.direction = intersection == 1 ? "down" : "up";
-
- if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
- this._rearrange(event, item);
- } else {
- break;
- }
-
- this._trigger("change", event, this._uiHash());
- break;
- }
- }
-
- //Post events to containers
- this._contactContainers(event);
-
- //Interconnect with droppables
- if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
- //Call callbacks
- this._trigger('sort', event, this._uiHash());
-
- this.lastPositionAbs = this.positionAbs;
- return false;
-
- },
-
- _mouseStop: function(event, noPropagation) {
-
- if(!event) return;
-
- //If we are using droppables, inform the manager about the drop
- if ($.ui.ddmanager && !this.options.dropBehaviour)
- $.ui.ddmanager.drop(this, event);
-
- if(this.options.revert) {
- var self = this;
- var cur = self.placeholder.offset();
-
- self.reverting = true;
-
- $(this.helper).animate({
- left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
- top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
- }, parseInt(this.options.revert, 10) || 500, function() {
- self._clear(event);
- });
- } else {
- this._clear(event, noPropagation);
- }
-
- return false;
-
- },
-
- cancel: function() {
-
- var self = this;
-
- if(this.dragging) {
-
- this._mouseUp();
-
- if(this.options.helper == "original")
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- else
- this.currentItem.show();
-
- //Post deactivating events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- this.containers[i]._trigger("deactivate", null, self._uiHash(this));
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", null, self._uiHash(this));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- }
-
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
- if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
-
- $.extend(this, {
- helper: null,
- dragging: false,
- reverting: false,
- _noFinalSort: null
- });
-
- if(this.domPosition.prev) {
- $(this.domPosition.prev).after(this.currentItem);
- } else {
- $(this.domPosition.parent).prepend(this.currentItem);
- }
-
- return true;
-
- },
-
- serialize: function(o) {
-
- var items = this._getItemsAsjQuery(o && o.connected);
- var str = []; o = o || {};
-
- $(items).each(function() {
- var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
- if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
- });
-
- return str.join('&');
-
- },
-
- toArray: function(o) {
-
- var items = this._getItemsAsjQuery(o && o.connected);
- var ret = []; o = o || {};
-
- items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
- return ret;
-
- },
-
- /* Be careful with the following core functions */
- _intersectsWith: function(item) {
-
- var x1 = this.positionAbs.left,
- x2 = x1 + this.helperProportions.width,
- y1 = this.positionAbs.top,
- y2 = y1 + this.helperProportions.height;
-
- var l = item.left,
- r = l + item.width,
- t = item.top,
- b = t + item.height;
-
- var dyClick = this.offset.click.top,
- dxClick = this.offset.click.left;
-
- var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
-
- if( this.options.tolerance == "pointer"
- || this.options.forcePointerForContainers
- || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
- ) {
- return isOverElement;
- } else {
-
- return (l < x1 + (this.helperProportions.width / 2) // Right Half
- && x2 - (this.helperProportions.width / 2) < r // Left Half
- && t < y1 + (this.helperProportions.height / 2) // Bottom Half
- && y2 - (this.helperProportions.height / 2) < b ); // Top Half
-
- }
- },
-
- _intersectsWithPointer: function(item) {
-
- var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
- isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
- isOverElement = isOverElementHeight && isOverElementWidth,
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
-
- if (!isOverElement)
- return false;
-
- return this.floating ?
- ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
- : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
-
- },
-
- _intersectsWithSides: function(item) {
-
- var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
- isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
- verticalDirection = this._getDragVerticalDirection(),
- horizontalDirection = this._getDragHorizontalDirection();
-
- if (this.floating && horizontalDirection) {
- return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
- } else {
- return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
- }
-
- },
-
- _getDragVerticalDirection: function() {
- var delta = this.positionAbs.top - this.lastPositionAbs.top;
- return delta != 0 && (delta > 0 ? "down" : "up");
- },
-
- _getDragHorizontalDirection: function() {
- var delta = this.positionAbs.left - this.lastPositionAbs.left;
- return delta != 0 && (delta > 0 ? "right" : "left");
- },
-
- refresh: function(event) {
- this._refreshItems(event);
- this.refreshPositions();
- },
-
- _connectWith: function() {
- var options = this.options;
- return options.connectWith.constructor == String
- ? [options.connectWith]
- : options.connectWith;
- },
-
- _getItemsAsjQuery: function(connected) {
-
- var self = this;
- var items = [];
- var queries = [];
- var connectWith = this._connectWith();
-
- if(connectWith && connected) {
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
- }
- };
- };
- }
-
- queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);
-
- for (var i = queries.length - 1; i >= 0; i--){
- queries[i][0].each(function() {
- items.push(this);
- });
- };
-
- return $(items);
-
- },
-
- _removeCurrentsFromItems: function() {
-
- var list = this.currentItem.find(":data(sortable-item)");
-
- for (var i=0; i < this.items.length; i++) {
-
- for (var j=0; j < list.length; j++) {
- if(list[j] == this.items[i].item[0])
- this.items.splice(i,1);
- };
-
- };
-
- },
-
- _refreshItems: function(event) {
-
- this.items = [];
- this.containers = [this];
- var items = this.items;
- var self = this;
- var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
- var connectWith = this._connectWith();
-
- if(connectWith) {
- for (var i = connectWith.length - 1; i >= 0; i--){
- var cur = $(connectWith[i]);
- for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
- if(inst && inst != this && !inst.options.disabled) {
- queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
- this.containers.push(inst);
- }
- };
- };
- }
-
- for (var i = queries.length - 1; i >= 0; i--) {
- var targetData = queries[i][1];
- var _queries = queries[i][0];
-
- for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
- var item = $(_queries[j]);
-
- item.data('sortable-item', targetData); // Data for target checking (mouse manager)
-
- items.push({
- item: item,
- instance: targetData,
- width: 0, height: 0,
- left: 0, top: 0
- });
- };
- };
-
- },
-
- refreshPositions: function(fast) {
-
- //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
- if(this.offsetParent && this.helper) {
- this.offset.parent = this._getParentOffset();
- }
-
- for (var i = this.items.length - 1; i >= 0; i--){
- var item = this.items[i];
-
- //We ignore calculating positions of all connected containers when we're not over them
- if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
- continue;
-
- var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
-
- if (!fast) {
- item.width = t.outerWidth();
- item.height = t.outerHeight();
- }
-
- var p = t.offset();
- item.left = p.left;
- item.top = p.top;
- };
-
- if(this.options.custom && this.options.custom.refreshContainers) {
- this.options.custom.refreshContainers.call(this);
- } else {
- for (var i = this.containers.length - 1; i >= 0; i--){
- var p = this.containers[i].element.offset();
- this.containers[i].containerCache.left = p.left;
- this.containers[i].containerCache.top = p.top;
- this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
- this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
- };
- }
-
- },
-
- _createPlaceholder: function(that) {
-
- var self = that || this, o = self.options;
-
- if(!o.placeholder || o.placeholder.constructor == String) {
- var className = o.placeholder;
- o.placeholder = {
- element: function() {
-
- var el = $(document.createElement(self.currentItem[0].nodeName))
- .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
- .removeClass("ui-sortable-helper")[0];
-
- if(!className)
- el.style.visibility = "hidden";
-
- return el;
- },
- update: function(container, p) {
-
- // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
- // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
- if(className && !o.forcePlaceholderSize) return;
-
- //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
- if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
- if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
- }
- };
- }
-
- //Create the placeholder
- self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
-
- //Append it after the actual current item
- self.currentItem.after(self.placeholder);
-
- //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
- o.placeholder.update(self, self.placeholder);
-
- },
-
- _contactContainers: function(event) {
- for (var i = this.containers.length - 1; i >= 0; i--){
-
- if(this._intersectsWith(this.containers[i].containerCache)) {
- if(!this.containers[i].containerCache.over) {
-
- if(this.currentContainer != this.containers[i]) {
-
- //When entering a new container, we will find the item with the least distance and append our item near it
- var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
- for (var j = this.items.length - 1; j >= 0; j--) {
- if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
- var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
- if(Math.abs(cur - base) < dist) {
- dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
- }
- }
-
- if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
- continue;
-
- this.currentContainer = this.containers[i];
- itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
- this._trigger("change", event, this._uiHash());
- this.containers[i]._trigger("change", event, this._uiHash(this));
-
- //Update the placeholder
- this.options.placeholder.update(this.currentContainer, this.placeholder);
-
- }
-
- this.containers[i]._trigger("over", event, this._uiHash(this));
- this.containers[i].containerCache.over = 1;
- }
- } else {
- if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", event, this._uiHash(this));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- };
- },
-
- _createHelper: function(event) {
-
- var o = this.options;
- var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
-
- if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
- $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
-
- if(helper[0] == this.currentItem[0])
- this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
-
- if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
- if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
-
- return helper;
-
- },
-
- _adjustOffsetFromHelper: function(obj) {
- if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
- if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
- if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
- if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
- },
-
- _getParentOffset: function() {
-
-
- //Get the offsetParent and cache its position
- this.offsetParent = this.helper.offsetParent();
- var po = this.offsetParent.offset();
-
- // This is a special case where we need to modify a offset calculated on start, since the following happened:
- // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
- // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
- // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
- po.left += this.scrollParent.scrollLeft();
- po.top += this.scrollParent.scrollTop();
- }
-
- if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
- po = { top: 0, left: 0 };
-
- return {
- top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
- left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
- };
-
- },
-
- _getRelativeOffset: function() {
-
- if(this.cssPosition == "relative") {
- var p = this.currentItem.position();
- return {
- top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
- left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
- };
- } else {
- return { top: 0, left: 0 };
- }
-
- },
-
- _cacheMargins: function() {
- this.margins = {
- left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
- top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
- };
- },
-
- _cacheHelperProportions: function() {
- this.helperProportions = {
- width: this.helper.outerWidth(),
- height: this.helper.outerHeight()
- };
- },
-
- _setContainment: function() {
-
- var o = this.options;
- if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
- if(o.containment == 'document' || o.containment == 'window') this.containment = [
- 0 - this.offset.relative.left - this.offset.parent.left,
- 0 - this.offset.relative.top - this.offset.parent.top,
- $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
- ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
- ];
-
- if(!(/^(document|window|parent)$/).test(o.containment)) {
- var ce = $(o.containment)[0];
- var co = $(o.containment).offset();
- var over = ($(ce).css("overflow") != 'hidden');
-
- this.containment = [
- co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
- co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
- co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
- co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
- ];
- }
-
- },
-
- _convertPositionTo: function(d, pos) {
-
- if(!pos) pos = this.position;
- var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- return {
- top: (
- pos.top // The absolute mouse position
- + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
- ),
- left: (
- pos.left // The absolute mouse position
- + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
- + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
- )
- };
-
- },
-
- _generatePosition: function(event) {
-
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
- // This is another very weird special case that only happens for relative elements:
- // 1. If the css position is relative
- // 2. and the scroll parent is the document or similar to the offset parent
- // we have to refresh the relative offset during the scroll so there are no jumps
- if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
- this.offset.relative = this._getRelativeOffset();
- }
-
- var pageX = event.pageX;
- var pageY = event.pageY;
-
- /*
- * - Position constraining -
- * Constrain the position to a mix of grid, containment.
- */
-
- if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
- if(this.containment) {
- if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
- if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
- if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
- if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
- }
-
- if(o.grid) {
- var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
- pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
- var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
- pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
- }
-
- }
-
- return {
- top: (
- pageY // The absolute mouse position
- - this.offset.click.top // Click offset (relative to the element)
- - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
- ),
- left: (
- pageX // The absolute mouse position
- - this.offset.click.left // Click offset (relative to the element)
- - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
- )
- };
-
- },
-
- _rearrange: function(event, i, a, hardRefresh) {
-
- a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
-
- //Various things done here to improve the performance:
- // 1. we create a setTimeout, that calls refreshPositions
- // 2. on the instance, we have a counter variable, that get's higher after every append
- // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
- // 4. this lets only the last addition to the timeout stack through
- this.counter = this.counter ? ++this.counter : 1;
- var self = this, counter = this.counter;
-
- window.setTimeout(function() {
- if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
- },0);
-
- },
-
- _clear: function(event, noPropagation) {
-
- this.reverting = false;
- // We delay all events that have to be triggered to after the point where the placeholder has been removed and
- // everything else normalized again
- var delayedTriggers = [], self = this;
-
- // We first have to update the dom position of the actual currentItem
- // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
- if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
- this._noFinalSort = null;
-
- if(this.helper[0] == this.currentItem[0]) {
- for(var i in this._storedCSS) {
- if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
- }
- this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
- } else {
- this.currentItem.show();
- }
-
- if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
- if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
- if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
- if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
- for (var i = this.containers.length - 1; i >= 0; i--){
- if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- }
- };
- };
-
- //Post events to containers
- for (var i = this.containers.length - 1; i >= 0; i--){
- if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- if(this.containers[i].containerCache.over) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- this.containers[i].containerCache.over = 0;
- }
- }
-
- //Do what was originally in plugins
- if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
- if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
- if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
-
- this.dragging = false;
- if(this.cancelHelperRemoval) {
- if(!noPropagation) {
- this._trigger("beforeStop", event, this._uiHash());
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
- return false;
- }
-
- if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
-
- //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
- this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-
- if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
-
- if(!noPropagation) {
- for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
- this._trigger("stop", event, this._uiHash());
- }
-
- this.fromOutside = false;
- return true;
-
- },
-
- _trigger: function() {
- if ($.widget.prototype._trigger.apply(this, arguments) === false) {
- this.cancel();
- }
- },
-
- _uiHash: function(inst) {
- var self = inst || this;
- return {
- helper: self.helper,
- placeholder: self.placeholder || $([]),
- position: self.position,
- absolutePosition: self.positionAbs, //deprecated
- offset: self.positionAbs,
- item: self.currentItem,
- sender: inst ? inst.element : null
- };
- }
-
-}));
-
-$.extend($.ui.sortable, {
- getter: "serialize toArray",
- version: "1.7.1",
- eventPrefix: "sort",
- defaults: {
- appendTo: "parent",
- axis: false,
- cancel: ":input,option",
- connectWith: false,
- containment: false,
- cursor: 'auto',
- cursorAt: false,
- delay: 0,
- distance: 1,
- dropOnEmpty: true,
- forcePlaceholderSize: false,
- forceHelperSize: false,
- grid: false,
- handle: false,
- helper: "original",
- items: '> *',
- opacity: false,
- placeholder: false,
- revert: false,
- scroll: true,
- scrollSensitivity: 20,
- scrollSpeed: 20,
- scope: "default",
- tolerance: "intersect",
- zIndex: 1000
- }
-});
-
-})(jQuery);
+++ /dev/null
-/*
- * jQuery UI Tabs 1.7.1
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- * ui.core.js
- */
-(function($) {
-
-$.widget("ui.tabs", {
-
- _init: function() {
- if (this.options.deselectable !== undefined) {
- this.options.collapsible = this.options.deselectable;
- }
- this._tabify(true);
- },
-
- _setData: function(key, value) {
- if (key == 'selected') {
- if (this.options.collapsible && value == this.options.selected) {
- return;
- }
- this.select(value);
- }
- else {
- this.options[key] = value;
- if (key == 'deselectable') {
- this.options.collapsible = value;
- }
- this._tabify();
- }
- },
-
- _tabId: function(a) {
- return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
- this.options.idPrefix + $.data(a);
- },
-
- _sanitizeSelector: function(hash) {
- return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
- },
-
- _cookie: function() {
- var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
- return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
- },
-
- _ui: function(tab, panel) {
- return {
- tab: tab,
- panel: panel,
- index: this.anchors.index(tab)
- };
- },
-
- _cleanup: function() {
- // restore all former loading tabs labels
- this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
- .find('span:data(label.tabs)')
- .each(function() {
- var el = $(this);
- el.html(el.data('label.tabs')).removeData('label.tabs');
- });
- },
-
- _tabify: function(init) {
-
- this.list = this.element.children('ul:first');
- this.lis = $('li:has(a[href])', this.list);
- this.anchors = this.lis.map(function() { return $('a', this)[0]; });
- this.panels = $([]);
-
- var self = this, o = this.options;
-
- var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
- this.anchors.each(function(i, a) {
- var href = $(a).attr('href');
-
- // For dynamically created HTML that contains a hash as href IE < 8 expands
- // such href to the full page url with hash and then misinterprets tab as ajax.
- // Same consideration applies for an added tab with a fragment identifier
- // since a[href=#fragment-identifier] does unexpectedly not match.
- // Thus normalize href attribute...
- var hrefBase = href.split('#')[0], baseEl;
- if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
- (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
- href = a.hash;
- a.href = href;
- }
-
- // inline tab
- if (fragmentId.test(href)) {
- self.panels = self.panels.add(self._sanitizeSelector(href));
- }
-
- // remote tab
- else if (href != '#') { // prevent loading the page itself if href is just "#"
- $.data(a, 'href.tabs', href); // required for restore on destroy
-
- // TODO until #3808 is fixed strip fragment identifier from url
- // (IE fails to load from such url)
- $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
-
- var id = self._tabId(a);
- a.href = '#' + id;
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
- .insertAfter(self.panels[i - 1] || self.list);
- $panel.data('destroy.tabs', true);
- }
- self.panels = self.panels.add($panel);
- }
-
- // invalid tab href
- else {
- o.disabled.push(i);
- }
- });
-
- // initialization from scratch
- if (init) {
-
- // attach necessary classes for styling
- this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
- this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
- this.lis.addClass('ui-state-default ui-corner-top');
- this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
-
- // Selected tab
- // use "selected" option or try to retrieve:
- // 1. from fragment identifier in url
- // 2. from cookie
- // 3. from selected class attribute on <li>
- if (o.selected === undefined) {
- if (location.hash) {
- this.anchors.each(function(i, a) {
- if (a.hash == location.hash) {
- o.selected = i;
- return false; // break
- }
- });
- }
- if (typeof o.selected != 'number' && o.cookie) {
- o.selected = parseInt(self._cookie(), 10);
- }
- if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
- o.selected = o.selected || 0;
- }
- else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
- o.selected = -1;
- }
-
- // sanity check - default to first tab...
- o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
-
- // Take disabling tabs via class attribute from HTML
- // into account and update option properly.
- // A selected tab cannot become disabled.
- o.disabled = $.unique(o.disabled.concat(
- $.map(this.lis.filter('.ui-state-disabled'),
- function(n, i) { return self.lis.index(n); } )
- )).sort();
-
- if ($.inArray(o.selected, o.disabled) != -1) {
- o.disabled.splice($.inArray(o.selected, o.disabled), 1);
- }
-
- // highlight selected tab
- this.panels.addClass('ui-tabs-hide');
- this.lis.removeClass('ui-tabs-selected ui-state-active');
- if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
- this.panels.eq(o.selected).removeClass('ui-tabs-hide');
- this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
-
- // seems to be expected behavior that the show callback is fired
- self.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
- });
-
- this.load(o.selected);
- }
-
- // clean up to avoid memory leaks in certain versions of IE 6
- $(window).bind('unload', function() {
- self.lis.add(self.anchors).unbind('.tabs');
- self.lis = self.anchors = self.panels = null;
- });
-
- }
- // update selected after add/remove
- else {
- o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
- }
-
- // update collapsible
- this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
-
- // set or update cookie after init and add/remove respectively
- if (o.cookie) {
- this._cookie(o.selected, o.cookie);
- }
-
- // disable tabs
- for (var i = 0, li; (li = this.lis[i]); i++) {
- $(li)[$.inArray(i, o.disabled) != -1 &&
- !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
- }
-
- // reset cache if switching from cached to not cached
- if (o.cache === false) {
- this.anchors.removeData('cache.tabs');
- }
-
- // remove all handlers before, tabify may run on existing tabs after add or option change
- this.lis.add(this.anchors).unbind('.tabs');
-
- if (o.event != 'mouseover') {
- var addState = function(state, el) {
- if (el.is(':not(.ui-state-disabled)')) {
- el.addClass('ui-state-' + state);
- }
- };
- var removeState = function(state, el) {
- el.removeClass('ui-state-' + state);
- };
- this.lis.bind('mouseover.tabs', function() {
- addState('hover', $(this));
- });
- this.lis.bind('mouseout.tabs', function() {
- removeState('hover', $(this));
- });
- this.anchors.bind('focus.tabs', function() {
- addState('focus', $(this).closest('li'));
- });
- this.anchors.bind('blur.tabs', function() {
- removeState('focus', $(this).closest('li'));
- });
- }
-
- // set up animations
- var hideFx, showFx;
- if (o.fx) {
- if ($.isArray(o.fx)) {
- hideFx = o.fx[0];
- showFx = o.fx[1];
- }
- else {
- hideFx = showFx = o.fx;
- }
- }
-
- // Reset certain styles left over from animation
- // and prevent IE's ClearType bug...
- function resetStyle($el, fx) {
- $el.css({ display: '' });
- if ($.browser.msie && fx.opacity) {
- $el[0].style.removeAttribute('filter');
- }
- }
-
- // Show a tab...
- var showTab = showFx ?
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
- .animate(showFx, showFx.duration || 'normal', function() {
- resetStyle($show, showFx);
- self._trigger('show', null, self._ui(clicked, $show[0]));
- });
- } :
- function(clicked, $show) {
- $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
- $show.removeClass('ui-tabs-hide');
- self._trigger('show', null, self._ui(clicked, $show[0]));
- };
-
- // Hide a tab, $show is optional...
- var hideTab = hideFx ?
- function(clicked, $hide) {
- $hide.animate(hideFx, hideFx.duration || 'normal', function() {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- resetStyle($hide, hideFx);
- self.element.dequeue("tabs");
- });
- } :
- function(clicked, $hide, $show) {
- self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
- $hide.addClass('ui-tabs-hide');
- self.element.dequeue("tabs");
- };
-
- // attach tab event handler, unbind to avoid duplicates from former tabifying...
- this.anchors.bind(o.event + '.tabs', function() {
- var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
- $show = $(self._sanitizeSelector(this.hash));
-
- // If tab is already selected and not collapsible or tab disabled or
- // or is already loading or click callback returns false stop here.
- // Check if click handler returns false last so that it is not executed
- // for a disabled or loading tab!
- if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
- $li.hasClass('ui-state-disabled') ||
- $li.hasClass('ui-state-processing') ||
- self._trigger('select', null, self._ui(this, $show[0])) === false) {
- this.blur();
- return false;
- }
-
- o.selected = self.anchors.index(this);
-
- self.abort();
-
- // if tab may be closed
- if (o.collapsible) {
- if ($li.hasClass('ui-tabs-selected')) {
- o.selected = -1;
-
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- }).dequeue("tabs");
-
- this.blur();
- return false;
- }
- else if (!$hide.length) {
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
-
- self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
-
- this.blur();
- return false;
- }
- }
-
- if (o.cookie) {
- self._cookie(o.selected, o.cookie);
- }
-
- // show new tab
- if ($show.length) {
- if ($hide.length) {
- self.element.queue("tabs", function() {
- hideTab(el, $hide);
- });
- }
- self.element.queue("tabs", function() {
- showTab(el, $show);
- });
-
- self.load(self.anchors.index(this));
- }
- else {
- throw 'jQuery UI Tabs: Mismatching fragment identifier.';
- }
-
- // Prevent IE from keeping other link focussed when using the back button
- // and remove dotted border from clicked link. This is controlled via CSS
- // in modern browsers; blur() removes focus from address bar in Firefox
- // which can become a usability and annoying problem with tabs('rotate').
- if ($.browser.msie) {
- this.blur();
- }
-
- });
-
- // disable click in any case
- this.anchors.bind('click.tabs', function(){return false;});
-
- },
-
- destroy: function() {
- var o = this.options;
-
- this.abort();
-
- this.element.unbind('.tabs')
- .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
- .removeData('tabs');
-
- this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
-
- this.anchors.each(function() {
- var href = $.data(this, 'href.tabs');
- if (href) {
- this.href = href;
- }
- var $this = $(this).unbind('.tabs');
- $.each(['href', 'load', 'cache'], function(i, prefix) {
- $this.removeData(prefix + '.tabs');
- });
- });
-
- this.lis.unbind('.tabs').add(this.panels).each(function() {
- if ($.data(this, 'destroy.tabs')) {
- $(this).remove();
- }
- else {
- $(this).removeClass([
- 'ui-state-default',
- 'ui-corner-top',
- 'ui-tabs-selected',
- 'ui-state-active',
- 'ui-state-hover',
- 'ui-state-focus',
- 'ui-state-disabled',
- 'ui-tabs-panel',
- 'ui-widget-content',
- 'ui-corner-bottom',
- 'ui-tabs-hide'
- ].join(' '));
- }
- });
-
- if (o.cookie) {
- this._cookie(null, o.cookie);
- }
- },
-
- add: function(url, label, index) {
- if (index === undefined) {
- index = this.anchors.length; // append by default
- }
-
- var self = this, o = this.options,
- $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
- id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
-
- $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
-
- // try to find an existing element before creating a new one
- var $panel = $('#' + id);
- if (!$panel.length) {
- $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
- }
- $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
-
- if (index >= this.lis.length) {
- $li.appendTo(this.list);
- $panel.appendTo(this.list[0].parentNode);
- }
- else {
- $li.insertBefore(this.lis[index]);
- $panel.insertBefore(this.panels[index]);
- }
-
- o.disabled = $.map(o.disabled,
- function(n, i) { return n >= index ? ++n : n; });
-
- this._tabify();
-
- if (this.anchors.length == 1) { // after tabify
- $li.addClass('ui-tabs-selected ui-state-active');
- $panel.removeClass('ui-tabs-hide');
- this.element.queue("tabs", function() {
- self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
- });
-
- this.load(0);
- }
-
- // callback
- this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
- },
-
- remove: function(index) {
- var o = this.options, $li = this.lis.eq(index).remove(),
- $panel = this.panels.eq(index).remove();
-
- // If selected tab was removed focus tab to the right or
- // in case the last tab was removed the tab to the left.
- if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
- this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
- }
-
- o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
- function(n, i) { return n >= index ? --n : n; });
-
- this._tabify();
-
- // callback
- this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
- },
-
- enable: function(index) {
- var o = this.options;
- if ($.inArray(index, o.disabled) == -1) {
- return;
- }
-
- this.lis.eq(index).removeClass('ui-state-disabled');
- o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
-
- // callback
- this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
- },
-
- disable: function(index) {
- var self = this, o = this.options;
- if (index != o.selected) { // cannot disable already selected tab
- this.lis.eq(index).addClass('ui-state-disabled');
-
- o.disabled.push(index);
- o.disabled.sort();
-
- // callback
- this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
- }
- },
-
- select: function(index) {
- if (typeof index == 'string') {
- index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
- }
- else if (index === null) { // usage of null is deprecated, TODO remove in next release
- index = -1;
- }
- if (index == -1 && this.options.collapsible) {
- index = this.options.selected;
- }
-
- this.anchors.eq(index).trigger(this.options.event + '.tabs');
- },
-
- load: function(index) {
- var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
-
- this.abort();
-
- // not remote or from cache
- if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
- this.element.dequeue("tabs");
- return;
- }
-
- // load remote from here on
- this.lis.eq(index).addClass('ui-state-processing');
-
- if (o.spinner) {
- var span = $('span', a);
- span.data('label.tabs', span.html()).html(o.spinner);
- }
-
- this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
- url: url,
- success: function(r, s) {
- $(self._sanitizeSelector(a.hash)).html(r);
-
- // take care of tab labels
- self._cleanup();
-
- if (o.cache) {
- $.data(a, 'cache.tabs', true); // if loaded once do not load them again
- }
-
- // callbacks
- self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
- try {
- o.ajaxOptions.success(r, s);
- }
- catch (e) {}
-
- // last, so that load event is fired before show...
- self.element.dequeue("tabs");
- }
- }));
- },
-
- abort: function() {
- // stop possibly running animations
- this.element.queue([]);
- this.panels.stop(false, true);
-
- // terminate pending requests from other tabs
- if (this.xhr) {
- this.xhr.abort();
- delete this.xhr;
- }
-
- // take care of tab labels
- this._cleanup();
-
- },
-
- url: function(index, url) {
- this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
- },
-
- length: function() {
- return this.anchors.length;
- }
-
-});
-
-$.extend($.ui.tabs, {
- version: '1.7.1',
- getter: 'length',
- defaults: {
- ajaxOptions: null,
- cache: false,
- cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
- collapsible: false,
- disabled: [],
- event: 'click',
- fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
- idPrefix: 'ui-tabs-',
- panelTemplate: '<div></div>',
- spinner: '<em>Loading…</em>',
- tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
- }
-});
-
-/*
- * Tabs Extensions
- */
-
-/*
- * Rotate
- */
-$.extend($.ui.tabs.prototype, {
- rotation: null,
- rotate: function(ms, continuing) {
-
- var self = this, o = this.options;
-
- var rotate = self._rotate || (self._rotate = function(e) {
- clearTimeout(self.rotation);
- self.rotation = setTimeout(function() {
- var t = o.selected;
- self.select( ++t < self.anchors.length ? t : 0 );
- }, ms);
-
- if (e) {
- e.stopPropagation();
- }
- });
-
- var stop = self._unrotate || (self._unrotate = !continuing ?
- function(e) {
- if (e.clientX) { // in case of a true click
- self.rotate(null);
- }
- } :
- function(e) {
- t = o.selected;
- rotate();
- });
-
- // start rotation
- if (ms) {
- this.element.bind('tabsshow', rotate);
- this.anchors.bind(o.event + '.tabs', stop);
- rotate();
- }
- // stop rotation
- else {
- clearTimeout(self.rotation);
- this.element.unbind('tabsshow', rotate);
- this.anchors.unbind(o.event + '.tabs', stop);
- delete this._rotate;
- delete this._unrotate;
- }
- }
-});
-
-})(jQuery);
+++ /dev/null
-1.7.1
\ No newline at end of file
--- /dev/null
+jQuery UI Authors (http://ui.jquery.com/about)
+
+This software consists of voluntary contributions made by many
+individuals. For exact contribution history, see the revision history
+and logs, available at http://jquery-ui.googlecode.com/svn/
+
+Brandon Aaron
+Paul Bakaus (paulbakaus.com)
+David Bolter
+Rich Caloggero
+Chi Cheng (cloudream@gmail.com)
+Colin Clark (http://colin.atrc.utoronto.ca/)
+Michelle D'Souza
+Aaron Eisenberger (aaronchi@gmail.com)
+Ariel Flesler
+Bohdan Ganicky
+Scott González
+Marc Grabanski (m@marcgrabanski.com)
+Klaus Hartl (stilbuero.de)
+Scott Jehl
+Cody Lindley
+Eduardo Lundgren (eduardolundgren@gmail.com)
+Todd Parker
+John Resig
+Patty Toland
+Ca-Phun Ung (yelotofu.com)
+Keith Wood (kbwood@virginbroadband.com.au)
+Maggie Costello Wachs
+Richard D. Worth (rdworth.org)
+Jörn Zaefferer (bassistance.de)
--- /dev/null
+ GNU GENERAL PUBLIC LICENSE
+ Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+ Preamble
+
+ The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users. This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it. (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.) You can apply it to
+your programs, too.
+
+ When we speak of free software, we are referring to freedom, not
+price. Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+ To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+ For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have. You must make sure that they, too, receive or can get the
+source code. And you must show them these terms so they know their
+rights.
+
+ We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+ Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software. If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+ Finally, any free program is threatened constantly by software
+patents. We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary. To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+ The precise terms and conditions for copying, distribution and
+modification follow.
+
+ GNU GENERAL PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License. The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language. (Hereinafter, translation is included without limitation in
+the term "modification".) Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+ 1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+ 2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+ a) You must cause the modified files to carry prominent notices
+ stating that you changed the files and the date of any change.
+
+ b) You must cause any work that you distribute or publish, that in
+ whole or in part contains or is derived from the Program or any
+ part thereof, to be licensed as a whole at no charge to all third
+ parties under the terms of this License.
+
+ c) If the modified program normally reads commands interactively
+ when run, you must cause it, when started running for such
+ interactive use in the most ordinary way, to print or display an
+ announcement including an appropriate copyright notice and a
+ notice that there is no warranty (or else, saying that you provide
+ a warranty) and that users may redistribute the program under
+ these conditions, and telling the user how to view a copy of this
+ License. (Exception: if the Program itself is interactive but
+ does not normally print such an announcement, your work based on
+ the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+ 3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+ a) Accompany it with the complete corresponding machine-readable
+ source code, which must be distributed under the terms of Sections
+ 1 and 2 above on a medium customarily used for software interchange; or,
+
+ b) Accompany it with a written offer, valid for at least three
+ years, to give any third party, for a charge no more than your
+ cost of physically performing source distribution, a complete
+ machine-readable copy of the corresponding source code, to be
+ distributed under the terms of Sections 1 and 2 above on a medium
+ customarily used for software interchange; or,
+
+ c) Accompany it with the information you received as to the offer
+ to distribute corresponding source code. (This alternative is
+ allowed only for noncommercial distribution and only if you
+ received the program in object code or executable form with such
+ an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it. For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable. However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+ 4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License. Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+ 5. You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Program or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+ 6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+ 7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all. For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+ 8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded. In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+ 9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time. Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number. If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation. If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+ 10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission. For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this. Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+ NO WARRANTY
+
+ 11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW. EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE. THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU. SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+ 12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
--- /dev/null
+Copyright (c) 2009 Paul Bakaus, http://jqueryui.com/
+
+This software consists of voluntary contributions made by many
+individuals (AUTHORS.txt, http://jqueryui.com/about) For exact
+contribution history, see the revision history and logs, available
+at http://jquery-ui.googlecode.com/svn/
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
--- /dev/null
+== New and Noteworthy ==
+
+== 2.1.1 ==
+
+* Removed $.browser.version for jQuery < 1.1.3
+
+== 2.1 ==
+
+* Updated to work with jQuery 1.1.3
+* Added $.browser.version for jQuery < 1.1.3
+* Optimized duplication check by using child selector and using .length test
+
+== 2.0 ==
+
+* Added ability change settings like width, height, src and more.
+
+== 1.0 ==
+
+* Only adds iframe once per an element
+* Works with SSL enabled pages
\ No newline at end of file
--- /dev/null
+{
+ "name": "jQuery-bgiframe",
+ "version": 2.1,
+ "author": [
+ "Brandon Aaron <brandon.aaron@gmail.com>"
+ ],
+ "abstract": "jQuery plugin for fixing z-index issues in IE6",
+ "license": "mit, gpl",
+ "distribution_type": "plugin",
+ "requires": {
+ "jQuery": ">=1.0.3"
+ },
+ "provides": {
+ "jQuery.bgiframe": {
+ "version": 2.1,
+ "file": "jquery.bgiframe.js"
+ }
+ },
+ "keywords": [
+ "iframe",
+ "hack",
+ "zIndex",
+ "z-index",
+ "ie6"
+ ],
+ "stability": "Official",
+ "meta-spec": {
+ "version": 1.3,
+ "url": "http://module-build.sourceforge.net/META-spec-v1.3.html"
+ },
+ "generated_by": "Brandon Aaron"
+}
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN"
+ "http://www.w3.org/TR/html4/strict.dtd">
+<html>
+ <head>
+ <meta http-equiv="Content-type" content="text/html; charset=utf-8">
+ <title>bgiframe 2.1.1 docs</title>
+ <link rel="stylesheet" type="text/css" href="http://yui.yahooapis.com/2.2.2/build/reset/reset-min.css">
+ <link rel="stylesheet" type="text/css" href="http://yui.yahooapis.com/2.2.2/build/fonts/fonts-min.css">
+ <style type="text/css" media="screen">
+ body { margin: 25px; }
+ h1 { margin: 1.0em 0; font-size: 167%; font-weight: bold; }
+ #toc { margin: 0 0 3.0em; }
+ #toc li { margin: 0.4em 0; font-size: 100%; }
+ #qa { margin: 0 0 3.0em; }
+ #qa dt.question { margin: 2.0em 0 1.0em; font-size: 122%; font-weight: bold; }
+ #qa dd.answer { margin: 0 2.0em; }
+ #qa dd.answer p { margin: 0 0 1.5em; }
+ #qa dd.answer code { font-size: 92%; }
+
+ #qa dd.answer #options dt { margin: 2.0em 0 1.0em; }
+ #qa dd.answer #options dd { margin: 0 2.0em; }
+
+ </style>
+ </head>
+ <body>
+ <div id="wrapper">
+ <div id="container">
+ <h1>bgiframe 2.1.1</h1>
+ <ul id="toc">
+ <li><a href="#what_does_it_do">What does it do</a></li>
+ <li><a href="#when_should_i_use_it">When should I use it</a></li>
+ <li><a href="#how_do_i_use_it">How do I use it</a></li>
+ <li><a href="#how_does_it_work">How does it work</a></li>
+ <li><a href="#where_can_i_get_it">Where can I get it</a></li>
+ <li><a href="#what_has_changed">What has changed</a></li>
+ <li><a href="#suggestions_bugs_patches">Suggestions? Bugs? Patches?</a></li>
+ </ul>
+ <dl id="qa">
+ <dt id="what_does_it_do" class="question">What does it do?</dt>
+ <dd class="answer">
+ <p>Have you ever experienced the select form element z-index issue in Internet Explorer 6? Most likely you have if you've implemented some sort of drop down menu navigation that shows up over a select form element.</p>
+ <p>The background iframe (bgiframe) plugin provides a very small, quick and easy way to fix that problem so you don't have to worry about it. No matter the size, borders or position the bgiframe plugin can fix it.</p>
+ </dd>
+
+ <dt id="when_should_i_use_it" class="question">When should I use it?</dt>
+ <dd class="answer">
+ <p>The bgiframe plugin should be used when you are trying to show elements above a select form control in Internet Explorer 6.</p>
+ </dd>
+
+ <dt id="how_do_i_use_it" class="question">How do I use it?</dt>
+ <dd class="answer">
+ <p>The usage is simple. Just call <code>bgiframe</code> on a jQuery collection of elements.</p>
+ <p><code>$('.fix-z-index').bgiframe();</code></p>
+ <p>The plugin tries its best to handle most situations but sometimes some configuration is necessary. For example if your borders are defined in a unit other than pixels, you will need to manually set the <code>top</code> and <code>left</code> properties to the negative width of the border. Here are the options/settings available to configure the output.</p>
+ <dl id="options">
+ <dt><code>top</code></dt>
+ <dd>
+ <p>The iframe must be offset to the top by the width of the top border. This should be a negative number representing the border-top-width. If a number is is used here, pixels will be assumed. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the border-top-width if it is in pixels.</p>
+ <p><code>$('.fix-z-index').bgiframe({ top: '-1em' });</code></p>
+ </dd>
+ <dt><code>left</code></dt>
+ <dd>
+ <p>The iframe must be offset to the left by the width of the left border. This should be a negative number representing the border-left-width. If a number is used here, pixels will be assumed. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the border-left-width if it is in pixels.</p>
+ <p><code>$('.fix-z-index').bgiframe({ left: '-1em' });</code></p>
+ </dd>
+ <dt><code>width</code></dt>
+ <dd>
+ <p>This is the width of the iframe. If a number is used here, pixels will be assume. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the offsetWidth.</p>
+ <p><code>$('.fix-z-index').bgiframe({ width: 100 });</code></p>
+ </dd>
+ <dt><code>height</code></dt>
+ <dd>
+ <p>This is the height of the iframe. If a number is used here, pixels will be assume. Otherwise, be sure to specify a unit. An expression could also be used. By default the value is "auto" which will use an expression to get the offsetHeight.</p>
+ <p><code>$('.fix-z-index').bgiframe({ height: 100 });</code></p>
+ </dd>
+ <dt><code>opacity</code></dt>
+ <dd>
+ <p>This is a boolean representing whether or not to use opacity. If set to true, the opacity of 0 is applied. If set to false, the opacity filter is not applied. Default: true.</p>
+ <p><code>$('.fix-z-index').bgiframe({ opacity: false });</code></p>
+ </dd>
+ <dt><code>src</code></dt>
+ <dd>
+ <p>This setting is provided so that one could change the src of the iframe to whatever they need. Default: "javascript:false;"</p>
+ <p><code>$('.fix-z-index').bgiframe({ src: '#' });</code></p>
+ </dd>
+ </dl>
+ </dd>
+
+ <dt id="how_does_it_work" class="question">How does it work?</dt>
+ <dd class="answer">
+ <p>The bgiframe plugin works by prepending an iframe to the element. The iframe is given a class of bgiframe and positioned below all the other children of the element. In the default configuration it automatically adjusts to the width and height of the element (including the borders) and the opacity is set to 0. The element needs to have position (relative or absolute) and should have a background (color or image).</p>
+ <p>Check out the <a href="http://brandonaaron.net/jquery/plugins/bgiframe/test/">test page</a> to see the plugin in action.</p>
+ </dd>
+
+ <dt id="where_can_i_get_it" class="question">Where can I get it?</dt>
+ <dd class="answer">
+ <ul>
+ <li><a href="http://jquery.com/plugins/files/bgiframe-2.1.zip">2.1 zip</a> from the bgiframe <a href="http://jquery.com/plugins/project/bgiframe">project page</a>.</li>
+ <li>Latest SVN: http://jqueryjs.googlecode.com/svn/trunk/plugins/bgiframe/</li>
+ <li>Tagged Versions in SVN: Latest SVN: http://jqueryjs.googlecode.com/svn/tags/plugins/bgiframe/</li>
+ </ul>
+ </dd>
+
+ <dt id="suggestions_bugs_patches" class="question">Suggestions? Bugs? Patches?</dt>
+ <dd class="answer">
+ <p>Feel free to make any suggestions, bug reports or add any patches via the <a href="http://jquery.com/plugins/project/bgiframe">project page</a>.</p>
+ </dd>
+ </dl>
+ <p>The bgiframe plugin is authored by <a href="http://blog.brandonaaron.net/">Brandon Aaron (http://brandonaaron.net/)</a></p>
+ </div>
+ </div>
+ </body>
+</html>
\ No newline at end of file
--- /dev/null
+/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ *
+ * $LastChangedDate: 2007-07-21 18:44:59 -0500 (Sat, 21 Jul 2007) $
+ * $Rev: 2446 $
+ *
+ * Version 2.1.1
+ */
+
+(function($){
+
+/**
+ * The bgiframe is chainable and applies the iframe hack to get
+ * around zIndex issues in IE6. It will only apply itself in IE6
+ * and adds a class to the iframe called 'bgiframe'. The iframe
+ * is appeneded as the first child of the matched element(s)
+ * with a tabIndex and zIndex of -1.
+ *
+ * By default the plugin will take borders, sized with pixel units,
+ * into account. If a different unit is used for the border's width,
+ * then you will need to use the top and left settings as explained below.
+ *
+ * NOTICE: This plugin has been reported to cause perfromance problems
+ * when used on elements that change properties (like width, height and
+ * opacity) a lot in IE6. Most of these problems have been caused by
+ * the expressions used to calculate the elements width, height and
+ * borders. Some have reported it is due to the opacity filter. All
+ * these settings can be changed if needed as explained below.
+ *
+ * @example $('div').bgiframe();
+ * @before <div><p>Paragraph</p></div>
+ * @result <div><iframe class="bgiframe".../><p>Paragraph</p></div>
+ *
+ * @param Map settings Optional settings to configure the iframe.
+ * @option String|Number top The iframe must be offset to the top
+ * by the width of the top border. This should be a negative
+ * number representing the border-top-width. If a number is
+ * is used here, pixels will be assumed. Otherwise, be sure
+ * to specify a unit. An expression could also be used.
+ * By default the value is "auto" which will use an expression
+ * to get the border-top-width if it is in pixels.
+ * @option String|Number left The iframe must be offset to the left
+ * by the width of the left border. This should be a negative
+ * number representing the border-left-width. If a number is
+ * is used here, pixels will be assumed. Otherwise, be sure
+ * to specify a unit. An expression could also be used.
+ * By default the value is "auto" which will use an expression
+ * to get the border-left-width if it is in pixels.
+ * @option String|Number width This is the width of the iframe. If
+ * a number is used here, pixels will be assume. Otherwise, be sure
+ * to specify a unit. An experssion could also be used.
+ * By default the value is "auto" which will use an experssion
+ * to get the offsetWidth.
+ * @option String|Number height This is the height of the iframe. If
+ * a number is used here, pixels will be assume. Otherwise, be sure
+ * to specify a unit. An experssion could also be used.
+ * By default the value is "auto" which will use an experssion
+ * to get the offsetHeight.
+ * @option Boolean opacity This is a boolean representing whether or not
+ * to use opacity. If set to true, the opacity of 0 is applied. If
+ * set to false, the opacity filter is not applied. Default: true.
+ * @option String src This setting is provided so that one could change
+ * the src of the iframe to whatever they need.
+ * Default: "javascript:false;"
+ *
+ * @name bgiframe
+ * @type jQuery
+ * @cat Plugins/bgiframe
+ * @author Brandon Aaron (brandon.aaron@gmail.com || http://brandonaaron.net)
+ */
+$.fn.bgIframe = $.fn.bgiframe = function(s) {
+ // This is only for IE6
+ if ( $.browser.msie && /6.0/.test(navigator.userAgent) ) {
+ s = $.extend({
+ top : 'auto', // auto == .currentStyle.borderTopWidth
+ left : 'auto', // auto == .currentStyle.borderLeftWidth
+ width : 'auto', // auto == offsetWidth
+ height : 'auto', // auto == offsetHeight
+ opacity : true,
+ src : 'javascript:false;'
+ }, s || {});
+ var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
+ html = '<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+
+ 'style="display:block;position:absolute;z-index:-1;'+
+ (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
+ 'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+
+ 'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+
+ 'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
+ 'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
+ '"/>';
+ return this.each(function() {
+ if ( $('> iframe.bgiframe', this).length == 0 )
+ this.insertBefore( document.createElement(html), this.firstChild );
+ });
+ }
+ return this;
+};
+
+})(jQuery);
\ No newline at end of file
--- /dev/null
+/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ *
+ * $LastChangedDate: 2007-07-21 18:45:56 -0500 (Sat, 21 Jul 2007) $
+ * $Rev: 2447 $
+ *
+ * Version 2.1.1
+ */
+(function($){$.fn.bgIframe=$.fn.bgiframe=function(s){if($.browser.msie&&/6.0/.test(navigator.userAgent)){s=$.extend({top:'auto',left:'auto',width:'auto',height:'auto',opacity:true,src:'javascript:false;'},s||{});var prop=function(n){return n&&n.constructor==Number?n+'px':n;},html='<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+'style="display:block;position:absolute;z-index:-1;'+(s.opacity!==false?'filter:Alpha(Opacity=\'0\');':'')+'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+'"/>';return this.each(function(){if($('> iframe.bgiframe',this).length==0)this.insertBefore(document.createElement(html),this.firstChild);});}return this;};})(jQuery);
\ No newline at end of file
--- /dev/null
+/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ *
+ * $LastChangedDate: 2007-07-21 18:44:59 -0500 (Sat, 21 Jul 2007) $
+ * $Rev: 2446 $
+ *
+ * Version 2.1.1
+ */
+eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('(b($){$.m.E=$.m.g=b(s){h($.x.10&&/6.0/.I(D.B)){s=$.w({c:\'3\',5:\'3\',8:\'3\',d:\'3\',k:M,e:\'F:i;\'},s||{});C a=b(n){f n&&n.t==r?n+\'4\':n},p=\'<o Y="g"W="0"R="-1"e="\'+s.e+\'"\'+\'Q="P:O;N:L;z-H:-1;\'+(s.k!==i?\'G:J(K=\\\'0\\\');\':\'\')+\'c:\'+(s.c==\'3\'?\'7(((l(2.9.j.A)||0)*-1)+\\\'4\\\')\':a(s.c))+\';\'+\'5:\'+(s.5==\'3\'?\'7(((l(2.9.j.y)||0)*-1)+\\\'4\\\')\':a(s.5))+\';\'+\'8:\'+(s.8==\'3\'?\'7(2.9.S+\\\'4\\\')\':a(s.8))+\';\'+\'d:\'+(s.d==\'3\'?\'7(2.9.v+\\\'4\\\')\':a(s.d))+\';\'+\'"/>\';f 2.T(b(){h($(\'> o.g\',2).U==0)2.V(q.X(p),2.u)})}f 2}})(Z);',62,63,'||this|auto|px|left||expression|width|parentNode||function|top|height|src|return|bgiframe|if|false|currentStyle|opacity|parseInt|fn||iframe|html|document|Number||constructor|firstChild|offsetHeight|extend|browser|borderLeftWidth||borderTopWidth|userAgent|var|navigator|bgIframe|javascript|filter|index|test|Alpha|Opacity|absolute|true|position|block|display|style|tabindex|offsetWidth|each|length|insertBefore|frameborder|createElement|class|jQuery|msie'.split('|'),0,{}))
\ No newline at end of file
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN"
+ "http://www.w3.org/TR/html4/strict.dtd">
+<html debug="true">
+ <head>
+ <meta http-equiv="Content-type" content="text/html; charset=utf-8">
+ <title>jQuery bgiframe Visual Test</title>
+
+ <!-- load latest build of jquery.js -->
+ <script type="text/javascript" src="../../../jquery/dist/jquery.js"></script>
+
+ <!-- load dimensions.js (this is what we're testing! -->
+ <script type="text/javascript" src="../jquery.bgiframe.js"></script>
+
+ <!-- load firebug lite
+ <script type="text/javascript" src="http://brandon.jquery.com/firebuglite/firebug.js"></script>-->
+
+ <link rel="Stylesheet" media="screen" href="../../../jquery/test/data/testsuite.css" />
+
+ <script type="text/javascript" charset="utf-8">
+ $(function() {
+ $('#userAgent').html(navigator.userAgent);
+ $('#box2').bgiframe();
+ $('#box3').bgiframe({top: -5, left: -5});
+ $('#box4').bgiframe({top: -5, left: -5, width: 270, height: 120});
+ $('#box5').bgiframe({top: 0, left: 0, width: 260, height: 110});
+ $('#box6').bgiframe({top: '-5px', left: '-5px', width: '270px', height: '120px'});
+ $('#box7').bgiframe({top: '-.5em', left: '-.5em', width: '17em', height: '12em'});
+ $('#box8').bgiframe({top: '-.5em', left: '-.5em'});
+ $('#box9').bgiframe({opacity:false});
+ });
+ </script>
+
+ <style type="text/css" media="screen">
+ #wrapper { position: relative; width: 100%; font: 12px Arial; }
+ form { position: absolute; top: 0; left: 0; width: 100%; }
+ select { position: relative; width: 100%; margin: 0 0 2px; z-index: 1; }
+
+ .box { position: relative; z-index: 2; float: left; margin: 5px; border: 5px solid #666; padding: 5px; width: 250px; height: 100px; color: #000; background-color: #999; }
+ dl { margin: 0; padding: 0; }
+ dt { float: left; margin: 0; padding: 0; width: 50px; }
+ dd { margin: 0; padding: 0; }
+ #box7, #box8 { border-width: .5em; padding: .5em; width: 15em; height: 10em; }
+ </style>
+ </head>
+ <body>
+ <h1 id="banner">jQuery bgiframe - Visual Test</h1>
+ <h2 id="userAgent"></h2>
+ <div id="wrapper">
+ <form action="#" method="get" accept-charset="utf-8">
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ <select name="test"><option>Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing Testing</option></select>
+ </form>
+
+ <div id="box1" class="box">nothing</div>
+ <div id="box2" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>'auto'</dd>
+
+ <dt>left:</dt>
+ <dd>'auto'</dd>
+
+ <dt>width:</dt>
+ <dd>'auto'</dd>
+
+ <dt>height:</dt>
+ <dd>'auto'</dd>
+ </dl>
+ </div>
+ <div id="box3" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>0</dd>
+
+ <dt>left:</dt>
+ <dd>0</dd>
+
+ <dt>width:</dt>
+ <dd>'auto'</dd>
+
+ <dt>height:</dt>
+ <dd>'auto'</dd>
+ </dl>
+ </div>
+ <div id="box4" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>-5</dd>
+
+ <dt>left:</dt>
+ <dd>-5</dd>
+
+ <dt>width:</dt>
+ <dd>270</dd>
+
+ <dt>height:</dt>
+ <dd>120</dd>
+ </dl>
+ </div>
+ <div id="box5" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>0</dd>
+
+ <dt>left:</dt>
+ <dd>0</dd>
+
+ <dt>width:</dt>
+ <dd>260</dd>
+
+ <dt>height:</dt>
+ <dd>110</dd>
+ </dl>
+ </div>
+ <div id="box6" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>'-5px'</dd>
+
+ <dt>left:</dt>
+ <dd>'-5px'</dd>
+
+ <dt>width:</dt>
+ <dd>'270px'</dd>
+
+ <dt>height:</dt>
+ <dd>'120px'</dd>
+ </dl>
+ </div>
+ <div id="box7" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>'-.5em'</dd>
+
+ <dt>left:</dt>
+ <dd>'-.5em'</dd>
+
+ <dt>width:</dt>
+ <dd>'17em'</dd>
+
+ <dt>height:</dt>
+ <dd>'12em'</dd>
+ </dl>
+ </div>
+ <div id="box8" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>'-.5em'</dd>
+
+ <dt>left:</dt>
+ <dd>'-.5em'</dd>
+
+ <dt>width:</dt>
+ <dd>'auto'</dd>
+
+ <dt>height:</dt>
+ <dd>'auto'</dd>
+ </dl>
+ </div>
+ <div id="box9" class="box">
+ <dl>
+ <dt>top:</dt>
+ <dd>'auto'</dd>
+
+ <dt>left:</dt>
+ <dd>'auto'</dd>
+
+ <dt>width:</dt>
+ <dd>'auto'</dd>
+
+ <dt>height:</dt>
+ <dd>'auto'</dd>
+
+ <dt>opacity:</dt>
+ <dd>false</dd>
+ </dl>
+ </div>
+ </div>
+ </body>
+</html>
\ No newline at end of file
--- /dev/null
+/**
+ * Cookie plugin
+ *
+ * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
+ * Dual licensed under the MIT and GPL licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ * http://www.gnu.org/licenses/gpl.html
+ *
+ */
+jQuery.cookie=function(name,value,options){if(typeof value!='undefined'){options=options||{};if(value===null){value='';options=$.extend({},options);options.expires=-1;}var expires='';if(options.expires&&(typeof options.expires=='number'||options.expires.toUTCString)){var date;if(typeof options.expires=='number'){date=new Date();date.setTime(date.getTime()+(options.expires*24*60*60*1000));}else{date=options.expires;}expires='; expires='+date.toUTCString();}var path=options.path?'; path='+(options.path):'';var domain=options.domain?'; domain='+(options.domain):'';var secure=options.secure?'; secure':'';document.cookie=[name,'=',encodeURIComponent(value),expires,path,domain,secure].join('');}else{var cookieValue=null;if(document.cookie&&document.cookie!=''){var cookies=document.cookie.split(';');for(var i=0;i<cookies.length;i++){var cookie=jQuery.trim(cookies[i]);if(cookie.substring(0,name.length+1)==(name+'=')){cookieValue=decodeURIComponent(cookie.substring(name.length+1));break;}}}return cookieValue;}};
\ No newline at end of file
--- /dev/null
+/**
+ * Cookie plugin
+ *
+ * Copyright (c) 2006 Klaus Hartl (stilbuero.de)
+ * Dual licensed under the MIT and GPL licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ * http://www.gnu.org/licenses/gpl.html
+ *
+ */
+eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('q.5=x(k,d,a){4(m d!=\'H\'){a=a||{};4(d===p){d=\'\';a=$.A({},a);a.3=-1}2 g=\'\';4(a.3&&(m a.3==\'u\'||a.3.s)){2 f;4(m a.3==\'u\'){f=F C();f.B(f.z()+(a.3*y*o*o*v))}n{f=a.3}g=\'; 3=\'+f.s()}2 b=a.7?\'; 7=\'+(a.7):\'\';2 e=a.9?\'; 9=\'+(a.9):\'\';2 l=a.t?\'; t\':\'\';6.5=[k,\'=\',L(d),g,b,e,l].K(\'\')}n{2 h=p;4(6.5&&6.5!=\'\'){2 c=6.5.E(\';\');D(2 i=0;i<c.8;i++){2 j=q.G(c[i]);4(j.r(0,k.8+1)==(k+\'=\')){h=I(j.r(k.8+1));J}}}w h}};',48,48,'||var|expires|if|cookie|document|path|length|domain|||||||||||||typeof|else|60|null|jQuery|substring|toUTCString|secure|number|1000|return|function|24|getTime|extend|setTime|Date|for|split|new|trim|undefined|decodeURIComponent|break|join|encodeURIComponent'.split('|'),0,{}))
\ No newline at end of file
--- /dev/null
+/*
+ * Javascript Diff Algorithm
+ * By John Resig (http://ejohn.org/)
+ * Modified by Chu Alan "sprite"
+ *
+ * More Info:
+ * http://ejohn.org/projects/javascript-diff-algorithm/
+ */
+
+function escape(s) {
+ var n = s;
+ n = n.replace(/&/g, "&");
+ n = n.replace(/</g, "<");
+ n = n.replace(/>/g, ">");
+ n = n.replace(/"/g, """);
+
+ return n;
+}
+
+function diffString( o, n ) {
+ o = o.replace(/\s+$/, '');
+ n = n.replace(/\s+$/, '');
+
+ var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/) );
+ var str = "";
+
+ var oSpace = o.match(/\s+/g);
+ if (oSpace == null) {
+ oSpace = ["\n"];
+ } else {
+ oSpace.push("\n");
+ }
+ var nSpace = n.match(/\s+/g);
+ if (nSpace == null) {
+ nSpace = ["\n"];
+ } else {
+ nSpace.push("\n");
+ }
+
+ if (out.n.length == 0) {
+ for (var i = 0; i < out.o.length; i++) {
+ str += '<del>' + escape(out.o[i]) + oSpace[i] + "</del>";
+ }
+ } else {
+ if (out.n[0].text == null) {
+ for (n = 0; n < out.o.length && out.o[n].text == null; n++) {
+ str += '<del>' + escape(out.o[n]) + oSpace[n] + "</del>";
+ }
+ }
+
+ for ( var i = 0; i < out.n.length; i++ ) {
+ if (out.n[i].text == null) {
+ str += '<ins>' + escape(out.n[i]) + nSpace[i] + "</ins>";
+ } else {
+ var pre = "";
+
+ for (n = out.n[i].row + 1; n < out.o.length && out.o[n].text == null; n++ ) {
+ pre += '<del>' + escape(out.o[n]) + oSpace[n] + "</del>";
+ }
+ str += " " + out.n[i].text + nSpace[i] + pre;
+ }
+ }
+ }
+
+ return str;
+}
+
+function randomColor() {
+ return "rgb(" + (Math.random() * 100) + "%, " +
+ (Math.random() * 100) + "%, " +
+ (Math.random() * 100) + "%)";
+}
+function diffString2( o, n ) {
+ o = o.replace(/\s+$/, '');
+ n = n.replace(/\s+$/, '');
+
+ var out = diff(o == "" ? [] : o.split(/\s+/), n == "" ? [] : n.split(/\s+/) );
+
+ var oSpace = o.match(/\s+/g);
+ if (oSpace == null) {
+ oSpace = ["\n"];
+ } else {
+ oSpace.push("\n");
+ }
+ var nSpace = n.match(/\s+/g);
+ if (nSpace == null) {
+ nSpace = ["\n"];
+ } else {
+ nSpace.push("\n");
+ }
+
+ var os = "";
+ var colors = new Array();
+ for (var i = 0; i < out.o.length; i++) {
+ colors[i] = randomColor();
+
+ if (out.o[i].text != null) {
+ os += '<span style="background-color: ' +colors[i]+ '">' +
+ escape(out.o[i].text) + oSpace[i] + "</span>";
+ } else {
+ os += "<del>" + escape(out.o[i]) + oSpace[i] + "</del>";
+ }
+ }
+
+ var ns = "";
+ for (var i = 0; i < out.n.length; i++) {
+ if (out.n[i].text != null) {
+ ns += '<span style="background-color: ' +colors[out.n[i].row]+ '">' +
+ escape(out.n[i].text) + nSpace[i] + "</span>";
+ } else {
+ ns += "<ins>" + escape(out.n[i]) + nSpace[i] + "</ins>";
+ }
+ }
+
+ return { o : os , n : ns };
+}
+
+function diff( o, n ) {
+ var ns = new Object();
+ var os = new Object();
+
+ for ( var i = 0; i < n.length; i++ ) {
+ if ( ns[ n[i] ] == null )
+ ns[ n[i] ] = { rows: new Array(), o: null };
+ ns[ n[i] ].rows.push( i );
+ }
+
+ for ( var i = 0; i < o.length; i++ ) {
+ if ( os[ o[i] ] == null )
+ os[ o[i] ] = { rows: new Array(), n: null };
+ os[ o[i] ].rows.push( i );
+ }
+
+ for ( var i in ns ) {
+ if ( ns[i].rows.length == 1 && typeof(os[i]) != "undefined" && os[i].rows.length == 1 ) {
+ n[ ns[i].rows[0] ] = { text: n[ ns[i].rows[0] ], row: os[i].rows[0] };
+ o[ os[i].rows[0] ] = { text: o[ os[i].rows[0] ], row: ns[i].rows[0] };
+ }
+ }
+
+ for ( var i = 0; i < n.length - 1; i++ ) {
+ if ( n[i].text != null && n[i+1].text == null && n[i].row + 1 < o.length && o[ n[i].row + 1 ].text == null &&
+ n[i+1] == o[ n[i].row + 1 ] ) {
+ n[i+1] = { text: n[i+1], row: n[i].row + 1 };
+ o[n[i].row+1] = { text: o[n[i].row+1], row: i + 1 };
+ }
+ }
+
+ for ( var i = n.length - 1; i > 0; i-- ) {
+ if ( n[i].text != null && n[i-1].text == null && n[i].row > 0 && o[ n[i].row - 1 ].text == null &&
+ n[i-1] == o[ n[i].row - 1 ] ) {
+ n[i-1] = { text: n[i-1], row: n[i].row - 1 };
+ o[n[i].row-1] = { text: o[n[i].row-1], row: i - 1 };
+ }
+ }
+
+ return { o: o, n: n };
+}
+
--- /dev/null
+/*
+ * QUnit - jQuery unit testrunner
+ *
+ * http://docs.jquery.com/QUnit
+ *
+ * Copyright (c) 2008 John Resig, Jörn Zaefferer
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * $Id: testrunner.js 6173 2009-02-02 20:09:32Z jeresig $
+ */
+
+(function($) {
+
+// Tests for equality any JavaScript type and structure without unexpected results.
+// Discussions and reference: http://philrathe.com/articles/equiv
+// Test suites: http://philrathe.com/tests/equiv
+// Author: Philippe Rathé <prathe@gmail.com>
+var equiv = function () {
+
+ var innerEquiv; // the real equiv function
+ var callers = []; // stack to decide between skip/abort functions
+
+ // Determine what is o.
+ function hoozit(o) {
+ if (typeof o === "string") {
+ return "string";
+
+ } else if (typeof o === "boolean") {
+ return "boolean";
+
+ } else if (typeof o === "number") {
+
+ if (isNaN(o)) {
+ return "nan";
+ } else {
+ return "number";
+ }
+
+ } else if (typeof o === "undefined") {
+ return "undefined";
+
+ // consider: typeof null === object
+ } else if (o === null) {
+ return "null";
+
+ // consider: typeof [] === object
+ } else if (o instanceof Array) {
+ return "array";
+
+ // consider: typeof new Date() === object
+ } else if (o instanceof Date) {
+ return "date";
+
+ // consider: /./ instanceof Object;
+ // /./ instanceof RegExp;
+ // typeof /./ === "function"; // => false in IE and Opera,
+ // true in FF and Safari
+ } else if (o instanceof RegExp) {
+ return "regexp";
+
+ } else if (typeof o === "object") {
+ return "object";
+
+ } else if (o instanceof Function) {
+ return "function";
+ }
+ }
+
+ // Call the o related callback with the given arguments.
+ function bindCallbacks(o, callbacks, args) {
+ var prop = hoozit(o);
+ if (prop) {
+ if (hoozit(callbacks[prop]) === "function") {
+ return callbacks[prop].apply(callbacks, args);
+ } else {
+ return callbacks[prop]; // or undefined
+ }
+ }
+ }
+
+ var callbacks = function () {
+
+ // for string, boolean, number and null
+ function useStrictEquality(b, a) {
+ return a === b;
+ }
+
+ return {
+ "string": useStrictEquality,
+ "boolean": useStrictEquality,
+ "number": useStrictEquality,
+ "null": useStrictEquality,
+ "undefined": useStrictEquality,
+
+ "nan": function (b) {
+ return isNaN(b);
+ },
+
+ "date": function (b, a) {
+ return hoozit(b) === "date" && a.valueOf() === b.valueOf();
+ },
+
+ "regexp": function (b, a) {
+ return hoozit(b) === "regexp" &&
+ a.source === b.source && // the regex itself
+ a.global === b.global && // and its modifers (gmi) ...
+ a.ignoreCase === b.ignoreCase &&
+ a.multiline === b.multiline;
+ },
+
+ // - skip when the property is a method of an instance (OOP)
+ // - abort otherwise,
+ // initial === would have catch identical references anyway
+ "function": function () {
+ var caller = callers[callers.length - 1];
+ return caller !== Object &&
+ typeof caller !== "undefined";
+ },
+
+ "array": function (b, a) {
+ var i;
+ var len;
+
+ // b could be an object literal here
+ if ( ! (hoozit(b) === "array")) {
+ return false;
+ }
+
+ len = a.length;
+ if (len !== b.length) { // safe and faster
+ return false;
+ }
+ for (i = 0; i < len; i++) {
+ if( ! innerEquiv(a[i], b[i])) {
+ return false;
+ }
+ }
+ return true;
+ },
+
+ "object": function (b, a) {
+ var i;
+ var eq = true; // unless we can proove it
+ var aProperties = [], bProperties = []; // collection of strings
+
+ // comparing constructors is more strict than using instanceof
+ if ( a.constructor !== b.constructor) {
+ return false;
+ }
+
+ // stack constructor before traversing properties
+ callers.push(a.constructor);
+
+ for (i in a) { // be strict: don't ensures hasOwnProperty and go deep
+
+ aProperties.push(i); // collect a's properties
+
+ if ( ! innerEquiv(a[i], b[i])) {
+ eq = false;
+ }
+ }
+
+ callers.pop(); // unstack, we are done
+
+ for (i in b) {
+ bProperties.push(i); // collect b's properties
+ }
+
+ // Ensures identical properties name
+ return eq && innerEquiv(aProperties.sort(), bProperties.sort());
+ }
+ };
+ }();
+
+ innerEquiv = function () { // can take multiple arguments
+ var args = Array.prototype.slice.apply(arguments);
+ if (args.length < 2) {
+ return true; // end transition
+ }
+
+ return (function (a, b) {
+ if (a === b) {
+ return true; // catch the most you can
+
+ } else if (typeof a !== typeof b || a === null || b === null || typeof a === "undefined" || typeof b === "undefined") {
+ return false; // don't lose time with error prone cases
+
+ } else {
+ return bindCallbacks(a, callbacks, [b, a]);
+ }
+
+ // apply transition with (1..n) arguments
+ })(args[0], args[1]) && arguments.callee.apply(this, args.splice(1, args.length -1));
+ };
+
+ return innerEquiv;
+}(); // equiv
+
+var GETParams = $.map( location.search.slice(1).split('&'), decodeURIComponent ),
+ ngindex = $.inArray("noglobals", GETParams),
+ noglobals = ngindex !== -1;
+
+if( noglobals )
+ GETParams.splice( ngindex, 1 );
+
+var config = {
+ stats: {
+ all: 0,
+ bad: 0
+ },
+ queue: [],
+ // block until document ready
+ blocking: true,
+ //restrict modules/tests by get parameters
+ filters: GETParams,
+ isLocal: !!(window.location.protocol == 'file:')
+};
+
+// public API as global methods
+$.extend(window, {
+ test: test,
+ module: module,
+ expect: expect,
+ ok: ok,
+ equals: equals,
+ start: start,
+ stop: stop,
+ reset: reset,
+ isLocal: config.isLocal,
+ same: function(a, b, message) {
+ push(equiv(a, b), a, b, message);
+ },
+ QUnit: {
+ equiv: equiv,
+ ok: ok,
+ done: function(failures, total){},
+ log: function(result, message){}
+ },
+ // legacy methods below
+ isSet: isSet,
+ isObj: isObj,
+ compare: function() {
+ throw "compare is deprecated - use same() instead";
+ },
+ compare2: function() {
+ throw "compare2 is deprecated - use same() instead";
+ },
+ serialArray: function() {
+ throw "serialArray is deprecated - use jsDump.parse() instead";
+ },
+ q: q,
+ t: t,
+ url: url,
+ triggerEvent: triggerEvent
+});
+
+$(window).load(function() {
+ $('#userAgent').html(navigator.userAgent);
+ var head = $('<div class="testrunner-toolbar"><label for="filter-pass">Hide passed tests</label></div>').insertAfter("#userAgent");
+ $('<input type="checkbox" id="filter-pass" />').attr("disabled", true).prependTo(head).click(function() {
+ $('li.pass')[this.checked ? 'hide' : 'show']();
+ });
+ $('<input type="checkbox" id="filter-missing">').attr("disabled", true).appendTo(head).click(function() {
+ $("li.fail:contains('missing test - untested code is broken code')").parent('ol').parent('li.fail')[this.checked ? 'hide' : 'show']();
+ });
+ $("#filter-missing").after('<label for="filter-missing">Hide missing tests (untested code is broken code)</label>');
+ runTest();
+});
+
+function synchronize(callback) {
+ config.queue.push(callback);
+ if(!config.blocking) {
+ process();
+ }
+}
+
+function process() {
+ while(config.queue.length && !config.blocking) {
+ config.queue.shift()();
+ }
+}
+
+function stop(timeout) {
+ config.blocking = true;
+ if (timeout)
+ config.timeout = setTimeout(function() {
+ QUnit.ok( false, "Test timed out" );
+ start();
+ }, timeout);
+}
+function start() {
+ // A slight delay, to avoid any current callbacks
+ setTimeout(function() {
+ if(config.timeout)
+ clearTimeout(config.timeout);
+ config.blocking = false;
+ process();
+ }, 13);
+}
+
+function validTest( name ) {
+ var i = config.filters.length,
+ run = false;
+
+ if( !i )
+ return true;
+
+ while( i-- ){
+ var filter = config.filters[i],
+ not = filter.charAt(0) == '!';
+ if( not )
+ filter = filter.slice(1);
+ if( name.indexOf(filter) != -1 )
+ return !not;
+ if( not )
+ run = true;
+ }
+ return run;
+}
+
+function runTest() {
+ config.blocking = false;
+ var started = +new Date;
+ config.fixture = document.getElementById('main').innerHTML;
+ config.ajaxSettings = $.ajaxSettings;
+ synchronize(function() {
+ $('<p id="testresult" class="result"/>').html(['Tests completed in ',
+ +new Date - started, ' milliseconds.<br/>',
+ '<span class="bad">', config.stats.bad, '</span> tests of <span class="all">', config.stats.all, '</span> failed.']
+ .join(''))
+ .appendTo("body");
+ $("#banner").addClass(config.stats.bad ? "fail" : "pass");
+ QUnit.done( config.stats.bad, config.stats.all );
+ });
+}
+
+var pollution;
+
+function saveGlobal(){
+ pollution = [ ];
+
+ if( noglobals )
+ for( var key in window )
+ pollution.push(key);
+}
+function checkPollution( name ){
+ var old = pollution;
+ saveGlobal();
+
+ if( pollution.length > old.length ){
+ ok( false, "Introduced global variable(s): " + diff(old, pollution).join(", ") );
+ config.expected++;
+ }
+}
+
+function diff( clean, dirty ){
+ return $.grep( dirty, function(name){
+ return $.inArray( name, clean ) == -1;
+ });
+}
+
+function test(name, callback) {
+ if(config.currentModule)
+ name = config.currentModule + " module: " + name;
+ var lifecycle = $.extend({
+ setup: function() {},
+ teardown: function() {}
+ }, config.moduleLifecycle);
+
+ if ( !validTest(name) )
+ return;
+
+ synchronize(function() {
+ config.assertions = [];
+ config.expected = null;
+ try {
+ if( !pollution )
+ saveGlobal();
+ lifecycle.setup();
+ } catch(e) {
+ QUnit.ok( false, "Setup failed on " + name + ": " + e.message );
+ }
+ })
+ synchronize(function() {
+ try {
+ callback();
+ } catch(e) {
+ if( typeof console != "undefined" && console.error && console.warn ) {
+ console.error("Test " + name + " died, exception and test follows");
+ console.error(e);
+ console.warn(callback.toString());
+ }
+ QUnit.ok( false, "Died on test #" + (config.assertions.length + 1) + ": " + e.message );
+ // else next test will carry the responsibility
+ saveGlobal();
+ }
+ });
+ synchronize(function() {
+ try {
+ checkPollution();
+ lifecycle.teardown();
+ } catch(e) {
+ QUnit.ok( false, "Teardown failed on " + name + ": " + e.message );
+ }
+ })
+ synchronize(function() {
+ try {
+ reset();
+ } catch(e) {
+ if( typeof console != "undefined" && console.error && console.warn ) {
+ console.error("reset() failed, following Test " + name + ", exception and reset fn follows");
+ console.error(e);
+ console.warn(reset.toString());
+ }
+ }
+
+ if(config.expected && config.expected != config.assertions.length) {
+ QUnit.ok( false, "Expected " + config.expected + " assertions, but " + config.assertions.length + " were run" );
+ }
+
+ var good = 0, bad = 0;
+ var ol = $("<ol/>").hide();
+ config.stats.all += config.assertions.length;
+ for ( var i = 0; i < config.assertions.length; i++ ) {
+ var assertion = config.assertions[i];
+ $("<li/>").addClass(assertion.result ? "pass" : "fail").text(assertion.message || "(no message)").appendTo(ol);
+ assertion.result ? good++ : bad++;
+ }
+ config.stats.bad += bad;
+
+ var b = $("<strong/>").html(name + " <b style='color:black;'>(<b class='fail'>" + bad + "</b>, <b class='pass'>" + good + "</b>, " + config.assertions.length + ")</b>")
+ .click(function(){
+ $(this).next().toggle();
+ })
+ .dblclick(function(event) {
+ var target = $(event.target).filter("strong").clone();
+ if ( target.length ) {
+ target.children().remove();
+ location.href = location.href.match(/^(.+?)(\?.*)?$/)[1] + "?" + encodeURIComponent($.trim(target.text()));
+ }
+ });
+
+ $("<li/>").addClass(bad ? "fail" : "pass").append(b).append(ol).appendTo("#tests");
+
+ if(bad) {
+ $("#filter-pass").attr("disabled", null);
+ $("#filter-missing").attr("disabled", null);
+ }
+ });
+}
+
+// call on start of module test to prepend name to all tests
+function module(name, lifecycle) {
+ config.currentModule = name;
+ config.moduleLifecycle = lifecycle;
+}
+
+/**
+ * Specify the number of expected assertions to gurantee that failed test (no assertions are run at all) don't slip through.
+ */
+function expect(asserts) {
+ config.expected = asserts;
+}
+
+/**
+ * Resets the test setup. Useful for tests that modify the DOM.
+ */
+function reset() {
+ $("#main").html( config.fixture );
+ $.event.global = {};
+ $.ajaxSettings = $.extend({}, config.ajaxSettings);
+}
+
+/**
+ * Asserts true.
+ * @example ok( $("a").size() > 5, "There must be at least 5 anchors" );
+ */
+function ok(a, msg) {
+ QUnit.log(a, msg);
+
+ config.assertions.push({
+ result: !!a,
+ message: msg
+ });
+}
+
+/**
+ * Asserts that two arrays are the same
+ */
+function isSet(a, b, msg) {
+ function serialArray( a ) {
+ var r = [];
+
+ if ( a && a.length )
+ for ( var i = 0; i < a.length; i++ ) {
+ var str = a[i].nodeName;
+ if ( str ) {
+ str = str.toLowerCase();
+ if ( a[i].id )
+ str += "#" + a[i].id;
+ } else
+ str = a[i];
+ r.push( str );
+ }
+
+ return "[ " + r.join(", ") + " ]";
+ }
+ var ret = true;
+ if ( a && b && a.length != undefined && a.length == b.length ) {
+ for ( var i = 0; i < a.length; i++ )
+ if ( a[i] != b[i] )
+ ret = false;
+ } else
+ ret = false;
+ QUnit.ok( ret, !ret ? (msg + " expected: " + serialArray(b) + " result: " + serialArray(a)) : msg );
+}
+
+/**
+ * Asserts that two objects are equivalent
+ */
+function isObj(a, b, msg) {
+ var ret = true;
+
+ if ( a && b ) {
+ for ( var i in a )
+ if ( a[i] != b[i] )
+ ret = false;
+
+ for ( i in b )
+ if ( a[i] != b[i] )
+ ret = false;
+ } else
+ ret = false;
+
+ QUnit.ok( ret, msg );
+}
+
+/**
+ * Returns an array of elements with the given IDs, eg.
+ * @example q("main", "foo", "bar")
+ * @result [<div id="main">, <span id="foo">, <input id="bar">]
+ */
+function q() {
+ var r = [];
+ for ( var i = 0; i < arguments.length; i++ )
+ r.push( document.getElementById( arguments[i] ) );
+ return r;
+}
+
+/**
+ * Asserts that a select matches the given IDs
+ * @example t("Check for something", "//[a]", ["foo", "baar"]);
+ * @result returns true if "//[a]" return two elements with the IDs 'foo' and 'baar'
+ */
+function t(a,b,c) {
+ var f = $(b);
+ var s = "";
+ for ( var i = 0; i < f.length; i++ )
+ s += (s && ",") + '"' + f[i].id + '"';
+ isSet(f, q.apply(q,c), a + " (" + b + ")");
+}
+
+/**
+ * Add random number to url to stop IE from caching
+ *
+ * @example url("data/test.html")
+ * @result "data/test.html?10538358428943"
+ *
+ * @example url("data/test.php?foo=bar")
+ * @result "data/test.php?foo=bar&10538358345554"
+ */
+function url(value) {
+ return value + (/\?/.test(value) ? "&" : "?") + new Date().getTime() + "" + parseInt(Math.random()*100000);
+}
+
+/**
+ * Checks that the first two arguments are equal, with an optional message.
+ * Prints out both actual and expected values.
+ *
+ * Prefered to ok( actual == expected, message )
+ *
+ * @example equals( $.format("Received {0} bytes.", 2), "Received 2 bytes." );
+ *
+ * @param Object actual
+ * @param Object expected
+ * @param String message (optional)
+ */
+function equals(actual, expected, message) {
+ push(expected == actual, actual, expected, message);
+}
+
+function push(result, actual, expected, message) {
+ message = message || (result ? "okay" : "failed");
+ QUnit.ok( result, result ? message + ": " + expected : message + ", expected: " + jsDump.parse(expected) + " result: " + jsDump.parse(actual) );
+}
+
+/**
+ * Trigger an event on an element.
+ *
+ * @example triggerEvent( document.body, "click" );
+ *
+ * @param DOMElement elem
+ * @param String type
+ */
+function triggerEvent( elem, type, event ) {
+ if ( $.browser.mozilla || $.browser.opera ) {
+ event = document.createEvent("MouseEvents");
+ event.initMouseEvent(type, true, true, elem.ownerDocument.defaultView,
+ 0, 0, 0, 0, 0, false, false, false, false, 0, null);
+ elem.dispatchEvent( event );
+ } else if ( $.browser.msie ) {
+ elem.fireEvent("on"+type);
+ }
+}
+
+})(jQuery);
+
+/**
+ * jsDump
+ * Copyright (c) 2008 Ariel Flesler - aflesler(at)gmail(dot)com | http://flesler.blogspot.com
+ * Licensed under BSD (http://www.opensource.org/licenses/bsd-license.php)
+ * Date: 5/15/2008
+ * @projectDescription Advanced and extensible data dumping for Javascript.
+ * @version 1.0.0
+ * @author Ariel Flesler
+ * @link {http://flesler.blogspot.com/2008/05/jsdump-pretty-dump-of-any-javascript.html}
+ */
+(function(){
+ function quote( str ){
+ return '"' + str.toString().replace(/"/g, '\\"') + '"';
+ };
+ function literal( o ){
+ return o + '';
+ };
+ function join( pre, arr, post ){
+ var s = jsDump.separator(),
+ base = jsDump.indent();
+ inner = jsDump.indent(1);
+ if( arr.join )
+ arr = arr.join( ',' + s + inner );
+ if( !arr )
+ return pre + post;
+ return [ pre, inner + arr, base + post ].join(s);
+ };
+ function array( arr ){
+ var i = arr.length, ret = Array(i);
+ this.up();
+ while( i-- )
+ ret[i] = this.parse( arr[i] );
+ this.down();
+ return join( '[', ret, ']' );
+ };
+
+ var reName = /^function (\w+)/;
+
+ var jsDump = window.jsDump = {
+ parse:function( obj, type ){//type is used mostly internally, you can fix a (custom)type in advance
+ var parser = this.parsers[ type || this.typeOf(obj) ];
+ type = typeof parser;
+
+ return type == 'function' ? parser.call( this, obj ) :
+ type == 'string' ? parser :
+ this.parsers.error;
+ },
+ typeOf:function( obj ){
+ var type = typeof obj,
+ f = 'function';//we'll use it 3 times, save it
+ return type != 'object' && type != f ? type :
+ !obj ? 'null' :
+ obj.exec ? 'regexp' :// some browsers (FF) consider regexps functions
+ obj.getHours ? 'date' :
+ obj.scrollBy ? 'window' :
+ obj.nodeName == '#document' ? 'document' :
+ obj.nodeName ? 'node' :
+ obj.item ? 'nodelist' : // Safari reports nodelists as functions
+ obj.callee ? 'arguments' :
+ obj.call || obj.constructor != Array && //an array would also fall on this hack
+ (obj+'').indexOf(f) != -1 ? f : //IE reports functions like alert, as objects
+ 'length' in obj ? 'array' :
+ type;
+ },
+ separator:function(){
+ return this.multiline ? this.HTML ? '<br />' : '\n' : this.HTML ? ' ' : ' ';
+ },
+ indent:function( extra ){// extra can be a number, shortcut for increasing-calling-decreasing
+ if( !this.multiline )
+ return '';
+ var chr = this.indentChar;
+ if( this.HTML )
+ chr = chr.replace(/\t/g,' ').replace(/ /g,' ');
+ return Array( this._depth_ + (extra||0) ).join(chr);
+ },
+ up:function( a ){
+ this._depth_ += a || 1;
+ },
+ down:function( a ){
+ this._depth_ -= a || 1;
+ },
+ setParser:function( name, parser ){
+ this.parsers[name] = parser;
+ },
+ // The next 3 are exposed so you can use them
+ quote:quote,
+ literal:literal,
+ join:join,
+ //
+ _depth_: 1,
+ // This is the list of parsers, to modify them, use jsDump.setParser
+ parsers:{
+ window: '[Window]',
+ document: '[Document]',
+ error:'[ERROR]', //when no parser is found, shouldn't happen
+ unknown: '[Unknown]',
+ 'null':'null',
+ undefined:'undefined',
+ 'function':function( fn ){
+ var ret = 'function',
+ name = 'name' in fn ? fn.name : (reName.exec(fn)||[])[1];//functions never have name in IE
+ if( name )
+ ret += ' ' + name;
+ ret += '(';
+
+ ret = [ ret, this.parse( fn, 'functionArgs' ), '){'].join('');
+ return join( ret, this.parse(fn,'functionCode'), '}' );
+ },
+ array: array,
+ nodelist: array,
+ arguments: array,
+ object:function( map ){
+ var ret = [ ];
+ this.up();
+ for( var key in map )
+ ret.push( this.parse(key,'key') + ': ' + this.parse(map[key]) );
+ this.down();
+ return join( '{', ret, '}' );
+ },
+ node:function( node ){
+ var open = this.HTML ? '<' : '<',
+ close = this.HTML ? '>' : '>';
+
+ var tag = node.nodeName.toLowerCase(),
+ ret = open + tag;
+
+ for( var a in this.DOMAttrs ){
+ var val = node[this.DOMAttrs[a]];
+ if( val )
+ ret += ' ' + a + '=' + this.parse( val, 'attribute' );
+ }
+ return ret + close + open + '/' + tag + close;
+ },
+ functionArgs:function( fn ){//function calls it internally, it's the arguments part of the function
+ var l = fn.length;
+ if( !l ) return '';
+
+ var args = Array(l);
+ while( l-- )
+ args[l] = String.fromCharCode(97+l);//97 is 'a'
+ return ' ' + args.join(', ') + ' ';
+ },
+ key:quote, //object calls it internally, the key part of an item in a map
+ functionCode:'[code]', //function calls it internally, it's the content of the function
+ attribute:quote, //node calls it internally, it's an html attribute value
+ string:quote,
+ date:quote,
+ regexp:literal, //regex
+ number:literal,
+ 'boolean':literal
+ },
+ DOMAttrs:{//attributes to dump from nodes, name=>realName
+ id:'id',
+ name:'name',
+ 'class':'className'
+ },
+ HTML:false,//if true, entities are escaped ( <, >, \t, space and \n )
+ indentChar:' ',//indentation unit
+ multiline:true //if true, items in a collection, are separated by a \n, else just a space.
+ };
+
+})();
--- /dev/null
+body, div, h1 { font-family: 'trebuchet ms', verdana, arial; margin: 0; padding: 0 }
+body {font-size: 10pt; }
+h1 { padding: 15px; font-size: large; background-color: #06b; color: white; }
+h1 a { color: white; }
+h2 { padding: 10px; background-color: #eee; color: black; margin: 0; font-size: small; font-weight: normal }
+
+.pass { color: green; }
+.fail { color: red; }
+p.result { margin-left: 1em; }
+
+#banner { height: 2em; border-bottom: 1px solid white; }
+h2.pass { background-color: green; }
+h2.fail { background-color: red; }
+
+div.testrunner-toolbar { background: #eee; border-top: 1px solid black; padding: 10px; }
+
+ol#tests > li > strong { cursor:pointer; }
+
+div#fx-tests h4 {
+ background: red;
+}
+
+div#fx-tests h4.pass {
+ background: green;
+}
+
+div#fx-tests div.box {
+ background: red url(data/cow.jpg) no-repeat;
+ overflow: hidden;
+ border: 2px solid #000;
+}
+
+div#fx-tests div.overflow {
+ overflow: visible;
+}
+
+div.inline {
+ display: inline;
+}
+
+div.autoheight {
+ height: auto;
+}
+
+div.autowidth {
+ width: auto;
+}
+
+div.autoopacity {
+ opacity: auto;
+}
+
+div.largewidth {
+ width: 100px;
+}
+
+div.largeheight {
+ height: 100px;
+}
+
+div.largeopacity {
+ filter: progid:DXImageTransform.Microsoft.Alpha(opacity=100);
+}
+
+div.medwidth {
+ width: 50px;
+}
+
+div.medheight {
+ height: 50px;
+}
+
+div.medopacity {
+ opacity: 0.5;
+ filter: progid:DXImageTransform.Microsoft.Alpha(opacity=50);
+}
+
+div.nowidth {
+ width: 0px;
+}
+
+div.noheight {
+ height: 0px;
+}
+
+div.noopacity {
+ opacity: 0;
+ filter: progid:DXImageTransform.Microsoft.Alpha(opacity=0);
+}
+
+div.hidden {
+ display: none;
+}
+
+div#fx-tests div.widewidth {
+ background-repeat: repeat-x;
+}
+
+div#fx-tests div.wideheight {
+ background-repeat: repeat-y;
+}
+
+div#fx-tests div.widewidth.wideheight {
+ background-repeat: repeat;
+}
+
+div#fx-tests div.noback {
+ background-image: none;
+}
+
+div.chain, div.chain div { width: 100px; height: 20px; position: relative; float: left; }
+div.chain div { position: absolute; top: 0px; left: 0px; }
+
+div.chain.test { background: red; }
+div.chain.test div { background: green; }
+
+div.chain.out { background: green; }
+div.chain.out div { background: red; display: none; }
+
+div#show-tests * { display: none; }
--- /dev/null
+/*
+ * jquery.simulate - simulate browser mouse and keyboard events
+ *
+ * Copyright (c) 2009 Eduardo Lundgren (eduardolundgren@gmail.com)
+ * and Richard D. Worth (rdworth@gmail.com)
+ *
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ *
+ */
+
+;(function($) {
+
+$.fn.extend({
+ simulate: function(type, options) {
+ return this.each(function() {
+ var opt = $.extend({}, $.simulate.defaults, options || {});
+ new $.simulate(this, type, opt);
+ });
+ }
+});
+
+$.simulate = function(el, type, options) {
+ this.target = el;
+ this.options = options;
+
+ if (/^drag$/.test(type)) {
+ this[type].apply(this, [this.target, options]);
+ } else {
+ this.simulateEvent(el, type, options);
+ }
+}
+
+$.extend($.simulate.prototype, {
+ simulateEvent: function(el, type, options) {
+ var evt = this.createEvent(type, options);
+ this.dispatchEvent(el, type, evt, options);
+ return evt;
+ },
+ createEvent: function(type, options) {
+ if (/^mouse(over|out|down|up|move)|(dbl)?click$/.test(type)) {
+ return this.mouseEvent(type, options);
+ } else if (/^key(up|down|press)$/.test(type)) {
+ return this.keyboardEvent(type, options);
+ }
+ },
+ mouseEvent: function(type, options) {
+ var evt;
+ var e = $.extend({
+ bubbles: true, cancelable: (type != "mousemove"), view: window, detail: 0,
+ screenX: 0, screenY: 0, clientX: 0, clientY: 0,
+ ctrlKey: false, altKey: false, shiftKey: false, metaKey: false,
+ button: 0, relatedTarget: undefined
+ }, options);
+
+ var relatedTarget = $(e.relatedTarget)[0];
+
+ if ($.isFunction(document.createEvent)) {
+ evt = document.createEvent("MouseEvents");
+ evt.initMouseEvent(type, e.bubbles, e.cancelable, e.view, e.detail,
+ e.screenX, e.screenY, e.clientX, e.clientY,
+ e.ctrlKey, e.altKey, e.shiftKey, e.metaKey,
+ e.button, e.relatedTarget || document.body.parentNode);
+ } else if (document.createEventObject) {
+ evt = document.createEventObject();
+ $.extend(evt, e);
+ evt.button = { 0:1, 1:4, 2:2 }[evt.button] || evt.button;
+ }
+ return evt;
+ },
+ keyboardEvent: function(type, options) {
+ var evt;
+
+ var e = $.extend({ bubbles: true, cancelable: true, view: window,
+ ctrlKey: false, altKey: false, shiftKey: false, metaKey: false,
+ keyCode: 0, charCode: 0
+ }, options);
+
+ if ($.isFunction(document.createEvent)) {
+ try {
+ evt = document.createEvent("KeyEvents");
+ evt.initKeyEvent(type, e.bubbles, e.cancelable, e.view,
+ e.ctrlKey, e.altKey, e.shiftKey, e.metaKey,
+ e.keyCode, e.charCode);
+ } catch(err) {
+ evt = document.createEvent("Events");
+ evt.initEvent(type, e.bubbles, e.cancelable);
+ $.extend(evt, { view: e.view,
+ ctrlKey: e.ctrlKey, altKey: e.altKey, shiftKey: e.shiftKey, metaKey: e.metaKey,
+ keyCode: e.keyCode, charCode: e.charCode
+ });
+ }
+ } else if (document.createEventObject) {
+ evt = document.createEventObject();
+ $.extend(evt, e);
+ }
+ if ($.browser.msie || $.browser.opera) {
+ evt.keyCode = (e.charCode > 0) ? e.charCode : e.keyCode;
+ evt.charCode = undefined;
+ }
+ return evt;
+ },
+
+ dispatchEvent: function(el, type, evt) {
+ if (el.dispatchEvent) {
+ el.dispatchEvent(evt);
+ } else if (el.fireEvent) {
+ el.fireEvent('on' + type, evt);
+ }
+ return evt;
+ },
+
+ drag: function(el) {
+ var self = this, center = this.findCenter(this.target),
+ options = this.options, x = Math.floor(center.x), y = Math.floor(center.y),
+ dx = options.dx || 0, dy = options.dy || 0, target = this.target;
+ var coord = { clientX: x, clientY: y };
+ this.simulateEvent(target, "mousedown", coord);
+ coord = { clientX: x + 1, clientY: y + 1 };
+ this.simulateEvent(document, "mousemove", coord);
+ coord = { clientX: x + dx, clientY: y + dy };
+ this.simulateEvent(document, "mousemove", coord);
+ this.simulateEvent(document, "mousemove", coord);
+ this.simulateEvent(target, "mouseup", coord);
+ },
+ findCenter: function(el) {
+ var el = $(this.target), o = el.offset();
+ return {
+ x: o.left + el.outerWidth() / 2,
+ y: o.top + el.outerHeight() / 2
+ };
+ }
+});
+
+$.extend($.simulate, {
+ defaults: {
+ speed: 'sync'
+ },
+ VK_TAB: 9,
+ VK_ENTER: 13,
+ VK_ESC: 27,
+ VK_PGUP: 33,
+ VK_PGDN: 34,
+ VK_END: 35,
+ VK_HOME: 36,
+ VK_LEFT: 37,
+ VK_UP: 38,
+ VK_RIGHT: 39,
+ VK_DOWN: 40
+});
+
+})(jQuery);
--- /dev/null
+\r
+/*\r
+* jQuery UI CSS Framework\r
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)\r
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.\r
+* To view and modify this theme, visit http://jqueryui.com/themeroller/\r
+*/\r
+\r
+/*** Begin CORE ***/\r
+\r
+/* Layout helpers\r
+----------------------------------*/\r
+.ui-helper-hidden { display: none; }\r
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }\r
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }\r
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }\r
+.ui-helper-clearfix { display: inline-block; }\r
+/* required comment for clearfix to work in Opera \*/\r
+* html .ui-helper-clearfix { height:1%; }\r
+.ui-helper-clearfix { display:block; }\r
+/* end clearfix */\r
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }*/\r
+\r
+\r
+/* Interaction Cues\r
+----------------------------------*/\r
+.ui-state-disabled { cursor: default !important; }\r
+\r
+\r
+/* Icons\r
+----------------------------------*/\r
+\r
+/* states and images */\r
+.ui-icon { display: block; text-indents: -99999px; overflow: hidden; background-repeat: no-repeat; }\r
+\r
+\r
+/* Misc visuals\r
+----------------------------------*/\r
+\r
+/* Overlays */\r
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }\r
+\r
+/*** End Core ***/\r
+\r
+\r
+/*** Begin THEME ***/\r
+\r
+/* Component containers\r
+----------------------------------*/\r
+.ui-widget { font-family: Arial,sans-serif/*{ffDefault}*/; font-size: 11px/*{fsDefault}*/; }\r
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Arial,sans-serif/*{ffDefault}*/; font-size: 11px; }\r
+.ui-widget-content { border: none/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png) 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*//*{bgContentRepeat}*/; color: #A9A9A9/*{fcContent}*/; }\r
+.ui-widget-content a { color: #A9A9A9/*{fcContent}*/; }\r
+.ui-widget-header { border: none/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*//*{bgHeaderRepeat}*/; color: #565656/*{fcHeader}*/; font-weight: bold; }\r
+.ui-widget-header a { color: #000/*{fcHeader}*/; }\r
+\r
+\r
+\r
+/* Interaction states\r
+----------------------------------*/\r
+.ui-state-default, .ui-widget-content .ui-state-default { border: none/*{borderColorDefault}*/; background: none/*{bgColorDefault}*/ /*{bgDefaultXPos}*/ /*{bgDefaultYPos}*/ /*{bgDefaultRepeat}*//*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #333/*{fcDefault}*/; outline: none; }\r
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #000/*{fcDefault}*/; text-decoration: none; outline: none; }\r
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: none/*{borderColorHover}*/; background: none/*{bgColorHover}*/ none /*{bgHoverXPos}*/ /*{bgHoverYPos}*/ /*{bgHoverRepeat}*//*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #222/*{fcHover}*/; outline: none; }\r
+.ui-state-hover a, .ui-state-hover a:hover { color: #000/*{fcHover}*/; text-decoration: none; outline: none; }\r
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #ccc/*{borderColorActive}*/; background: none/*{bgColorActive}*/ /*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*//*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; }\r
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; }\r
+\r
+/* Interaction Cues\r
+----------------------------------*/\r
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*//*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }\r
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }\r
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png) 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*//*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }\r
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a/*{fcError}*/; }\r
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }\r
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }\r
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }\r
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }\r
+\r
+/* Icons\r
+----------------------------------*/\r
+\r
+/* states and images */\r
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }\r
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }\r
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }\r
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }\r
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }\r
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }\r
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }\r
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }\r
+\r
+/* positioning */\r
+.ui-icon-carat-1-n { background-position: 0 0; }\r
+.ui-icon-carat-1-ne { background-position: -16px 0; }\r
+.ui-icon-carat-1-e { background-position: -32px 0; }\r
+.ui-icon-carat-1-se { background-position: -48px 0; }\r
+.ui-icon-carat-1-s { background-position: -64px 0; }\r
+.ui-icon-carat-1-sw { background-position: -80px 0; }\r
+.ui-icon-carat-1-w { background-position: -96px 0; }\r
+.ui-icon-carat-1-nw { background-position: -112px 0; }\r
+.ui-icon-carat-2-n-s { background-position: -128px 0; }\r
+.ui-icon-carat-2-e-w { background-position: -144px 0; }\r
+.ui-icon-triangle-1-n { background-position: 0 -16px; }\r
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }\r
+.ui-icon-triangle-1-e { background-position: -32px -16px; }\r
+.ui-icon-triangle-1-se { background-position: -48px -16px; }\r
+.ui-icon-triangle-1-s { background-position: -64px -16px; }\r
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }\r
+.ui-icon-triangle-1-w { background-position: -96px -16px; }\r
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }\r
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }\r
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }\r
+.ui-icon-arrow-1-n { background-position: 0 -32px; }\r
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }\r
+.ui-icon-arrow-1-e { background-position: -32px -32px; }\r
+.ui-icon-arrow-1-se { background-position: -48px -32px; }\r
+.ui-icon-arrow-1-s { background-position: -64px -32px; }\r
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }\r
+.ui-icon-arrow-1-w { background-position: -96px -32px; }\r
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }\r
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }\r
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }\r
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }\r
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }\r
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }\r
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }\r
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }\r
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }\r
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }\r
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }\r
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }\r
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }\r
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }\r
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }\r
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }\r
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }\r
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }\r
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }\r
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }\r
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }\r
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }\r
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }\r
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }\r
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }\r
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }\r
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }\r
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }\r
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }\r
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }\r
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }\r
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }\r
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }\r
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }\r
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }\r
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }\r
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }\r
+.ui-icon-arrow-4 { background-position: 0 -80px; }\r
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }\r
+.ui-icon-extlink { background-position: -32px -80px; }\r
+.ui-icon-newwin { background-position: -48px -80px; }\r
+.ui-icon-refresh { background-position: -64px -80px; }\r
+.ui-icon-shuffle { background-position: -80px -80px; }\r
+.ui-icon-transfer-e-w { background-position: -96px -80px; }\r
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }\r
+.ui-icon-folder-collapsed { background-position: 0 -96px; }\r
+.ui-icon-folder-open { background-position: -16px -96px; }\r
+.ui-icon-document { background-position: -32px -96px; }\r
+.ui-icon-document-b { background-position: -48px -96px; }\r
+.ui-icon-note { background-position: -64px -96px; }\r
+.ui-icon-mail-closed { background-position: -80px -96px; }\r
+.ui-icon-mail-open { background-position: -96px -96px; }\r
+.ui-icon-suitcase { background-position: -112px -96px; }\r
+.ui-icon-comment { background-position: -128px -96px; }\r
+.ui-icon-person { background-position: -144px -96px; }\r
+.ui-icon-print { background-position: -160px -96px; }\r
+.ui-icon-trash { background-position: -176px -96px; }\r
+.ui-icon-locked { background-position: -192px -96px; }\r
+.ui-icon-unlocked { background-position: -208px -96px; }\r
+.ui-icon-bookmark { background-position: -224px -96px; }\r
+.ui-icon-tag { background-position: -240px -96px; }\r
+.ui-icon-home { background-position: 0 -112px; }\r
+.ui-icon-flag { background-position: -16px -112px; }\r
+.ui-icon-calendar { background-position: -32px -112px; }\r
+.ui-icon-cart { background-position: -48px -112px; }\r
+.ui-icon-pencil { background-position: -64px -112px; }\r
+.ui-icon-clock { background-position: -80px -112px; }\r
+.ui-icon-disk { background-position: -96px -112px; }\r
+.ui-icon-calculator { background-position: -112px -112px; }\r
+.ui-icon-zoomin { background-position: -128px -112px; }\r
+.ui-icon-zoomout { background-position: -144px -112px; }\r
+.ui-icon-search { background-position: -160px -112px; }\r
+.ui-icon-wrench { background-position: -176px -112px; }\r
+.ui-icon-gear { background-position: -192px -112px; }\r
+.ui-icon-heart { background-position: -208px -112px; }\r
+.ui-icon-star { background-position: -224px -112px; }\r
+.ui-icon-link { background-position: -240px -112px; }\r
+.ui-icon-cancel { background-position: 0 -128px; }\r
+.ui-icon-plus { background-position: -16px -128px; }\r
+.ui-icon-plusthick { background-position: -32px -128px; }\r
+.ui-icon-minus { background-position: -48px -128px; }\r
+.ui-icon-minusthick { background-position: -64px -128px; }\r
+.ui-icon-close { background-position: -80px -128px; }\r
+.ui-icon-closethick { background-position: -96px -128px; }\r
+.ui-icon-key { background-position: -112px -128px; }\r
+.ui-icon-lightbulb { background-position: -128px -128px; }\r
+.ui-icon-scissors { background-position: -144px -128px; }\r
+.ui-icon-clipboard { background-position: -160px -128px; }\r
+.ui-icon-copy { background-position: -176px -128px; }\r
+.ui-icon-contact { background-position: -192px -128px; }\r
+.ui-icon-image { background-position: -208px -128px; }\r
+.ui-icon-video { background-position: -224px -128px; }\r
+.ui-icon-script { background-position: -240px -128px; }\r
+.ui-icon-alert { background-position: 0 -144px; }\r
+.ui-icon-info { background-position: -16px -144px; }\r
+.ui-icon-notice { background-position: -32px -144px; }\r
+.ui-icon-help { background-position: -48px -144px; }\r
+.ui-icon-check { background-position: -64px -144px; }\r
+.ui-icon-bullet { background-position: -80px -144px; }\r
+.ui-icon-radio-off { background-position: -96px -144px; }\r
+.ui-icon-radio-on { background-position: -112px -144px; }\r
+.ui-icon-pin-w { background-position: -128px -144px; }\r
+.ui-icon-pin-s { background-position: -144px -144px; }\r
+.ui-icon-play { background-position: 0 -160px; }\r
+.ui-icon-pause { background-position: -16px -160px; }\r
+.ui-icon-seek-next { background-position: -32px -160px; }\r
+.ui-icon-seek-prev { background-position: -48px -160px; }\r
+.ui-icon-seek-end { background-position: -64px -160px; }\r
+.ui-icon-seek-first { background-position: -80px -160px; }\r
+.ui-icon-stop { background-position: -96px -160px; }\r
+.ui-icon-eject { background-position: -112px -160px; }\r
+.ui-icon-volume-off { background-position: -128px -160px; }\r
+.ui-icon-volume-on { background-position: -144px -160px; }\r
+.ui-icon-power { background-position: 0 -176px; }\r
+.ui-icon-signal-diag { background-position: -16px -176px; }\r
+.ui-icon-signal { background-position: -32px -176px; }\r
+.ui-icon-battery-0 { background-position: -48px -176px; }\r
+.ui-icon-battery-1 { background-position: -64px -176px; }\r
+.ui-icon-battery-2 { background-position: -80px -176px; }\r
+.ui-icon-battery-3 { background-position: -96px -176px; }\r
+.ui-icon-circle-plus { background-position: 0 -192px; }\r
+.ui-icon-circle-minus { background-position: -16px -192px; }\r
+.ui-icon-circle-close { background-position: -32px -192px; }\r
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }\r
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }\r
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }\r
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }\r
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }\r
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }\r
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }\r
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }\r
+.ui-icon-circle-zoomin { background-position: -176px -192px; }\r
+.ui-icon-circle-zoomout { background-position: -192px -192px; }\r
+.ui-icon-circle-check { background-position: -208px -192px; }\r
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }\r
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }\r
+.ui-icon-circlesmall-close { background-position: -32px -208px; }\r
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }\r
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }\r
+.ui-icon-squaresmall-close { background-position: -80px -208px; }\r
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }\r
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }\r
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }\r
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }\r
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }\r
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }\r
+\r
+\r
+/* Misc visuals\r
+----------------------------------*/\r
+\r
+/* Corner radius */\r
+.ui-corner-tl { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-tr { -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-bl { -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-br { -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-top { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-bottom { -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-right { -moz-border-radius-topright: 5px/*{cornerRadius}*/; -webkit-border-top-right-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomright: 5px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-left { -moz-border-radius-topleft: 5px/*{cornerRadius}*/; -webkit-border-top-left-radius: 5px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 5px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 5px/*{cornerRadius}*/; }\r
+.ui-corner-all { -moz-border-radius: 5px/*{cornerRadius}*/; -webkit-border-radius: 5px/*{cornerRadius}*/; }\r
+\r
+/* Overlays */\r
+.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*//*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }\r
+.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*//*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; }\r
+\r
+\r
+
--- /dev/null
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
+.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
--- /dev/null
+@import "ui.base.css";
+@import "ui.theme.css";
--- /dev/null
+@import url("ui.core.css");
+@import url("ui.resizable.css");
+@import url("ui.accordion.css");
+@import url("ui.dialog.css");
+@import url("ui.slider.css");
+@import url("ui.tabs.css");
+@import url("ui.datepicker.css");
+@import url("ui.progressbar.css");
\ No newline at end of file
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file
--- /dev/null
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
--- /dev/null
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: relative; padding: .2em; width: 300px; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null
+/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
--- /dev/null
+/* Tabs
+----------------------------------*/
+.ui-tabs { padding: .2em; zoom: 1; }
+.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
+.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_glass_75_ffffff_1x400.png)/*{bgImgUrlContent}*/ 0/*{bgContentXPos}*/ 0/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
+.ui-widget-content a { color: #222222/*{fcContent}*/; }
+.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 0/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; }
+.ui-widget-header a { color: #222222/*{fcHeader}*/; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 0/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; outline: none; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; outline: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 0/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; outline: none; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; outline: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 0/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; outline: none; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 0/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_inset-soft_95_fef1ec_1x100.png)/*{bgImgUrlError}*/ 0/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #363636/*{fcError}*/; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ none/*{bgImgUrlOverlay}*/ 0/*{bgOverlayXPos}*/ 0/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
+.ui-widget-shadow { margin: -4px/*{offsetTopShadow}*/ 0 0 -4px/*{offsetLeftShadow}*/; padding: 4px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ none/*{bgImgUrlShadow}*/ 0/*{bgShadowXPos}*/ 0/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .35;filter:Alpha(Opacity=35)/*{opacityShadow}*/; -moz-border-radius: 4px/*{cornerRadiusShadow}*/; -webkit-border-radius: 4px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Lucida%20Grande,%20Lucida%20Sans,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=5px&bgColorHeader=5c9ccc&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=55&borderColorHeader=4297d7&fcHeader=ffffff&iconColorHeader=d8e7f3&bgColorContent=fcfdfd&bgTextureContent=06_inset_hard.png&bgImgOpacityContent=100&borderColorContent=a6c9e2&fcContent=222222&iconColorContent=469bdd&bgColorDefault=dfeffc&bgTextureDefault=02_glass.png&bgImgOpacityDefault=85&borderColorDefault=c5dbec&fcDefault=2e6e9e&iconColorDefault=6da8d5&bgColorHover=d0e5f5&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=79b7e7&fcHover=1d5987&iconColorHover=217bc0&bgColorActive=f5f8f9&bgTextureActive=06_inset_hard.png&bgImgOpacityActive=100&borderColorActive=79b7e7&fcActive=e17009&iconColorActive=f9bd01&bgColorHighlight=fbec88&bgTextureHighlight=01_flat.png&bgImgOpacityHighlight=55&borderColorHighlight=fad42e&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Lucida Grande, Lucida Sans, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #a6c9e2; background: #fcfdfd url(images/ui-bg_inset-hard_100_fcfdfd_1x100.png) 50% bottom repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #4297d7; background: #5c9ccc url(images/ui-bg_gloss-wave_55_5c9ccc_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #c5dbec; background: #dfeffc url(images/ui-bg_glass_85_dfeffc_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #2e6e9e; outline: none; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #2e6e9e; text-decoration: none; outline: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #79b7e7; background: #d0e5f5 url(images/ui-bg_glass_75_d0e5f5_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1d5987; outline: none; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #1d5987; text-decoration: none; outline: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #79b7e7; background: #f5f8f9 url(images/ui-bg_inset-hard_100_f5f8f9_1x100.png) 50% 50% repeat-x; font-weight: bold; color: #e17009; outline: none; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #e17009; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fad42e; background: #fbec88 url(images/ui-bg_flat_55_fbec88_40x100.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_469bdd_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_d8e7f3_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_6da8d5_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_217bc0_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_f9bd01_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; }
+.ui-corner-tr { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
+.ui-corner-br { -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-top { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-right { -moz-border-radius-topright: 5px; -webkit-border-top-right-radius: 5px; -moz-border-radius-bottomright: 5px; -webkit-border-bottom-right-radius: 5px; }
+.ui-corner-left { -moz-border-radius-topleft: 5px; -webkit-border-top-left-radius: 5px; -moz-border-radius-bottomleft: 5px; -webkit-border-bottom-left-radius: 5px; }
+.ui-corner-all { -moz-border-radius: 5px; -webkit-border-radius: 5px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Dialog
+----------------------------------*/
+.ui-dialog { position: relative; padding: .2em; width: 300px; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { padding: .2em; zoom: 1; }
+.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
+.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; outline: none; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; outline: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; outline: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Dialog
+----------------------------------*/
+.ui-dialog { position: relative; padding: .2em; width: 300px; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { padding: .2em; zoom: 1; }
+.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
+.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; }
+.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
--- /dev/null
+@import "ui.base.css";
+@import "ui.theme.css";
--- /dev/null
+@import url("ui.core.css");
+@import url("ui.resizable.css");
+@import url("ui.accordion.css");
+@import url("ui.dialog.css");
+@import url("ui.slider.css");
+@import url("ui.tabs.css");
+@import url("ui.datepicker.css");
+@import url("ui.progressbar.css");
\ No newline at end of file
--- /dev/null
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
\ No newline at end of file
--- /dev/null
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { float:left; font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker .ui-datepicker-title select.ui-datepicker-year { float: right; }
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
--- /dev/null
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: relative; padding: .2em; width: 300px; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em .3em .3em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 0 .2em; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null
+/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0px; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0px; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0px; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0px; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
--- /dev/null
+/* Tabs
+----------------------------------*/
+.ui-tabs { padding: .2em; zoom: 1; }
+.ui-tabs .ui-tabs-nav { list-style: none; position: relative; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { position: relative; float: left; border-bottom-width: 0 !important; margin: 0 .2em -1px 0; padding: 0; }
+.ui-tabs .ui-tabs-nav li a { float: left; text-decoration: none; padding: .5em 1em; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 1px; border-bottom-width: 0; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { padding: 1em 1.4em; display: block; border-width: 0; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; outline: none; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; outline: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; outline: none; }
+.ui-state-active, .ui-widget-content .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; outline: none; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text { color: #cd0a0a; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
\ No newline at end of file
--- /dev/null
+/*
+ * jQuery UI Effects Blind 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Bounce 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Clip 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {
+ version: "1.7.1",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ //if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent();
+
+ //Cache width,height and float properties of the element, and create a wrapper around it
+ var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
+ element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
+ var wrapper = element.parent();
+
+ //Transfer the positioning of the element to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative'} );
+ } else {
+ var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
+ var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
+ wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ wrapper.css(props);
+ return wrapper;
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ },
+
+ //Base function to animate from one class to another in a seamless transition
+ animateClass: function(value, duration, easing, callback) {
+
+ var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
+ var ea = (typeof easing == "string" ? easing : null);
+
+ return this.each(function() {
+
+ var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
+ if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
+ if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+
+ //Let's get a style offset
+ var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
+ var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+
+ // The main function to form the object for animation
+ for(var n in newStyle) {
+ if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
+ && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
+ && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
+ && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
+ && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
+ ) offset[n] = newStyle[n];
+ }
+
+ that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
+ // Change style attribute back to original. For stupid IE, we need to clear the damn object.
+ if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
+ if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
+ if(cb) cb.apply(this, arguments);
+ });
+
+ });
+ }
+};
+
+
+function _normalizeArguments(a, m) {
+
+ var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
+ var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
+ speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+ var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
+
+ return [a[0], o, speed, callback];
+
+}
+
+//Extend the methods of jQuery
+$.fn.extend({
+
+ //Save old methods
+ _show: $.fn.show,
+ _hide: $.fn.hide,
+ __toggle: $.fn.toggle,
+ _addClass: $.fn.addClass,
+ _removeClass: $.fn.removeClass,
+ _toggleClass: $.fn.toggleClass,
+
+ // New effect methods
+ effect: function(fx, options, speed, callback) {
+ return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
+ },
+
+ show: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._show.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
+ }
+ },
+
+ hide: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._hide.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
+ }
+ },
+
+ toggle: function(){
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
+ return this.__toggle.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
+ }
+ },
+
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+ toggleClass: function(classNames,speed,easing,callback) {
+ return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
+ },
+ morph: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ },
+ switchClass: function() {
+ return this.morph.apply(this, arguments);
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+/*
+ * jQuery Color Animations
+ * Copyright 2007 John Resig
+ * Released under the MIT and GPL licenses.
+ */
+
+// We override the animation for all of these color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
+ $.fx.step[attr] = function(fx) {
+ if ( fx.state == 0 ) {
+ fx.start = getColor( fx.elem, attr );
+ fx.end = getRGB( fx.end );
+ }
+
+ fx.elem.style[attr] = "rgb(" + [
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
+ ].join(",") + ")";
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Drop 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Explode 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Fold 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Highlight 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var color = o.options.color || "#ffff99"; // Default highlight color
+ var oldColor = el.css("backgroundColor");
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
+
+ // Animation
+ var animation = {backgroundColor: oldColor };
+ if (mode == "hide") animation['opacity'] = 0;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == "hide") el.hide();
+ $.effects.restore(el, props);
+ if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
+ if(o.callback) o.callback.apply(this, arguments);
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Pulsate 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var times = o.options.times || 5; // Default # of times
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ if (mode == 'hide') times--;
+ if (el.is(':hidden')) { // Show fadeIn
+ el.css('opacity', 0);
+ el.show(); // Show
+ el.animate({opacity: 1}, duration, o.options.easing);
+ times = times-2;
+ }
+
+ // Animate
+ for (var i = 0; i < times; i++) { // Pulsate
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
+ };
+ if (mode == 'hide') { // Last Pulse
+ el.animate({opacity: 0}, duration, o.options.easing, function(){
+ el.hide(); // Hide
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Scale 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
+ options.fade = true; // It's not a puff if it doesn't fade! :)
+ var original = {height: el.height(), width: el.width()}; // Save original
+
+ // Adjust
+ var factor = percent / 100;
+ el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
+
+ // Animation
+ options.from = el.from;
+ options.percent = (mode == 'hide') ? percent : 100;
+ options.mode = mode;
+
+ // Animate
+ el.effect('scale', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Shake 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Slide 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Effects Transfer 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
--- /dev/null
+/* Arabic Translation for jQuery UI date picker plugin. */\r
+/* Khaled Al Horani -- koko.dw@gmail.com */\r
+/* خالد الحوراني -- koko.dw@gmail.com */\r
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */\r
+jQuery(function($){\r
+ $.datepicker.regional['ar'] = {\r
+ closeText: 'إغلاق',\r
+ prevText: '<السابق',\r
+ nextText: 'التالي>',\r
+ currentText: 'اليوم',\r
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',\r
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],\r
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],\r
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['ar']);\r
+});/* Bulgarian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Stoyan Kyosev (http://svest.org). */\r
+jQuery(function($){\r
+ $.datepicker.regional['bg'] = {\r
+ closeText: 'затвори',\r
+ prevText: '<назад',\r
+ nextText: 'напред>',\r
+ nextBigText: '>>',\r
+ currentText: 'днес',\r
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',\r
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],\r
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',\r
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],\r
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],\r
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],\r
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['bg']);\r
+});\r
+/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */\r
+/* Writers: (joan.leon@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ca'] = {\r
+ closeText: 'Tancar',\r
+ prevText: '<Ant',\r
+ nextText: 'Seg>',\r
+ currentText: 'Avui',\r
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',\r
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],\r
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',\r
+ 'Jul','Ago','Set','Oct','Nov','Des'],\r
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],\r
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],\r
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],\r
+ dateFormat: 'mm/dd/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ca']);\r
+});/* Czech initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Tomas Muller (tomas@tomas-muller.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['cs'] = {\r
+ closeText: 'Zavřít',\r
+ prevText: '<Dříve',\r
+ nextText: 'Později>',\r
+ currentText: 'Nyní',\r
+ monthNames: ['leden','únor','březen','duben','květen','červen',\r
+ 'červenec','srpen','září','říjen','listopad','prosinec'],\r
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',\r
+ 'čvc','srp','zář','říj','lis','pro'],\r
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],\r
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],\r
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['cs']);\r
+});\r
+/* Danish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jan Christensen ( deletestuff@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['da'] = {\r
+ closeText: 'Luk',\r
+ prevText: '<Forrige',\r
+ nextText: 'Næste>',\r
+ currentText: 'Idag',\r
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',\r
+ 'Juli','August','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
+ dateFormat: 'dd-mm-yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['da']);\r
+});\r
+/* German initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Milian Wolff (mail@milianw.de). */\r
+jQuery(function($){\r
+ $.datepicker.regional['de'] = {\r
+ closeText: 'schließen',\r
+ prevText: '<zurück',\r
+ nextText: 'Vor>',\r
+ currentText: 'heute',\r
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',\r
+ 'Juli','August','September','Oktober','November','Dezember'],\r
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],\r
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],\r
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['de']);\r
+});\r
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */\r
+jQuery(function($){\r
+ $.datepicker.regional['el'] = {\r
+ closeText: 'Κλείσιμο',\r
+ prevText: 'Προηγούμενος',\r
+ nextText: 'Επόμενος',\r
+ currentText: 'Τρέχων Μήνας',\r
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',\r
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],\r
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',\r
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],\r
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],\r
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],\r
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['el']);\r
+});/* Esperanto initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Olivier M. (olivierweb@ifrance.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['eo'] = {\r
+ closeText: 'Fermi',\r
+ prevText: '<Anta',\r
+ nextText: 'Sekv>',\r
+ currentText: 'Nuna',\r
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',\r
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],\r
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],\r
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['eo']);\r
+});\r
+/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */\r
+/* Traducido por Vester (xvester@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['es'] = {\r
+ closeText: 'Cerrar',\r
+ prevText: '<Ant',\r
+ nextText: 'Sig>',\r
+ currentText: 'Hoy',\r
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',\r
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],\r
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',\r
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],\r
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],\r
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],\r
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['es']);\r
+});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */\r
+/* Javad Mowlanezhad -- jmowla@gmail.com */\r
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */\r
+jQuery(function($) {\r
+ $.datepicker.regional['fa'] = {\r
+ closeText: 'بستن',\r
+ prevText: '<قبلي',\r
+ nextText: 'بعدي>',\r
+ currentText: 'امروز',\r
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',\r
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],\r
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],\r
+ dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],\r
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],\r
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 6,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['fa']);\r
+});/* Finnish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['fi'] = {\r
+ closeText: 'Sulje',\r
+ prevText: '«Edellinen',\r
+ nextText: 'Seuraava»',\r
+ currentText: 'Tänään',\r
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',\r
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],\r
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',\r
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],\r
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],\r
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],\r
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['fi']);\r
+});\r
+/* French initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['fr'] = {\r
+ closeText: 'Fermer',\r
+ prevText: '<Préc',\r
+ nextText: 'Suiv>',\r
+ currentText: 'Courant',\r
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',\r
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],\r
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',\r
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],\r
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],\r
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],\r
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['fr']);\r
+});/* Hebrew initialisation for the UI Datepicker extension. */\r
+/* Written by Amir Hardon (ahardon at gmail dot com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['he'] = {\r
+ closeText: 'סגור',\r
+ prevText: '<הקודם',\r
+ nextText: 'הבא>',\r
+ currentText: 'היום',\r
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',\r
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],\r
+ monthNamesShort: ['1','2','3','4','5','6',\r
+ '7','8','9','10','11','12'],\r
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],\r
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['he']);\r
+});\r
+/* Croatian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Vjekoslav Nesek. */\r
+jQuery(function($){\r
+ $.datepicker.regional['hr'] = {\r
+ closeText: 'Zatvori',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Danas',\r
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',\r
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],\r
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',\r
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],\r
+ dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],\r
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
+ dateFormat: 'dd.mm.yy.', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hr']);\r
+});/* Hungarian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */\r
+jQuery(function($){\r
+ $.datepicker.regional['hu'] = {\r
+ closeText: 'bezárás',\r
+ prevText: '« vissza',\r
+ nextText: 'előre »',\r
+ currentText: 'ma',\r
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',\r
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],\r
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',\r
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],\r
+ dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],\r
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],\r
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hu']);\r
+});\r
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/\r
+jQuery(function($){\r
+ $.datepicker.regional['hy'] = {\r
+ closeText: 'Փակել',\r
+ prevText: '<Նախ.',\r
+ nextText: 'Հաջ.>',\r
+ currentText: 'Այսօր',\r
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',\r
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],\r
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',\r
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],\r
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],\r
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['hy']);\r
+});/* Indonesian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Deden Fathurahman (dedenf@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['id'] = {\r
+ closeText: 'Tutup',\r
+ prevText: '<mundur',\r
+ nextText: 'maju>',\r
+ currentText: 'hari ini',\r
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',\r
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',\r
+ 'Jul','Agus','Sep','Okt','Nop','Des'],\r
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],\r
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],\r
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['id']);\r
+});/* Icelandic initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */\r
+jQuery(function($){\r
+ $.datepicker.regional['is'] = {\r
+ closeText: 'Loka',\r
+ prevText: '< Fyrri',\r
+ nextText: 'Næsti >',\r
+ currentText: 'Í dag',\r
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',\r
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',\r
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],\r
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],\r
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],\r
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['is']);\r
+});/* Italian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Apaella (apaella@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['it'] = {\r
+ closeText: 'Chiudi',\r
+ prevText: '<Prec',\r
+ nextText: 'Succ>',\r
+ currentText: 'Oggi',\r
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',\r
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],\r
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',\r
+ 'Lug','Ago','Set','Ott','Nov','Dic'],\r
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],\r
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],\r
+ dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['it']);\r
+});\r
+/* Japanese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Kentaro SATO (kentaro@ranvis.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ja'] = {\r
+ closeText: '閉じる',\r
+ prevText: '<前',\r
+ nextText: '次>',\r
+ currentText: '今日',\r
+ monthNames: ['1月','2月','3月','4月','5月','6月',\r
+ '7月','8月','9月','10月','11月','12月'],\r
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',\r
+ '7月','8月','9月','10月','11月','12月'],\r
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],\r
+ dayNamesShort: ['日','月','火','水','木','金','土'],\r
+ dayNamesMin: ['日','月','火','水','木','金','土'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 0,\r
+ isRTL: false,\r
+ showMonthAfterYear: true};\r
+ $.datepicker.setDefaults($.datepicker.regional['ja']);\r
+});/* Korean initialisation for the jQuery calendar extension. */\r
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ko'] = {\r
+ closeText: '닫기',\r
+ prevText: '이전달',\r
+ nextText: '다음달',\r
+ currentText: '오늘',\r
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',\r
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],\r
+ dayNames: ['일','월','화','수','목','금','토'],\r
+ dayNamesShort: ['일','월','화','수','목','금','토'],\r
+ dayNamesMin: ['일','월','화','수','목','금','토'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ko']);\r
+});/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* @author Arturas Paleicikas <arturas@avalon.lt> */\r
+jQuery(function($){\r
+ $.datepicker.regional['lt'] = {\r
+ closeText: 'Uždaryti',\r
+ prevText: '<Atgal',\r
+ nextText: 'Pirmyn>',\r
+ currentText: 'Šiandien',\r
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',\r
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],\r
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',\r
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],\r
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],\r
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],\r
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['lt']);\r
+});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */\r
+jQuery(function($){\r
+ $.datepicker.regional['lv'] = {\r
+ closeText: 'Aizvērt',\r
+ prevText: 'Iepr',\r
+ nextText: 'Nāka',\r
+ currentText: 'Šodien',\r
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',\r
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',\r
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],\r
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],\r
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],\r
+ dateFormat: 'dd-mm-yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['lv']);\r
+});/* Malaysian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ms'] = {\r
+ closeText: 'Tutup',\r
+ prevText: '<Sebelum',\r
+ nextText: 'Selepas>',\r
+ currentText: 'hari ini',\r
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',\r
+ 'Julai','Ogos','September','Oktober','November','Disember'],\r
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',\r
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],\r
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],\r
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],\r
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ms']);\r
+});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */\r
+jQuery(function($){\r
+ $.datepicker.regional.nl = {\r
+ closeText: 'Sluiten',\r
+ prevText: '←',\r
+ nextText: '→',\r
+ currentText: 'Vandaag',\r
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',\r
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],\r
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',\r
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],\r
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],\r
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],\r
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional.nl);\r
+});/* Norwegian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['no'] = {\r
+ closeText: 'Lukk',\r
+ prevText: '«Forrige',\r
+ nextText: 'Neste»',\r
+ currentText: 'I dag',\r
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',\r
+ 'Juli','August','September','Oktober','November','Desember'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Des'],\r
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],\r
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],\r
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['no']);\r
+});\r
+/* Polish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['pl'] = {\r
+ closeText: 'Zamknij',\r
+ prevText: '<Poprzedni',\r
+ nextText: 'Następny>',\r
+ currentText: 'Dziś',\r
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',\r
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],\r
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',\r
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],\r
+ dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],\r
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],\r
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['pl']);\r
+});\r
+/* Brazilian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['pt-BR'] = {\r
+ closeText: 'Fechar',\r
+ prevText: '<Anterior',\r
+ nextText: 'Próximo>',\r
+ currentText: 'Hoje',\r
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',\r
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],\r
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',\r
+ 'Jul','Ago','Set','Out','Nov','Dez'],\r
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],\r
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);\r
+});/* Romanian initialisation for the jQuery UI date picker plugin.\r
+ *\r
+ * Written by Edmond L. (ll_edmond@walla.com)\r
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)\r
+ */\r
+jQuery(function($){\r
+ $.datepicker.regional['ro'] = {\r
+ closeText: 'Închide',\r
+ prevText: '« Luna precedentă',\r
+ nextText: 'Luna următoare »',\r
+ currentText: 'Azi',\r
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',\r
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],\r
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',\r
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],\r
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],\r
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],\r
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],\r
+ dateFormat: 'dd MM yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ro']);\r
+});\r
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Andrew Stromnov (stromnov@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['ru'] = {\r
+ closeText: 'Закрыть',\r
+ prevText: '<Пред',\r
+ nextText: 'След>',\r
+ currentText: 'Сегодня',\r
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',\r
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],\r
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',\r
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],\r
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],\r
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],\r
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['ru']);\r
+});/* Slovak initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Vojtech Rinik (vojto@hmm.sk). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sk'] = {\r
+ closeText: 'Zavrieť',\r
+ prevText: '<Predchádzajúci',\r
+ nextText: 'Nasledujúci>',\r
+ currentText: 'Dnes',\r
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',\r
+ 'Júl','August','September','Október','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',\r
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],\r
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sk']);\r
+});\r
+/* Slovenian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Jaka Jancar (jaka@kubje.org). */\r
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */\r
+jQuery(function($){\r
+ $.datepicker.regional['sl'] = {\r
+ closeText: 'Zapri',\r
+ prevText: '<Prejšnji',\r
+ nextText: 'Naslednji>',\r
+ currentText: 'Trenutni',\r
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',\r
+ 'Julij','Avgust','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],\r
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],\r
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sl']);\r
+});\r
+/* Albanian initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Flakron Bytyqi (flakron@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sq'] = {\r
+ closeText: 'mbylle',\r
+ prevText: '<mbrapa',\r
+ nextText: 'Përpara>',\r
+ currentText: 'sot',\r
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',\r
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],\r
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',\r
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],\r
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],\r
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sq']);\r
+});\r
+/* Serbian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Dejan Dimić. */\r
+jQuery(function($){\r
+ $.datepicker.regional['sr-SR'] = {\r
+ closeText: 'Zatvori',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Danas',\r
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',\r
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],\r
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);\r
+});
+/* Serbian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Dejan Dimić. */\r
+jQuery(function($){\r
+ $.datepicker.regional['sr'] = {\r
+ closeText: 'Затвори',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Данас',\r
+ monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',\r
+ 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],\r
+ monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',\r
+ 'Јул','Авг','Сеп','Окт','Нов','Дец'],\r
+ dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],\r
+ dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],\r
+ dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sr']);\r
+});
+/* Swedish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */\r
+jQuery(function($){\r
+ $.datepicker.regional['sv'] = {\r
+ closeText: 'Stäng',\r
+ prevText: '«Förra',\r
+ nextText: 'Nästa»',\r
+ currentText: 'Idag',\r
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',\r
+ 'Juli','Augusti','September','Oktober','November','December'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],\r
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],\r
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],\r
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sv']);\r
+});\r
+/* Thai initialisation for the jQuery UI date picker plugin. */\r
+/* Written by pipo (pipo@sixhead.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['th'] = {\r
+ closeText: 'ปิด',\r
+ prevText: '« ย้อน',\r
+ nextText: 'ถัดไป »',\r
+ currentText: 'วันนี้',\r
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',\r
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],\r
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',\r
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],\r
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],\r
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 0,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['th']);\r
+});/* Turkish initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */\r
+jQuery(function($){\r
+ $.datepicker.regional['tr'] = {\r
+ closeText: 'kapat',\r
+ prevText: '<geri',\r
+ nextText: 'ileri>',\r
+ currentText: 'bugün',\r
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',\r
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],\r
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',\r
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],\r
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],\r
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],\r
+ dateFormat: 'dd.mm.yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['tr']);\r
+});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['uk'] = {\r
+ clearText: 'Очистити', clearStatus: '',\r
+ closeText: 'Закрити', closeStatus: '',\r
+ prevText: '<', prevStatus: '',\r
+ prevBigText: '<<', prevBigStatus: '',\r
+ nextText: '>', nextStatus: '',\r
+ nextBigText: '>>', nextBigStatus: '',\r
+ currentText: 'Сьогодні', currentStatus: '',\r
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',\r
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],\r
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',\r
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],\r
+ monthStatus: '', yearStatus: '',\r
+ weekHeader: 'Не', weekStatus: '',\r
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],\r
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],\r
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],\r
+ dayStatus: 'DD', dateStatus: 'D, M d',\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ initStatus: '', isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['uk']);\r
+});/* Chinese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Cloudream (cloudream@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['zh-CN'] = {\r
+ closeText: '关闭',\r
+ prevText: '<上月',\r
+ nextText: '下月>',\r
+ currentText: '今天',\r
+ monthNames: ['一月','二月','三月','四月','五月','六月',\r
+ '七月','八月','九月','十月','十一月','十二月'],\r
+ monthNamesShort: ['一','二','三','四','五','六',\r
+ '七','八','九','十','十一','十二'],\r
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
+ dayNamesMin: ['日','一','二','三','四','五','六'],\r
+ dateFormat: 'yy-mm-dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);\r
+});\r
+/* Chinese initialisation for the jQuery UI date picker plugin. */\r
+/* Written by Ressol (ressol@gmail.com). */\r
+jQuery(function($){\r
+ $.datepicker.regional['zh-TW'] = {\r
+ closeText: '關閉',\r
+ prevText: '<上月',\r
+ nextText: '下月>',\r
+ currentText: '今天',\r
+ monthNames: ['一月','二月','三月','四月','五月','六月',\r
+ '七月','八月','九月','十月','十一月','十二月'],\r
+ monthNamesShort: ['一','二','三','四','五','六',\r
+ '七','八','九','十','十一','十二'],\r
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],\r
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],\r
+ dayNamesMin: ['日','一','二','三','四','五','六'],\r
+ dateFormat: 'yy/mm/dd', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);\r
+});\r
--- /dev/null
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الحوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name فبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '<السابق',
+ nextText: 'التالي>',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+});
\ No newline at end of file
--- /dev/null
+/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '<назад',
+ nextText: 'напред>',
+ nextBigText: '>>',
+ currentText: 'днес',
+ monthNames: ['Януари','Февруари','Март','Април','Май','Юни',
+ 'Юли','Август','Септември','Октомври','Ноември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Апр','Май','Юни',
+ 'Юли','Авг','Сеп','Окт','Нов','Дек'],
+ dayNames: ['Неделя','Понеделник','Вторник','Сряда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Нед','Пон','Вто','Сря','Чет','Пет','Съб'],
+ dayNamesMin: ['Не','По','Вт','Ср','Че','Пе','Съ'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
--- /dev/null
+/* Inicialitzaci� en catal� per a l'extenci� 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '<Ant',
+ nextText: 'Seg>',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ dateFormat: 'mm/dd/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+});
\ No newline at end of file
--- /dev/null
+/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'Zavřít',
+ prevText: '<Dříve',
+ nextText: 'Později>',
+ currentText: 'Nyní',
+ monthNames: ['leden','únor','březen','duben','květen','červen',
+ 'červenec','srpen','září','říjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bře','dub','kvě','čer',
+ 'čvc','srp','zář','říj','lis','pro'],
+ dayNames: ['neděle', 'pondělí', 'úterý', 'středa', 'čtvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'čt', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','čt','pá','so'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
--- /dev/null
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '<Forrige',
+ nextText: 'Næste>',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ dateFormat: 'dd-mm-yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
--- /dev/null
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '<zurück',
+ nextText: 'Vor>',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
--- /dev/null
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Προηγούμενος',
+ nextText: 'Επόμενος',
+ currentText: 'Τρέχων Μήνας',
+ monthNames: ['Ιανουάριος','Φεβρουάριος','Μάρτιος','Απρίλιος','Μάιος','Ιούνιος',
+ 'Ιούλιος','Αύγουστος','Σεπτέμβριος','Οκτώβριος','Νοέμβριος','Δεκέμβριος'],
+ monthNamesShort: ['Ιαν','Φεβ','Μαρ','Απρ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Νοε','Δεκ'],
+ dayNames: ['Κυριακή','Δευτέρα','Τρίτη','Τετάρτη','Πέμπτη','Παρασκευή','Σάββατο'],
+ dayNamesShort: ['Κυρ','Δευ','Τρι','Τετ','Πεμ','Παρ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','Τρ','Τε','Πε','Πα','Σα'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+});
\ No newline at end of file
--- /dev/null
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '<Anta',
+ nextText: 'Sekv>',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','Aŭgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aŭg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ĵaŭ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ĵa','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
--- /dev/null
+/* Inicializaci�n en espa�ol para la extensi�n 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '<Ant',
+ nextText: 'Sig>',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+});
\ No newline at end of file
--- /dev/null
+/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '<قبلي',
+ nextText: 'بعدي>',
+ currentText: 'امروز',
+ monthNames: ['فروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسفند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سهشنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ dateFormat: 'yy/mm/dd', firstDay: 6,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+});
\ No newline at end of file
--- /dev/null
+/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '«Edellinen',
+ nextText: 'Seuraava»',
+ currentText: 'Tänään',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
--- /dev/null
+/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood@virginbroadband.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+});
\ No newline at end of file
--- /dev/null
+/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '<הקודם',
+ nextText: 'הבא>',
+ currentText: 'היום',
+ monthNames: ['ינואר','פברואר','מרץ','אפריל','מאי','יוני',
+ 'יולי','אוגוסט','ספטמבר','אוקטובר','נובמבר','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ראשון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dayNamesMin: ['א\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: true};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
--- /dev/null
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Siječanj','Veljača','Ožujak','Travanj','Svibanj','Lipani',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjalja','Ponedjeljak','Utorak','Srijeda','Četvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','Čet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],
+ dateFormat: 'dd.mm.yy.', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+});
\ No newline at end of file
--- /dev/null
+/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquerycalendar@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '« vissza',
+ nextText: 'előre »',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Április', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ápr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasámap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
--- /dev/null
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Փակել',
+ prevText: '<Նախ.',
+ nextText: 'Հաջ.>',
+ currentText: 'Այսօր',
+ monthNames: ['Հունվար','Փետրվար','Մարտ','Ապրիլ','Մայիս','Հունիս',
+ 'Հուլիս','Օգոստոս','Սեպտեմբեր','Հոկտեմբեր','Նոյեմբեր','Դեկտեմբեր'],
+ monthNamesShort: ['Հունվ','Փետր','Մարտ','Ապր','Մայիս','Հունիս',
+ 'Հուլ','Օգս','Սեպ','Հոկ','Նոյ','Դեկ'],
+ dayNames: ['կիրակի','եկուշաբթի','երեքշաբթի','չորեքշաբթի','հինգշաբթի','ուրբաթ','շաբաթ'],
+ dayNamesShort: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dayNamesMin: ['կիր','երկ','երք','չրք','հնգ','ուրբ','շբթ'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+});
\ No newline at end of file
--- /dev/null
+/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '<mundur',
+ nextText: 'maju>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+});
\ No newline at end of file
--- /dev/null
+/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '< Fyrri',
+ nextText: 'Næsti >',
+ currentText: 'Í dag',
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+});
\ No newline at end of file
--- /dev/null
+/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Apaella (apaella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '<Prec',
+ nextText: 'Succ>',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gio','Ve','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
--- /dev/null
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: '閉じる',
+ prevText: '<前',
+ nextText: '次>',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','火曜日','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['日','月','火','水','木','金','土'],
+ dayNamesMin: ['日','月','火','水','木','金','土'],
+ dateFormat: 'yy/mm/dd', firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+});
\ No newline at end of file
--- /dev/null
+/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: '이전달',
+ nextText: '다음달',
+ currentText: '오늘',
+ monthNames: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ monthNamesShort: ['1월(JAN)','2월(FEB)','3월(MAR)','4월(APR)','5월(MAY)','6월(JUN)',
+ '7월(JUL)','8월(AUG)','9월(SEP)','10월(OCT)','11월(NOV)','12월(DEC)'],
+ dayNames: ['일','월','화','수','목','금','토'],
+ dayNamesShort: ['일','월','화','수','목','금','토'],
+ dayNamesMin: ['일','월','화','수','목','금','토'],
+ dateFormat: 'yy-mm-dd', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+});
\ No newline at end of file
--- /dev/null
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '<Atgal',
+ nextText: 'Pirmyn>',
+ currentText: 'Šiandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','trečiadienis','ketvirtadienis','penktadienis','šeštadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Še'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+});
\ No newline at end of file
--- /dev/null
+/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'Nāka',
+ currentText: 'Šodien',
+ monthNames: ['Janvāris','Februāris','Marts','Aprīlis','Maijs','Jūnijs',
+ 'Jūlijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jūn',
+ 'Jūl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ dateFormat: 'dd-mm-yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+});
\ No newline at end of file
--- /dev/null
+/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '<Sebelum',
+ nextText: 'Selepas>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+});
\ No newline at end of file
--- /dev/null
+/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: '←',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+});
\ No newline at end of file
--- /dev/null
+/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '«Forrige',
+ nextText: 'Neste»',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ dateFormat: 'yy-mm-dd', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
--- /dev/null
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '<Poprzedni',
+ nextText: 'Następny>',
+ currentText: 'Dziś',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedzialek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Śr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Śr','Cz','Pt','So'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
--- /dev/null
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '<Anterior',
+ nextText: 'Próximo>',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});
\ No newline at end of file
--- /dev/null
+/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'Închide',
+ prevText: '« Luna precedentă',
+ nextText: 'Luna următoare »',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+ dateFormat: 'dd MM yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
--- /dev/null
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '<Пред',
+ nextText: 'След>',
+ currentText: 'Сегодня',
+ monthNames: ['Январь','Февраль','Март','Апрель','Май','Июнь',
+ 'Июль','Август','Сентябрь','Октябрь','Ноябрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Апр','Май','Июн',
+ 'Июл','Авг','Сен','Окт','Ноя','Дек'],
+ dayNames: ['воскресенье','понедельник','вторник','среда','четверг','пятница','суббота'],
+ dayNamesShort: ['вск','пнд','втр','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Вс','Пн','Вт','Ср','Чт','Пт','Сб'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+});
\ No newline at end of file
--- /dev/null
+/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '<Predchádzajúci',
+ nextText: 'Nasledujúci>',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Štvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Štv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Št','Pia','So'],
+ dateFormat: 'dd.mm.yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
--- /dev/null
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '<Prejšnji',
+ nextText: 'Naslednji>',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
--- /dev/null
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '<mbrapa',
+ nextText: 'Përpara>',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
--- /dev/null
+/* Serbian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Dejan Dimić. */\r
+jQuery(function($){\r
+ $.datepicker.regional['sr-SR'] = {\r
+ closeText: 'Zatvori',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Danas',\r
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',\r
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],\r
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',\r
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],\r
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','Četvrtak','Petak','Subota'],\r
+ dayNamesShort: ['Ned','Pon','Uto','Sre','Čet','Pet','Sub'],\r
+ dayNamesMin: ['Ne','Po','Ut','Sr','Če','Pe','Su'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);\r
+});
--- /dev/null
+/* Serbian i18n for the jQuery UI date picker plugin. */\r
+/* Written by Dejan Dimić. */\r
+jQuery(function($){\r
+ $.datepicker.regional['sr'] = {\r
+ closeText: 'Затвори',\r
+ prevText: '<',\r
+ nextText: '>',\r
+ currentText: 'Данас',\r
+ monthNames: ['Јануар','Фебруар','Март','Април','Мај','Јун',\r
+ 'Јул','Август','Септембар','Октобар','Новембар','Децембар'],\r
+ monthNamesShort: ['Јан','Феб','Мар','Апр','Мај','Јун',\r
+ 'Јул','Авг','Сеп','Окт','Нов','Дец'],\r
+ dayNames: ['Недеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],\r
+ dayNamesShort: ['Нед','Пон','Уто','Сре','Чет','Пет','Суб'],\r
+ dayNamesMin: ['Не','По','Ут','Ср','Че','Пе','Су'],\r
+ dateFormat: 'dd/mm/yy', firstDay: 1,\r
+ isRTL: false};\r
+ $.datepicker.setDefaults($.datepicker.regional['sr']);\r
+});
--- /dev/null
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '«Förra',
+ nextText: 'Nästa»',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
--- /dev/null
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '« ย้อน',
+ nextText: 'ถัดไป »',
+ currentText: 'วันนี้',
+ monthNames: ['มกราคม','กุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'กรกฏาคม','สิงหาคม','กันยายน','ตุลาคม','พฤศจิกายน','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','ก.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'ก.ค.','ส.ค.','ก.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุกร์','เสาร์'],
+ dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+ dateFormat: 'dd/mm/yy', firstDay: 0,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+});
\ No newline at end of file
--- /dev/null
+/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '<geri',
+ nextText: 'ileri>',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Şub','Mar','Nis','May','Haz',
+ 'Tem','Ağu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dateFormat: 'dd.mm.yy', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+});
\ No newline at end of file
--- /dev/null
+/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ clearText: 'Очистити', clearStatus: '',
+ closeText: 'Закрити', closeStatus: '',
+ prevText: '<', prevStatus: '',
+ prevBigText: '<<', prevBigStatus: '',
+ nextText: '>', nextStatus: '',
+ nextBigText: '>>', nextBigStatus: '',
+ currentText: 'Сьогодні', currentStatus: '',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','Вересень','Жовтень','Листопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','Лис','Гру'],
+ monthStatus: '', yearStatus: '',
+ weekHeader: 'Не', weekStatus: '',
+ dayNames: ['неділя','понеділок','вівторок','середа','четвер','п’ятниця','субота'],
+ dayNamesShort: ['нед','пнд','вів','срд','чтв','птн','сбт'],
+ dayNamesMin: ['Нд','Пн','Вт','Ср','Чт','Пт','Сб'],
+ dayStatus: 'DD', dateStatus: 'D, M d',
+ dateFormat: 'dd/mm/yy', firstDay: 1,
+ initStatus: '', isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+});
\ No newline at end of file
--- /dev/null
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: '关闭',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ dateFormat: 'yy-mm-dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
--- /dev/null
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','六月',
+ '七月','八月','九月','十月','十一月','十二月'],
+ monthNamesShort: ['一','二','三','四','五','六',
+ '七','八','九','十','十一','十二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+ dayNamesMin: ['日','一','二','三','四','五','六'],
+ dateFormat: 'yy/mm/dd', firstDay: 1,
+ isRTL: false};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
--- /dev/null
+/*
+ * jQuery UI 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+var _remove = $.fn.remove,
+ isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.7.1",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+ var attr = $.attr,
+ removeAttr = $.fn.removeAttr,
+ ariaNS = "http://www.w3.org/2005/07/aaa",
+ ariaState = /^aria-/,
+ ariaRole = /^wairole:/;
+
+ $.attr = function(elem, name, value) {
+ var set = value !== undefined;
+
+ return (name == 'role'
+ ? (set
+ ? attr.call(this, elem, name, "wairole:" + value)
+ : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+ : (ariaState.test(name)
+ ? (set
+ ? elem.setAttributeNS(ariaNS,
+ name.replace(ariaState, "aaa:"), value)
+ : attr.call(this, elem, name.replace(ariaState, "aaa:")))
+ : attr.apply(this, arguments)));
+ };
+
+ $.fn.removeAttr = function(name) {
+ return (ariaState.test(name)
+ ? this.each(function() {
+ this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+ }) : removeAttr.call(this, name));
+ };
+}
+
+//jQuery plugins
+$.fn.extend({
+ remove: function() {
+ // Safari has a native remove event which actually removes DOM elements,
+ // so we have to use triggerHandler instead of trigger (#3037).
+ $("*", this).add(this).each(function() {
+ $(this).triggerHandler("remove");
+ });
+ return _remove.apply(this, arguments );
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+function getter(namespace, plugin, method, args) {
+ function getMethods(type) {
+ var methods = $[namespace][plugin][type] || [];
+ return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
+ }
+
+ var methods = getMethods('getter');
+ if (args.length == 1 && typeof args[0] == 'string') {
+ methods = methods.concat(getMethods('getterSetter'));
+ }
+ return ($.inArray(method, methods) != -1);
+}
+
+$.widget = function(name, prototype) {
+ var namespace = name.split(".")[0];
+ name = name.split(".")[1];
+
+ // create plugin method
+ $.fn[name] = function(options) {
+ var isMethodCall = (typeof options == 'string'),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ // prevent calls to internal methods
+ if (isMethodCall && options.substring(0, 1) == '_') {
+ return this;
+ }
+
+ // handle getter methods
+ if (isMethodCall && getter(namespace, name, options, args)) {
+ var instance = $.data(this[0], name);
+ return (instance ? instance[options].apply(instance, args)
+ : undefined);
+ }
+
+ // handle initialization and non-getter methods
+ return this.each(function() {
+ var instance = $.data(this, name);
+
+ // constructor
+ (!instance && !isMethodCall &&
+ $.data(this, name, new $[namespace][name](this, options))._init());
+
+ // method call
+ (instance && isMethodCall && $.isFunction(instance[options]) &&
+ instance[options].apply(instance, args));
+ });
+ };
+
+ // create widget constructor
+ $[namespace] = $[namespace] || {};
+ $[namespace][name] = function(element, options) {
+ var self = this;
+
+ this.namespace = namespace;
+ this.widgetName = name;
+ this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+ this.widgetBaseClass = namespace + '-' + name;
+
+ this.options = $.extend({},
+ $.widget.defaults,
+ $[namespace][name].defaults,
+ $.metadata && $.metadata.get(element)[name],
+ options);
+
+ this.element = $(element)
+ .bind('setData.' + name, function(event, key, value) {
+ if (event.target == element) {
+ return self._setData(key, value);
+ }
+ })
+ .bind('getData.' + name, function(event, key) {
+ if (event.target == element) {
+ return self._getData(key);
+ }
+ })
+ .bind('remove', function() {
+ return self.destroy();
+ });
+ };
+
+ // add widget prototype
+ $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+
+ // TODO: merge getter and getterSetter properties from widget prototype
+ // and plugin prototype
+ $[namespace][name].getterSetter = 'option';
+};
+
+$.widget.prototype = {
+ _init: function() {},
+ destroy: function() {
+ this.element.removeData(this.widgetName)
+ .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+ .removeAttr('aria-disabled');
+ },
+
+ option: function(key, value) {
+ var options = key,
+ self = this;
+
+ if (typeof key == "string") {
+ if (value === undefined) {
+ return this._getData(key);
+ }
+ options = {};
+ options[key] = value;
+ }
+
+ $.each(options, function(key, value) {
+ self._setData(key, value);
+ });
+ },
+ _getData: function(key) {
+ return this.options[key];
+ },
+ _setData: function(key, value) {
+ this.options[key] = value;
+
+ if (key == 'disabled') {
+ this.element
+ [value ? 'addClass' : 'removeClass'](
+ this.widgetBaseClass + '-disabled' + ' ' +
+ this.namespace + '-state-disabled')
+ .attr("aria-disabled", value);
+ }
+ },
+
+ enable: function() {
+ this._setData('disabled', false);
+ },
+ disable: function() {
+ this._setData('disabled', true);
+ },
+
+ _trigger: function(type, event, data) {
+ var callback = this.options[type],
+ eventName = (type == this.widgetEventPrefix
+ ? type : this.widgetEventPrefix + type);
+
+ event = $.Event(event);
+ event.type = eventName;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (event.originalEvent) {
+ for (var i = $.event.props.length, prop; i;) {
+ prop = $.event.props[--i];
+ event[prop] = event.originalEvent[prop];
+ }
+ }
+
+ this.element.trigger(event, data);
+
+ return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+ || event.isDefaultPrevented());
+ }
+};
+
+$.widget.defaults = {
+ disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ // Prevent text selection in IE
+ if ($.browser.msie) {
+ this._mouseUnselectable = this.element.attr('unselectable');
+ this.element.attr('unselectable', 'on');
+ }
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+
+ // Restore text selection in IE
+ ($.browser.msie
+ && this.element.attr('unselectable', this._mouseUnselectable));
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+ cancel: null,
+ distance: 1,
+ delay: 0
+};
+
+})(jQuery);
+/*
+ * jQuery UI Draggable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Call plugins and callbacks
+ this._trigger("start", event);
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ this._trigger('drag', event, ui);
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ self._trigger("stop", event);
+ self._clear();
+ });
+ } else {
+ this._trigger("stop", event);
+ this._clear();
+ }
+
+ return false;
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ absolutePosition: this.positionAbs, //deprecated
+ offset: this.positionAbs
+ };
+ }
+
+}));
+
+$.extend($.ui.draggable, {
+ version: "1.7.1",
+ eventPrefix: "drag",
+ defaults: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ }
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ });
+
+ $(group).each(function(i) {
+ this.style.zIndex = o.stack.min + i;
+ });
+
+ this[0].style.zIndex = o.stack.min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+
+ _init: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
+ $.ui.ddmanager.droppables[this.options.scope].push(this);
+
+ (this.options.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+ },
+
+ _setData: function(key, value) {
+
+ if(key == 'accept') {
+ this.options.accept = value && $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ } else {
+ $.widget.prototype._setData.apply(this, arguments);
+ }
+
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
+ childrenIntersection = true; return false;
+ }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ absolutePosition: c.positionAbs, //deprecated
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.7.1",
+ eventPrefix: 'drop',
+ defaults: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ }
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.parent().append(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).end().remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var handle = false;
+ for(var i in this.handles) {
+ if($(this.handles[i])[0] == event.target) handle = true;
+ }
+
+ return this.options.disabled || !!handle;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+}));
+
+$.extend($.ui.resizable, {
+ version: "1.7.1",
+ eventPrefix: "resize",
+ defaults: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ cancel: ":input,option",
+ containment: false,
+ delay: 0,
+ distance: 1,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ }
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+}));
+
+$.extend($.ui.selectable, {
+ version: "1.7.1",
+ defaults: {
+ appendTo: 'body',
+ autoRefresh: true,
+ cancel: ":input,option",
+ delay: 0,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
+ _init: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return true;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+ if(!this.containers[i].containerCache.over) {
+
+ if(this.currentContainer != this.containers[i]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ continue;
+
+ this.currentContainer = this.containers[i];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[i]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ }
+
+ this.containers[i]._trigger("over", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 1;
+ }
+ } else {
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ };
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ absolutePosition: self.positionAbs, //deprecated
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+}));
+
+$.extend($.ui.sortable, {
+ getter: "serialize toArray",
+ version: "1.7.1",
+ eventPrefix: "sort",
+ defaults: {
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+
+ _init: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ // if the user set the alwaysOpen option on init
+ // then we need to set the collapsible option
+ // if they set both on init, collapsible will take priority
+ if (o.collapsible == $.ui.accordion.defaults.collapsible &&
+ o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
+ o.collapsible = !o.alwaysOpen;
+ }
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ if ( current.filter(o.header).length ) {
+ this.active = current;
+ } else {
+ this.active = current.parent().parent().prev();
+ current.addClass("ui-accordion-content-active");
+ }
+ }
+ }
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
+ }
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+
+ // IE7-/Win - Extra vertical space in lists fixed
+ if ($.browser.msie) {
+ this.element.find('a').css('zoom', '1');
+ }
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
+ }
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+
+ this.headers.find("a").removeAttr("tabindex");
+ this.headers.children(".ui-icon").remove();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+ },
+
+ _setData: function(key, value) {
+ if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ return this._clickHandler({ target: event.target }, event.target);
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight();
+ });
+
+ var maxPadding = 0;
+ this.headers.next().each(function() {
+ maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
+ }).height(Math.max(0, maxHeight - maxPadding))
+ .css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).outerHeight());
+ }).height(maxHeight);
+ }
+
+ },
+
+ activate: function(index) {
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ _clickHandler: function(event, target) {
+
+ var o = this.options;
+ if (o.disabled) return false;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target && o.collapsible) {
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return false;
+ }
+
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return false;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
+ oldContent: toHide.find('> *')
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return false;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.7.1",
+ defaults: {
+ active: null,
+ alwaysOpen: true, //deprecated, use collapsible
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ },
+ easeslide: function(options) {
+ this.slide(options, {
+ easing: "easeinout",
+ duration: 700
+ });
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Dialog 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+ dragStart: "start.draggable",
+ drag: "drag.draggable",
+ dragStop: "stop.draggable",
+ maxHeight: "maxHeight.resizable",
+ minHeight: "minHeight.resizable",
+ maxWidth: "maxWidth.resizable",
+ minWidth: "minWidth.resizable",
+ resizeStart: "start.resizable",
+ resize: "drag.resizable",
+ resizeStop: "stop.resizable"
+ },
+
+ uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+
+ _init: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = this.options,
+
+ title = options.title || this.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(this.element),
+
+ uiDialog = (this.uiDialog = $('<div/>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ (options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = this.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"/>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .mousedown(function(ev) {
+ ev.stopPropagation();
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span/>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ (options.draggable && $.fn.draggable && this._makeDraggable());
+ (options.resizable && $.fn.resizable && this._makeResizable());
+
+ this._createButtons(options.buttons);
+ this._isOpen = false;
+
+ (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
+ (options.autoOpen && this.open());
+
+ },
+
+ destroy: function() {
+ (this.overlay && this.overlay.destroy());
+ this.uiDialog.hide();
+ this.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ this.uiDialog.remove();
+
+ (this.originalTitle && this.element.attr('title', this.originalTitle));
+ },
+
+ close: function(event) {
+ var self = this;
+
+ if (false === self._trigger('beforeclose', event)) {
+ return;
+ }
+
+ (self.overlay && self.overlay.destroy());
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ (self.options.hide
+ ? self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ })
+ : self.uiDialog.hide() && self._trigger('close', event));
+
+ $.ui.dialog.overlay.resize();
+
+ self._isOpen = false;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+
+ if ((this.options.modal && !force)
+ || (!this.options.stack && !this.options.modal)) {
+ return this._trigger('focus', event);
+ }
+
+ if (this.options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = this.options.zIndex;
+ }
+ (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
+ this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
+ this.element.attr(saveScroll);
+ this._trigger('focus', event);
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var options = this.options,
+ uiDialog = this.uiDialog;
+
+ this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
+ (uiDialog.next().length && uiDialog.appendTo('body'));
+ this._size();
+ this._position(options.position);
+ uiDialog.show(options.show);
+ this.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode != $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first')[0],
+ last = tabbables.filter(':last')[0];
+
+ if (event.target == last && !event.shiftKey) {
+ setTimeout(function() {
+ first.focus();
+ }, 1);
+ } else if (event.target == first && event.shiftKey) {
+ setTimeout(function() {
+ last.focus();
+ }, 1);
+ }
+ }));
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ this._trigger('open');
+ this._isOpen = true;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ this.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ (typeof buttons == 'object' && buttons !== null &&
+ $.each(buttons, function() { return !(hasButtons = true); }));
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ $('<button type="button"></button>')
+ .addClass(
+ 'ui-state-default ' +
+ 'ui-corner-all'
+ )
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .hover(
+ function() {
+ $(this).addClass('ui-state-hover');
+ },
+ function() {
+ $(this).removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ $(this).addClass('ui-state-focus');
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ })
+ .appendTo(uiDialogButtonPane);
+ });
+ uiDialogButtonPane.appendTo(this.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = this.options,
+ heightBeforeDrag;
+
+ this.uiDialog.draggable({
+ cancel: '.ui-dialog-content',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function() {
+ heightBeforeDrag = options.height;
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ (options.dragStart && options.dragStart.apply(self.element[0], arguments));
+ },
+ drag: function() {
+ (options.drag && options.drag.apply(self.element[0], arguments));
+ },
+ stop: function() {
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ (options.dragStop && options.dragStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = this.options,
+ resizeHandles = typeof handles == 'string'
+ ? handles
+ : 'n,e,s,w,se,sw,ne,nw';
+
+ this.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: options.minHeight,
+ start: function() {
+ $(this).addClass("ui-dialog-resizing");
+ (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
+ },
+ resize: function() {
+ (options.resize && options.resize.apply(self.element[0], arguments));
+ },
+ handles: resizeHandles,
+ stop: function() {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _position: function(pos) {
+ var wnd = $(window), doc = $(document),
+ pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
+ minTop = pTop;
+
+ if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
+ pos = [
+ pos == 'right' || pos == 'left' ? pos : 'center',
+ pos == 'top' || pos == 'bottom' ? pos : 'middle'
+ ];
+ }
+ if (pos.constructor != Array) {
+ pos = ['center', 'middle'];
+ }
+ if (pos[0].constructor == Number) {
+ pLeft += pos[0];
+ } else {
+ switch (pos[0]) {
+ case 'left':
+ pLeft += 0;
+ break;
+ case 'right':
+ pLeft += wnd.width() - this.uiDialog.outerWidth();
+ break;
+ default:
+ case 'center':
+ pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ }
+ }
+ if (pos[1].constructor == Number) {
+ pTop += pos[1];
+ } else {
+ switch (pos[1]) {
+ case 'top':
+ pTop += 0;
+ break;
+ case 'bottom':
+ pTop += wnd.height() - this.uiDialog.outerHeight();
+ break;
+ default:
+ case 'middle':
+ pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ }
+ }
+
+ // prevent the dialog from being too high (make sure the titlebar
+ // is accessible)
+ pTop = Math.max(pTop, minTop);
+ this.uiDialog.css({top: pTop, left: pLeft});
+ },
+
+ _setData: function(key, value){
+ (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
+ switch (key) {
+ case "buttons":
+ this._createButtons(value);
+ break;
+ case "closeText":
+ this.uiDialogTitlebarCloseText.text(value);
+ break;
+ case "dialogClass":
+ this.uiDialog
+ .removeClass(this.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "draggable":
+ (value
+ ? this._makeDraggable()
+ : this.uiDialog.draggable('destroy'));
+ break;
+ case "height":
+ this.uiDialog.height(value);
+ break;
+ case "position":
+ this._position(value);
+ break;
+ case "resizable":
+ var uiDialog = this.uiDialog,
+ isResizable = this.uiDialog.is(':data(resizable)');
+
+ // currently resizable, becoming non-resizable
+ (isResizable && !value && uiDialog.resizable('destroy'));
+
+ // currently resizable, changing handles
+ (isResizable && typeof value == 'string' &&
+ uiDialog.resizable('option', 'handles', value));
+
+ // currently non-resizable, becoming resizable
+ (isResizable || this._makeResizable(value));
+ break;
+ case "title":
+ $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
+ break;
+ case "width":
+ this.uiDialog.width(value);
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options;
+
+ // reset content sizing
+ this.element.css({
+ height: 0,
+ minHeight: 0,
+ width: 'auto'
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ var nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css({
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: options.height == 'auto'
+ ? 'auto'
+ : Math.max(options.height - nonContentHeight, 0)
+ });
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.7.1",
+ defaults: {
+ autoOpen: true,
+ bgiframe: false,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ getter: 'isOpen',
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
+ return (dialogZ > $.ui.dialog.overlay.maxZ);
+ });
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ (dialog.options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = $('<div></div>').appendTo(document.body)
+ .addClass('ui-widget-overlay').css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.instances.splice($.inArray(this.instances, $el), 1);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+ },
+
+ height: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ var offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ var offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Slider 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) {
+
+$.widget("ui.slider", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this._keySliding = false;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass("ui-slider"
+ + " ui-slider-" + this.orientation
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all");
+
+ this.range = $([]);
+
+ if (o.range) {
+
+ if (o.range === true) {
+ this.range = $('<div></div>');
+ if (!o.values) o.values = [this._valueMin(), this._valueMin()];
+ if (o.values.length && o.values.length != 2) {
+ o.values = [o.values[0], o.values[0]];
+ }
+ } else {
+ this.range = $('<div></div>');
+ }
+
+ this.range
+ .appendTo(this.element)
+ .addClass("ui-slider-range");
+
+ if (o.range == "min" || o.range == "max") {
+ this.range.addClass("ui-slider-range-" + o.range);
+ }
+
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass("ui-widget-header");
+
+ }
+
+ if ($(".ui-slider-handle", this.element).length == 0)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+
+ if (o.values && o.values.length) {
+ while ($(".ui-slider-handle", this.element).length < o.values.length)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+ }
+
+ this.handles = $(".ui-slider-handle", this.element)
+ .addClass("ui-state-default"
+ + " ui-corner-all");
+
+ this.handle = this.handles.eq(0);
+
+ this.handles.add(this.range).filter("a")
+ .click(function(event) { event.preventDefault(); })
+ .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); })
+ .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); })
+ .blur(function() { $(this).removeClass('ui-state-focus'); });
+
+ this.handles.each(function(i) {
+ $(this).data("index.ui-slider-handle", i);
+ });
+
+ this.handles.keydown(function(event) {
+
+ var ret = true;
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self.options.disabled)
+ return;
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if (!self._keySliding) {
+ self._keySliding = true;
+ $(this).addClass("ui-state-active");
+ self._start(event, index);
+ }
+ break;
+ }
+
+ var curVal, newVal, step = self._step();
+ if (self.options.values && self.options.values.length) {
+ curVal = newVal = self.values(index);
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if(curVal == self._valueMax()) return;
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if(curVal == self._valueMin()) return;
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide(event, index, newVal);
+
+ return ret;
+
+ }).keyup(function(event) {
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self._keySliding) {
+ self._stop(event, index);
+ self._change(event, index);
+ self._keySliding = false;
+ $(this).removeClass("ui-state-active");
+ }
+
+ });
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass("ui-slider"
+ + " ui-slider-horizontal"
+ + " ui-slider-vertical"
+ + " ui-slider-disabled"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeData("slider")
+ .unbind(".slider");
+
+ this._mouseDestroy();
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (o.disabled)
+ return false;
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
+ var self = this, index;
+ this.handles.each(function(i) {
+ var thisDistance = Math.abs(normValue - self.values(i));
+ if (distance > thisDistance) {
+ distance = thisDistance;
+ closestHandle = $(this);
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if(o.range == true && this.values(1) == o.min) {
+ closestHandle = $(this.handles[++index]);
+ }
+
+ this._start(event, index);
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass("ui-state-active")
+ .focus();
+
+ var offset = closestHandle.offset();
+ var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - (closestHandle.width() / 2),
+ top: event.pageY - offset.top
+ - (closestHandle.height() / 2)
+ - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
+ - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
+ + (parseInt(closestHandle.css('marginTop'),10) || 0)
+ };
+
+ normValue = this._normValueFromMouse(position);
+ this._slide(event, index, normValue);
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ this._slide(event, this._handleIndex, normValue);
+
+ return false;
+
+ },
+
+ _mouseStop: function(event) {
+
+ this.handles.removeClass("ui-state-active");
+ this._stop(event, this._handleIndex);
+ this._change(event, this._handleIndex);
+ this._handleIndex = null;
+ this._clickOffset = null;
+
+ return false;
+
+ },
+
+ _detectOrientation: function() {
+ this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
+ },
+
+ _normValueFromMouse: function(position) {
+
+ var pixelTotal, pixelMouse;
+ if ('horizontal' == this.orientation) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
+ }
+
+ var percentMouse = (pixelMouse / pixelTotal);
+ if (percentMouse > 1) percentMouse = 1;
+ if (percentMouse < 0) percentMouse = 0;
+ if ('vertical' == this.orientation)
+ percentMouse = 1 - percentMouse;
+
+ var valueTotal = this._valueMax() - this._valueMin(),
+ valueMouse = percentMouse * valueTotal,
+ valueMouseModStep = valueMouse % this.options.step,
+ normValue = this._valueMin() + valueMouse - valueMouseModStep;
+
+ if (valueMouseModStep > (this.options.step / 2))
+ normValue += this.options.step;
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat(normValue.toFixed(5));
+
+ },
+
+ _start: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("start", event, uiHash);
+ },
+
+ _slide: function(event, index, newVal) {
+
+ var handle = this.handles[index];
+
+ if (this.options.values && this.options.values.length) {
+
+ var otherVal = this.values(index ? 0 : 1);
+
+ if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal))
+ newVal = otherVal;
+
+ if (newVal != this.values(index)) {
+ var newValues = this.values();
+ newValues[index] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal,
+ values: newValues
+ });
+ var otherVal = this.values(index ? 0 : 1);
+ if (allowed !== false) {
+ this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
+ }
+ }
+
+ } else {
+
+ if (newVal != this.value()) {
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal
+ });
+ if (allowed !== false) {
+ this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
+ }
+
+ }
+
+ }
+
+ },
+
+ _stop: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("stop", event, uiHash);
+ },
+
+ _change: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("change", event, uiHash);
+ },
+
+ value: function(newValue) {
+
+ if (arguments.length) {
+ this._setData("value", newValue);
+ this._change(null, 0);
+ }
+
+ return this._value();
+
+ },
+
+ values: function(index, newValue, animated, noPropagation) {
+
+ if (arguments.length > 1) {
+ this.options.values[index] = newValue;
+ this._refreshValue(animated);
+ if(!noPropagation) this._change(null, index);
+ }
+
+ if (arguments.length) {
+ if (this.options.values && this.options.values.length) {
+ return this._values(index);
+ } else {
+ return this.value();
+ }
+ } else {
+ return this._values();
+ }
+
+ },
+
+ _setData: function(key, value, animated) {
+
+ $.widget.prototype._setData.apply(this, arguments);
+
+ switch (key) {
+ case 'orientation':
+
+ this._detectOrientation();
+
+ this.element
+ .removeClass("ui-slider-horizontal ui-slider-vertical")
+ .addClass("ui-slider-" + this.orientation);
+ this._refreshValue(animated);
+ break;
+ case 'value':
+ this._refreshValue(animated);
+ break;
+ }
+
+ },
+
+ _step: function() {
+ var step = this.options.step;
+ return step;
+ },
+
+ _value: function() {
+
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+
+ },
+
+ _values: function(index) {
+
+ if (arguments.length) {
+ var val = this.options.values[index];
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+ } else {
+ return this.options.values;
+ }
+
+ },
+
+ _valueMin: function() {
+ var valueMin = this.options.min;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = this.options.max;
+ return valueMax;
+ },
+
+ _refreshValue: function(animate) {
+
+ var oRange = this.options.range, o = this.options, self = this;
+
+ if (this.options.values && this.options.values.length) {
+ var vp0, vp1;
+ this.handles.each(function(i, j) {
+ var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+ if (self.options.range === true) {
+ if (self.orientation == 'horizontal') {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ } else {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ var value = this.value(),
+ valueMin = this._valueMin(),
+ valueMax = this._valueMax(),
+ valPercent = valueMax != valueMin
+ ? (value - valueMin) / (valueMax - valueMin) * 100
+ : 0;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+
+ (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+
+ }
+
+}));
+
+$.extend($.ui.slider, {
+ getter: "value values",
+ version: "1.7.1",
+ eventPrefix: "slide",
+ defaults: {
+ animate: false,
+ delay: 0,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: 'horizontal',
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Tabs 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.tabs", {
+
+ _init: function() {
+ if (this.options.deselectable !== undefined) {
+ this.options.collapsible = this.options.deselectable;
+ }
+ this._tabify(true);
+ },
+
+ _setData: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ if (key == 'deselectable') {
+ this.options.collapsible = value;
+ }
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + $.data(a);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.children('ul:first');
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || 0;
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if ($.browser.msie && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+ }
+ }));
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.7.1',
+ getter: 'length',
+ defaults: {
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disabled: [],
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ panelTemplate: '<div></div>',
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ }
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.7.1" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false // True if right-to-left language, false if left-to-right
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearRange: '-10:+10', // Range of years to display in drop-down,
+ // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'normal', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false // True to show button panel, false to not show it
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (appendText)
+ input[isRTL ? 'before' : 'after']('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(target);
+ return false;
+ });
+ }
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst));
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param dateText string - the initial date to display (in the current format)
+ @param onSelect function - the function(dateText) to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" size="1" style="position: absolute; top: -100px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ this._dialogInput.val(dateText);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
+ var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.trigger.remove();
+ $target.siblings('.' + this._appendClass).remove().end().
+ removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = false; }).end().
+ filter("img").
+ css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = true; }).end().
+ filter("img").
+ css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or
+ @param value any - the new value for the setting (omit if above is an object) */
+ _optionDatepicker: function(target, name, value) {
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ var inst = this._getInst(target);
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker(null);
+ }
+ extendRemove(inst.settings, settings);
+ var date = new Date();
+ extendRemove(inst, {rangeStart: null, // start of range
+ endDay: null, endMonth: null, endYear: null, // end of range
+ selectedDay: date.getDate(), selectedMonth: date.getMonth(),
+ selectedYear: date.getFullYear(), // starting point
+ currentDay: date.getDate(), currentMonth: date.getMonth(),
+ currentYear: date.getFullYear(), // current selection
+ drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date
+ @param endDate Date - the new end date for a range (optional) */
+ _setDateDatepicker: function(target, date, endDate) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date, endDate);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @return Date - the current date or
+ Date[2] - the current dates for a range */
+ _getDateDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker(null, '');
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+ ', td.' + $.datepicker._currentClass, inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ $.datepicker._hideDatepicker(null, '');
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ inst.rangeStart = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
+ $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4});
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim](duration, postProcess);
+ if (duration == '')
+ postProcess();
+ if (inst.input[0].type != 'hidden')
+ inst.input[0].focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var dims = {width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4};
+ var self = this;
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover').
+ css({width: dims.width, height: dims.height})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1) {
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ } else {
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ }
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+ $(inst.input[0]).focus();
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
+ var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
+ offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj.nextSibling;
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker
+ @param duration string - the duration over which to close the date picker */
+ _hideDatepicker: function(input, duration) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (inst.stayOpen)
+ this._selectDate('#' + inst.id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ inst.stayOpen = false;
+ if (this._datepickerShowing) {
+ duration = (duration != null ? duration : this._get(inst, 'duration'));
+ var showAnim = this._get(inst, 'showAnim');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if (duration != '' && $.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+ duration, postProcess);
+ else
+ inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+ if (duration == '')
+ this._tidyDialog(inst);
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ this._curInst = null;
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker(null, '');
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input[0].focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ if (inst.stayOpen) {
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ }
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ if (inst.stayOpen) {
+ inst.rangeStart = this._daylightSavingAdjust(
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst.stayOpen = false;
+ inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else if (!inst.stayOpen) {
+ this._hideDatepicker(null, this._get(inst, 'duration'));
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input[0].focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
+ var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
+ var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
+ firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
+ if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
+ checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
+ return $.datepicker.iso8601Week(checkDate);
+ } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
+ firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
+ if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
+ return 1;
+ }
+ }
+ return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
+ var size = origSize;
+ var num = 0;
+ while (size > 0 && iValue < value.length &&
+ value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
+ num = num * 10 + parseInt(value.charAt(iValue++),10);
+ size--;
+ }
+ if (size == origSize)
+ throw 'Missing number at position ' + iValue;
+ return num;
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ var size = 0;
+ for (var j = 0; j < names.length; j++)
+ size = Math.max(size, names[j].length);
+ var name = '';
+ var iInit = iValue;
+ while (size > 0 && iValue < value.length) {
+ name += value.charAt(iValue++);
+ for (var i = 0; i < names.length; i++)
+ if (name == names[i])
+ return i + 1;
+ size--;
+ }
+ throw 'Unknown name at position ' + iInit;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ var doy = date.getDate();
+ for (var m = date.getMonth() - 1; m >= 0; m--)
+ doy += this._getDaysInMonth(date.getFullYear(), m);
+ output += formatNumber('o', doy, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst) {
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.input ? inst.input.val() : null;
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ var date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ date = defaultDate;
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset, getDaysInMonth) {
+ var date = new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate :
+ (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, endDate) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._determineDate(date, new Date());
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var stepBigMonths = this._get(inst, 'stepBigMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var endDate = inst.endDay ? this._daylightSavingAdjust(
+ new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+ switch (col) {
+ case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += 'middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = '';
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = '';
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = otherMonth || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
+ inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
+ (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ui-state-active' : '') + // highlight selected day
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, secondary, monthNames, monthNamesShort) {
+ minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var year = 0;
+ var endYear = 0;
+ if (years.length != 2) {
+ year = drawYear - 10;
+ endYear = drawYear + 10;
+ } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+ year = drawYear + parseInt(years[0], 10);
+ endYear = drawYear + parseInt(years[1], 10);
+ } else {
+ year = parseInt(years[0], 10);
+ endYear = parseInt(years[1], 10);
+ }
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ if (showMonthAfterYear)
+ html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._daylightSavingAdjust(new Date(year, month, day));
+ // ensure it is within the bounds set
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
+ _getMinMaxDate: function(inst, minMax, checkRange) {
+ var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
+ return (!checkRange || !inst.rangeStart ? date :
+ (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(
+ curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ // during range selection, use minimum of selected date and range start
+ var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
+ new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
+ newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
+ var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.7.1";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window.DP_jQuery = $;
+
+})(jQuery);
+/*
+ * jQuery UI Progressbar 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.progressbar", {
+
+ _init: function() {
+
+ this.element
+ .addClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.element
+ .removeClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeAttr("role")
+ .removeAttr("aria-valuemin")
+ .removeAttr("aria-valuemax")
+ .removeAttr("aria-valuenow")
+ .removeData("progressbar")
+ .unbind(".progressbar");
+
+ this.valueDiv.remove();
+
+ $.widget.prototype.destroy.apply(this, arguments);
+
+ },
+
+ value: function(newValue) {
+ arguments.length && this._setData("value", newValue);
+ return this._value();
+ },
+
+ _setData: function(key, value) {
+
+ switch (key) {
+ case 'value':
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger('change', null, {});
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+
+ },
+
+ _value: function() {
+
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+
+ },
+
+ _valueMin: function() {
+ var valueMin = 0;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = 100;
+ return valueMax;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
+ this.valueDiv.width(value + '%');
+ this.element.attr("aria-valuenow", value);
+ }
+
+});
+
+$.extend($.ui.progressbar, {
+ version: "1.7.1",
+ defaults: {
+ value: 0
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Effects 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {
+ version: "1.7.1",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ //if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent();
+
+ //Cache width,height and float properties of the element, and create a wrapper around it
+ var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
+ element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
+ var wrapper = element.parent();
+
+ //Transfer the positioning of the element to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative'} );
+ } else {
+ var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
+ var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
+ wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ wrapper.css(props);
+ return wrapper;
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ },
+
+ //Base function to animate from one class to another in a seamless transition
+ animateClass: function(value, duration, easing, callback) {
+
+ var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
+ var ea = (typeof easing == "string" ? easing : null);
+
+ return this.each(function() {
+
+ var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
+ if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
+ if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+
+ //Let's get a style offset
+ var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
+ var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+ if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+
+ // The main function to form the object for animation
+ for(var n in newStyle) {
+ if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
+ && n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
+ && newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
+ && (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
+ && (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
+ ) offset[n] = newStyle[n];
+ }
+
+ that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
+ // Change style attribute back to original. For stupid IE, we need to clear the damn object.
+ if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
+ if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
+ if(cb) cb.apply(this, arguments);
+ });
+
+ });
+ }
+};
+
+
+function _normalizeArguments(a, m) {
+
+ var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
+ var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
+ speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+ var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );
+
+ return [a[0], o, speed, callback];
+
+}
+
+//Extend the methods of jQuery
+$.fn.extend({
+
+ //Save old methods
+ _show: $.fn.show,
+ _hide: $.fn.hide,
+ __toggle: $.fn.toggle,
+ _addClass: $.fn.addClass,
+ _removeClass: $.fn.removeClass,
+ _toggleClass: $.fn.toggleClass,
+
+ // New effect methods
+ effect: function(fx, options, speed, callback) {
+ return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
+ },
+
+ show: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._show.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
+ }
+ },
+
+ hide: function() {
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
+ return this._hide.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
+ }
+ },
+
+ toggle: function(){
+ if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) || (arguments[0].constructor == Function))
+ return this.__toggle.apply(this, arguments);
+ else {
+ return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
+ }
+ },
+
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+ toggleClass: function(classNames,speed,easing,callback) {
+ return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
+ },
+ morph: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ },
+ switchClass: function() {
+ return this.morph.apply(this, arguments);
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+/*
+ * jQuery Color Animations
+ * Copyright 2007 John Resig
+ * Released under the MIT and GPL licenses.
+ */
+
+// We override the animation for all of these color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
+ $.fx.step[attr] = function(fx) {
+ if ( fx.state == 0 ) {
+ fx.start = getColor( fx.elem, attr );
+ fx.end = getRGB( fx.end );
+ }
+
+ fx.elem.style[attr] = "rgb(" + [
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
+ Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
+ ].join(",") + ")";
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var color = o.options.color || "#ffff99"; // Default highlight color
+ var oldColor = el.css("backgroundColor");
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ el.css({backgroundImage: 'none', backgroundColor: color}); // Shift
+
+ // Animation
+ var animation = {backgroundColor: oldColor };
+ if (mode == "hide") animation['opacity'] = 0;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == "hide") el.hide();
+ $.effects.restore(el, props);
+ if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
+ if(o.callback) o.callback.apply(this, arguments);
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var times = o.options.times || 5; // Default # of times
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ if (mode == 'hide') times--;
+ if (el.is(':hidden')) { // Show fadeIn
+ el.css('opacity', 0);
+ el.show(); // Show
+ el.animate({opacity: 1}, duration, o.options.easing);
+ times = times-2;
+ }
+
+ // Animate
+ for (var i = 0; i < times; i++) { // Pulsate
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
+ };
+ if (mode == 'hide') { // Last Pulse
+ el.animate({opacity: 0}, duration, o.options.easing, function(){
+ el.hide(); // Hide
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
+ options.fade = true; // It's not a puff if it doesn't fade! :)
+ var original = {height: el.height(), width: el.width()}; // Save original
+
+ // Adjust
+ var factor = percent / 100;
+ el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};
+
+ // Animation
+ options.from = el.from;
+ options.percent = (mode == 'hide') ? percent : 100;
+ options.mode = mode;
+
+ // Animate
+ el.effect('scale', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Accordion 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+
+ _init: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ // if the user set the alwaysOpen option on init
+ // then we need to set the collapsible option
+ // if they set both on init, collapsible will take priority
+ if (o.collapsible == $.ui.accordion.defaults.collapsible &&
+ o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
+ o.collapsible = !o.alwaysOpen;
+ }
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ if ( current.filter(o.header).length ) {
+ this.active = current;
+ } else {
+ this.active = current.parent().parent().prev();
+ current.addClass("ui-accordion-content-active");
+ }
+ }
+ }
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
+ }
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+
+ // IE7-/Win - Extra vertical space in lists fixed
+ if ($.browser.msie) {
+ this.element.find('a').css('zoom', '1');
+ }
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
+ }
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+
+ this.headers.find("a").removeAttr("tabindex");
+ this.headers.children(".ui-icon").remove();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+ },
+
+ _setData: function(key, value) {
+ if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ return this._clickHandler({ target: event.target }, event.target);
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight();
+ });
+
+ var maxPadding = 0;
+ this.headers.next().each(function() {
+ maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
+ }).height(Math.max(0, maxHeight - maxPadding))
+ .css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).outerHeight());
+ }).height(maxHeight);
+ }
+
+ },
+
+ activate: function(index) {
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ _clickHandler: function(event, target) {
+
+ var o = this.options;
+ if (o.disabled) return false;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target && o.collapsible) {
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return false;
+ }
+
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return false;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
+ oldContent: toHide.find('> *')
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return false;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.7.1",
+ defaults: {
+ active: null,
+ alwaysOpen: true, //deprecated, use collapsible
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ },
+ easeslide: function(options) {
+ this.slide(options, {
+ easing: "easeinout",
+ duration: 700
+ });
+ }
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+var _remove = $.fn.remove,
+ isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.7.1",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+ var attr = $.attr,
+ removeAttr = $.fn.removeAttr,
+ ariaNS = "http://www.w3.org/2005/07/aaa",
+ ariaState = /^aria-/,
+ ariaRole = /^wairole:/;
+
+ $.attr = function(elem, name, value) {
+ var set = value !== undefined;
+
+ return (name == 'role'
+ ? (set
+ ? attr.call(this, elem, name, "wairole:" + value)
+ : (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+ : (ariaState.test(name)
+ ? (set
+ ? elem.setAttributeNS(ariaNS,
+ name.replace(ariaState, "aaa:"), value)
+ : attr.call(this, elem, name.replace(ariaState, "aaa:")))
+ : attr.apply(this, arguments)));
+ };
+
+ $.fn.removeAttr = function(name) {
+ return (ariaState.test(name)
+ ? this.each(function() {
+ this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+ }) : removeAttr.call(this, name));
+ };
+}
+
+//jQuery plugins
+$.fn.extend({
+ remove: function() {
+ // Safari has a native remove event which actually removes DOM elements,
+ // so we have to use triggerHandler instead of trigger (#3037).
+ $("*", this).add(this).each(function() {
+ $(this).triggerHandler("remove");
+ });
+ return _remove.apply(this, arguments );
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '')
+ .unbind('selectstart.ui');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none')
+ .bind('selectstart.ui', function() { return false; });
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+function getter(namespace, plugin, method, args) {
+ function getMethods(type) {
+ var methods = $[namespace][plugin][type] || [];
+ return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
+ }
+
+ var methods = getMethods('getter');
+ if (args.length == 1 && typeof args[0] == 'string') {
+ methods = methods.concat(getMethods('getterSetter'));
+ }
+ return ($.inArray(method, methods) != -1);
+}
+
+$.widget = function(name, prototype) {
+ var namespace = name.split(".")[0];
+ name = name.split(".")[1];
+
+ // create plugin method
+ $.fn[name] = function(options) {
+ var isMethodCall = (typeof options == 'string'),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ // prevent calls to internal methods
+ if (isMethodCall && options.substring(0, 1) == '_') {
+ return this;
+ }
+
+ // handle getter methods
+ if (isMethodCall && getter(namespace, name, options, args)) {
+ var instance = $.data(this[0], name);
+ return (instance ? instance[options].apply(instance, args)
+ : undefined);
+ }
+
+ // handle initialization and non-getter methods
+ return this.each(function() {
+ var instance = $.data(this, name);
+
+ // constructor
+ (!instance && !isMethodCall &&
+ $.data(this, name, new $[namespace][name](this, options))._init());
+
+ // method call
+ (instance && isMethodCall && $.isFunction(instance[options]) &&
+ instance[options].apply(instance, args));
+ });
+ };
+
+ // create widget constructor
+ $[namespace] = $[namespace] || {};
+ $[namespace][name] = function(element, options) {
+ var self = this;
+
+ this.namespace = namespace;
+ this.widgetName = name;
+ this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+ this.widgetBaseClass = namespace + '-' + name;
+
+ this.options = $.extend({},
+ $.widget.defaults,
+ $[namespace][name].defaults,
+ $.metadata && $.metadata.get(element)[name],
+ options);
+
+ this.element = $(element)
+ .bind('setData.' + name, function(event, key, value) {
+ if (event.target == element) {
+ return self._setData(key, value);
+ }
+ })
+ .bind('getData.' + name, function(event, key) {
+ if (event.target == element) {
+ return self._getData(key);
+ }
+ })
+ .bind('remove', function() {
+ return self.destroy();
+ });
+ };
+
+ // add widget prototype
+ $[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+
+ // TODO: merge getter and getterSetter properties from widget prototype
+ // and plugin prototype
+ $[namespace][name].getterSetter = 'option';
+};
+
+$.widget.prototype = {
+ _init: function() {},
+ destroy: function() {
+ this.element.removeData(this.widgetName)
+ .removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+ .removeAttr('aria-disabled');
+ },
+
+ option: function(key, value) {
+ var options = key,
+ self = this;
+
+ if (typeof key == "string") {
+ if (value === undefined) {
+ return this._getData(key);
+ }
+ options = {};
+ options[key] = value;
+ }
+
+ $.each(options, function(key, value) {
+ self._setData(key, value);
+ });
+ },
+ _getData: function(key) {
+ return this.options[key];
+ },
+ _setData: function(key, value) {
+ this.options[key] = value;
+
+ if (key == 'disabled') {
+ this.element
+ [value ? 'addClass' : 'removeClass'](
+ this.widgetBaseClass + '-disabled' + ' ' +
+ this.namespace + '-state-disabled')
+ .attr("aria-disabled", value);
+ }
+ },
+
+ enable: function() {
+ this._setData('disabled', false);
+ },
+ disable: function() {
+ this._setData('disabled', true);
+ },
+
+ _trigger: function(type, event, data) {
+ var callback = this.options[type],
+ eventName = (type == this.widgetEventPrefix
+ ? type : this.widgetEventPrefix + type);
+
+ event = $.Event(event);
+ event.type = eventName;
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if (event.originalEvent) {
+ for (var i = $.event.props.length, prop; i;) {
+ prop = $.event.props[--i];
+ event[prop] = event.originalEvent[prop];
+ }
+ }
+
+ this.element.trigger(event, data);
+
+ return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+ || event.isDefaultPrevented());
+ }
+};
+
+$.widget.defaults = {
+ disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ // Prevent text selection in IE
+ if ($.browser.msie) {
+ this._mouseUnselectable = this.element.attr('unselectable');
+ this.element.attr('unselectable', 'on');
+ }
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+
+ // Restore text selection in IE
+ ($.browser.msie
+ && this.element.attr('unselectable', this._mouseUnselectable));
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+ cancel: null,
+ distance: 1,
+ delay: 0
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Datepicker 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.7.1" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false // True if right-to-left language, false if left-to-right
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearRange: '-10:+10', // Range of years to display in drop-down,
+ // either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: 'normal', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false // True to show button panel, false to not show it
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (appendText)
+ input[isRTL ? 'before' : 'after']('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(target);
+ return false;
+ });
+ }
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst));
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param dateText string - the initial date to display (in the current format)
+ @param onSelect function - the function(dateText) to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" size="1" style="position: absolute; top: -100px;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ this._dialogInput.val(dateText);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;
+ var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.trigger.remove();
+ $target.siblings('.' + this._appendClass).remove().end().
+ removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = false; }).end().
+ filter("img").
+ css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter("button").
+ each(function() { this.disabled = true; }).end().
+ filter("img").
+ css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or
+ @param value any - the new value for the setting (omit if above is an object) */
+ _optionDatepicker: function(target, name, value) {
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ var inst = this._getInst(target);
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker(null);
+ }
+ extendRemove(inst.settings, settings);
+ var date = new Date();
+ extendRemove(inst, {rangeStart: null, // start of range
+ endDay: null, endMonth: null, endYear: null, // end of range
+ selectedDay: date.getDate(), selectedMonth: date.getMonth(),
+ selectedYear: date.getFullYear(), // starting point
+ currentDay: date.getDate(), currentMonth: date.getMonth(),
+ currentYear: date.getFullYear(), // current selection
+ drawMonth: date.getMonth(), drawYear: date.getFullYear()}); // month being drawn
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date
+ @param endDate Date - the new end date for a range (optional) */
+ _setDateDatepicker: function(target, date, endDate) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date, endDate);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @return Date - the current date or
+ Date[2] - the current dates for a range */
+ _getDateDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker(null, '');
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+ ', td.' + $.datepicker._currentClass, inst.dpDiv);
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ $.datepicker._hideDatepicker(null, '');
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ inst.rangeStart = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
+ $('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4});
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim](duration, postProcess);
+ if (duration == '')
+ postProcess();
+ if (inst.input[0].type != 'hidden')
+ inst.input[0].focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var dims = {width: inst.dpDiv.width() + 4,
+ height: inst.dpDiv.height() + 4};
+ var self = this;
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover').
+ css({width: dims.width, height: dims.height})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1) {
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ } else {
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ }
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+ $(inst.input[0]).focus();
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
+ var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
+ offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj.nextSibling;
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker
+ @param duration string - the duration over which to close the date picker */
+ _hideDatepicker: function(input, duration) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (inst.stayOpen)
+ this._selectDate('#' + inst.id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ inst.stayOpen = false;
+ if (this._datepickerShowing) {
+ duration = (duration != null ? duration : this._get(inst, 'duration'));
+ var showAnim = this._get(inst, 'showAnim');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ };
+ if (duration != '' && $.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+ duration, postProcess);
+ else
+ inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+ if (duration == '')
+ this._tidyDialog(inst);
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ this._curInst = null;
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker(null, '');
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input[0].focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ if (inst.stayOpen) {
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ }
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ if (inst.stayOpen) {
+ inst.rangeStart = this._daylightSavingAdjust(
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst.stayOpen = false;
+ inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else if (!inst.stayOpen) {
+ this._hideDatepicker(null, this._get(inst, 'duration'));
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input[0].focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
+ var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
+ var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
+ firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
+ if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
+ checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
+ return $.datepicker.iso8601Week(checkDate);
+ } else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
+ firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
+ if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
+ return 1;
+ }
+ }
+ return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
+ var size = origSize;
+ var num = 0;
+ while (size > 0 && iValue < value.length &&
+ value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
+ num = num * 10 + parseInt(value.charAt(iValue++),10);
+ size--;
+ }
+ if (size == origSize)
+ throw 'Missing number at position ' + iValue;
+ return num;
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ var size = 0;
+ for (var j = 0; j < names.length; j++)
+ size = Math.max(size, names[j].length);
+ var name = '';
+ var iInit = iValue;
+ while (size > 0 && iValue < value.length) {
+ name += value.charAt(iValue++);
+ for (var i = 0; i < names.length; i++)
+ if (name == names[i])
+ return i + 1;
+ size--;
+ }
+ throw 'Unknown name at position ' + iInit;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ var doy = date.getDate();
+ for (var m = date.getMonth() - 1; m >= 0; m--)
+ doy += this._getDaysInMonth(date.getFullYear(), m);
+ output += formatNumber('o', doy, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst) {
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.input ? inst.input.val() : null;
+ inst.endDay = inst.endMonth = inst.endYear = null;
+ var date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ date = defaultDate;
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset, getDaysInMonth) {
+ var date = new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate :
+ (typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, endDate) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._determineDate(date, new Date());
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var stepBigMonths = this._get(inst, 'stepBigMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var endDate = inst.endDay ? this._daylightSavingAdjust(
+ new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+ switch (col) {
+ case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += 'middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = '';
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = '';
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = otherMonth || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
+ inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
+ (otherMonth ? (showOtherMonths ? printDate.getDate() : ' ') : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
+ ' ui-state-active' : '') + // highlight selected day
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ selectedDate, secondary, monthNames, monthNamesShort) {
+ minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var year = 0;
+ var endYear = 0;
+ if (years.length != 2) {
+ year = drawYear - 10;
+ endYear = drawYear + 10;
+ } else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+ year = drawYear + parseInt(years[0], 10);
+ endYear = drawYear + parseInt(years[1], 10);
+ } else {
+ year = parseInt(years[0], 10);
+ endYear = parseInt(years[1], 10);
+ }
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ if (showMonthAfterYear)
+ html += (secondary || changeMonth || changeYear ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._daylightSavingAdjust(new Date(year, month, day));
+ // ensure it is within the bounds set
+ var minDate = this._getMinMaxDate(inst, 'min', true);
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
+ _getMinMaxDate: function(inst, minMax, checkRange) {
+ var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
+ return (!checkRange || !inst.rangeStart ? date :
+ (!date || inst.rangeStart > date ? inst.rangeStart : date));
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(
+ curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ // during range selection, use minimum of selected date and range start
+ var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
+ new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
+ newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
+ var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.7.1";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window.DP_jQuery = $;
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Dialog 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ * ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+ dragStart : "start.draggable",
+ drag : "drag.draggable",
+ dragStop : "stop.draggable",
+ maxHeight : "maxHeight.resizable",
+ minHeight : "minHeight.resizable",
+ maxWidth : "maxWidth.resizable",
+ minWidth : "minWidth.resizable",
+ resizeStart : "start.resizable",
+ resize : "drag.resizable",
+ resizeStop : "stop.resizable"
+ },
+
+ uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+
+ _init: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = this.options,
+
+ title = options.title || this.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(this.element),
+
+ uiDialog = (this.uiDialog = $('<div/>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ (options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = this.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"/>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .mousedown(function(ev) {
+ ev.stopPropagation();
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span/>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ (options.draggable && $.fn.draggable && this._makeDraggable());
+ (options.resizable && $.fn.resizable && this._makeResizable());
+
+ this._createButtons(options.buttons);
+ this._isOpen = false;
+
+ (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
+ (options.autoOpen && this.open());
+
+ },
+
+ destroy: function() {
+ (this.overlay && this.overlay.destroy());
+ this.uiDialog.hide();
+ this.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ this.uiDialog.remove();
+
+ (this.originalTitle && this.element.attr('title', this.originalTitle));
+ },
+
+ close: function(event) {
+ var self = this;
+
+ if (false === self._trigger('beforeclose', event)) {
+ return;
+ }
+
+ (self.overlay && self.overlay.destroy());
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ (self.options.hide
+ ? self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ })
+ : self.uiDialog.hide() && self._trigger('close', event));
+
+ $.ui.dialog.overlay.resize();
+
+ self._isOpen = false;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+
+ if ((this.options.modal && !force)
+ || (!this.options.stack && !this.options.modal)) {
+ return this._trigger('focus', event);
+ }
+
+ if (this.options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = this.options.zIndex;
+ }
+ (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
+ this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
+ this.element.attr(saveScroll);
+ this._trigger('focus', event);
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var options = this.options,
+ uiDialog = this.uiDialog;
+
+ this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
+ (uiDialog.next().length && uiDialog.appendTo('body'));
+ this._size();
+ this._position(options.position);
+ uiDialog.show(options.show);
+ this.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode != $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first')[0],
+ last = tabbables.filter(':last')[0];
+
+ if (event.target == last && !event.shiftKey) {
+ setTimeout(function() {
+ first.focus();
+ }, 1);
+ } else if (event.target == first && event.shiftKey) {
+ setTimeout(function() {
+ last.focus();
+ }, 1);
+ }
+ }));
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ this._trigger('open');
+ this._isOpen = true;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ this.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ (typeof buttons == 'object' && buttons !== null &&
+ $.each(buttons, function() { return !(hasButtons = true); }));
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ $('<button type="button"></button>')
+ .addClass(
+ 'ui-state-default ' +
+ 'ui-corner-all'
+ )
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .hover(
+ function() {
+ $(this).addClass('ui-state-hover');
+ },
+ function() {
+ $(this).removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ $(this).addClass('ui-state-focus');
+ })
+ .blur(function() {
+ $(this).removeClass('ui-state-focus');
+ })
+ .appendTo(uiDialogButtonPane);
+ });
+ uiDialogButtonPane.appendTo(this.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = this.options,
+ heightBeforeDrag;
+
+ this.uiDialog.draggable({
+ cancel: '.ui-dialog-content',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function() {
+ heightBeforeDrag = options.height;
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ (options.dragStart && options.dragStart.apply(self.element[0], arguments));
+ },
+ drag: function() {
+ (options.drag && options.drag.apply(self.element[0], arguments));
+ },
+ stop: function() {
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ (options.dragStop && options.dragStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = this.options,
+ resizeHandles = typeof handles == 'string'
+ ? handles
+ : 'n,e,s,w,se,sw,ne,nw';
+
+ this.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ alsoResize: this.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: options.minHeight,
+ start: function() {
+ $(this).addClass("ui-dialog-resizing");
+ (options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
+ },
+ resize: function() {
+ (options.resize && options.resize.apply(self.element[0], arguments));
+ },
+ handles: resizeHandles,
+ stop: function() {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ (options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _position: function(pos) {
+ var wnd = $(window), doc = $(document),
+ pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
+ minTop = pTop;
+
+ if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
+ pos = [
+ pos == 'right' || pos == 'left' ? pos : 'center',
+ pos == 'top' || pos == 'bottom' ? pos : 'middle'
+ ];
+ }
+ if (pos.constructor != Array) {
+ pos = ['center', 'middle'];
+ }
+ if (pos[0].constructor == Number) {
+ pLeft += pos[0];
+ } else {
+ switch (pos[0]) {
+ case 'left':
+ pLeft += 0;
+ break;
+ case 'right':
+ pLeft += wnd.width() - this.uiDialog.outerWidth();
+ break;
+ default:
+ case 'center':
+ pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
+ }
+ }
+ if (pos[1].constructor == Number) {
+ pTop += pos[1];
+ } else {
+ switch (pos[1]) {
+ case 'top':
+ pTop += 0;
+ break;
+ case 'bottom':
+ pTop += wnd.height() - this.uiDialog.outerHeight();
+ break;
+ default:
+ case 'middle':
+ pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
+ }
+ }
+
+ // prevent the dialog from being too high (make sure the titlebar
+ // is accessible)
+ pTop = Math.max(pTop, minTop);
+ this.uiDialog.css({top: pTop, left: pLeft});
+ },
+
+ _setData: function(key, value){
+ (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
+ switch (key) {
+ case "buttons":
+ this._createButtons(value);
+ break;
+ case "closeText":
+ this.uiDialogTitlebarCloseText.text(value);
+ break;
+ case "dialogClass":
+ this.uiDialog
+ .removeClass(this.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "draggable":
+ (value
+ ? this._makeDraggable()
+ : this.uiDialog.draggable('destroy'));
+ break;
+ case "height":
+ this.uiDialog.height(value);
+ break;
+ case "position":
+ this._position(value);
+ break;
+ case "resizable":
+ var uiDialog = this.uiDialog,
+ isResizable = this.uiDialog.is(':data(resizable)');
+
+ // currently resizable, becoming non-resizable
+ (isResizable && !value && uiDialog.resizable('destroy'));
+
+ // currently resizable, changing handles
+ (isResizable && typeof value == 'string' &&
+ uiDialog.resizable('option', 'handles', value));
+
+ // currently non-resizable, becoming resizable
+ (isResizable || this._makeResizable(value));
+ break;
+ case "title":
+ $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' ');
+ break;
+ case "width":
+ this.uiDialog.width(value);
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options;
+
+ // reset content sizing
+ this.element.css({
+ height: 0,
+ minHeight: 0,
+ width: 'auto'
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ var nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css({
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: options.height == 'auto'
+ ? 'auto'
+ : Math.max(options.height - nonContentHeight, 0)
+ });
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.7.1",
+ defaults: {
+ autoOpen: true,
+ bgiframe: false,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+
+ getter: 'isOpen',
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
+ return (dialogZ > $.ui.dialog.overlay.maxZ);
+ });
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ (dialog.options.closeOnEscape && event.keyCode
+ && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = $('<div></div>').appendTo(document.body)
+ .addClass('ui-widget-overlay').css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.instances.splice($.inArray(this.instances, $el), 1);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+ },
+
+ height: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ var offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ var scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ var offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Draggable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Call plugins and callbacks
+ this._trigger("start", event);
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ this._trigger('drag', event, ui);
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ self._trigger("stop", event);
+ self._clear();
+ });
+ } else {
+ this._trigger("stop", event);
+ this._clear();
+ }
+
+ return false;
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ absolutePosition: this.positionAbs, //deprecated
+ offset: this.positionAbs
+ };
+ }
+
+}));
+
+$.extend($.ui.draggable, {
+ version: "1.7.1",
+ eventPrefix: "drag",
+ defaults: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ }
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
+ });
+
+ $(group).each(function(i) {
+ this.style.zIndex = o.stack.min + i;
+ });
+
+ this[0].style.zIndex = o.stack.min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Droppable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * ui.core.js
+ * ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+
+ _init: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
+ $.ui.ddmanager.droppables[this.options.scope].push(this);
+
+ (this.options.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+ },
+
+ _setData: function(key, value) {
+
+ if(key == 'accept') {
+ this.options.accept = value && $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ } else {
+ $.widget.prototype._setData.apply(this, arguments);
+ }
+
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
+ childrenIntersection = true; return false;
+ }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ absolutePosition: c.positionAbs, //deprecated
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.7.1",
+ eventPrefix: 'drop',
+ defaults: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ }
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+
+ $.each($.ui.ddmanager.droppables[draggable.options.scope], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Progressbar 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.progressbar", {
+
+ _init: function() {
+
+ this.element
+ .addClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.element
+ .removeClass("ui-progressbar"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeAttr("role")
+ .removeAttr("aria-valuemin")
+ .removeAttr("aria-valuemax")
+ .removeAttr("aria-valuenow")
+ .removeData("progressbar")
+ .unbind(".progressbar");
+
+ this.valueDiv.remove();
+
+ $.widget.prototype.destroy.apply(this, arguments);
+
+ },
+
+ value: function(newValue) {
+ arguments.length && this._setData("value", newValue);
+ return this._value();
+ },
+
+ _setData: function(key, value) {
+
+ switch (key) {
+ case 'value':
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger('change', null, {});
+ break;
+ }
+
+ $.widget.prototype._setData.apply(this, arguments);
+
+ },
+
+ _value: function() {
+
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+
+ },
+
+ _valueMin: function() {
+ var valueMin = 0;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = 100;
+ return valueMax;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
+ this.valueDiv.width(value + '%');
+ this.element.attr("aria-valuenow", value);
+ }
+
+});
+
+$.extend($.ui.progressbar, {
+ version: "1.7.1",
+ defaults: {
+ value: 0
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Resizable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.parent().append(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).end().remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var handle = false;
+ for(var i in this.handles) {
+ if($(this.handles[i])[0] == event.target) handle = true;
+ }
+
+ return this.options.disabled || !!handle;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+}));
+
+$.extend($.ui.resizable, {
+ version: "1.7.1",
+ eventPrefix: "resize",
+ defaults: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ cancel: ":input,option",
+ containment: false,
+ delay: 0,
+ distance: 1,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ }
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Selectable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+}));
+
+$.extend($.ui.selectable, {
+ version: "1.7.1",
+ defaults: {
+ appendTo: 'body',
+ autoRefresh: true,
+ cancel: ":input,option",
+ delay: 0,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Slider 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * ui.core.js
+ */
+
+(function($) {
+
+$.widget("ui.slider", $.extend({}, $.ui.mouse, {
+
+ _init: function() {
+
+ var self = this, o = this.options;
+ this._keySliding = false;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass("ui-slider"
+ + " ui-slider-" + this.orientation
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all");
+
+ this.range = $([]);
+
+ if (o.range) {
+
+ if (o.range === true) {
+ this.range = $('<div></div>');
+ if (!o.values) o.values = [this._valueMin(), this._valueMin()];
+ if (o.values.length && o.values.length != 2) {
+ o.values = [o.values[0], o.values[0]];
+ }
+ } else {
+ this.range = $('<div></div>');
+ }
+
+ this.range
+ .appendTo(this.element)
+ .addClass("ui-slider-range");
+
+ if (o.range == "min" || o.range == "max") {
+ this.range.addClass("ui-slider-range-" + o.range);
+ }
+
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass("ui-widget-header");
+
+ }
+
+ if ($(".ui-slider-handle", this.element).length == 0)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+
+ if (o.values && o.values.length) {
+ while ($(".ui-slider-handle", this.element).length < o.values.length)
+ $('<a href="#"></a>')
+ .appendTo(this.element)
+ .addClass("ui-slider-handle");
+ }
+
+ this.handles = $(".ui-slider-handle", this.element)
+ .addClass("ui-state-default"
+ + " ui-corner-all");
+
+ this.handle = this.handles.eq(0);
+
+ this.handles.add(this.range).filter("a")
+ .click(function(event) { event.preventDefault(); })
+ .hover(function() { $(this).addClass('ui-state-hover'); }, function() { $(this).removeClass('ui-state-hover'); })
+ .focus(function() { $(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus'); })
+ .blur(function() { $(this).removeClass('ui-state-focus'); });
+
+ this.handles.each(function(i) {
+ $(this).data("index.ui-slider-handle", i);
+ });
+
+ this.handles.keydown(function(event) {
+
+ var ret = true;
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self.options.disabled)
+ return;
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if (!self._keySliding) {
+ self._keySliding = true;
+ $(this).addClass("ui-state-active");
+ self._start(event, index);
+ }
+ break;
+ }
+
+ var curVal, newVal, step = self._step();
+ if (self.options.values && self.options.values.length) {
+ curVal = newVal = self.values(index);
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch (event.keyCode) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if(curVal == self._valueMax()) return;
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if(curVal == self._valueMin()) return;
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide(event, index, newVal);
+
+ return ret;
+
+ }).keyup(function(event) {
+
+ var index = $(this).data("index.ui-slider-handle");
+
+ if (self._keySliding) {
+ self._stop(event, index);
+ self._change(event, index);
+ self._keySliding = false;
+ $(this).removeClass("ui-state-active");
+ }
+
+ });
+
+ this._refreshValue();
+
+ },
+
+ destroy: function() {
+
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass("ui-slider"
+ + " ui-slider-horizontal"
+ + " ui-slider-vertical"
+ + " ui-slider-disabled"
+ + " ui-widget"
+ + " ui-widget-content"
+ + " ui-corner-all")
+ .removeData("slider")
+ .unbind(".slider");
+
+ this._mouseDestroy();
+
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ if (o.disabled)
+ return false;
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
+ var self = this, index;
+ this.handles.each(function(i) {
+ var thisDistance = Math.abs(normValue - self.values(i));
+ if (distance > thisDistance) {
+ distance = thisDistance;
+ closestHandle = $(this);
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if(o.range == true && this.values(1) == o.min) {
+ closestHandle = $(this.handles[++index]);
+ }
+
+ this._start(event, index);
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass("ui-state-active")
+ .focus();
+
+ var offset = closestHandle.offset();
+ var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - (closestHandle.width() / 2),
+ top: event.pageY - offset.top
+ - (closestHandle.height() / 2)
+ - (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
+ - (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
+ + (parseInt(closestHandle.css('marginTop'),10) || 0)
+ };
+
+ normValue = this._normValueFromMouse(position);
+ this._slide(event, index, normValue);
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ var position = { x: event.pageX, y: event.pageY };
+ var normValue = this._normValueFromMouse(position);
+
+ this._slide(event, this._handleIndex, normValue);
+
+ return false;
+
+ },
+
+ _mouseStop: function(event) {
+
+ this.handles.removeClass("ui-state-active");
+ this._stop(event, this._handleIndex);
+ this._change(event, this._handleIndex);
+ this._handleIndex = null;
+ this._clickOffset = null;
+
+ return false;
+
+ },
+
+ _detectOrientation: function() {
+ this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
+ },
+
+ _normValueFromMouse: function(position) {
+
+ var pixelTotal, pixelMouse;
+ if ('horizontal' == this.orientation) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
+ }
+
+ var percentMouse = (pixelMouse / pixelTotal);
+ if (percentMouse > 1) percentMouse = 1;
+ if (percentMouse < 0) percentMouse = 0;
+ if ('vertical' == this.orientation)
+ percentMouse = 1 - percentMouse;
+
+ var valueTotal = this._valueMax() - this._valueMin(),
+ valueMouse = percentMouse * valueTotal,
+ valueMouseModStep = valueMouse % this.options.step,
+ normValue = this._valueMin() + valueMouse - valueMouseModStep;
+
+ if (valueMouseModStep > (this.options.step / 2))
+ normValue += this.options.step;
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat(normValue.toFixed(5));
+
+ },
+
+ _start: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("start", event, uiHash);
+ },
+
+ _slide: function(event, index, newVal) {
+
+ var handle = this.handles[index];
+
+ if (this.options.values && this.options.values.length) {
+
+ var otherVal = this.values(index ? 0 : 1);
+
+ if ((index == 0 && newVal >= otherVal) || (index == 1 && newVal <= otherVal))
+ newVal = otherVal;
+
+ if (newVal != this.values(index)) {
+ var newValues = this.values();
+ newValues[index] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal,
+ values: newValues
+ });
+ var otherVal = this.values(index ? 0 : 1);
+ if (allowed !== false) {
+ this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
+ }
+ }
+
+ } else {
+
+ if (newVal != this.value()) {
+ // A slide can be canceled by returning false from the slide callback
+ var allowed = this._trigger("slide", event, {
+ handle: this.handles[index],
+ value: newVal
+ });
+ if (allowed !== false) {
+ this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
+ }
+
+ }
+
+ }
+
+ },
+
+ _stop: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("stop", event, uiHash);
+ },
+
+ _change: function(event, index) {
+ var uiHash = {
+ handle: this.handles[index],
+ value: this.value()
+ };
+ if (this.options.values && this.options.values.length) {
+ uiHash.value = this.values(index)
+ uiHash.values = this.values()
+ }
+ this._trigger("change", event, uiHash);
+ },
+
+ value: function(newValue) {
+
+ if (arguments.length) {
+ this._setData("value", newValue);
+ this._change(null, 0);
+ }
+
+ return this._value();
+
+ },
+
+ values: function(index, newValue, animated, noPropagation) {
+
+ if (arguments.length > 1) {
+ this.options.values[index] = newValue;
+ this._refreshValue(animated);
+ if(!noPropagation) this._change(null, index);
+ }
+
+ if (arguments.length) {
+ if (this.options.values && this.options.values.length) {
+ return this._values(index);
+ } else {
+ return this.value();
+ }
+ } else {
+ return this._values();
+ }
+
+ },
+
+ _setData: function(key, value, animated) {
+
+ $.widget.prototype._setData.apply(this, arguments);
+
+ switch (key) {
+ case 'orientation':
+
+ this._detectOrientation();
+
+ this.element
+ .removeClass("ui-slider-horizontal ui-slider-vertical")
+ .addClass("ui-slider-" + this.orientation);
+ this._refreshValue(animated);
+ break;
+ case 'value':
+ this._refreshValue(animated);
+ break;
+ }
+
+ },
+
+ _step: function() {
+ var step = this.options.step;
+ return step;
+ },
+
+ _value: function() {
+
+ var val = this.options.value;
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+
+ },
+
+ _values: function(index) {
+
+ if (arguments.length) {
+ var val = this.options.values[index];
+ if (val < this._valueMin()) val = this._valueMin();
+ if (val > this._valueMax()) val = this._valueMax();
+
+ return val;
+ } else {
+ return this.options.values;
+ }
+
+ },
+
+ _valueMin: function() {
+ var valueMin = this.options.min;
+ return valueMin;
+ },
+
+ _valueMax: function() {
+ var valueMax = this.options.max;
+ return valueMax;
+ },
+
+ _refreshValue: function(animate) {
+
+ var oRange = this.options.range, o = this.options, self = this;
+
+ if (this.options.values && this.options.values.length) {
+ var vp0, vp1;
+ this.handles.each(function(i, j) {
+ var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ $(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+ if (self.options.range === true) {
+ if (self.orientation == 'horizontal') {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ } else {
+ (i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
+ (i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ var value = this.value(),
+ valueMin = this._valueMin(),
+ valueMax = this._valueMax(),
+ valPercent = valueMax != valueMin
+ ? (value - valueMin) / (valueMax - valueMin) * 100
+ : 0;
+ var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+ this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+
+ (oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ (oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
+ (oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+ }
+
+ }
+
+}));
+
+$.extend($.ui.slider, {
+ getter: "value values",
+ version: "1.7.1",
+ eventPrefix: "slide",
+ defaults: {
+ animate: false,
+ delay: 0,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: 'horizontal',
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ }
+});
+
+})(jQuery);
+
--- /dev/null
+/*
+ * jQuery UI Sortable 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
+ _init: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ if(o.cursorAt)
+ this._adjustOffsetFromHelper(o.cursorAt);
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return true;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ //We ignore calculating positions of all connected containers when we're not over them
+ if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
+ continue;
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+ if(!this.containers[i].containerCache.over) {
+
+ if(this.currentContainer != this.containers[i]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ continue;
+
+ this.currentContainer = this.containers[i];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[i]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ }
+
+ this.containers[i]._trigger("over", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 1;
+ }
+ } else {
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ };
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
+ if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
+ if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ absolutePosition: self.positionAbs, //deprecated
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+}));
+
+$.extend($.ui.sortable, {
+ getter: "serialize toArray",
+ version: "1.7.1",
+ eventPrefix: "sort",
+ defaults: {
+ appendTo: "parent",
+ axis: false,
+ cancel: ":input,option",
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ delay: 0,
+ distance: 1,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ }
+});
+
+})(jQuery);
--- /dev/null
+/*
+ * jQuery UI Tabs 1.7.1
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * ui.core.js
+ */
+(function($) {
+
+$.widget("ui.tabs", {
+
+ _init: function() {
+ if (this.options.deselectable !== undefined) {
+ this.options.collapsible = this.options.deselectable;
+ }
+ this._tabify(true);
+ },
+
+ _setData: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ if (key == 'deselectable') {
+ this.options.collapsible = value;
+ }
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + $.data(a);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.children('ul:first');
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || 0;
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if ($.browser.msie && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+ }
+ }));
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.7.1',
+ getter: 'length',
+ defaults: {
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disabled: [],
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ panelTemplate: '<div></div>',
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ }
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+ }
+});
+
+})(jQuery);
--- /dev/null
+1.7.1
\ No newline at end of file
"mv_for_best_experience": "For a better video playback experience we recommend:<br> <b><a href=\"http://www.mozilla.com/en-US/firefox/upgrade.html?from=mwEmbed\">Firefox 3.5</a></b>",
"mv_do_not_warn_again": "Dissmiss for now.",
- "players": "Players",
-
+ "players": "Players"
});
var default_video_attributes = {
);
//set the dismissNativeWarn flag:
_global['dismissNativeWarn'] = false;
-/*
-* Converts all occurrences of <video> tag into video object
-*/
-function mv_video_embed(swap_done_callback, force_id){
- mvEmbed.init( swap_done_callback, force_id );
-}
-mvEmbed = {
- //flist stores the set of functions to run after the video has been swaped in.
- flist:new Array(),
- init:function( swap_done_callback, force_id ){
-
- if(swap_done_callback)
- mvEmbed.flist.push( swap_done_callback );
-
- //get mv_embed location if it has not been set
- js_log('mv_embed ' + MV_EMBED_VERSION);
-
- var loadPlaylistLib=false;
-
- var eAction = function(this_elm){
- js_log( "Do SWAP: " + $j(this_elm).attr("id") + ' tag: '+ this_elm.tagName.toLowerCase() );
-
- if( $j(this_elm).attr("id") == '' ){
- $j(this_elm).attr("id", 'v'+ global_player_list.length);
- }
- //stre a global reference to the id
- global_player_list.push( $j(this_elm).attr("id") );
- //if video doSwap
- switch( this_elm.tagName.toLowerCase()){
- case 'video':
- var videoInterface = new embedVideo(this_elm);
- mvEmbed.swapEmbedVideoElement( this_elm, videoInterface );
- break;
- case 'audio':
- var videoInterface = new embedVideo(this_elm);
- videoInterface.type ='audio';
- mvEmbed.swapEmbedVideoElement( this_elm, videoInterface );
- break;
- case 'playlist':
- loadPlaylistLib=true;
- break;
- }
- }
-
- if( force_id == null && force_id != '' ){
- var j_selector = 'video,audio,playlist';
- }else{
- var j_selector = '#' + force_id;
- }
- //process selected elements:
- //ie8 does not play well with the jQuery video,audio,playlist selector use native:
- if($j.browser.msie && $j.browser.version >= 8){
- jtags = j_selector.split(',');
- for( var i=0; i < jtags.length; i++){
- $j( document.getElementsByTagName( jtags[i] )).each(function(){
- eAction(this);
- });
- }
- }else{
- $j( j_selector ).each(function(){
- eAction(this);
- });
- }
- if(loadPlaylistLib){
- mvJsLoader.doLoad([
- 'mvPlayList',
- '$j.ui', //include dialog for pop-ing up thigns
- '$j.ui.dialog'
- ], function(){
- $j('playlist').each(function(){
- //create new playlist interface:
- var plObj = new mvPlayList( this );
- mvEmbed.swapEmbedVideoElement(this, plObj);
- var added_height = plObj.pl_layout.title_bar_height + plObj.pl_layout.control_height;
- //move into a blocking display container with height + controls + title height:
- $j('#'+plObj.id).wrap('<div style="display:block;height:' + (plObj.height + added_height) + 'px;"></div>');
- });
- });
- }
- this.checkClipsReady();
- },
- /*
- * swapEmbedVideoElement
- * takes a video element as input and swaps it out with
- * an embed video interface based on the video_elements attributes
- */
- swapEmbedVideoElement:function(video_element, videoInterface){
- js_log('do swap ' + videoInterface.id + ' for ' + video_element);
- embed_video = document.createElement('div');
- //make sure our div has a hight/width set:
-
- $j(embed_video).css({
- 'width':videoInterface.width,
- 'height':videoInterface.height
- }).html( mv_get_loading_img() );
- //inherit the video interface
- for(var method in videoInterface){ //for in loop oky in Element context
- if(method!='readyState'){ //readyState crashes IE
- if(method=='style'){
- embed_video.setAttribute('style', videoInterface[method]);
- }else if(method=='class'){
- if( $j.browser.msie )
- embed_video.setAttribute("className", videoInterface['class']);
- else
- embed_video.setAttribute("class", videoInterface['class']);
- }else{
- //normal inherit:
- embed_video[method]=videoInterface[method];
- }
- }
- //string -> boolean:
- if(embed_video[method]=="false")embed_video[method]=false;
- if(embed_video[method]=="true")embed_video[method]=true;
- }
- ///js_log('did vI style');
- //now swap out the video element for the embed_video obj:
- $j(video_element).after(embed_video).remove();
- //js_log('did swap');
- $j('#'+embed_video.id).get(0).on_dom_swap();
-
- // now that "embed_video" is stable, do more initialization (if we are ready)
- if($j('#'+embed_video.id).get(0).loading_external_data == false &&
- $j('#'+embed_video.id).get(0).init_with_sources_loadedDone == false){
- //load and set ready state since source are available:
- $j('#'+embed_video.id).get(0).init_with_sources_loaded();
- }
-
- js_log('done with child: ' + embed_video.id + ' len:' + global_player_list.length);
- return true;
- },
- //this should not be needed.
- checkClipsReady : function(){
- //js_log('checkClipsReady');
- var is_ready=true;
- for(var i=0; i < global_player_list.length; i++){
- if( $j('#'+global_player_list[i]).length !=0){
- var cur_vid = $j('#'+global_player_list[i]).get(0);
- is_ready = ( cur_vid.ready_to_play ) ? is_ready : false;
- if( !is_ready && cur_vid.load_error ){
- is_ready=true;
- $j(cur_vid).html( cur_vid.load_error );
- }
- }
- }
- if( is_ready ){
- mvEmbed.allClipsReady = true;
- // run queued functions
- //js_log('run queded functions:' + mvEmbed.flist[0]);
- mvEmbed.runFlist();
- }else{
- setTimeout( 'mvEmbed.checkClipsReady()', 25 );
- }
- },
- runFlist:function(){
- while (this.flist.length){
- this.flist.shift()();
- }
- }
-}
-/*
- * controlsBuilder:
- *
- */
+
var ctrlBuilder = {
height:29,
supports:{
}
}
+/*
+* Converts all occurrences of <video> tag into video object
+*/
+function mv_video_embed(swap_done_callback, force_id){
+ mvEmbed.init( swap_done_callback, force_id );
+}
+mvEmbed = {
+ //flist stores the set of functions to run after the video has been swaped in.
+ flist:new Array(),
+ init:function( swap_done_callback, force_id ){
+
+ if(swap_done_callback)
+ mvEmbed.flist.push( swap_done_callback );
+
+ //get mv_embed location if it has not been set
+ js_log('mv_embed ' + MV_EMBED_VERSION);
+
+ var loadPlaylistLib=false;
+
+ var eAction = function(this_elm){
+ js_log( "Do SWAP: " + $j(this_elm).attr("id") + ' tag: '+ this_elm.tagName.toLowerCase() );
+
+ if( $j(this_elm).attr("id") == '' ){
+ $j(this_elm).attr("id", 'v'+ global_player_list.length);
+ }
+ //stre a global reference to the id
+ global_player_list.push( $j(this_elm).attr("id") );
+ //if video doSwap
+ switch( this_elm.tagName.toLowerCase()){
+ case 'video':
+ var videoInterface = new embedVideo(this_elm);
+ mvEmbed.swapEmbedVideoElement( this_elm, videoInterface );
+ break;
+ case 'audio':
+ var videoInterface = new embedVideo(this_elm);
+ videoInterface.type ='audio';
+ mvEmbed.swapEmbedVideoElement( this_elm, videoInterface );
+ break;
+ case 'playlist':
+ loadPlaylistLib=true;
+ break;
+ }
+ }
+
+ if( force_id == null && force_id != '' ){
+ var j_selector = 'video,audio,playlist';
+ }else{
+ var j_selector = '#' + force_id;
+ }
+ //process selected elements:
+ //ie8 does not play well with the jQuery video,audio,playlist selector use native:
+ if($j.browser.msie && $j.browser.version >= 8){
+ jtags = j_selector.split(',');
+ for( var i=0; i < jtags.length; i++){
+ $j( document.getElementsByTagName( jtags[i] )).each(function(){
+ eAction(this);
+ });
+ }
+ }else{
+ $j( j_selector ).each(function(){
+ eAction(this);
+ });
+ }
+ if(loadPlaylistLib){
+ mvJsLoader.doLoad([
+ 'mvPlayList',
+ '$j.ui', //include dialog for pop-ing up thigns
+ '$j.ui.dialog'
+ ], function(){
+ $j('playlist').each(function(){
+ //create new playlist interface:
+ var plObj = new mvPlayList( this );
+ mvEmbed.swapEmbedVideoElement(this, plObj);
+ var added_height = plObj.pl_layout.title_bar_height + plObj.pl_layout.control_height;
+ //move into a blocking display container with height + controls + title height:
+ $j('#'+plObj.id).wrap('<div style="display:block;height:' + (plObj.height + added_height) + 'px;"></div>');
+ });
+ });
+ }
+ this.checkClipsReady();
+ },
+ /*
+ * swapEmbedVideoElement
+ * takes a video element as input and swaps it out with
+ * an embed video interface based on the video_elements attributes
+ */
+ swapEmbedVideoElement:function(video_element, videoInterface){
+ js_log('do swap ' + videoInterface.id + ' for ' + video_element);
+ embed_video = document.createElement('div');
+ //make sure our div has a hight/width set:
+
+ $j(embed_video).css({
+ 'width':videoInterface.width,
+ 'height':videoInterface.height
+ }).html( mv_get_loading_img() );
+ //inherit the video interface
+ for(var method in videoInterface){ //for in loop oky in Element context
+ if(method!='readyState'){ //readyState crashes IE
+ if(method=='style'){
+ embed_video.setAttribute('style', videoInterface[method]);
+ }else if(method=='class'){
+ if( $j.browser.msie )
+ embed_video.setAttribute("className", videoInterface['class']);
+ else
+ embed_video.setAttribute("class", videoInterface['class']);
+ }else{
+ //normal inherit:
+ embed_video[method]=videoInterface[method];
+ }
+ }
+ //string -> boolean:
+ if(embed_video[method]=="false")embed_video[method]=false;
+ if(embed_video[method]=="true")embed_video[method]=true;
+ }
+ ///js_log('did vI style');
+ //now swap out the video element for the embed_video obj:
+ $j(video_element).after(embed_video).remove();
+ //js_log('did swap');
+ $j('#'+embed_video.id).get(0).on_dom_swap();
+
+ // now that "embed_video" is stable, do more initialization (if we are ready)
+ if($j('#'+embed_video.id).get(0).loading_external_data == false &&
+ $j('#'+embed_video.id).get(0).init_with_sources_loadedDone == false){
+ //load and set ready state since source are available:
+ $j('#'+embed_video.id).get(0).init_with_sources_loaded();
+ }
+
+ js_log('done with child: ' + embed_video.id + ' len:' + global_player_list.length);
+ return true;
+ },
+ //this should not be needed.
+ checkClipsReady : function(){
+ //js_log('checkClipsReady');
+ var is_ready=true;
+ for(var i=0; i < global_player_list.length; i++){
+ if( $j('#'+global_player_list[i]).length !=0){
+ var cur_vid = $j('#'+global_player_list[i]).get(0);
+ is_ready = ( cur_vid.ready_to_play ) ? is_ready : false;
+ if( !is_ready && cur_vid.load_error ){
+ is_ready=true;
+ $j(cur_vid).html( cur_vid.load_error );
+ }
+ }
+ }
+ if( is_ready ){
+ mvEmbed.allClipsReady = true;
+ // run queued functions
+ //js_log('run queded functions:' + mvEmbed.flist[0]);
+ mvEmbed.runFlist();
+ }else{
+ setTimeout( 'mvEmbed.checkClipsReady()', 25 );
+ }
+ },
+ runFlist:function(){
+ while (this.flist.length){
+ this.flist.shift()();
+ }
+ }
+}
+
/**
* mediaSource class represents a source for a media element.
* @param {String} type MIME type of the source.
} */
},
doThumbnailHTML:function(){
- //empty out player html (jquery with java applets does not work) :
- var pelm = document.getElementById('mv_embedded_player_' + this.id );
+ //empty out player html (jquery with java applets does mix) :
+ var pelm = document.getElementById('dc_' + this.id );
pelm.innerHTML = '';
this.parent_doThumbnailHTML();
},
},
playerPixelWidth : function()
{
- var player = $j('#mv_embedded_player_'+this.id).get(0);
+ var player = $j('#dc_'+this.id).get(0);
if(typeof player!='undefined' && player['offsetWidth'])
return player.offsetWidth;
else
},
playerPixelHeight : function()
{
- var player = $j('#mv_embedded_player_'+this.id).get(0);
+ var player = $j('#dc_'+this.id).get(0);
if(typeof player!='undefined' && player['offsetHeight'])
return player.offsetHeight;
else
* set up mwConfig global overide any of the defaultMwConfig values:
* @@ more config valuse on the way ;)
*/
-var defaultMwConfig = {
+var defaultMwConfig = {
'skin_name': 'kskin',
'video_size':'400x300'
}
if( !mv_embed_path ){
var mv_embed_path = getMvEmbedPath();
}
-var jQueryUiVN = 'jquery.ui-1.7.1';
-
//setup the skin path:
-var mv_jquery_skin_path = mv_embed_path + 'jquery/' + jQueryUiVN + '/themes/base/';
+var mv_jquery_skin_path = mv_embed_path + 'jquery/jquery.ui/themes/base/';
var mv_skin_img_path = mv_embed_path + 'skins/' + mwConfig['skin_name'] + '/images/';
var mv_default_thumb_url = mv_skin_img_path + 'vid_default_thumb.jpg';
* if an array $j.className become jquery.className.js
* if an asssociative object then key => value paris are used
*/
-if(typeof mvClassPaths == 'undefined')
- mvClassPaths = {};
+if(typeof mvAutoLoadClasses == 'undefined')
+ mvAutoLoadClasses = {};
-function lcPaths( path, gClasses , opt){
- if(!opt)
- opt = {};
- if(typeof opt['j_replace'] == 'undefined')
- opt['j_replace'] = 'jquery.';
- if(!path)
- path = '';
- if(gClasses.length){
- //do array loop:
- for(var i=0; i < gClasses.length; i++){
- if(typeof gClasses[i] != 'undefined'){
- //setup normal replacement of j with jquery
- var jsName = ( gClasses[i].substr(0,3) == '$j.' ) ? opt['j_replace'] + gClasses[i].substr(3) : gClasses[i];
- mvClassPaths[ gClasses[i] ] = path + jsName + '.js';
- }
- }
- }else{
- //do object loop:
- for(var i in gClasses){
- //assume object with key:path:
- mvClassPaths[i] = path + gClasses[ i ];
- }
- }
+//the script that loads the classet
+function lcPaths( classSet){
+ for(var i in classSet){
+ mvAutoLoadClasses[i] = classSet[i];
+ }
}
+
function mvGetClassPath(k){
- if( mvClassPaths[k] ){
+ if( mvAutoLoadClasses[k] ){
//js_log('got classpath:' + k + ' : '+ mvClassPaths[k]);
- return mvClassPaths[k];
+ return mvAutoLoadClasses[k];
}else{
return js_error('could not find path for requested class ' + k );
}
mvCssPaths[i]= mv_embed_path + cssSet[i];
}
}
-//core and (non-standard named files relative to class the init):
-lcPaths('',{
- 'mv_embed' : 'mv_embed.js',
- 'window.jQuery' : 'jquery/jquery-1.3.2.js',
- '$j.fn.pngFix' : 'jquery/plugins/jquery.pngFix.js',
- '$j.fn.autocomplete': 'jquery/plugins/jquery.autocomplete.js',
- '$j.fn.hoverIntent' : 'jquery/plugins/jquery.hoverIntent.js',
- '$j.fn.datePicker' : 'jquery/plugins/jquery.datePicker.js',
- '$j.ui' : 'jquery/jquery.ui-1.7.1/ui/ui.core.js',
- '$j.fn.ColorPicker' : 'libClipEdit/colorpicker/js/colorpicker.js',
- '$j.Jcrop' : 'libClipEdit/Jcrop/js/jquery.Jcrop.js',
- '$j.fn.simpleUploadForm': 'libAddMedia/simpleUploadForm.js'
+
+/*
+ * -- Load Class Paths --
+ *
+ * MUST BE VALID JSON (NOT JS)
+ * is used by the scriptloader to autoLoad classes (so we only define this once for php & javascript)
+ *
+ * this is more verbose than earlier version that compressed paths
+ * but its all good gziping help compress repetative path strings
+ * grouped by
+ *
+ * right now php AutoLoader only reads this mv_embed.js file
+ * in the future we could have multiple lcPath calls that php reads
+ * (if our autoloading class list becomes too long) just have to add thouse
+ * files to the jsAutoLoader file list.
+ */
+lcPaths({
+ "mv_embed" : "mv_embed.js",
+ "window.jQuery" : "jquery/jquery-1.3.2.js",
+ "$j.fn.pngFix" : "jquery/plugins/jquery.pngFix.js",
+ "$j.fn.autocomplete": "jquery/plugins/jquery.autocomplete.js",
+ "$j.fn.hoverIntent" : "jquery/plugins/jquery.hoverIntent.js",
+ "$j.fn.datePicker" : "jquery/plugins/jquery.datePicker.js",
+ "$j.ui" : "jquery/jquery.ui/ui/ui.core.js",
+ "$j.fn.ColorPicker" : "libClipEdit/colorpicker/js/colorpicker.js",
+ "$j.Jcrop" : "libClipEdit/Jcrop/js/jquery.Jcrop.js",
+ "$j.fn.simpleUploadForm": "libAddMedia/simpleUploadForm.js",
+
+ "baseSkin" : "skins/baseSkin.js",
+ "kskin" : "skins/kskin/kskin.js",
+ "mvpcf" : "skins/mvpcf/mvpcf.js",
+
+ "$j.secureEvalJSON" : "jquery/plugins/jquery.secureEvalJSON.js",
+ "$j.cookie" : "jquery/plugins/jquery.cookie.js",
+ "$j.contextMenu" : "jquery/plugins/jquery.contextMenu.js",
+
+ "$j.effects.blind" : "jquery/jquery.ui/ui/effects.blind.js",
+ "$j.effects.drop" : "jquery/jquery.ui/ui/effects.drop.js",
+ "$j.effects.pulsate" : "jquery/jquery.ui/ui/effects.pulsate.js",
+ "$j.effects.transfer" : "jquery/jquery.ui/ui/effects.transfer.js",
+ "$j.ui.droppable" : "jquery/jquery.ui/ui/ui.droppable.js",
+ "$j.ui.slider" : "jquery/jquery.ui/ui/ui.slider.js",
+ "$j.effects.bounce" : "jquery/jquery.ui/ui/effects.bounce.js",
+ "$j.effects.explode" : "jquery/jquery.ui/ui/effects.explode.js",
+ "$j.effects.scale" : "jquery/jquery.ui/ui/effects.scale.js",
+ "$j.ui.datepicker" : "jquery/jquery.ui/ui/ui.datepicker.js",
+ "$j.ui.progressbar" : "jquery/jquery.ui/ui/ui.progressbar.js",
+ "$j.ui.sortable" : "jquery/jquery.ui/ui/ui.sortable.js",
+ "$j.effects.clip" : "jquery/jquery.ui/ui/effects.clip.js",
+ "$j.effects.fold" : "jquery/jquery.ui/ui/effects.fold.js",
+ "$j.effects.shake" : "jquery/jquery.ui/ui/effects.shake.js",
+ "$j.ui.dialog" : "jquery/jquery.ui/ui/ui.dialog.js",
+ "$j.ui.resizable" : "jquery/jquery.ui/ui/ui.resizable.js",
+ "$j.ui.tabs" : "jquery/jquery.ui/ui/ui.tabs.js",
+ "$j.effects.core" : "jquery/jquery.ui/ui/effects.core.js",
+ "$j.effects.highlight" : "jquery/jquery.ui/ui/effects.highlight.js",
+ "$j.effects.slide" : "jquery/jquery.ui/ui/effects.slide.js",
+ "$j.ui.accordion" : "jquery/jquery.ui/ui/ui.accordion.js",
+ "$j.ui.draggable" : "jquery/jquery.ui/ui/ui.draggable.js",
+ "$j.ui.selectable" : "jquery/jquery.ui/ui/ui.selectable.js",
+
+ "mvFirefogg" : "libAddMedia/mvFirefogg.js",
+ "mvAdvFirefogg" : "libAddMedia/mvAdvFirefogg.js",
+ "mvBaseUploadInterface" : "libAddMedia/mvBaseUploadInterface.js",
+ "remoteSearchDriver" : "libAddMedia/remoteSearchDriver.js",
+ "seqRemoteSearchDriver" : "libAddMedia/seqRemoteSearchDriver.js",
+
+ "baseRemoteSearch" : "libAddMedia/searchLibs/baseRemoteSearch.js",
+ "mediaWikiSearch" : "libAddMedia/searchLibs/mediaWikiSearch.js",
+ "metavidSearch" : "libAddMedia/searchLibs/metavidSearch.js",
+ "archiveOrgSearch" : "libAddMedia/searchLibs/archiveOrgSearch.js",
+ "baseRemoteSearch" : "libAddMedia/searchLibs/baseRemoteSearch.js",
+
+ "mvClipEdit" : "libClipEdit/mvClipEdit.js",
+
+ "embedVideo" : "libEmbedVideo/embedVideo.js",
+ "flashEmbed" : "libEmbedVideo/flashEmbed.js",
+ "genericEmbed" : "libEmbedVideo/genericEmbed.js",
+ "htmlEmbed" : "libEmbedVideo/htmlEmbed.js",
+ "javaEmbed" : "libEmbedVideo/javaEmbed.js",
+ "nativeEmbed" : "libEmbedVideo/nativeEmbed.js",
+ "quicktimeEmbed" : "libEmbedVideo/quicktimeEmbed.js",
+ "vlcEmbed" : "libEmbedVideo/vlcEmbed.js",
+
+ "mvPlayList" : "libSequencer/mvPlayList.js",
+ "mvSequencer" : "libSequencer/mvSequencer.js",
+ "mvFirefoggRender" : "libSequencer/mvFirefoggRender.js",
+ "mvTimedEffectsEdit": "libSequencer/mvTimedEffectsEdit.js",
+
+ "libTimedText" : "libTimedText/mvTextInterface.js"
+
});
-//query plugins
-lcPaths( 'jquery/plugins/', [
- '$j.secureEvalJSON',
- '$j.cookie',
- '$j.contextMenu'
-]);
-//jquery ui
-lcPaths('jquery/jquery.ui-1.7.1/ui/', [
- '$j.effects.blind',
- '$j.effects.drop',
- '$j.effects.pulsate',
- '$j.effects.transfer',
- '$j.ui.droppable',
- '$j.ui.slider',
- '$j.effects.bounce',
- '$j.effects.explode',
- '$j.effects.scale',
- '$j.ui.datepicker',
- '$j.ui.progressbar',
- '$j.ui.sortable',
- '$j.effects.clip',
- '$j.effects.fold',
- '$j.effects.shake',
- '$j.ui.dialog',
- '$j.ui.resizable',
- '$j.ui.tabs',
- '$j.effects.core',
- '$j.effects.highlight',
- '$j.effects.slide',
- '$j.ui.accordion',
- '$j.ui.draggable',
- '$j.ui.selectable'
-],
-{'j_replace':''});
-//add mediaLibs
-lcPaths('libAddMedia/', [
- 'mvFirefogg',
- 'mvAdvFirefogg',
- 'mvBaseUploadInterface',
- 'remoteSearchDriver',
- 'seqRemoteSearchDriver'
-]);
-//search libs:
-lcPaths('libAddMedia/searchLibs/', [
- 'baseRemoteSearch',
- 'mediaWikiSearch',
- 'metavidSearch',
- 'archiveOrgSearch',
- 'baseRemoteSearch'
-]);
-//libclip edit
-lcPaths( 'libClipEdit/', [
- 'mvClipEdit'
-])
-//libEmbedObj (we could load all these clasess in embedVideo):
-lcPaths( 'libEmbedVideo/', [
- 'embedVideo',
- 'flashEmbed',
- 'genericEmbed',
- 'htmlEmbed',
- 'javaEmbed',
- 'nativeEmbed',
- 'quicktimeEmbed',
- 'vlcEmbed'
-])
-//libSequencer:
-lcPaths( 'libSequencer/', [
- 'mvPlayList',
- 'mvSequencer',
- 'mvFirefoggRender',
- 'mvTimedEffectsEdit'
-])
-//libTimedText:
-lcPaths( 'libTimedText/', [
- 'mvTextInterface'
-]);
//depencency mapping for css files for self contained included plugins:
lcCssPath({
global $wgJSAutoloadLocalClasses, $wgMwEmbedDirectory;
-// the basis of the loader calls:
-$wgJSAutoloadLocalClasses['mv_embed'] = $wgMwEmbedDirectory . 'mv_embed.js';
-
-// core:
-$wgJSAutoloadLocalClasses['window.jQuery'] = $wgMwEmbedDirectory . 'jquery/jquery-1.3.2.js';
-
-$wgJSAutoloadLocalClasses['j.secureEvalJSON'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.json-1.3.js';
-$wgJSAutoloadLocalClasses['j.cookie'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.cookie.js';
-$wgJSAutoloadLocalClasses['j.contextMenu'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.contextMenu.js';
-$wgJSAutoloadLocalClasses['j.fn.pngFix'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.pngFix.js';
-$wgJSAutoloadLocalClasses['j.fn.autocomplete'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.autocomplete.js';
-$wgJSAutoloadLocalClasses['j.fn.hoverIntent'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.hoverIntent.js';
-$wgJSAutoloadLocalClasses['Date.fromString'] = $wgMwEmbedDirectory . 'jquery/plugins/date.js';
-$wgJSAutoloadLocalClasses['j.fn.datePicker'] = $wgMwEmbedDirectory . 'jquery/plugins/jquery.datePicker.js';
-
-// jcrop
-$wgJSAutoloadLocalClasses['j.Jcrop'] = $wgMwEmbedDirectory . 'libClipEdit/Jcrop/js/jquery.Jcrop.js';
-
-// color picker
-$wgJSAutoloadLocalClasses['j.fn.ColorPicker'] = $wgMwEmbedDirectory . 'libClipEdit/colorpicker/js/colorpicker.js';
-
-// jquery.ui
-$wgJSAutoloadLocalClasses['j.ui'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.core.js';
-
-$wgJSAutoloadLocalClasses['j.effects.blind'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.blind.js';
-$wgJSAutoloadLocalClasses['j.effects.drop'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.drop.js';
-$wgJSAutoloadLocalClasses['j.effects.pulsate'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.pulsate.js';
-$wgJSAutoloadLocalClasses['j.effects.transfer'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.transfer.js';
-$wgJSAutoloadLocalClasses['j.ui.droppable'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.droppable.js';
-$wgJSAutoloadLocalClasses['j.ui.slider'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.slider.js';
-$wgJSAutoloadLocalClasses['j.effects.bounce'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.bounce.js';
-$wgJSAutoloadLocalClasses['j.effects.explode'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.explode.js';
-$wgJSAutoloadLocalClasses['j.effects.scale'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.scale.js';
-$wgJSAutoloadLocalClasses['j.ui.datepicker'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.datepicker.js';
-$wgJSAutoloadLocalClasses['j.ui.progressbar'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.progressbar.js';
-$wgJSAutoloadLocalClasses['j.ui.sortable'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.sortable.js';
-$wgJSAutoloadLocalClasses['j.effects.clip'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.clip.js';
-$wgJSAutoloadLocalClasses['j.effects.fold'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.fold.js';
-$wgJSAutoloadLocalClasses['j.effects.shake'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.shake.js';
-$wgJSAutoloadLocalClasses['j.ui.dialog'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.dialog.js';
-$wgJSAutoloadLocalClasses['j.ui.resizable'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.resizable.js';
-$wgJSAutoloadLocalClasses['j.ui.tabs'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.tabs.js';
-$wgJSAutoloadLocalClasses['j.effects.core'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.core.js';
-$wgJSAutoloadLocalClasses['j.effects.highlight']= $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.highlight.js';
-$wgJSAutoloadLocalClasses['j.effects.slide'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/effects.slide.js';
-$wgJSAutoloadLocalClasses['j.ui.accordion'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.accordion.js';
-$wgJSAutoloadLocalClasses['j.ui.draggable'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.draggable.js';
-$wgJSAutoloadLocalClasses['j.ui.selectable'] = $wgMwEmbedDirectory . 'jquery/jquery.ui-1.7.1/ui/ui.selectable.js';
-
-// libAddMedia:
-$wgJSAutoloadLocalClasses['mvFirefogg'] = $wgMwEmbedDirectory . 'libAddMedia/mvFirefogg.js';
-$wgJSAutoloadLocalClasses['mvAdvFirefogg'] = $wgMwEmbedDirectory . 'libAddMedia/mvAdvFirefogg.js';
-
-$wgJSAutoloadLocalClasses['mvBaseUploadInterface'] = $wgMwEmbedDirectory . 'libAddMedia/mvBaseUploadInterface.js';
-$wgJSAutoloadLocalClasses['remoteSearchDriver'] = $wgMwEmbedDirectory . 'libAddMedia/remoteSearchDriver.js';
-$wgJSAutoloadLocalClasses['seqRemoteSearchDriver'] = $wgMwEmbedDirectory . 'libAddMedia/seqRemoteSearchDriver.js';
-$wgJSAutoloadLocalClasses['baseRemoteSearch'] = $wgMwEmbedDirectory . 'libAddMedia/searchLibs/baseRemoteSearch.js';
-$wgJSAutoloadLocalClasses['mediaWikiSearch'] = $wgMwEmbedDirectory . 'libAddMedia/searchLibs/mediaWikiSearch.js';
-$wgJSAutoloadLocalClasses['metavidSearch'] = $wgMwEmbedDirectory . 'libAddMedia/searchLibs/metavidSearch.js';
-$wgJSAutoloadLocalClasses['archiveOrgSearch'] = $wgMwEmbedDirectory . 'libAddMedia/searchLibs/archiveOrgSearch.js';
-$wgJSAutoloadLocalClasses['baseRemoteSearch'] = $wgMwEmbedDirectory . 'libAddMedia/searchLibs/baseRemoteSearch.js';
-
-$wgJSAutoloadLocalClasses['j.fn.simpleUploadForm'] = $wgMwEmbedDirectory . 'libAddMedia/simpleUploadForm.js';
-
-// libClipEdit:
-$wgJSAutoloadLocalClasses['mvClipEdit'] = $wgMwEmbedDirectory . 'libClipEdit/mvClipEdit.js';
-
-// libEmbedObj:
-$wgJSAutoloadLocalClasses['embedVideo'] = $wgMwEmbedDirectory . 'libEmbedVideo/embedVideo.js';
-$wgJSAutoloadLocalClasses['flashEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/flashEmbed.js';
-$wgJSAutoloadLocalClasses['genericEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/genericEmbed.js';
-$wgJSAutoloadLocalClasses['htmlEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/htmlEmbed.js';
-$wgJSAutoloadLocalClasses['javaEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/javaEmbed.js';
-$wgJSAutoloadLocalClasses['nativeEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/nativeEmbed.js';
-$wgJSAutoloadLocalClasses['quicktimeEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/quicktimeEmbed.js';
-$wgJSAutoloadLocalClasses['vlcEmbed'] = $wgMwEmbedDirectory . 'libEmbedVideo/vlcEmbed.js';
-
-// libSequencer:
-$wgJSAutoloadLocalClasses['mvPlayList'] = $wgMwEmbedDirectory . 'libSequencer/mvPlayList.js';
-$wgJSAutoloadLocalClasses['mvSequencer'] = $wgMwEmbedDirectory . 'libSequencer/mvSequencer.js';
-$wgJSAutoloadLocalClasses['mvSequencer'] = $wgMwEmbedDirectory . 'libSequencer/mvSequencer.js';
-$wgJSAutoloadLocalClasses['mvFirefoggRender'] = $wgMwEmbedDirectory . 'libSequencer/mvFirefoggRender.js';
-$wgJSAutoloadLocalClasses['mvTimedEffectsEdit'] = $wgMwEmbedDirectory . 'libSequencer/mvTimedEffectsEdit.js';
-
-// libTimedText
-$wgJSAutoloadLocalClasses['mvTextInterface'] = $wgMwEmbedDirectory . 'libTimedText/mvTextInterface.js';
+//load classes from mv_embed.js::
+
+//read the file:
+if( is_file( $wgMwEmbedDirectory . 'mv_embed.js' )){
+
+ $str = @file_get_contents( $wgMwEmbedDirectory . 'mv_embed.js');
+
+ $str = preg_replace_callback(
+ '/lcPaths\s*\(\s*{(.*)}\s*\)\s*/siU',
+ 'jsClassPathLoader',
+ $str
+ );
+}
+function jsClassPathLoader($jvar){
+ global $wgJSAutoloadLocalClasses,$wgMwEmbedDirectory;
+ if( !isset( $jvar[1] ) )
+ return false;
+ $jClassSet = json_decode( '{' . $jvar[1] . '}', true );
+ foreach( $jClassSet as $jClass => $jPath ){
+ //strip $ from jsclass (as they are striped on url request param input)
+ $jClass = str_replace('$', '', $jClass);
+ $wgJSAutoloadLocalClasses[$jClass] = $wgMwEmbedDirectory . $jPath;
+ }
+}
#<JAVASCRIPT EN REPLACE>
$messages['en'] = array(
/*
- * js file: /libSequencer/mvSequencer.js
+ * js file: /libTimedText/mvTextInterface.js
*/
- 'menu_clipedit' => 'Edit Media',
- 'menu_transition' => 'Transitions & Effects',
- 'menu_cliplib' => 'Add Media',
- 'menu_resource_overview' => 'Resource Overview',
- 'menu_options' => 'Options',
- 'loading_timeline' => 'Loading TimeLine <blink>...</blink>',
- 'loading_user_rights' => 'Loading user rights <blink>...</blink>',
- 'no_edit_permissions' => 'You don\'t have permissions to save changes to this sequence',
- 'edit_clip' => 'Edit Clip',
- 'edit_save' => 'Save Sequence Changes',
- 'saving_wait' => 'Save in Progress (please wait)',
- 'save_done' => 'Save Done',
- 'edit_cancel' => 'Cancel Sequence Edit',
- 'edit_cancel_confirm' => 'Are you sure you want to cancel your edit. Changes will be lost',
- 'zoom_in' => 'Zoom In',
- 'zoom_out' => 'Zoom Out',
- 'cut_clip' => 'Cut Clips',
- 'expand_track' => 'Expand Track',
- 'colapse_track' => 'Collapse Track',
- 'play_from_position' => 'Play From Playline Position',
- 'pixle2sec' => 'pixles to seconds',
- 'rmclip' => 'Remove Clip',
- 'clip_in' => 'clip in',
- 'clip_out' => 'clip out',
- 'mv_welcome_to_sequencer' => '<h3>Welcome to the sequencer demo</h3> very <b>limited</b> functionality right now. Not much documentation yet either',
- 'no_selected_resource' => '<h3>No Resource Selected</h3> Select a Clip to enable editing',
- 'error_edit_multiple' => '<h3>Multiple Resources Selected</h3> Select a single clip to edit it',
- 'mv_editor_options' => 'Editor options',
- 'mv_editor_mode' => 'Editor mode',
- 'mv_simple_editor_desc' => 'simple editor (iMovie style)',
- 'mv_advanced_editor_desc' => 'advanced editor (Final Cut style)',
- 'mv_other_options' => 'Other Options',
- 'mv_contextmenu_opt' => 'Enable Context Menus',
- 'mv_sequencer_credit_line' => 'Developed by <a href="http://kaltura.com">Kaltura, Inc.</a> in partnership with the <a href="http://wikimediafoundation.org/wiki/Home">Wikimedia Foundation</a> ( <a href="#">more info</a> )',
+ 'select_transcript_set' => 'Select Layers',
+ 'auto_scroll' => 'auto scroll',
+ 'close' => 'close',
+ 'improve_transcript' => 'Improve',
/*
- * js file: /libSequencer/mvTimedEffectsEdit.js
+ * js file: /libAddMedia/mvBaseUploadInterface.js
*/
- 'transition_in' => 'Transition In',
- 'transition_out' => 'Transition Out',
- 'effects' => 'Effects Stack',
- 'remove_transition' => 'Remove Transition',
- 'edit_transin' => 'Edit Transition Into Clip',
- 'edit_transout' => 'Edit Transition Out of Clip',
+ 'upload-transcode-in-progress' => 'Doing Transcode & Upload (do not close this window)',
+ 'upload-in-progress' => 'Upload in Progress (do not close this window)',
+ 'upload-transcoded-status' => 'Transcoded',
+ 'uploaded-status' => 'Uploaded',
+ 'wgfogg_wrong_version' => 'You have firefogg installed but its outdated, <a href="http://firefogg.org">please upgrade</a> ',
+ 'upload-stats-fileprogres' => '$1 of $2',
+ 'mv_upload_completed' => 'Your upload is complete',
+ 'mv_upload_done' => 'Your upload <i>should be</i> accessible <a href="$1">here</a>',
+ 'upload-unknown-size' => 'Unknown size',
+ 'mv-cancel-confim' => 'Are you sure you want to cancel?',
+ 'successfulupload' => 'Successful Upload',
+ 'uploaderror' => 'Upload error',
+ 'uploadwarning' => 'Upload warning',
+ 'unknown-error' => 'Unknown Error',
+ 'return-to-form' => 'Return to form',
+ 'file-exists-duplicate' => 'This file is a duplicate of the following file',
+ 'fileexists' => 'A file with this name exists already, please check <b><tt>$1</tt></b> if you are not sure if you want to change it.',
+ 'fileexists-thumb' => '<center><b>Existing file</b></center>',
+ 'ignorewarning' => 'Ignore warning and save file anyway',
+ 'file-thumbnail-no' => 'The filename begins with <b><tt>$1</tt></b>',
+ 'go-to-resource' => 'Go to Resource Page',
+ 'upload-misc-error' => 'Unknown upload error',
+ 'wgfogg_waring_bad_extension' => 'You have selected a file with an unsuported extension (<a href="http://commons.wikimedia.org/wiki/Commons:Firefogg#Supported_File_Types">more information</a>).',
+ 'cancel-button' => 'Cancel',
+ 'ok-button' => 'OK',
/*
- * js file: /libClipEdit/mvClipEdit.js
+ * js file: /libAddMedia/mvAdvFirefogg.js
*/
- 'mv_crop' => 'Crop Image',
- 'mv_apply_crop' => 'Apply Crop to Image',
- 'mv_reset_crop' => 'Rest Crop',
- 'mv_insert_image_page' => 'Insert Into page',
- 'mv_insert_into_sequence' => 'Insert Into Sequence',
- 'mv_preview_insert' => 'Preview Insert',
- 'mv_cancel_image_insert' => 'Cancel Insert',
- 'sc_fileopts' => 'Clip Detail Edit',
- 'sc_inoutpoints' => 'Set In-Out points',
- 'sc_overlays' => 'Overlays',
- 'sc_audio' => 'Audio Control',
- 'sc_duration' => 'Duration',
- 'mv_template_properties' => 'Template Properties',
- 'mv_custom_title' => 'Custom Title',
- 'mv_edit_properties' => 'Edit Properties',
- 'mv_other_properties' => 'Other Properties',
- 'mv_resource_page' => 'Resource Page:',
- 'mv_set_in_out_points' => 'Set in-out points',
- 'mv_start_time' => 'Start Time',
- 'mv_end_time' => 'End Time',
- 'mv_preview_inout' => 'Preview/Play In-out points',
+ 'help-sticky' => 'Help (Click to Stick)',
+ 'fogg-cg-preset' => 'Preset: <strong>$1</strong>',
+ 'fogg-cg-quality' => 'Basic Quality and Resolution Control',
+ 'fogg-cg-meta' => 'Meta Data for the Clip',
+ 'fogg-cg-range' => 'Encoding Range',
+ 'fogg-cg-advVideo' => 'Advanced Video Encoding Controls',
+ 'fogg-cg-advAudio' => 'Advanced Audio Encoding Controls',
+ 'fogg-preset-custom' => 'Custom Settings',
/*
* js file: /libAddMedia/searchLibs/metavidSearch.js
*/
'imported_from' => '$1 imported from [$2 $3]. See the original [$4 resource page] for more info',
- /*
- * js file: /libAddMedia/remoteSearchDriver.js
- */
- 'add_media_wizard' => 'Add Media Wizard',
- 'mv_media_search' => 'Media Search',
- 'rsd_box_layout' => 'Box layout',
- 'rsd_list_layout' => 'List Layout',
- 'rsd_results_desc' => 'Results ',
- 'rsd_results_next' => 'next ',
- 'rsd_results_prev' => 'previous ',
- 'rsd_no_results' => 'No search results for <b>$1</b>',
- 'upload_tab' => 'Upload',
- 'rsd_layout' => 'Layout:',
- 'rsd_resource_edit' => 'Edit Resource: $1',
- 'resource_description_page' => 'Resource Description Page',
- 'rsd_local_resource_title' => 'Local Resource Title',
- 'rsd_do_insert' => 'Do Insert',
- 'cc_title' => 'Creative Commons',
- 'cc_by_title' => 'Attribution',
- 'cc_nc_title' => 'Noncommercial',
- 'cc_nd_title' => 'No Derivative Works',
- 'cc_sa_title' => 'Share Alike',
- 'cc_pd_title' => 'Public Domain',
- 'unknown_license' => 'Unknown License',
- 'no_import_by_url' => 'This User or Wiki <b>can not</b> import assets from remote URLs. </p><p> Do you need to Login? </p><p> If permissions are set you may have to enable $wgAllowCopyUploads, <a href="http://www.mediawiki.org/wiki/Manual:$wgAllowCopyUploads">more info</a></p>',
- 'results_from' => 'Results from <a href="$1" target="_new" >$2</a>',
- 'missing_desc_see_soruce' => 'This Asset is missing a description. Please see the [$1 orginal source] and help describe it',
- 'rsd_config_error' => 'Add media Wizard configuation error: $1',
-
/*
* js file: /libAddMedia/mvFirefogg.js
*/
'fogg-passthrough_mode' => 'Your selected file is already ogg or not a video file',
'fogg-transcoding' => 'Encoding Video to Ogg',
'fogg-encoding-done' => 'Encoding Done',
-
- /*
- * js file: /libAddMedia/mvBaseUploadInterface.js
- */
- 'upload-transcode-in-progress' => 'Doing Transcode & Upload (do not close this window)',
- 'upload-in-progress' => 'Upload in Progress (do not close this window)',
- 'upload-transcoded-status' => 'Transcoded',
- 'uploaded-status' => 'Uploaded',
- 'wgfogg_wrong_version' => 'You have firefogg installed but its outdated, <a href="http://firefogg.org">please upgrade</a> ',
- 'upload-stats-fileprogres' => '$1 of $2',
- 'mv_upload_completed' => 'Your upload is complete',
- 'mv_upload_done' => 'Your upload <i>should be</i> accessible <a href="$1">here</a>',
- 'upload-unknown-size' => 'Unknown size',
- 'mv-cancel-confim' => 'Are you sure you want to cancel?',
- 'successfulupload' => 'Successful Upload',
- 'uploaderror' => 'Upload error',
- 'uploadwarning' => 'Upload warning',
- 'unknown-error' => 'Unknown Error',
- 'return-to-form' => 'Return to form',
- 'file-exists-duplicate' => 'This file is a duplicate of the following file',
- 'fileexists' => 'A file with this name exists already, please check <b><tt>$1</tt></b> if you are not sure if you want to change it.',
- 'fileexists-thumb' => '<center><b>Existing file</b></center>',
- 'ignorewarning' => 'Ignore warning and save file anyway',
- 'file-thumbnail-no' => 'The filename begins with <b><tt>$1</tt></b>',
- 'go-to-resource' => 'Go to Resource Page',
- 'upload-misc-error' => 'Unknown upload error',
- 'wgfogg_waring_bad_extension' => 'You have selected a file with an unsuported extension (<a href="http://commons.wikimedia.org/wiki/Commons:Firefogg#Supported_File_Types">more information</a>).',
- 'cancel-button' => 'Cancel',
- 'ok-button' => 'OK',
+ 'fogg-badtoken' => 'Token is not valid',
/*
* js file: /libAddMedia/simpleUploadForm.js
'error_not_loggedin' => 'You don\'t appear to be logged in or don\'t have upload privlages.',
/*
- * js file: /libAddMedia/mvAdvFirefogg.js
+ * js file: /libAddMedia/remoteSearchDriver.js
*/
- 'help-sticky' => 'Help (Click to Stick)',
- 'fogg-cg-preset' => 'Preset: <strong>$1</strong>',
- 'fogg-cg-quality' => 'Basic Quality and Resolution Control',
- 'fogg-cg-meta' => 'Meta Data for the Clip',
- 'fogg-cg-range' => 'Encoding Range',
- 'fogg-cg-advVideo' => 'Advanced Video Encoding Controls',
- 'fogg-cg-advAudio' => 'Advanced Audio Encoding Controls',
- 'fogg-preset-custom' => 'Custom Settings',
+ 'add_media_wizard' => 'Add Media Wizard',
+ 'mv_media_search' => 'Media Search',
+ 'rsd_box_layout' => 'Box layout',
+ 'rsd_list_layout' => 'List Layout',
+ 'rsd_results_desc' => 'Results ',
+ 'rsd_results_next' => 'next ',
+ 'rsd_results_prev' => 'previous ',
+ 'rsd_no_results' => 'No search results for <b>$1</b>',
+ 'upload_tab' => 'Upload',
+ 'rsd_layout' => 'Layout:',
+ 'rsd_resource_edit' => 'Edit Resource: $1',
+ 'resource_description_page' => 'Resource Description Page',
+ 'rsd_local_resource_title' => 'Local Resource Title',
+ 'rsd_do_insert' => 'Do Insert',
+ 'cc_title' => 'Creative Commons',
+ 'cc_by_title' => 'Attribution',
+ 'cc_nc_title' => 'Noncommercial',
+ 'cc_nd_title' => 'No Derivative Works',
+ 'cc_sa_title' => 'Share Alike',
+ 'cc_pd_title' => 'Public Domain',
+ 'unknown_license' => 'Unknown License',
+ 'no_import_by_url' => 'This User or Wiki <b>can not</b> import assets from remote URLs. </p><p> Do you need to Login? </p><p> If permissions are set you may have to enable $wgAllowCopyUploads, <a href="http://www.mediawiki.org/wiki/Manual:$wgAllowCopyUploads">more info</a></p>',
+ 'results_from' => 'Results from <a href="$1" target="_new" >$2</a>',
+ 'missing_desc_see_soruce' => 'This Asset is missing a description. Please see the [$1 orginal source] and help describe it',
+ 'rsd_config_error' => 'Add media Wizard configuation error: $1',
/*
- * js file: /libTimedText/mvTextInterface.js
+ * js file: /libSequencer/mvSequencer.js
*/
- 'select_transcript_set' => 'Select Layers',
- 'auto_scroll' => 'auto scroll',
- 'close' => 'close',
- 'improve_transcript' => 'Improve',
+ 'menu_clipedit' => 'Edit Media',
+ 'menu_transition' => 'Transitions & Effects',
+ 'menu_cliplib' => 'Add Media',
+ 'menu_resource_overview' => 'Resource Overview',
+ 'menu_options' => 'Options',
+ 'loading_timeline' => 'Loading TimeLine <blink>...</blink>',
+ 'loading_user_rights' => 'Loading user rights <blink>...</blink>',
+ 'no_edit_permissions' => 'You don\'t have permissions to save changes to this sequence',
+ 'edit_clip' => 'Edit Clip',
+ 'edit_save' => 'Save Sequence Changes',
+ 'saving_wait' => 'Save in Progress (please wait)',
+ 'save_done' => 'Save Done',
+ 'edit_cancel' => 'Cancel Sequence Edit',
+ 'edit_cancel_confirm' => 'Are you sure you want to cancel your edit. Changes will be lost',
+ 'zoom_in' => 'Zoom In',
+ 'zoom_out' => 'Zoom Out',
+ 'cut_clip' => 'Cut Clips',
+ 'expand_track' => 'Expand Track',
+ 'colapse_track' => 'Collapse Track',
+ 'play_from_position' => 'Play From Playline Position',
+ 'pixle2sec' => 'pixles to seconds',
+ 'rmclip' => 'Remove Clip',
+ 'clip_in' => 'clip in',
+ 'clip_out' => 'clip out',
+ 'mv_welcome_to_sequencer' => '<h3>Welcome to the sequencer demo</h3> very <b>limited</b> functionality right now. Not much documentation yet either',
+ 'no_selected_resource' => '<h3>No Resource Selected</h3> Select a Clip to enable editing',
+ 'error_edit_multiple' => '<h3>Multiple Resources Selected</h3> Select a single clip to edit it',
+ 'mv_editor_options' => 'Editor options',
+ 'mv_editor_mode' => 'Editor mode',
+ 'mv_simple_editor_desc' => 'simple editor (iMovie style)',
+ 'mv_advanced_editor_desc' => 'advanced editor (Final Cut style)',
+ 'mv_other_options' => 'Other Options',
+ 'mv_contextmenu_opt' => 'Enable Context Menus',
+ 'mv_sequencer_credit_line' => 'Developed by <a href="http://kaltura.com">Kaltura, Inc.</a> in partnership with the <a href="http://wikimediafoundation.org/wiki/Home">Wikimedia Foundation</a> ( <a href="#">more info</a> )',
/*
- * js file: /mv_embed.js
+ * js file: /libSequencer/mvTimedEffectsEdit.js
*/
- 'loading_txt' => 'loading <blink>...</blink>',
- 'loading_title' => 'Loading...',
- 'size-gigabytes' => '$1 GB',
- 'size-megabytes' => '$1 MB',
- 'size-kilobytes' => '$1 K',
- 'size-bytes' => '$1 B',
+ 'transition_in' => 'Transition In',
+ 'transition_out' => 'Transition Out',
+ 'effects' => 'Effects Stack',
+ 'remove_transition' => 'Remove Transition',
+ 'edit_transin' => 'Edit Transition Into Clip',
+ 'edit_transout' => 'Edit Transition Out of Clip',
/*
* js file: /libEmbedVideo/embedVideo.js
'download_segment' => 'Download Selection:',
'download_full' => 'Download Full Video File:',
'download_right_click' => 'To download right click and select <i>save target as</i>',
- 'download_clip' => 'Download the Clip',
+ 'download_clip' => 'Download Video',
'download_text' => 'Download Text (<a style="color:white" title="cmml" href="http://wiki.xiph.org/index.php/CMML">cmml</a> xml):',
+ 'download' => 'Download',
+ 'share' => 'Share',
+ 'credits' => 'Credits',
'clip_linkback' => 'Clip Source Page',
+ 'chose_player' => 'Choose Video Player',
+ 'share_this_video' => 'Share This Video',
+ 'video_credits' => 'Video Credits',
+ 'menu_btn' => 'MENU',
+ 'close_btn' => 'CLOSE',
'mv_ogg-player-vlc-mozilla' => 'VLC Plugin',
'mv_ogg-player-videoElement' => 'Native Ogg Video Support',
'mv_ogg-player-vlc-activex' => 'VLC ActiveX',
'mv_generic_missing_plugin' => 'You browser does not appear to support playback type: <b>$1</b><br> visit the <a href="http://commons.wikimedia.org/wiki/Commons:Media_help">Playback Methods</a> page to download a player<br>',
'mv_for_best_experience' => 'For a better video playback experience we recommend:<br> <b><a href="http://www.mozilla.com/en-US/firefox/upgrade.html?from=mwEmbed">Firefox 3.5</a></b>',
'mv_do_not_warn_again' => 'Dissmiss for now.',
+ 'players' => 'Players',
+
+ /*
+ * js file: /libClipEdit/mvClipEdit.js
+ */
+ 'mv_crop' => 'Crop Image',
+ 'mv_apply_crop' => 'Apply Crop to Image',
+ 'mv_reset_crop' => 'Rest Crop',
+ 'mv_insert_image_page' => 'Insert Into page',
+ 'mv_insert_into_sequence' => 'Insert Into Sequence',
+ 'mv_preview_insert' => 'Preview Insert',
+ 'mv_cancel_image_insert' => 'Cancel Insert',
+ 'sc_fileopts' => 'Clip Detail Edit',
+ 'sc_inoutpoints' => 'Set In-Out points',
+ 'sc_overlays' => 'Overlays',
+ 'sc_audio' => 'Audio Control',
+ 'sc_duration' => 'Duration',
+ 'mv_template_properties' => 'Template Properties',
+ 'mv_custom_title' => 'Custom Title',
+ 'mv_edit_properties' => 'Edit Properties',
+ 'mv_other_properties' => 'Other Properties',
+ 'mv_resource_page' => 'Resource Page:',
+ 'mv_set_in_out_points' => 'Set in-out points',
+ 'mv_start_time' => 'Start Time',
+ 'mv_end_time' => 'End Time',
+ 'mv_preview_inout' => 'Preview/Play In-out points',
+
+ /*
+ * js file: /mv_embed.js
+ */
+ 'loading_txt' => 'loading <blink>...</blink>',
+ 'loading_title' => 'Loading...',
+ 'size-gigabytes' => '$1 GB',
+ 'size-megabytes' => '$1 MB',
+ 'size-kilobytes' => '$1 K',
+ 'size-bytes' => '$1 B',
);
#</JAVASCRIPT EN REPLACE>
\ No newline at end of file
--- /dev/null
+/*
+ * the base Skin Builder
+ * controlsBuilder:
+ *
+ */
+var ctrlBuilder = {
+ height:29,
+ supports:{
+ 'options':true,
+ 'borders':true
+ },
+ getControls:function( embedObj ){
+ js_log('f:controlsBuilder:: opt:');
+ this.id = (embedObj.pc)?embedObj.pc.pp.id:embedObj.id;
+ this.available_width = embedObj.playerPixelWidth();
+ //make pointer to the embedObj
+ this.embedObj = embedObj;
+ var _this = this;
+ for(var i in embedObj.supports){
+ _this.supports[i] = embedObj.supports[i];
+ };
+
+ //check for close_captions tracks:
+ if( ( embedObj.roe || embedObj.timedTextSources() )
+ && embedObj.show_meta_link )
+ this.supports['closed_captions']=true;
+
+ var o='';
+ for( var i in this.components ){
+ if( this.supports[i] ){
+ if( this.available_width > this.components[i].w ){
+ //special case with playhead don't add unless we have 60px
+ if( i == 'play_head' && ctrlBuilder.available_width < 60 )
+ continue;
+ o+=this.components[i].o();
+ this.available_width -= this.components[i].w;
+ }else{
+ js_log('not enough space for control component:' + i);
+ }
+ }
+ }
+ //add the options menu
+ o+=this.components['mv_embedded_options'].o( embedObj );
+ return o;
+ },
+ /*
+ * addControlHooks
+ * to be run once controls are attached to the dom
+ */
+ addControlHooks:function( embedObj ){
+ //add in drag/seek hooks:
+ if(!embedObj.base_seeker_slider_offset && $j('#mv_seeker_slider_'+embedObj.id).get(0))
+ embedObj.base_seeker_slider_offset = $j('#mv_seeker_slider_'+embedObj.id).get(0).offsetLeft;
+
+ //js_log('looking for: #mv_seeker_slider_'+embedObj.id + "\n " +
+ // 'start sec: '+embedObj.start_time_sec + ' base offset: '+embedObj.base_seeker_slider_offset);
+
+ var $tp=$j('#' + embedObj.id);
+
+ //@todo: which object is being play()'d (or whatever) ?
+ //We select the element to attach the event to this way:
+ //$tp.find('.ui-icon-play').parent().click(function(){alert(0)}); or we can give the button itself a class - probably better.
+
+ //add play hook for play-btn and large_play_button
+ $tp.find('.play-btn,.play-btn-large').unbind().btnBind().click(function(){
+ $j('#' + embedObj.id).get(0).play();
+ })
+ //add recomend firefox if non-native playback:
+ if( embedObj.doNativeWarningCheck() ){
+ $j('#dc_'+ embedObj.id).hover(
+ function(){
+ if($j('#gnp_' + embedObj.id).length==0){
+ $j(this).append('<div id="gnp_' + embedObj.id + '" class="ui-state-highlight ui-corner-all" ' +
+ 'style="position:absolute;display:none;background:#FFF;top:10px;left:10px;right:10px;height:60px;">' +
+ gM('mv_for_best_experience') +
+ '<br><input id="ffwarn_'+embedObj.id+'" type=\"checkbox\">' +
+ gM('mv_do_not_warn_again') +
+ '</div>');
+ $j('#ffwarn_'+embedObj.id).click(function(){
+ if( $j(this).is(':checked') ){
+ //set up a cookie for 5 days:
+ $j.cookie('dismissNativeWarn', true, { expires: 5 });
+ //set the current instance
+ _global['dismissNativeWarn'] = true;
+ $j('#gnp_' + embedObj.id).fadeOut('slow');
+ }else{
+ _global['adismissNativeWarn'] = false;
+ $j.cookie('dismissNativeWarn', false);
+ }
+
+ });
+ }
+ if( ($j.cookie('dismissNativeWarn') !== true) &&
+ _global['dismissNativeWarn'] === false ){
+ $j('#gnp_' + embedObj.id).fadeIn('slow');
+ }
+ },
+ function(){
+ $j('#gnp_' + embedObj.id).fadeOut('slow');
+ }
+ );
+ }
+
+ if( $j.browser.msie && $j.browser.version <= 6){
+ $j('#big_play_link_' + embedObj.id).pngFix();
+ }
+
+ //captions binding:
+ $j('#timed_text_' + embedObj.id).unbind().btnBind().click(function(){
+ $j('#' + embedObj.id).get(0).showTextInterface();
+ });
+
+ //options binding:
+ $j('#options_button_' + embedObj.id).unbind().btnBind().click(function(){
+ $j('#' +embedObj.id).get(0).doOptionsHTML();
+ });
+
+ //fullscreen binding:
+ $j('#fullscreen_'+embedObj.id).unbind().btnBind().click(function(){
+ $j('#' +embedObj.id).get(0).fullscreen();
+ });
+
+ js_log(" should add slider binding: " + $j('#mv_play_head_'+embedObj.id).length) ;
+// $j('#mv_play_head_'+embedObj.id).slider({
+ $tp.find( '.j-scrubber' ).slider({
+ range: "min",
+ value: 0,
+ min: 0,
+ max: 1000,
+ start: function(event, ui){
+ var id = (embedObj.pc!=null)?embedObj.pc.pp.id:embedObj.id;
+ embedObj.userSlide=true;
+ $j('#big_play_link_'+id).fadeOut('fast');
+ //if playlist always start at 0
+ embedObj.start_time_sec = (embedObj.instanceOf == 'mvPlayList')?0:
+ npt2seconds(embedObj.getTimeReq().split('/')[0]);
+ },
+ slide: function(event, ui) {
+ var perc = ui.value/1000;
+ embedObj.jump_time = seconds2npt( parseFloat( parseFloat(embedObj.getDuration()) * perc ) + embedObj.start_time_sec);
+ //js_log('perc:' + perc + ' * ' + embedObj.getDuration() + ' jt:'+ this.jump_time);
+ embedObj.setStatus( gM('seek_to')+' '+embedObj.jump_time );
+ //update the thumbnail / frame
+ if(embedObj.isPlaying==false){
+ embedObj.updateThumbPerc( perc );
+ }
+ },
+ change:function(event, ui){
+ //only run the onChange event if done by a user slide:
+ if(embedObj.userSlide){
+ embedObj.userSlide=false;
+ embedObj.seeking=true;
+ //stop the monitor timer (if we can)
+ if(embedObj.stopMonitor)
+ embedObj.stopMonitor();
+
+ var perc = ui.value/1000;
+ //set seek time (in case we have to do a url seek)
+ embedObj.seek_time_sec = npt2seconds( embedObj.jump_time, true );
+ js_log('do jump to: '+embedObj.jump_time + ' perc:' +perc + ' sts:' + embedObj.seek_time_sec);
+ embedObj.doSeek(perc);
+ }
+ }
+ });
+ //@todo: identify problem with volume button jumping...
+ $tp.find('.k-volume-slider').slider({
+ range: "min",
+ value: 80,
+ min: 0,
+ max: 100,
+ slide: function(event, ui) {
+ embedObj.updateVolumen(ui.value/100);
+ },
+ change: function(event, ui){
+ var level = ui.value/100;
+ if (level==0) {
+ $tp.find('.k-volume span').addClass('ui-icon-volume-off');
+ }else{
+ $tp.find('.k-volume span').removeClass('ui-icon-volume-off');
+ }
+ //only run the onChange event if done by a user slide:
+ if(embedObj.userSlide){
+ embedObj.userSlide=false;
+ embedObj.seeking=true;
+// var perc = ui.value/100;
+ embedObj.updateVolumen(level);
+ }
+ }
+ });
+ //up the z-index of the default status indicator:
+// $j('#mv_play_head_'+embedObj.id + ' .ui-slider-handle').css('z-index', 4);
+// $j('#mv_play_head_'+embedObj.id + ' .ui-slider-range').addClass('ui-corner-all').css('z-index', 2);
+ //extended class list for jQuery ui themeing (we can probably refactor this with custom buffering highliter)
+ $j('#' + embedObj.id + ' .j-scrubber').prepend( ctrlBuilder.getMvBufferHtml() );
+
+
+ //options menu
+ $tp.find('.k-menu').hide();
+ $tp.find('.k-options').click(function(){
+ var $ktxt = $j(this).find('.ui-icon-k-menu');
+ var $kmenu = $tp.find('.k-menu');
+ if( $kmenu.is(':visible') ){
+ $kmenu.fadeOut("fast",function(){
+ $ktxt.html ( gM('menu_btn') );
+ });
+ $tp.find('.play-btn-large').fadeIn('fast');
+ }else{
+ $kmenu.fadeIn("fast", function(){
+ $ktxt.html ( gM('close_btn') );
+ });
+ $tp.find('.play-btn-large').fadeOut('fast');
+ }
+ });
+
+
+ //videoOptions:
+ $tp.find('.k-player-btn').click(function(){
+ embedObj.selectPlaybackMethod();
+ return false;
+ });
+
+ $tp.find('.k-download-btn').click(function(){
+ embedObj.showVideoDownload();
+ return false;
+ });
+
+ $tp.find('.k-share-btn').click(function(){
+ embedObj.showEmbedCode();
+ return false;
+ });
+ $tp.find('.k-credits-btn').click(function(){
+ //@@todo show credits menu screen;
+ return false;
+ });
+
+ //volume binding:
+ $tp.find('.k-volume').unbind().btnBind().click(function(){
+ $tp.toggleMute();
+ });
+
+ var hoverOverDelay=false;
+ /*$j('#volume_control_'+embedObj.id).unbind().btnBind().click(function(){
+ $j('#' +embedObj.id).get(0).toggleMute();
+ });
+ .hover(
+ function(){
+ $j('#vol_container_' + embedObj.id).addClass('vol_container_top');
+ //set to "below" if playing and embedType != native
+ if(embedObj && embedObj.isPlaying() && !embedObj.supports['overlays']){
+ $j('#vol_container_' + embedObj.id).removeClass('vol_container_top').addClass('vol_container_below');
+ }
+
+ $j('#vol_container_' + embedObj.id).fadeIn('fast');
+ hoverOverDelay = true;
+ },
+ function(){
+ hoverOverDelay= false;
+ setTimeout(function doHideVolume(){
+ if(!hoverOverDelay){
+ $j('#vol_container_' + embedObj.id).fadeOut('fast');
+ }
+ }, 500);
+ }
+ );
+ //Volumen Slider
+ $j('#volume_bar_'+embedObj.id).slider({
+ orientation: "vertical",
+ range: "min",
+ value: 80,
+ min: 0,
+ max: 100,
+ slide: function(event, ui) {
+ var perc = ui.value/100;
+ //js_log('update volume:' + perc);
+ embedObj.updateVolumen(perc);
+ },
+ change:function(event, ui){
+ var perc = ui.value/100;
+ if (perc==0) {
+ $j('#volume_control_'+embedObj.id + ' span').removeClass('ui-icon-volume-on').addClass('ui-icon-volume-off');
+ }else{
+ $j('#volume_control_'+embedObj.id + ' span').removeClass('ui-icon-volume-off').addClass('ui-icon-volume-on');
+ }
+ //only run the onChange event if done by a user slide:
+ if(embedObj.userSlide){
+ embedObj.userSlide=false;
+ embedObj.seeking=true;
+ var perc = ui.value/100;
+ embedObj.updateVolumen(perc);
+ }
+ }
+ });*/
+
+ },
+ getMvBufferHtml:function(){
+ return '<div class="ui-slider-horizontal ui-corner-all ui-slider-buffer" />';
+ },
+ components:{
+ 'borders':{
+ 'w':8,
+ 'o':function(){
+ return '';
+ }
+ },
+ 'mv_embedded_options':{
+ 'w':0,
+ 'o':function( embedObj ){
+ var o= '' +
+ '<div class="k-menu ui-widget-content" ' +
+ 'style="width:' + embedObj.playerPixelWidth() + 'px; height:' + embedObj.playerPixelHeight() + 'px;">' +
+ '<ul class="k-menu-bar">' +
+ '<li class="k-players-btn"><a href="#player" title="'+ gM('players') +'">'+ gM('players') +'</a></li>' +
+ '<li class="k-download-btn"><a href="#player" title="'+ gM('download')+'">'+gM('download')+'</a></li>' +
+ '<li class="k-share-btn"><a href="#player" title="'+ gM('share')+'">'+gM('share')+'</a></li>' +
+ '<li class="k-credits-btn"><a href="#credits" title="'+ gM('credits')+'">'+gM('credits')+'</a></li>' +
+ '</ul>' +
+ '<div class="k-menu-screens" style="width:' + embedObj.playerPixelWidth() + 'px; height:' + embedObj.playerPixelHeight() + 'px;">' +
+ '<div class="k-screen k-players">' +
+ '<h2>' + gM('chose_player')+'</h2>' +
+ '</div>' +
+ '<div class="k-screen k-download">' +
+ '<h2>' + gM('download_clip')+'</h2>' +
+ '</div>' +
+ '<div class="k-screen k-players">' +
+ '<h2>' + gM('share_this_video') + '</h2>' +
+ '</div>' +
+ '<div class="k-screen k-players">' +
+ '<h2>' + gM('video_credits') + '</h2>' +
+ '</div>' +
+ '</div>' +
+ '</div>';
+ return o;
+ }
+ },
+ 'pause':{
+ 'w':147, //28 147
+ 'o':function(){
+ return '<button class="play-btn ui-state-default ui-corner-all" title="' +
+ gM('play_clip') + '" ><span class="ui-icon ui-icon-play"></span></button>'
+ }
+ },
+ 'play_head':{ // scrubber
+ 'w':0, //special case (takes up remaining space)
+ 'o':function(){
+ return '<div class="ui-slider ui-slider-horizontal ui-corner-all j-scrubber"' +
+ ' style="width:' + ( ctrlBuilder.available_width - 30 ) + 'px;"></div>'
+ }
+ },
+ 'time_display':{
+ 'w':36,
+ 'o':function(){
+ return '<div class="k-timer">' + seconds2npt ( ctrlBuilder.embedObj.getDuration() ) + '</div>';
+ }
+ },
+ 'volume_control':{
+ 'w':47,
+ 'o':function(){
+ return '<button class="ui-state-default ui-corner-all k-volume">' +
+ '<span class="ui-icon ui-icon-volume-on"></span>' +
+ '</button>' +
+ '<div class="ui-slider ui-slider-horizontal k-volume-slider"></div>';
+
+ //vertical volume control:
+ /* return '<div title="' + gM('volume_control') + '" id="volume_control_'+ctrlBuilder.id+'" class="ui-state-default ui-corner-all ui-icon_link rButton">' +
+ '<span class="ui-icon ui-icon-volume-on"></span>' +
+ '<div style="position:absolute;display:none;" id="vol_container_'+ctrlBuilder.id+'" class="vol_container ui-corner-all">' +
+ '<div class="volume_bar" id="volume_bar_' + ctrlBuilder.id + '"></div>' +
+ '</div>'+
+ '</div>';
+ */
+ }
+ },
+ 'closed_captions':{
+ 'w':24,
+ 'o':function(){
+ return '<div title="' + gM('closed_captions') + '" id="timed_text_' + ctrlBuilder.id +'" ' +
+ 'class="ui-state-default ui-corner-all ui-icon_link rButton">' +
+ '<span class="ui-icon ui-icon-comment"></span></div>';
+ }
+ },
+ 'fullscreen':{
+ 'w':24,
+ 'o':function(){
+ return '<button class="ui-state-default ui-corner-all k-fullscreen" title="' + gM('player_fullscreen') + '">' +
+ '<span class="ui-icon ui-icon-arrow-4-diag"></span></button>'
+ }
+ },
+ 'options':{
+ 'w':50,
+ 'o':function(){
+ return '<button class="ui-state-default ui-corner-bl k-options" title="'+ gM('player_options') + '" >' +
+ '<span class="ui-icon ui-icon-k-menu">'+ gM('menu_btn') + '</span>'
+ '</button>'
+ }
+ }
+ }
+}
\ No newline at end of file
.k-volume-slider { width:26px;}\r
.k-control-bar .k-options { width:50px; height:22px; margin-top:-2px; border: solid 1px #aaa; border-top:none; float:right; font: bold 11px arial,sans-serif; color:#555;}\r
span.ui-icon.ui-icon-k-menu { width:auto; padding-left:2px; background:none; outline:none; cursor:default;}\r
-.k-menu { background:#181818; position:absolute; top:0; left:0; display:none,filter:alpha(opacity=90); opacity: 0.9;} /* h, w, top inline via jq top:15px*/\r
- ul.k-menu-bar { height:128px; padding: 0 0 5px;position:absolute; bottom:5px;right:0px; list-style: none outside none; background: url(images/ksprite.png) -99px -104px no-repeat;} /* eventually: mtop inline via jq */\r
- .k-menu-bar li a { display:block; width:49px; height:32px; margin-left:1px; text-indent:99999px; background: url(images/ksprite.png) -51px -110px no-repeat; overflow:hidden;}\r
- .k-menu-bar li a:hover { background-position: -1px -110px;}\r
- .k-menu-bar li.k-download-btn a { background-position: -51px -141px;}\r
- .k-menu-bar li.k-download-btn a:hover { background-position: -1px -141px;}\r
- .k-menu-bar li.k-share-btn a { background-position: -51px -172px;}\r
- .k-menu-bar li.k-share-btn a:hover { background-position: -1px -172px;}\r
- .k-menu-bar li.k-credits-btn a { background-position: -51px -203px;}\r
- .k-menu-bar li.k-credits-btn a:hover { background-position: -1px -203px;}\r
+ .k-menu { width:400px; height:300px; background:#181818; position:absolute; top:0; left:0; display:none} /* h, w, top inline via jq top:15px*/\r
+ ul.k-menu-bar{ height:128px; padding: 0 0 5px;position:absolute; bottom:5px;right:0px; list-style: none outside none; background: url(images/ksprite.png) -99px -104px no-repeat;} /* eventually: mtop inline via jq */\r
+ .k-menu-bar li a { display:block; width:49px; height:32px; margin-left:1px; text-indent:99999px; background: url(images/ksprite.png) -51px -110px no-repeat; overflow:hidden;}\r
+ .k-menu-bar li a:hover { background-position: -1px -110px;}\r
+ .k-menu-bar li.k-download-btn a { background-position: -51px -141px;}\r
+ .k-menu-bar li.k-download-btn a:hover { background-position: -1px -141px;}\r
+ .k-menu-bar li.k-share-btn a { background-position: -51px -172px;}\r
+ .k-menu-bar li.k-share-btn a:hover { background-position: -1px -172px;}\r
+ .k-menu-bar li.k-credits-btn a { background-position: -51px -203px;}\r
+ .k-menu-bar li.k-credits-btn a:hover { background-position: -1px -203px;}\r
\r
.k-menu-screens { width:320px; padding: 13px 10px 15px 15px; float:left;} /* w & h inline via jq */\r
.k-menu-screens h2 { padding: 0 0 5px 1px; clear:both; font-size:12px; color:#666;}\r